{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "700e1197-e6e0-4e29-9a51-f60ac51ce62d", "code": "28855-11-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=28855-11-0", "code_system": "CAS", "references": [ "b9ac13d5-ff73-405b-a030-8fc7229a0b8c", "78e848a2-bd65-44e2-8140-afdc3ffabd69" ] }, { "uuid": "6cc6a304-eac5-419f-875f-4daa43cd939d", "code": "1539814", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1539814/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "b9ac13d5-ff73-405b-a030-8fc7229a0b8c" ] }, { "uuid": "c67e6123-0df6-40fa-b00b-e15f88df5329", "code": "76925", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76925", "code_system": "PUBCHEM", "references": [ "b9ac13d5-ff73-405b-a030-8fc7229a0b8c" ] }, { "uuid": "dff62c68-5884-4def-bb22-c70a40501129", "code": "HE7ABK56N5", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "cc874b30-2476-74be-eb40-b27ccec176fc", "code": "HE7ABK56N5", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=HE7ABK56N5", "code_system": "DAILYMED", "references": [ "5fdf8ab0-ea14-8f9d-23bd-137aef77729c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "53628e68-5004-46f9-8328-eccd1540f9af", "name": "1,3,5-TRIMETHYL-1,1,3,5,5-PENTAPHENYLTRISILOXANE", "stdName": "1,3,5-TRIMETHYL-1,1,3,5,5-PENTAPHENYLTRISILOXANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86401129-eb14-4402-ab09-84569ffbdedb", "a1e24929-5381-49c7-b1dc-eeecb03d8fa3" ], "display_name": false }, { "uuid": "fbcc92b8-e5a7-46fb-af34-3cfcae0d331b", "name": "DOW CORNING 555", "stdName": "DOW CORNING 555", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "86401129-eb14-4402-ab09-84569ffbdedb", "a1e24929-5381-49c7-b1dc-eeecb03d8fa3" ], "display_name": false }, { "uuid": "48d182f9-945f-4c62-8351-315aa3c66abc", "name": "DOW CORNING 705", "stdName": "DOW CORNING 705", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "86401129-eb14-4402-ab09-84569ffbdedb", "a1e24929-5381-49c7-b1dc-eeecb03d8fa3" ], "display_name": false }, { "uuid": "99b6291e-ce00-424c-ae71-436a73ccab25", "name": "PENTAPHENYLTRIMETHYLTRISILOXANE", "stdName": "PENTAPHENYLTRIMETHYLTRISILOXANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86401129-eb14-4402-ab09-84569ffbdedb", "a1e24929-5381-49c7-b1dc-eeecb03d8fa3" ], "display_name": false }, { "uuid": "7fd52be4-bce2-4b4f-97c9-c18c4c1f813c", "name": "TRIMETHYL PENTAPHENYL TRISILOXANE", "stdName": "TRIMETHYL PENTAPHENYL TRISILOXANE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "86401129-eb14-4402-ab09-84569ffbdedb", "244638bc-787a-48b7-a915-8bc4c97ad041", "8d2b1bf9-9f5b-4318-aa71-a3ce17113ae6" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "abfacf95-e245-4984-b743-f53b94b08e29", "name_org": "INCI" } ] }, { "uuid": "c84e3bc6-41d3-4d96-a435-0afc761e9c4f", "name": "TRIMETHYLPENTAPHENYL TRISOLOXANE", "stdName": "TRIMETHYLPENTAPHENYL TRISOLOXANE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "86401129-eb14-4402-ab09-84569ffbdedb", "b19a6e46-c5d8-4a38-ad98-a58438433e8b" ], "display_name": false }, { "uuid": "299b3b5d-38bd-4f98-92f1-446e71cbea3e", "name": "TRISILOXANE, 1,3,5-TRIMETHYL-1,1,3,5,5-PENTAPHENYL-", "stdName": "TRISILOXANE, 1,3,5-TRIMETHYL-1,1,3,5,5-PENTAPHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86401129-eb14-4402-ab09-84569ffbdedb", "a1e24929-5381-49c7-b1dc-eeecb03d8fa3" ], "display_name": false } ], "references": [ { "uuid": "244638bc-787a-48b7-a915-8bc4c97ad041", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "86401129-eb14-4402-ab09-84569ffbdedb", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a1e24929-5381-49c7-b1dc-eeecb03d8fa3", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b19a6e46-c5d8-4a38-ad98-a58438433e8b", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b9ac13d5-ff73-405b-a030-8fc7229a0b8c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391497000, "tags": [ "NOMEN" ] }, { "uuid": "82585b31-9e28-4f6f-910c-d8355ed6d7b5", "citation": "SRS import [HE7ABK56N5]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HE7ABK56N5", "doc_type": "SRS", "public_domain": true, "document_date": 1493391497000, "tags": [ "NOMEN" ] }, { "uuid": "735ece98-74df-4374-a5ac-4d3eadc5ac83", "citation": "http://www.chemicalbook.com/ChemicalProductProperty_DE_CB2965811.htm", "url": "http://www.chemicalbook.com/ChemicalProductProperty_DE_CB2965811.htm", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8d2b1bf9-9f5b-4318-aa71-a3ce17113ae6", "citation": "TRIMETHYL PENTAPHENYL TRISILOXANE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "78e848a2-bd65-44e2-8140-afdc3ffabd69", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5fdf8ab0-ea14-8f9d-23bd-137aef77729c", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3d629556-34b0-4188-9c66-c25024013ae9", "id": "3d629556-34b0-4188-9c66-c25024013ae9", "molfile": "\n Marvin 01132103152D \n\n 38 42 0 0 0 0 999 V2000\n 3.4096 -3.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1378 -2.5864 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6373 -1.9306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8191 -2.0362 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6856 -2.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0131 -2.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4573 -1.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6514 -1.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4014 -2.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9571 -3.1754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7630 -2.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6425 -1.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2523 -0.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0757 0.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2896 0.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6799 -0.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8564 -0.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7475 -2.0307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5651 -2.1404 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9255 -2.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3828 -2.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6966 -3.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5142 -3.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0181 -2.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7044 -1.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8867 -1.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6033 -1.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3360 -0.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3742 -0.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6794 0.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9467 -0.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9086 -0.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5169 -3.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0718 -4.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4509 -4.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2750 -4.7847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7200 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3410 -3.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 18 2 1 0 0 0 0\n 2 33 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 4 12 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 11 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 27 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 26 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 32 2 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\n 34 33 1 0 0 0 0\n 33 38 2 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 2 0 0 0 0\n 38 37 1 0 0 0 0\nM END", "smiles": "C[Si](c1ccccc1)(c2ccccc2)O[Si](C)(c3ccccc3)O[Si](C)(c4ccccc4)c5ccccc5", "formula": "C33H34O2Si3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "86f59670-7259-4adb-ad00-4a2d865c6458" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "546.8792", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "607fe58f-c13e-4da3-9a62-8579862877bb", "version": "4", "structure": { "id": "3991d374-1250-4ba3-bc29-436218f176df", "molfile": "\n Marvin 01132103032D \n\n 38 42 0 0 0 0 999 V2000\n 5.5651 -2.1404 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3828 -2.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6966 -3.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5142 -3.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0181 -2.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7044 -1.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8867 -1.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6033 -1.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3360 -0.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3742 -0.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6794 0.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9467 -0.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9086 -0.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7475 -2.0307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1378 -2.5864 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6373 -1.9306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8191 -2.0362 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0131 -2.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4573 -1.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6514 -1.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4014 -2.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9571 -3.1754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7630 -2.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6425 -1.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2523 -0.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0757 0.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2896 0.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6799 -0.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8564 -0.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6856 -2.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4096 -3.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5169 -3.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0718 -4.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4509 -4.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2750 -4.7847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7200 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3410 -3.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9255 -2.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 2 7 1 0 0 0 0\n 1 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 8 13 2 0 0 0 0\n 1 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 18 23 1 0 0 0 0\n 17 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 24 29 2 0 0 0 0\n 17 30 1 0 0 0 0\n 15 31 1 0 0 0 0\n 15 32 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 2 0 0 0 0\n 32 37 1 0 0 0 0\n 1 38 1 0 0 0 0\nM END", "smiles": "C[Si](c1ccccc1)(c2ccccc2)O[Si](C)(c3ccccc3)O[Si](C)(c4ccccc4)c5ccccc5", "formula": "C33H34O2Si3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "546.8792", "optical_activity": "NONE", "references": [ "82585b31-9e28-4f6f-910c-d8355ed6d7b5", "735ece98-74df-4374-a5ac-4d3eadc5ac83" ], "stereo_centers": 0 }, "unii": "HE7ABK56N5" } ] }