{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b0561d57-52ba-4613-9b12-72df48063a6c",
          "code": "366452-03-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=366452-03-1",
          "code_system": "CAS",
          "references": [
            "f05dd7e6-5fdc-463f-935d-0fc779f7e658",
            "edca04ae-0c0e-4140-b11a-5d6fe6557900"
          ]
        },
        {
          "uuid": "4b86f2d6-7c21-46a9-9f99-986e7ede646c",
          "code": "636923",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/636923",
          "code_system": "PUBCHEM",
          "references": [
            "f05dd7e6-5fdc-463f-935d-0fc779f7e658"
          ]
        },
        {
          "uuid": "55b75ec9-4e05-4457-8f79-2a05dd49ee72",
          "code": "HE37GBK28Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d6134d7e-e5cb-44f2-9d6b-0b9800d0d055",
          "name": "2-PROPENAMIDE, 3-(4-HYDROXYPHENYL)-N-(2-(5-METHOXY-1H-INDOL-3-YL)ETHYL)-, (2E)-",
          "stdName": "2-PROPENAMIDE, 3-(4-HYDROXYPHENYL)-N-(2-(5-METHOXY-1H-INDOL-3-YL)ETHYL)-, (2E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd6c11be-72a5-4564-a9a1-043d4dd0c734",
            "2d699952-298b-4441-8e04-fe85afb49d23"
          ],
          "display_name": false
        },
        {
          "uuid": "3befc71e-5a84-41d1-8850-5fece2e7f6ca",
          "name": "CENTCYAMINE",
          "stdName": "CENTCYAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd6c11be-72a5-4564-a9a1-043d4dd0c734",
            "2d699952-298b-4441-8e04-fe85afb49d23"
          ],
          "display_name": false
        },
        {
          "uuid": "10c41815-8b67-4f31-88d4-dcdc45df7078",
          "name": "CLOTHOLINE",
          "stdName": "CLOTHOLINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d75dcf3d-25b6-4428-946b-ba909d30d754",
            "2d699952-298b-4441-8e04-fe85afb49d23"
          ],
          "display_name": false
        },
        {
          "uuid": "72bea3b1-9605-4240-a8bc-88be6a1835fe",
          "name": "COUMAROYL METHOXYTRYPTAMINE",
          "stdName": "COUMAROYL METHOXYTRYPTAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d75dcf3d-25b6-4428-946b-ba909d30d754",
            "2d699952-298b-4441-8e04-fe85afb49d23",
            "26dd9b04-6f6d-47c4-b83d-b1d67d14ee77"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3cc4db3f-c15a-423f-a4d6-fa7cf7acce2e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "105adc0f-2169-425c-9253-1cc1dff57d0c",
          "name": "COUMAROYL METHOXYTRYPTAMINE, (E)-",
          "stdName": "COUMAROYL METHOXYTRYPTAMINE, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a01f9d0-6f95-4e2f-9e3f-21b011673b18",
            "2d699952-298b-4441-8e04-fe85afb49d23"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d75dcf3d-25b6-4428-946b-ba909d30d754",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2d699952-298b-4441-8e04-fe85afb49d23",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd6c11be-72a5-4564-a9a1-043d4dd0c734",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a01f9d0-6f95-4e2f-9e3f-21b011673b18",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f05dd7e6-5fdc-463f-935d-0fc779f7e658",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393195000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ec8211a-b397-4f38-ba7c-b6b348b3af4b",
          "citation": "SRS import [HE37GBK28Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HE37GBK28Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393195000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26dd9b04-6f6d-47c4-b83d-b1d67d14ee77",
          "citation": "COUMAROYL METHOXYTRYPTAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "edca04ae-0c0e-4140-b11a-5d6fe6557900",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d4a296b3-8a01-42dd-aefd-3d1b4fc09a43",
          "id": "d4a296b3-8a01-42dd-aefd-3d1b4fc09a43",
          "molfile": "\n  Marvin  01132111012D          \n\n 25 27  0  0  0  0            999 V2000\n    8.8907   -5.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7112   -5.7395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0469   -4.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5619   -4.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8974   -3.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7180   -3.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2029   -2.8110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9875   -3.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9875   -3.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6550   -4.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4086   -4.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0761   -4.5252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8298   -4.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9160   -3.3692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4973   -4.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2509   -4.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9184   -4.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6721   -4.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3395   -4.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2533   -5.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9207   -6.2787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4996   -6.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8322   -5.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2029   -4.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8673   -4.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 25  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 24  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 24  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 23  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc2c(c1)c(CCNC(=O)/C=C/c3ccc(cc3)O)c[nH]2",
          "formula": "C20H20N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "83b9f885-f1f3-445b-9596-b8c185269952"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "336.3852",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "228e6c6b-8363-45d9-bd36-c74dbd740175",
      "version": "3",
      "structure": {
        "id": "4bb5ff8a-0d4d-4527-8d4d-4afd029b1a69",
        "molfile": "\n  Marvin  01132103572D          \n\n 25 27  0  0  0  0            999 V2000\n   12.6550   -4.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9875   -3.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9875   -3.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2029   -2.8110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7180   -3.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8974   -3.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5619   -4.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0469   -4.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7112   -5.7395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8907   -5.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8673   -4.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2029   -4.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4086   -4.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0761   -4.5252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8298   -4.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9160   -3.3692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4973   -4.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2509   -4.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9184   -4.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6721   -4.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3395   -4.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2533   -5.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9207   -6.2787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4996   -6.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8322   -5.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12  5  1  0  0  0  0\n  2 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 19 25  2  0  0  0  0\nM  END",
        "smiles": "COc1ccc2c(c1)c(CCNC(=O)/C=C/c3ccc(cc3)O)c[nH]2",
        "formula": "C20H20N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "336.3852",
        "optical_activity": "NONE",
        "references": [
          "cd6c11be-72a5-4564-a9a1-043d4dd0c734",
          "9ec8211a-b397-4f38-ba7c-b6b348b3af4b"
        ],
        "stereo_centers": 0
      },
      "unii": "HE37GBK28Q"
    }
  ]
}