{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "50340a99-529b-4c64-a9b3-4ccc6b45256d", "code": "553-79-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=553-79-7", "code_system": "CAS", "references": [ "ac475a3b-e747-4126-b190-1b87d8c81902", "4f9e3060-9a2f-479f-944c-7e2f243d8841" ] }, { "uuid": "e6eb7a14-3f8d-4259-9244-4207391b2b1d", "code": "11118", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11118", "code_system": "PUBCHEM", "references": [ "ac475a3b-e747-4126-b190-1b87d8c81902" ] }, { "uuid": "0bb5c929-f0ea-4346-af1f-9728aeff0920", "code": "21 CFR 189.175", "comments": "PART 189 -- SUBSTANCES PROHIBITED FROM USE IN HUMAN FOOD|Subpart C--Substances Generally Prohibited From Direct Addition or Use as Human Food|Sec. 189.175 P-4000.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=189.175", "code_system": "CFR", "references": [ "ac475a3b-e747-4126-b190-1b87d8c81902" ] }, { "uuid": "875589d3-cfb8-4dd3-abb0-f6fd16dc4866", "code": "5-NITRO-2-PROPOXYANILINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/5-Nitro-2-propoxyaniline", "code_system": "WIKIPEDIA", "references": [ "ac475a3b-e747-4126-b190-1b87d8c81902" ] }, { "uuid": "65c8eaf7-8795-4c47-9ca6-17324e2d6bfb", "code": "209-049-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.228", "code_system": "ECHA (EC/EINECS)", "references": [ "ac475a3b-e747-4126-b190-1b87d8c81902" ] }, { "uuid": "024f729b-2fca-43e3-be14-5964c551f169", "code": "m7986", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m7986?q=authorize", "code_system": "MERCK INDEX", "references": [ "ac475a3b-e747-4126-b190-1b87d8c81902" ] }, { "uuid": "8cf53107-2332-526b-19dd-84f265e78292", "code": "DTXSID50203827", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50203827", "code_system": "EPA CompTox", "references": [ "bd3d6f3c-b9fd-f0da-004b-b0fe341d9df8" ] }, { "uuid": "847f348f-850d-4874-8a6d-95d9055863fa", "code": "HDS42MR6BM", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "96b23b6e-0432-e4ea-624b-f3b0d30103b5", "code": "108776", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=108776", "code_system": "NSC", "references": [ "92c40140-393c-8822-43a8-cc09ce6100c3" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7ef18d0f-69ef-4768-92de-717baa434a05", "name": "1-PROPOXY-2-AMINO-4-NITROBENZENE", "stdName": "1-PROPOXY-2-AMINO-4-NITROBENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "589f95aa-43bd-4b2f-af5d-9075eea2e54d", "7ee05e81-6134-47d9-88fe-02844b9d2bf7" ], "display_name": false }, { "uuid": "a4c9071e-6012-4f28-b280-cd73fb4708ce", "name": "2-AMINO-4-NITRO-1-PROPOXYBENZENE", "stdName": "2-AMINO-4-NITRO-1-PROPOXYBENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "589f95aa-43bd-4b2f-af5d-9075eea2e54d", "7ee05e81-6134-47d9-88fe-02844b9d2bf7" ], "display_name": false }, { "uuid": "b1bffea1-cc41-4825-8b16-bd0dce2b0ecf", "name": "5-NITRO-2-N-PROPOXYANILINE", "stdName": "5-NITRO-2-N-PROPOXYANILINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d8ba5709-43f0-4145-95cb-6f921f88f00f", "6b6bbe5d-8102-4aa3-a0ff-9d8d1fde19dc" ], "display_name": false }, { "uuid": "d5ab2fe6-a979-4579-a9f2-d57429f6428a", "name": "5-NITRO-2-PROPOXYANILINE", "stdName": "5-NITRO-2-PROPOXYANILINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "58b4dc98-18e6-4a5b-bfe8-8d09dc449f1f", "2c921a4c-2d97-48b7-a9f6-098789c9add6", "38b263d7-5f47-4c11-9f0e-c0e8d9838824", "7ee05e81-6134-47d9-88fe-02844b9d2bf7" ], "display_name": true }, { "uuid": "758742bf-c690-4a87-95e4-dc5645768de2", "name": "5-NITRO-2-PROPOXYANILINE [MI]", "stdName": "5-NITRO-2-PROPOXYANILINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "38b263d7-5f47-4c11-9f0e-c0e8d9838824", "7ee05e81-6134-47d9-88fe-02844b9d2bf7" ], "display_name": false }, { "uuid": "ecfb3165-ed59-4ef3-a404-a8c57f4f65d7", "name": "5-NITRO-2-PROPOXYBENZENAMINE", "stdName": "5-NITRO-2-PROPOXYBENZENAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "589f95aa-43bd-4b2f-af5d-9075eea2e54d", "7ee05e81-6134-47d9-88fe-02844b9d2bf7" ], "display_name": false }, { "uuid": "6dd79bff-eee3-4861-b8da-8176e733c228", "name": "ANILINE, 5-NITRO-2-PROPOXY-", "stdName": "ANILINE, 5-NITRO-2-PROPOXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7ee05e81-6134-47d9-88fe-02844b9d2bf7", "38581228-b8c6-464d-ba8f-8d68e9678369" ], "display_name": false }, { "uuid": "537fd722-c06a-400d-90fe-75d536d06785", "name": "NSC-108776", "stdName": "NSC-108776", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "4e686f0b-3c4e-43e2-aa31-9f5b754642c3", "7ee05e81-6134-47d9-88fe-02844b9d2bf7" ], "display_name": false }, { "uuid": "f0eaa1b5-2665-465f-a5cd-16fd94e0d3cd", "name": "P-4000", "stdName": "P-4000", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "589f95aa-43bd-4b2f-af5d-9075eea2e54d", "7ee05e81-6134-47d9-88fe-02844b9d2bf7" ], "display_name": false }, { "uuid": "5cd88083-b8f5-497d-98e8-37684ab056b9", "name": "ULTRASUSS", "stdName": "ULTRASUSS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "589f95aa-43bd-4b2f-af5d-9075eea2e54d", "7ee05e81-6134-47d9-88fe-02844b9d2bf7" ], "display_name": false } ], "references": [ { "uuid": "2c921a4c-2d97-48b7-a9f6-098789c9add6", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "38b263d7-5f47-4c11-9f0e-c0e8d9838824", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7ee05e81-6134-47d9-88fe-02844b9d2bf7", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "589f95aa-43bd-4b2f-af5d-9075eea2e54d", "citation": "Merck", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "38581228-b8c6-464d-ba8f-8d68e9678369", "citation": "ChemID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4e686f0b-3c4e-43e2-aa31-9f5b754642c3", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6b6bbe5d-8102-4aa3-a0ff-9d8d1fde19dc", "citation": "YES", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d8ba5709-43f0-4145-95cb-6f921f88f00f", "citation": "CFR", "doc_type": "CFR", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ac475a3b-e747-4126-b190-1b87d8c81902", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391004000, "tags": [ "NOMEN" ] }, { "uuid": "7cf1e805-e0db-45c2-856b-011eab7f794e", "citation": "SRS import [HDS42MR6BM]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HDS42MR6BM", "doc_type": "SRS", "public_domain": true, "document_date": 1493391004000, "tags": [ "NOMEN" ] }, { "uuid": "2d4c5f58-0d8d-4df0-b099-aae94a39a97a", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "58b4dc98-18e6-4a5b-bfe8-8d09dc449f1f", "citation": "5-NITRO-2-PROPOXYANILINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "bd3d6f3c-b9fd-f0da-004b-b0fe341d9df8", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=553-79-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4f9e3060-9a2f-479f-944c-7e2f243d8841", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "92c40140-393c-8822-43a8-cc09ce6100c3", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ca3e2373-cbdb-484d-9b76-33ffea9e6481", "id": "ca3e2373-cbdb-484d-9b76-33ffea9e6481", "molfile": "\n Marvin 01132110272D \n\n 14 14 0 0 0 0 999 V2000\n 7.4258 -3.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9124 -2.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4158 -3.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8894 -2.7895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2859 -3.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2859 -3.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5740 -4.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8598 -3.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8598 -3.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5740 -2.7274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5740 -1.9100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1334 -4.4011 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 3.1334 -5.2400 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.3590 -4.0499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 8 12 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\nM CHG 2 12 1 13 -1\nM END", "smiles": "CCCOc1ccc(cc1N)[N+](=O)[O-]", "formula": "C9H12N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "89a89c16-a0bd-4127-bf1e-592a146af041" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "196.2035", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9fd73e8c-a762-4062-afd1-9d1001ebd4d9", "version": "4", "structure": { "id": "76f74b05-5ee3-40f8-9dc6-4b84083c5210", "molfile": "\n Marvin 01132106112D \n\n 14 14 0 0 0 0 999 V2000\n 5.2859 -3.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5740 -2.7274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8598 -3.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8598 -3.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1334 -4.4011 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 3.1334 -5.2400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3590 -4.0499 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.5740 -4.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2859 -3.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5740 -1.9100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8894 -2.7895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4158 -3.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9124 -2.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4258 -3.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 8 4 2 0 0 0 0\n 9 8 1 0 0 0 0\n 1 9 2 0 0 0 0\n 2 10 1 0 0 0 0\n 1 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\nM CHG 2 5 1 7 -1\nM END", "smiles": "CCCOc1ccc(cc1N)[N+](=O)[O-]", "formula": "C9H12N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "196.2035", "optical_activity": "NONE", "references": [ "7cf1e805-e0db-45c2-856b-011eab7f794e", "2d4c5f58-0d8d-4df0-b099-aae94a39a97a" ], "stereo_centers": 0 }, "unii": "HDS42MR6BM" } ] }