{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2830becd-07df-40ae-b053-3366ea00ee36", "code": "4000", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "51b6edc8-1f0f-47b8-b939-42255b6535ad" ] }, { "uuid": "629348ef-4a03-41a9-873c-cfd4efce8c80", "code": "5-ANDROSTENEDIONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/5-Androstenedione", "code_system": "WIKIPEDIA", "references": [ "51b6edc8-1f0f-47b8-b939-42255b6535ad" ] }, { "uuid": "aa7f014c-37c0-49bc-9260-cba9b68ebcb4", "code": "571-36-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=571-36-8", "code_system": "CAS", "references": [ "51b6edc8-1f0f-47b8-b939-42255b6535ad", "d0dbe126-0ff5-494a-8c26-86597205e612" ] }, { "uuid": "90ab30e8-7b06-488b-a14c-19f1c35aed51", "code": "160531", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/160531", "code_system": "PUBCHEM", "references": [ "51b6edc8-1f0f-47b8-b939-42255b6535ad" ] }, { "uuid": "d105b97d-9ac6-4fc5-8f11-48267cb43cd4", "code": "DB01456", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01456", "code_system": "DRUG BANK", "references": [ "e5e56ad4-e317-e5fc-8fce-d5114dab59bd" ] }, { "uuid": "5e6ce4ba-1a55-44b7-8dec-f1c7535e51ed", "code": "HEE11L5C3G", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4fa3d5cc-2b0e-d3ac-d6e4-6180bac62623", "code": "83865", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83865", "code_system": "CHEBI", "references": [ "e5e56ad4-e317-e5fc-8fce-d5114dab59bd" ] }, { "uuid": "15a04a58-1bff-3b37-571f-be275f043eff", "code": "DTXSID10862217", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10862217", "code_system": "EPA CompTox", "references": [ "e5e56ad4-e317-e5fc-8fce-d5114dab59bd" ] }, { "uuid": "55b9a232-aa9b-5189-c9a2-18bbdb634319", "code": "12873", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=12873", "code_system": "NSC", "references": [ "340462a6-f932-ef54-a1e8-de0ebc3e09b3" ] } ], "relationships": [ { "uuid": "f00fc1e0-0204-4f06-9460-3b320d6ebab0", "type": "METABOLITE ACTIVE->PRODRUG", "references": [ "cf1714d1-9193-47b4-baf6-0553604bd09b" ], "related_substance": { "uuid": "03de62e9-c5af-45fe-91a7-a8fdeae774f1", "refuuid": "de5088e3-60d2-48db-8c91-311bd3435f32", "name": "TESTOSTERONE", "unii": "3XMK78S47O", "linking_id": "3XMK78S47O", "ref_pname": "TESTOSTERONE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "86c5d263-f901-4304-ad92-1291a5a7b8cb", "name": ".DELTA.5-ANDROSTENE-3,17-DIONE", "stdName": ".DELTA.5-ANDROSTENE-3,17-DIONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c69aee8b-3aed-436e-95d4-fe9abcabe125" ], "display_name": false }, { "uuid": "42c6c1d3-a771-4ef0-a8a8-341f22100edc", "name": "5-ANDROSTEN-3,17-DIONE", "stdName": "5-ANDROSTEN-3,17-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9795a3e8-3a8b-4a1c-a48b-373e344ff478" ], "display_name": false }, { "uuid": "85f18b4d-074a-4a61-8efd-f1e7498715dd", "name": "5-ANDROSTENEDIONE", "stdName": "5-ANDROSTENEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "24452b0e-75c4-45a8-baef-96eb658a7432" ], "display_name": true }, { "uuid": "b12c0542-c5a9-47c2-8475-733aa904a246", "name": "ANDROST-5-ENE-3,17-DIONE", "stdName": "ANDROST-5-ENE-3,17-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c69aee8b-3aed-436e-95d4-fe9abcabe125" ], "display_name": false }, { "uuid": "951218c9-1607-4ed7-a1d6-5f2dc7a620cf", "name": "J79.661A", "stdName": "J79.661A", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "8ef94144-7b12-4265-b4ed-89a5808a9e7b" ], "display_name": false }, { "uuid": "4281d3c5-353d-479e-99e9-874e037f28cd", "name": "NSC-12873", "stdName": "NSC-12873", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "c69aee8b-3aed-436e-95d4-fe9abcabe125" ], "display_name": false } ], "references": [ { "uuid": "cf1714d1-9193-47b4-baf6-0553604bd09b", "citation": "https://en.wikipedia.org/wiki/5-Androstenedione", "url": "https://en.wikipedia.org/wiki/5-Androstenedione", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "24452b0e-75c4-45a8-baef-96eb658a7432", "citation": "dea list", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "9795a3e8-3a8b-4a1c-a48b-373e344ff478", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c69aee8b-3aed-436e-95d4-fe9abcabe125", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8ef94144-7b12-4265-b4ed-89a5808a9e7b", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J79.661A", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J79.661A", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "51b6edc8-1f0f-47b8-b939-42255b6535ad", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393059000, "tags": [ "NOMEN" ] }, { "uuid": "582ff4a2-ed3b-493c-aedc-7b1ed518c499", "citation": "SRS import [HEE11L5C3G]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HEE11L5C3G", "doc_type": "SRS", "public_domain": true, "document_date": 1493393059000, "tags": [ "NOMEN" ] }, { "uuid": "e5e56ad4-e317-e5fc-8fce-d5114dab59bd", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "d0dbe126-0ff5-494a-8c26-86597205e612", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "340462a6-f932-ef54-a1e8-de0ebc3e09b3", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "bdc73a7c-e59b-4253-9fa7-3e0affbca570", "id": "bdc73a7c-e59b-4253-9fa7-3e0affbca570", "molfile": "\n Marvin 01132109492D \n\n 21 24 0 0 1 0 999 V2000\n 8.9136 -10.8886 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.6893 -11.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1759 -10.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6985 -9.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6985 -8.9883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9136 -10.0624 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.9136 -9.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2068 -9.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4724 -10.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4724 -10.8749 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.1838 -11.2972 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.1838 -12.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4677 -12.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7608 -12.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0448 -12.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3334 -12.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6127 -12.5227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3334 -11.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0448 -10.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7608 -11.2880 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.7608 -10.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 6 1 0 0 0 0\n 11 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 1 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 1 0 0 0\n 11 10 1 0 0 0 0\n 10 20 1 0 0 0 0\n 11 12 1 6 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 15 14 1 0 0 0 0\n 20 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 1 0 0 0\nM END", "smiles": "C[C@@]12CCC(=O)CC2=CC[C@H]3[C@@H]4CCC(=O)[C@@]4(C)CC[C@@H]31", "formula": "C19H26O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d94bf9c4-3846-4dc3-be54-a4bc84acc989" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "286.4093", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "d6778d06-418b-4e8b-8c5a-e31981fc2319", "version": "7", "structure": { "id": "ef99333f-0078-49f5-b53e-8b7520eb2fa0", "molfile": "\n Marvin 01132112252D \n\n 24 27 0 0 1 0 999 V2000\n 6.7608 -11.2880 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.7608 -12.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0448 -12.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3334 -12.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6127 -12.5227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3334 -11.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0448 -10.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4677 -12.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1838 -12.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1838 -11.2972 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.9136 -10.8886 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.9136 -10.0624 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.6985 -9.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6985 -8.9883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1759 -10.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6893 -11.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9136 -9.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2068 -9.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4724 -10.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4724 -10.8749 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.4724 -11.7012 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9136 -11.7149 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1838 -10.4663 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7608 -10.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 2 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 11 1 0 0 0 0\n 12 17 1 1 0 0 0\n 18 12 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 1 1 0 0 0 0\n 10 20 1 0 0 0 0\n 20 21 1 6 0 0 0\n 11 22 1 6 0 0 0\n 10 23 1 1 0 0 0\n 1 24 1 1 0 0 0\nM END", "smiles": "C[C@@]12CCC(=O)CC2=CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC[C@@]31[H]", "formula": "C19H26O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "286.4093", "optical_activity": "UNSPECIFIED", "references": [ "582ff4a2-ed3b-493c-aedc-7b1ed518c499", "cf1714d1-9193-47b4-baf6-0553604bd09b" ], "stereo_centers": 5 }, "unii": "HEE11L5C3G" } ] }