{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0125a3e4-4c90-421c-bf64-207f32d2445b",
          "code": "C03CC02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|HIGH-CEILING DIURETICS|Aryloxyacetic acid derivatives|tienilic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03CC02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "310025b7-0755-4c3e-9703-47f74c781e9c",
          "code": "QC03CC02",
          "comments": "VATC|DIURETICS|HIGH-CEILING DIURETICS|Aryloxyacetic acid derivatives|tienilic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03CC02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "34aa2710-87c1-4047-92ae-b01381803c6b",
          "code": "40180-04-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=40180-04-9",
          "code_system": "CAS",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3",
            "ac6e6c6e-903c-4360-a3d7-4d2833d03d74"
          ]
        },
        {
          "uuid": "68324f7a-6c0c-4561-b24d-b7abedc8e2cc",
          "code": "D013989",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013989",
          "code_system": "MESH",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "49fe3c98-2435-48e9-97d5-cbec23687d96",
          "code": "SUB11032MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "1b496b95-8cc4-4ef0-8b62-ce8400cdeda0",
          "code": "3036",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3036",
          "code_system": "INN",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "bbca124b-1a2d-4688-bcdd-c24c0500c88f",
          "code": "254-826-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.049.825",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "91109e9c-427d-4fa0-8ca4-7c8cd8bb84f7",
          "code": "m10856",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10856?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "fa1db853-e283-4645-ab34-21defd6b7b5e",
          "code": "CHEMBL267744",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL267744",
          "code_system": "ChEMBL",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "c6867089-b7c5-4d12-bfe5-8844e396ad64",
          "code": "38409",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/38409",
          "code_system": "PUBCHEM",
          "references": [
            "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3"
          ]
        },
        {
          "uuid": "a35716aa-be5f-70ec-f965-08c0cc5c4269",
          "code": "Tienilic acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tienilic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "818188e1-5eaf-742b-7823-3d5273643e82"
          ]
        },
        {
          "uuid": "be49f679-7f2d-aaea-9adc-3e68f4135fbc",
          "code": "DTXSID4023670",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023670",
          "code_system": "EPA CompTox",
          "references": [
            "ece220c2-f0dd-7e79-a608-b344e3d666e0"
          ]
        },
        {
          "uuid": "e9b6f193-cdd0-4e7b-e86b-22c8e38145c2",
          "code": "C152613",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152613",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d74ae42e-935f-f2a3-bde7-f39a1c410f40"
          ]
        },
        {
          "uuid": "7771128d-4242-e928-71ec-783b3678c819",
          "code": "C49184",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic[C448]|Loop Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C49184",
          "code_system": "NCI_THESAURUS",
          "references": [
            "17565c3f-0154-8da3-00a1-a9a88b3febba"
          ]
        },
        {
          "uuid": "4bcc4e8f-113c-1b63-88f4-3e054d5d31b0",
          "code": "C921",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Uricosuric Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C921",
          "code_system": "NCI_THESAURUS",
          "references": [
            "17565c3f-0154-8da3-00a1-a9a88b3febba"
          ]
        },
        {
          "uuid": "5975fd56-d887-42cd-a73a-a74d9c6f0c01",
          "code": "HC95205SY4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ac7b6983-554a-d96c-81ca-152d88534225",
          "code": "2658",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2658",
          "code_system": "DRUG CENTRAL",
          "references": [
            "17565c3f-0154-8da3-00a1-a9a88b3febba"
          ]
        },
        {
          "uuid": "f04863b2-a1c5-5b0a-d596-64d307751997",
          "code": "DB04831",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04831",
          "code_system": "DRUG BANK",
          "references": [
            "17565c3f-0154-8da3-00a1-a9a88b3febba"
          ]
        },
        {
          "uuid": "fcb2bf61-dfd4-91a6-6d02-c25690d32edf",
          "code": "9590",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9590",
          "code_system": "CHEBI",
          "references": [
            "17565c3f-0154-8da3-00a1-a9a88b3febba"
          ]
        },
        {
          "uuid": "f961e6b7-6a77-0c96-e1ff-fc00496c0ec2",
          "code": "100000082169",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "47c6c6fa-3f76-45dd-afdb-598bed07bd96"
          ]
        },
        {
          "uuid": "8d5854ad-e306-57ca-36e1-716573d88634",
          "code": "21 CFR 216.24",
          "comments": "PART 216 -- HUMAN DRUG COMPOUNDING|Subpart B--Compounded Drug Products|Sec. 216.24 Drug products withdrawn or removed from the market for reasons of safety or effectiveness.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=216.24",
          "code_system": "CFR",
          "references": [
            "1d457021-26c7-ce15-64ab-ea3006797fa5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ee36cbbd-80c6-4b6f-9bb1-82d9225ff380",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "15dcb1ea-4f84-40bc-b29c-1489d9df2355",
            "refuuid": "93e0e063-ced0-4405-a015-6f66ec6449d9",
            "name": "TICRYNAFEN",
            "unii": "HC95205SY4",
            "linking_id": "HC95205SY4",
            "ref_pname": "TICRYNAFEN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2cb4252f-604b-43e5-9922-e26236542516",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2d72fe9a-111a-445b-8cb2-8b4d12e2f048",
            "refuuid": "76a94b9e-be39-451c-9849-d3e58993185a",
            "name": "TICRYNAFEN TROMETHAMINE",
            "unii": "2442F2Q79Z",
            "linking_id": "2442F2Q79Z",
            "ref_pname": "TICRYNAFEN TROMETHAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f31e6953-c1b5-4bde-a86b-3f2dea602fc7",
          "name": "SELACRYN",
          "stdName": "SELACRYN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d537ebd-7a0a-46e2-ae7d-12c714c9f1a9",
            "2fc0c327-5ef5-4f8d-9ac5-4f918a888a24"
          ],
          "display_name": false
        },
        {
          "uuid": "20f439ac-1b52-4803-a9b6-61af870e340b",
          "name": "SK&F 62698",
          "stdName": "SK&F 62698",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ed2e7f7-67e0-4672-9c8a-76ac970946c8",
            "534f4022-05e3-4147-b175-cb50e4cca593"
          ],
          "display_name": false
        },
        {
          "uuid": "a8a106b0-9c97-46c0-9e53-e1e89ab9ec21",
          "name": "SK&F-62698",
          "stdName": "SK&F-62698",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ed2e7f7-67e0-4672-9c8a-76ac970946c8",
            "534f4022-05e3-4147-b175-cb50e4cca593"
          ],
          "display_name": false
        },
        {
          "uuid": "842048c2-a238-4422-9e02-d25b6383c0a7",
          "name": "TICRYNAFEN",
          "stdName": "TICRYNAFEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ab6ab6a-c227-4841-8423-8d7c0b6476e4",
            "4ed2e7f7-67e0-4672-9c8a-76ac970946c8",
            "cb65b039-8e16-465d-9b92-69242084adda",
            "3da46bc0-66b1-49c1-9e72-6f104f0a8e9d",
            "29ea8353-2666-4e99-8ef6-bfade1068144",
            "643ae377-b06d-4889-942e-6e30eb2d5ced"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f6b9c7b3-4f27-4748-b840-a5e255dffd7d",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "cdff4e3f-90c5-409c-b4b9-18756973d7a2",
          "name": "TICRYNAFEN [MI]",
          "stdName": "TICRYNAFEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ed2e7f7-67e0-4672-9c8a-76ac970946c8",
            "3da46bc0-66b1-49c1-9e72-6f104f0a8e9d"
          ],
          "display_name": false
        },
        {
          "uuid": "d4afd0fa-a462-4b7f-b310-253a37bf4d66",
          "name": "TICRYNAFEN [USAN]",
          "stdName": "TICRYNAFEN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "643ae377-b06d-4889-942e-6e30eb2d5ced"
          ],
          "display_name": false
        },
        {
          "uuid": "17d2005e-226e-4a2e-9a12-07253a9fdd13",
          "name": "TIENILIC ACID",
          "stdName": "TIENILIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ed2e7f7-67e0-4672-9c8a-76ac970946c8",
            "f3fbd138-4697-4765-b2ad-e2d87d2fc1c6",
            "8dc558c7-5cbd-46bb-91ef-444fc3c0d3a9",
            "987e7a6a-8fb0-4206-b25b-1fd59b73387c",
            "78894d89-d667-4365-97e5-89a1d218ca6c",
            "c0cba395-f4d3-4c5f-bd89-8edeef5c7c5d",
            "b75a3252-aeae-484b-9e9b-74f098f86049",
            "bca3fc91-8908-485a-8a41-f8e4559deb89"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "063f76e7-4e2c-471e-86d1-e5061864ffbc",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "be567789-050c-41bd-8e43-39cbb3b5b9d9",
          "name": "TIENILIC ACID [MART.]",
          "stdName": "TIENILIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3fbd138-4697-4765-b2ad-e2d87d2fc1c6"
          ],
          "display_name": false
        },
        {
          "uuid": "aba63b2b-eca1-f0ab-cd58-e0e92ef4fcb0",
          "name": "Tienilic acid [WHO-DD]",
          "stdName": "TIENILIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "445a35c3-272a-fe07-b591-61611146478d"
          ],
          "display_name": false
        },
        {
          "uuid": "5c79ab5d-a363-4b4e-b511-517d928a7fa4",
          "name": "tienilic acid [INN]",
          "stdName": "TIENILIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dc558c7-5cbd-46bb-91ef-444fc3c0d3a9",
            "6f0f94a6-0469-4c87-882b-29ab091c54cf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cb65b039-8e16-465d-9b92-69242084adda",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bca3fc91-8908-485a-8a41-f8e4559deb89",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ed2e7f7-67e0-4672-9c8a-76ac970946c8",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dc558c7-5cbd-46bb-91ef-444fc3c0d3a9",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "643ae377-b06d-4889-942e-6e30eb2d5ced",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3fbd138-4697-4765-b2ad-e2d87d2fc1c6",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3da46bc0-66b1-49c1-9e72-6f104f0a8e9d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d537ebd-7a0a-46e2-ae7d-12c714c9f1a9",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fc0c327-5ef5-4f8d-9ac5-4f918a888a24",
          "citation": "D02386",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0cba395-f4d3-4c5f-bd89-8edeef5c7c5d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "534f4022-05e3-4147-b175-cb50e4cca593",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "602d201d-7b4f-4f0a-a5dd-9b2cb73ccdc3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ee25ce6-0745-4827-9351-ef1409b30dee",
          "citation": "SRS import [HC95205SY4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HC95205SY4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "987e7a6a-8fb0-4206-b25b-1fd59b73387c",
          "citation": "TIENILIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7ab6ab6a-c227-4841-8423-8d7c0b6476e4",
          "citation": "TICRYNAFEN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b75a3252-aeae-484b-9e9b-74f098f86049",
          "citation": "TIENILIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29ea8353-2666-4e99-8ef6-bfade1068144",
          "citation": "TICRYNAFEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "78894d89-d667-4365-97e5-89a1d218ca6c",
          "citation": "TIENILIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "818188e1-5eaf-742b-7823-3d5273643e82",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Tienilic_acid",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ece220c2-f0dd-7e79-a608-b344e3d666e0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=40180-04-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d74ae42e-935f-f2a3-bde7-f39a1c410f40",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "17565c3f-0154-8da3-00a1-a9a88b3febba",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ac6e6c6e-903c-4360-a3d7-4d2833d03d74",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6f0f94a6-0469-4c87-882b-29ab091c54cf",
          "citation": "INN Proposed List 25",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL25.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "445a35c3-272a-fe07-b591-61611146478d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "47c6c6fa-3f76-45dd-afdb-598bed07bd96",
          "citation": "EMA 2023",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1d457021-26c7-ce15-64ab-ea3006797fa5",
          "citation": "21 CFR 216.24",
          "doc_type": "CFR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7ce1537a-bf2c-4df2-a669-f8d3db16e947",
          "id": "7ce1537a-bf2c-4df2-a669-f8d3db16e947",
          "molfile": "\n  Marvin  01132106292D          \n\n 20 21  0  0  0  0            999 V2000\n    6.3939   -0.5624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9792   -1.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3939   -1.9853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1473   -1.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7300   -2.0009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8903   -2.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4782   -1.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6592   -1.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2497   -2.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4177   -2.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0056   -2.7369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9952   -1.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3244   -0.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7076    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1711   -1.2233    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6695   -2.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2575   -3.4471    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4911   -2.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8980   -3.4393    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 19  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 17  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  2  0  0  0  0\n 16 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "c1cc(C(=O)c2ccc(c(c2Cl)Cl)OCC(=O)O)sc1",
          "formula": "C13H8Cl2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b4b77e81-60a8-4ed9-820f-5a2a280e2856"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "331.1727",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "93e0e063-ced0-4405-a015-6f66ec6449d9",
      "version": "18",
      "structure": {
        "id": "3c5ca2d8-c97d-49e7-b373-e04a557009eb",
        "molfile": "\n  Marvin  01132103122D          \n\n 20 21  0  0  0  0            999 V2000\n    2.2497   -2.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6695   -2.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4177   -2.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4911   -2.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9952   -1.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6592   -1.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1711   -1.2233    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8903   -2.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9792   -1.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0056   -2.7369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3244   -0.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7300   -2.0009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4782   -1.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7076    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3939   -0.5624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2575   -3.4471    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.8980   -3.4393    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.1473   -1.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3939   -1.9853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8 14  1  0  0  0  0\n  9 19  1  0  0  0  0\n 10  3  2  0  0  0  0\n 11  5  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  6  2  0  0  0  0\n 15 11  1  0  0  0  0\n 16  9  2  0  0  0  0\n 17  2  1  0  0  0  0\n 18  4  1  0  0  0  0\n 19 12  1  0  0  0  0\n 20  9  1  0  0  0  0\n  4  8  2  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
        "smiles": "c1cc(C(=O)c2ccc(c(c2Cl)Cl)OCC(=O)O)sc1",
        "formula": "C13H8Cl2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "331.1727",
        "optical_activity": "NONE",
        "references": [
          "cb65b039-8e16-465d-9b92-69242084adda",
          "7ee25ce6-0745-4827-9351-ef1409b30dee",
          "6f0f94a6-0469-4c87-882b-29ab091c54cf"
        ],
        "stereo_centers": 0
      },
      "unii": "HC95205SY4"
    }
  ]
}