{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9582dc39-0362-49a3-a882-284c021c642d",
          "code": "155633-54-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=155633-54-8",
          "code_system": "CAS",
          "references": [
            "b6ed3b1b-c7f0-4237-a719-e19b033ec41a",
            "027cb0e8-5ec5-402c-bafe-9783a1b5f5ca"
          ]
        },
        {
          "uuid": "91943a36-828a-459b-964e-15817977f07f",
          "code": "320341-73-9",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=320341-73-9",
          "code_system": "CAS",
          "references": [
            "b6ed3b1b-c7f0-4237-a719-e19b033ec41a",
            "469e7248-bce5-4a06-901c-327c7b74ae1a"
          ]
        },
        {
          "uuid": "0cfdac13-5b23-4acc-b9fc-ab5306e6278c",
          "code": "DROMETRIZOLE TRISILOXANE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Drometrizole_trisiloxane",
          "code_system": "WIKIPEDIA",
          "references": [
            "b6ed3b1b-c7f0-4237-a719-e19b033ec41a"
          ]
        },
        {
          "uuid": "2c461201-3079-4b5b-b7de-3a85b13642a1",
          "code": "SUB35411",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b6ed3b1b-c7f0-4237-a719-e19b033ec41a"
          ]
        },
        {
          "uuid": "a015cf7d-d029-4fac-8a8d-e99d1225afe8",
          "code": "9848888",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9848888",
          "code_system": "PUBCHEM",
          "references": [
            "b6ed3b1b-c7f0-4237-a719-e19b033ec41a"
          ]
        },
        {
          "uuid": "f8a0f579-714d-6955-88b1-e79294d7fe3d",
          "code": "DTXSID40431753",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40431753",
          "code_system": "EPA CompTox",
          "references": [
            "ae5259b3-3d18-83eb-c186-77b7a36821d1"
          ]
        },
        {
          "uuid": "084f911d-560e-d138-ec80-c22f6198776e",
          "code": "1992874",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1992874/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7eb3d03c-a490-8eb4-7eee-fcd7c5ca738b"
          ]
        },
        {
          "uuid": "3deecaec-3c62-751b-5bc2-dcdd6c68e2bf",
          "code": "DB11585",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11585",
          "code_system": "DRUG BANK",
          "references": [
            "2ced96b0-9c3b-d298-228b-e6909fc8fda3"
          ]
        },
        {
          "uuid": "be0be69e-76e3-491d-9bb3-2a63849cb86d",
          "code": "HC22845I1X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9aac58ee-b735-e89b-2660-041d7672e3cb",
          "code": "1228010",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1228010",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "2ced96b0-9c3b-d298-228b-e6909fc8fda3"
          ]
        },
        {
          "uuid": "a9a5bf7d-3454-d491-6654-6f2d5f929789",
          "code": "100000128399",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "da1e4903-58d8-e942-60a4-84c3cff1a610"
          ]
        },
        {
          "uuid": "285cad85-d562-defb-0c22-ef86dd885632",
          "code": "HC22845I1X",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=HC22845I1X",
          "code_system": "DAILYMED",
          "references": [
            "05c2f620-a938-ddd6-7e9d-5acb81d9afd0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3b9f10e3-5e43-4ded-844f-52bfc69a3d8a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "bd104b11-0e6d-4be6-b138-9d529acbacb0",
            "refuuid": "5219292d-f8ec-4469-84ae-f2e3a8fcbdc0",
            "name": "DROMETRIZOLE TRISILOXANE",
            "unii": "HC22845I1X",
            "linking_id": "HC22845I1X",
            "ref_pname": "DROMETRIZOLE TRISILOXANE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d189bd46-115b-49f1-833f-bfd2a4367c0f",
          "name": "DROMETRIZOLE TRISILOXANE",
          "stdName": "DROMETRIZOLE TRISILOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5445b32-73c1-4438-a80f-c2b9ca8b3295",
            "ff10d148-a7fd-4215-acb3-971be5a664d6",
            "5cacebec-f5c4-482b-9072-b7d498de6784",
            "15620903-3597-4e74-bcb3-a701823b97f0",
            "b8e1d348-a4eb-4bb5-843a-1da1cbe11abc"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d54c81d0-dd1d-4f30-b55d-b30c03cd0753",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "618f8977-8bb1-495d-a99c-5fb851e24973",
          "name": "DROMETRIZOLE TRISILOXANE [USP-RS]",
          "stdName": "DROMETRIZOLE TRISILOXANE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5445b32-73c1-4438-a80f-c2b9ca8b3295"
          ],
          "display_name": false
        },
        {
          "uuid": "1010a9e2-69cd-aa10-5be4-3509d88f2b42",
          "name": "Drometrizole trisiloxane [WHO-DD]",
          "stdName": "DROMETRIZOLE TRISILOXANE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "faa9c9cf-32f1-214e-4cdf-1026243aaac4"
          ],
          "display_name": false
        },
        {
          "uuid": "c6c2611c-11c1-4f13-bcbc-b55ae5efdac6",
          "name": "MEXORYL XL",
          "stdName": "MEXORYL XL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90ae8442-b3c7-4065-ab3e-f96f57ad2a9c"
          ],
          "display_name": false
        },
        {
          "uuid": "87e98aba-1f82-47e0-9a9c-1273223f978d",
          "name": "OR 10154",
          "stdName": "OR 10154",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90ae8442-b3c7-4065-ab3e-f96f57ad2a9c"
          ],
          "display_name": false
        },
        {
          "uuid": "b96eddaf-58ae-4c53-9589-15cdffac8bbf",
          "name": "OR-10154",
          "stdName": "OR-10154",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c81c69e6-107a-41a5-bb20-b1842b62836a"
          ],
          "display_name": false
        },
        {
          "uuid": "af840c7c-01d6-4f9b-9dfb-aeaea6399d74",
          "name": "PHENOL, 2-(2H-BENZOTRIAZOL-2-YL)-4-METHYL-6-(2-METHYL-3-(1,3,3,3-TETRAMETHYL-1-((TRIMETHYLSILYL)OXY)-1-DISILOXANYL)PROPYL)-",
          "stdName": "PHENOL, 2-(2H-BENZOTRIAZOL-2-YL)-4-METHYL-6-(2-METHYL-3-(1,3,3,3-TETRAMETHYL-1-((TRIMETHYLSILYL)OXY)-1-DISILOXANYL)PROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90ae8442-b3c7-4065-ab3e-f96f57ad2a9c"
          ],
          "display_name": false
        },
        {
          "uuid": "d3417ac3-4cb9-4549-aa99-6c15895ac42a",
          "name": "PHENOL, 2-(2H-BENZOTRIAZOL-2-YL)-4-METHYL-6-(2-METHYL-3-(1,3,3,3-TETRAMETHYL-1-((TRIMETHYLSILYL)OXY)DISILOXANYL)PROPYL)-",
          "stdName": "PHENOL, 2-(2H-BENZOTRIAZOL-2-YL)-4-METHYL-6-(2-METHYL-3-(1,3,3,3-TETRAMETHYL-1-((TRIMETHYLSILYL)OXY)DISILOXANYL)PROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90ae8442-b3c7-4065-ab3e-f96f57ad2a9c"
          ],
          "display_name": false
        },
        {
          "uuid": "abd58c49-8ab1-4671-ac52-77080290c479",
          "name": "SILATRIZOLE",
          "stdName": "SILATRIZOLE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90ae8442-b3c7-4065-ab3e-f96f57ad2a9c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e5445b32-73c1-4438-a80f-c2b9ca8b3295",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5cacebec-f5c4-482b-9072-b7d498de6784",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90ae8442-b3c7-4065-ab3e-f96f57ad2a9c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c81c69e6-107a-41a5-bb20-b1842b62836a",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8e1d348-a4eb-4bb5-843a-1da1cbe11abc",
          "citation": "wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6ed3b1b-c7f0-4237-a719-e19b033ec41a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392632000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed66285f-37a6-4c66-99b2-628e67757ffe",
          "citation": "SRS import [HC22845I1X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HC22845I1X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392632000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff10d148-a7fd-4215-acb3-971be5a664d6",
          "citation": "DROMETRIZOLE TRISILOXANE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15620903-3597-4e74-bcb3-a701823b97f0",
          "citation": "DROMETRIZOLE TRISILOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae5259b3-3d18-83eb-c186-77b7a36821d1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=155633-54-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a98ff6b5-f2c7-132a-e426-6225886d496e",
          "citation": "who",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "027cb0e8-5ec5-402c-bafe-9783a1b5f5ca",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "469e7248-bce5-4a06-901c-327c7b74ae1a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7eb3d03c-a490-8eb4-7eee-fcd7c5ca738b",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "2ced96b0-9c3b-d298-228b-e6909fc8fda3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "faa9c9cf-32f1-214e-4cdf-1026243aaac4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "05c2f620-a938-ddd6-7e9d-5acb81d9afd0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "da1e4903-58d8-e942-60a4-84c3cff1a610",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "59ffdde6-07d9-4a7a-bd7a-2ad2b00c4e0c",
          "id": "59ffdde6-07d9-4a7a-bd7a-2ad2b00c4e0c",
          "molfile": "\n  Marvin  01132104402D          \n\n 33 35  0  0  0  0            999 V2000\n    5.5723   -2.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3973   -2.6747    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.8098   -3.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3973   -4.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8098   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3973   -5.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8098   -6.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5723   -5.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1598   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5723   -4.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1598   -3.3891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3348   -4.8181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8499   -4.1506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0652   -4.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3508   -3.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6363   -4.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6363   -5.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3508   -5.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0652   -5.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8499   -5.4855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8098   -1.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3973   -1.2457    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9848   -0.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6828   -1.6582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9683   -1.2457    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2539   -1.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2539   -0.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9683   -0.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1118   -0.8332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8262   -1.2457    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.8262   -2.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5407   -1.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5407   -0.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 21  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 10  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 12  1  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 20 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 14 19  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 29  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 25 28  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 30 32  1  0  0  0  0\n 30 33  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(CC(C)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)c(c(c1)-n2nc3ccccc3n2)O",
          "formula": "C24H39N3O3Si3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7b3dc709-032a-4138-9137-79307245f6d8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "501.8418",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5219292d-f8ec-4469-84ae-f2e3a8fcbdc0",
      "version": "17",
      "structure": {
        "id": "ba24b7fe-3a15-4959-98e4-b48c9e6cf292",
        "molfile": "\n  Marvin  01132109382D          \n\n 33 35  0  0  0  0            999 V2000\n    6.3973   -2.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8098   -1.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3973   -1.2457    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9848   -0.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6828   -1.6582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9683   -1.2457    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2539   -1.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2539   -0.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9683   -0.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1118   -0.8332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8262   -1.2457    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.8262   -2.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5407   -1.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5407   -0.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8098   -3.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3973   -4.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8098   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3973   -5.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8098   -6.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5723   -5.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1598   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5723   -4.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1598   -3.3891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3348   -4.8181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8499   -5.4855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0652   -5.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0652   -4.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3508   -3.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6363   -4.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6363   -5.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3508   -5.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8499   -4.1506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5723   -2.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 15  1  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 16 22  1  0  0  0  0\n 21 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 26  1  0  0  0  0\n 27 32  2  0  0  0  0\n 32 24  1  0  0  0  0\n  1 33  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(CC(C)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)c(c(c1)-n2nc3ccccc3n2)O",
        "formula": "C24H39N3O3Si3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "501.8418",
        "optical_activity": "( + / - )",
        "references": [
          "ed66285f-37a6-4c66-99b2-628e67757ffe",
          "90ae8442-b3c7-4065-ab3e-f96f57ad2a9c"
        ],
        "stereo_centers": 1
      },
      "unii": "HC22845I1X"
    }
  ]
}