{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0c0f847b-d3f9-4a8b-af76-c081cc86a4dd",
          "code": "554-91-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=554-91-6",
          "code_system": "CAS",
          "references": [
            "da52f4ab-bd83-4185-8d02-278a87efa7b0",
            "2da4ba2c-68c6-4432-8368-f22cdb30778e"
          ]
        },
        {
          "uuid": "9cb6ac52-8db8-49ff-837f-dd2402d83a41",
          "code": "209-074-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.250",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "da52f4ab-bd83-4185-8d02-278a87efa7b0"
          ]
        },
        {
          "uuid": "61ac4bb5-0389-445f-a17c-50e761b94c2e",
          "code": "m5701",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5701?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "da52f4ab-bd83-4185-8d02-278a87efa7b0"
          ]
        },
        {
          "uuid": "75d5398b-275a-4329-bd1d-703f05a5971d",
          "code": "20056559",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20056559",
          "code_system": "PUBCHEM",
          "references": [
            "da52f4ab-bd83-4185-8d02-278a87efa7b0"
          ]
        },
        {
          "uuid": "fbd2e57e-117d-7147-b15c-be4e7bb16616",
          "code": "Gentiobiose",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Gentiobiose",
          "code_system": "WIKIPEDIA",
          "references": [
            "decc2bcf-ec33-05e5-28ec-f54432287cd8"
          ]
        },
        {
          "uuid": "7826bf20-0974-46cd-b02c-dffe3f7c23de",
          "code": "HF30HB040V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0de01ddf-f1c1-0c5e-eb0a-c8e4252f9ee5",
          "code": "28066",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28066",
          "code_system": "CHEBI",
          "references": [
            "a4bc71d9-5bf7-a16d-1416-191b1e6ad7bc"
          ]
        },
        {
          "uuid": "2329f073-c475-1821-aa2b-befe536e6255",
          "code": "DTXSID801017741",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801017741",
          "code_system": "EPA CompTox",
          "references": [
            "5d1a9f46-954f-489a-4c82-6d6b6e05193b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "79668d36-414c-42a9-b05f-1860b6286559",
          "name": "6-(.BETA.-D-GLUCOSIDO)-D-GLUCOSE",
          "stdName": "6-(.BETA.-D-GLUCOSIDO)-D-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d56ec1c6-4f15-4a70-bc50-cfae5b6818c0",
            "3c649df6-6ccb-4e35-83da-d0d2190a5072"
          ],
          "display_name": false
        },
        {
          "uuid": "2b053fdf-7e81-497f-89a8-c17750793982",
          "name": "6-O-.BETA.-D-GLUCOPYRANOSYL-D-GLUCOSE",
          "stdName": "6-O-.BETA.-D-GLUCOPYRANOSYL-D-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d56ec1c6-4f15-4a70-bc50-cfae5b6818c0",
            "3c649df6-6ccb-4e35-83da-d0d2190a5072"
          ],
          "display_name": false
        },
        {
          "uuid": "72c4d510-ed46-4616-8dd2-8eef8688e7a8",
          "name": "AMYGDALOSE",
          "stdName": "AMYGDALOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d56ec1c6-4f15-4a70-bc50-cfae5b6818c0",
            "3c649df6-6ccb-4e35-83da-d0d2190a5072"
          ],
          "display_name": false
        },
        {
          "uuid": "e4725f2d-c0c2-405a-affc-2cceb4adb25c",
          "name": "D-GENTIOBIOSE",
          "stdName": "D-GENTIOBIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d56ec1c6-4f15-4a70-bc50-cfae5b6818c0",
            "3c649df6-6ccb-4e35-83da-d0d2190a5072"
          ],
          "display_name": false
        },
        {
          "uuid": "a008091d-f250-4b72-b7d8-2f2c92c9cf4d",
          "name": "D-GLUCOSE, 6-O-.BETA.-D-GLUCOPYRANOSYL-",
          "stdName": "D-GLUCOSE, 6-O-.BETA.-D-GLUCOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d56ec1c6-4f15-4a70-bc50-cfae5b6818c0",
            "3c649df6-6ccb-4e35-83da-d0d2190a5072"
          ],
          "display_name": false
        },
        {
          "uuid": "856af3de-dbfa-4fe4-8921-060d93f3ca87",
          "name": "GENTIOBIOSE",
          "stdName": "GENTIOBIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d56ec1c6-4f15-4a70-bc50-cfae5b6818c0",
            "e8ed0a2d-b7c2-457e-9339-0a87cf14b51d",
            "031129f2-ba9d-4a87-9e79-ee4c4e7ab139",
            "dd2aa2a0-699a-44de-8dc1-267750b577e0"
          ],
          "display_name": true
        },
        {
          "uuid": "f9e7629e-c050-43af-91bd-cb753e80e59a",
          "name": "GENTIOBIOSE [MI]",
          "stdName": "GENTIOBIOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d56ec1c6-4f15-4a70-bc50-cfae5b6818c0",
            "031129f2-ba9d-4a87-9e79-ee4c4e7ab139"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "031129f2-ba9d-4a87-9e79-ee4c4e7ab139",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d56ec1c6-4f15-4a70-bc50-cfae5b6818c0",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c649df6-6ccb-4e35-83da-d0d2190a5072",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8ed0a2d-b7c2-457e-9339-0a87cf14b51d",
          "citation": "Merk Index",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da52f4ab-bd83-4185-8d02-278a87efa7b0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392003000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f28f8c95-e75d-424d-83c8-ddfa340dcb54",
          "citation": "SRS import [HF30HB040V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HF30HB040V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392003000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d89ee96e-5825-45a0-9b6a-f104d26d8e16",
          "citation": "MERK INDEX MONOGRAPH: MONO1500004431",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd2aa2a0-699a-44de-8dc1-267750b577e0",
          "citation": "GENTIOBIOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "decc2bcf-ec33-05e5-28ec-f54432287cd8",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Gentiobiose",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2da4ba2c-68c6-4432-8368-f22cdb30778e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a4bc71d9-5bf7-a16d-1416-191b1e6ad7bc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5d1a9f46-954f-489a-4c82-6d6b6e05193b",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9f8ef3ef-3551-4b9b-bbd8-ce1b3f70f151",
          "id": "9f8ef3ef-3551-4b9b-bbd8-ce1b3f70f151",
          "molfile": "\n  Marvin  01132108172D          \n\n 23 23  0  0  1  0            999 V2000\n    8.7100   -4.4893    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.7100   -5.3143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9955   -4.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2810   -4.4893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2810   -5.3143    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.9955   -5.7269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9955   -6.5519    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.7100   -6.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4245   -6.5519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2810   -6.9643    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.2810   -7.7893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5666   -6.5519    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8521   -6.9643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5666   -5.7269    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.8521   -5.3143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4245   -4.0769    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.4245   -3.2519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1390   -4.4893    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.1390   -5.3143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8534   -4.0769    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.8534   -3.2519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5679   -4.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2824   -4.0769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 16  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  6  0  0  0\n 10  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  6  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O",
          "formula": "C12H22O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1de57f5-1d9b-4c0d-b3bc-c71b4e673266"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "342.297",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9da09b8f-1bb0-47fe-84e2-6f246f9e84f0",
      "version": "9",
      "structure": {
        "id": "b1a6a627-278a-4bee-ac1c-49a3eb71929d",
        "molfile": "\n  Marvin  01132109122D          \n\n 23 23  0  0  1  0            999 V2000\n    7.2810   -4.4893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2810   -5.3143    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5666   -5.7269    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.8521   -5.3143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5666   -6.5519    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8521   -6.9643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2810   -6.9643    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2810   -7.7893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9955   -6.5519    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.7100   -6.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4245   -6.5519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9955   -5.7269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9955   -4.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7100   -4.4893    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.7100   -5.3143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4245   -4.0769    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.4245   -3.2519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1390   -4.4893    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.1390   -5.3143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8534   -4.0769    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.8534   -3.2519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5679   -4.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2824   -4.0769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n 10 11  1  0  0  0  0\n 12  9  1  0  0  0  0\n  2 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O",
        "formula": "C12H22O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "342.297",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f28f8c95-e75d-424d-83c8-ddfa340dcb54",
          "d89ee96e-5825-45a0-9b6a-f104d26d8e16"
        ],
        "stereo_centers": 9
      },
      "unii": "HF30HB040V"
    }
  ]
}