{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5d739d63-7656-4002-9a6d-6380c40141cd", "code": "26544-22-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=26544-22-9", "code_system": "CAS", "references": [ "64035a05-afcd-48c9-a30d-9aa840a6552a", "1109c1df-2341-4fd8-b444-5e34bb6c8200" ] }, { "uuid": "2c41d205-2c28-461e-be8c-332e0269275a", "code": "247-776-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.418", "code_system": "ECHA (EC/EINECS)", "references": [ "64035a05-afcd-48c9-a30d-9aa840a6552a" ] }, { "uuid": "d17a37e7-37a7-4351-9b1e-7f3c0c3a9c72", "code": "117813", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/117813", "code_system": "PUBCHEM", "references": [ "64035a05-afcd-48c9-a30d-9aa840a6552a" ] }, { "uuid": "3ac53ee9-52e0-4759-bddd-552bb8ad5364", "code": "HBT93TS2WG", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "4639f63e-0081-4120-a75f-3f6853fcee7b", "name": "Diisooctyl phenyl phosphite", "stdName": "DIISOOCTYL PHENYL PHOSPHITE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "01810548-b092-4f0b-a9f3-c6d54fca10a2", "a2e8b18f-fcc4-4485-b23c-26396aaabd7d" ], "display_name": true }, { "uuid": "f1aa02dc-1fbd-4804-9767-4dcbc8be861e", "name": "Phosphorous acid, diisooctyl phenyl ester", "stdName": "PHOSPHOROUS ACID, DIISOOCTYL PHENYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1109c1df-2341-4fd8-b444-5e34bb6c8200" ], "display_name": false } ], "references": [ { "uuid": "01810548-b092-4f0b-a9f3-c6d54fca10a2", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a2e8b18f-fcc4-4485-b23c-26396aaabd7d", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "64035a05-afcd-48c9-a30d-9aa840a6552a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394009000, "tags": [ "NOMEN" ] }, { "uuid": "d1845f26-ce5a-c1ab-0c32-e876e7a4f5e2", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=26544-22-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1109c1df-2341-4fd8-b444-5e34bb6c8200", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "96777c16-5c60-4e5e-a2ae-40c7176b52ac", "id": "96777c16-5c60-4e5e-a2ae-40c7176b52ac", "molfile": "\n Marvin 01132107492D \n\n 26 26 0 0 0 0 999 V2000\n 10.5973 -9.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8776 -9.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8717 -10.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1700 -9.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4505 -9.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7429 -9.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0233 -9.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3075 -9.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5962 -9.7438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8804 -9.3281 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8833 -8.5074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1675 -8.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1664 -7.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4547 -6.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4536 -6.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7422 -5.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7443 -4.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0293 -4.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4590 -4.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1646 -9.7383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1621 -10.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4443 -10.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4434 -11.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1561 -12.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8697 -11.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8747 -10.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 20 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 26 21 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCOP(OCCCCCC(C)C)Oc1ccccc1", "formula": "C22H39O3P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "770bf1bc-8cd0-4fb0-a15d-6996ac4f22e9" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "382.5179", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9275960f-a781-4ba9-be14-b76f09117e2d", "version": "8", "structure": { "id": "2d3dd640-c42f-4269-bed4-699fa80bad64", "molfile": "\n Marvin 01132102262D \n\n 26 26 0 0 0 0 999 V2000\n 10.5973 -9.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8776 -9.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1700 -9.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4505 -9.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7429 -9.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0233 -9.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3075 -9.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5962 -9.7438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8804 -9.3281 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1646 -9.7383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1621 -10.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4443 -10.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4434 -11.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1561 -12.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8697 -11.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8747 -10.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8833 -8.5074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1675 -8.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1664 -7.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4547 -6.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4536 -6.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7422 -5.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7443 -4.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0293 -4.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4590 -4.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8717 -10.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 11 2 0 0 0 0\n 9 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 2 26 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCOP(OCCCCCC(C)C)Oc1ccccc1", "formula": "C22H39O3P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "382.5179", "optical_activity": "NONE", "references": [ "01810548-b092-4f0b-a9f3-c6d54fca10a2" ], "stereo_centers": 0 }, "unii": "HBT93TS2WG" } ] }