{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "719f068d-e5ab-4c8b-910f-3cca4d69db08",
          "code": "553-11-7",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=553-11-7",
          "code_system": "CAS",
          "references": [
            "004a2c93-d61a-4a3d-beff-8b5c90047081",
            "2ec1bf38-6609-43f4-ad06-f727394406f2"
          ]
        },
        {
          "uuid": "fdd1516b-29d1-4686-9b43-9e341c83f398",
          "code": "HEMATOPORPHYRIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hematoporphyrin",
          "code_system": "WIKIPEDIA",
          "references": [
            "004a2c93-d61a-4a3d-beff-8b5c90047081"
          ]
        },
        {
          "uuid": "ea887439-a7ce-4726-9350-eba45f07888f",
          "code": "14459-29-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14459-29-1",
          "code_system": "CAS",
          "references": [
            "004a2c93-d61a-4a3d-beff-8b5c90047081",
            "773e7b18-0e54-49ca-a95e-ef2e12681fcd"
          ]
        },
        {
          "uuid": "d3cdc822-bc11-4662-b8df-cc59dd397c61",
          "code": "5164",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5164/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "004a2c93-d61a-4a3d-beff-8b5c90047081"
          ]
        },
        {
          "uuid": "64e67649-40da-4ef9-bb1c-a0690b82a223",
          "code": "m5941",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5941?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "004a2c93-d61a-4a3d-beff-8b5c90047081"
          ]
        },
        {
          "uuid": "24051e11-f902-419a-992d-eae96fff2fe5",
          "code": "SUB14072MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "004a2c93-d61a-4a3d-beff-8b5c90047081"
          ]
        },
        {
          "uuid": "49d40707-4bae-4a6f-9abe-0ab6064f9a07",
          "code": "SUB96359",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "004a2c93-d61a-4a3d-beff-8b5c90047081"
          ]
        },
        {
          "uuid": "d73b02a4-34c2-496d-b129-6e6b7b25db87",
          "code": "238-450-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.034.939",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "004a2c93-d61a-4a3d-beff-8b5c90047081"
          ]
        },
        {
          "uuid": "d1871c73-81de-461d-a262-8db3a84c4de1",
          "code": "11103",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11103",
          "code_system": "PUBCHEM",
          "references": [
            "d49b5775-aa9d-e353-69ad-fc1c09d769e1"
          ]
        },
        {
          "uuid": "e4af877c-eb79-bfbf-cdcb-bcbece3b991f",
          "code": "33626-3",
          "comments": "LOINC|ACTIVE|CHEM|Stool|Hematoporphyrin [Mass/time] in 24 hour Stool",
          "type": "PRIMARY",
          "url": "https://loinc.org/33626-3/",
          "code_system": "LOINC",
          "references": [
            "df73721e-f65d-3a7b-b1f7-628fb3b1800e"
          ]
        },
        {
          "uuid": "dab8833c-2d06-30ba-8968-04197d4e318d",
          "code": "3274",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3274",
          "code_system": "DRUG CENTRAL",
          "references": [
            "df73721e-f65d-3a7b-b1f7-628fb3b1800e"
          ]
        },
        {
          "uuid": "d53a4281-fba7-413c-9caf-8f25c15e913e",
          "code": "HBT6M5H379",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "91cabee7-7257-6bd8-8144-9cf2018243d0",
          "code": "36162",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:36162",
          "code_system": "CHEBI",
          "references": [
            "df73721e-f65d-3a7b-b1f7-628fb3b1800e"
          ]
        },
        {
          "uuid": "5e3b90b6-fcf6-f3be-f09c-999e8eb4e704",
          "code": "59265",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=59265",
          "code_system": "NSC",
          "references": [
            "af62dc23-8c46-e47c-464c-1726e5944660"
          ]
        },
        {
          "uuid": "c4a5d71f-58e4-6f38-5147-6e8072d0de24",
          "code": "100000077911",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2c16d58d-7b30-b2d3-b687-a3280118cb2c"
          ]
        },
        {
          "uuid": "b7882044-d56a-e1e9-4e77-6956b9b858b2",
          "code": "DTXSID901030645",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901030645",
          "code_system": "EPA CompTox",
          "references": [
            "df73721e-f65d-3a7b-b1f7-628fb3b1800e"
          ]
        },
        {
          "uuid": "7b0f709e-40bd-b285-f6b4-ac21dfca7dc7",
          "code": "C167224",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C167224",
          "code_system": "NCI_THESAURUS",
          "references": [
            "754f5b28-d2f1-d250-816a-11921c32fb8f"
          ]
        },
        {
          "uuid": "331663b3-07d0-30a1-1e85-771f7b95e0cb",
          "code": "267084",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=267084",
          "code_system": "NSC",
          "references": [
            "af62dc23-8c46-e47c-464c-1726e5944660"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "46bdcef3-e6f2-4682-8b24-a8dd52fb02ca",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c07ff2ec-31ef-49c1-bddb-261cfb18d97a",
            "refuuid": "277df8a1-814c-4f20-a029-dae6cb417893",
            "name": "HEMATOPORPHYRIN",
            "unii": "HBT6M5H379",
            "linking_id": "HBT6M5H379",
            "ref_pname": "HEMATOPORPHYRIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bed1602a-6654-4e4b-b67a-012e06ea3da7",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "e80c8df0-54b8-4d2a-a7b6-90393327bd71",
            "refuuid": "76535dcf-705a-4319-9845-135fa322915e",
            "name": "HEMATOPORPHYRIN DIHYDROCHLORIDE",
            "unii": "O535A6S0T2",
            "linking_id": "O535A6S0T2",
            "ref_pname": "HEMATOPORPHYRIN DIHYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d6710c92-5c05-4e75-a90f-715ceb7ce142",
          "name": "2,18-PORPHINEDIPROPIONIC ACID, 7,12-BIS(1-HYDROXYETHYL)-3,8,13,17-TETRAMETHYL-",
          "stdName": "2,18-PORPHINEDIPROPIONIC ACID, 7,12-BIS(1-HYDROXYETHYL)-3,8,13,17-TETRAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "fee15d6d-c4ad-467e-907d-bf3490ac38cb"
          ],
          "display_name": false
        },
        {
          "uuid": "35f78be9-b026-4e8b-a48a-f403dbe27998",
          "name": "2,4-BIS(1-HYDROXYETHYL)-1,3,5,8-TETRAMETHYL-5,7-PORPHINDIPROPIONSAEURE",
          "stdName": "2,4-BIS(1-HYDROXYETHYL)-1,3,5,8-TETRAMETHYL-5,7-PORPHINDIPROPIONSAEURE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "fee15d6d-c4ad-467e-907d-bf3490ac38cb"
          ],
          "display_name": false
        },
        {
          "uuid": "8bdec485-cf0f-efca-4fb8-f5ebc1223483",
          "name": "21H,23H-PORPHINE-2,18-DIPROPANOIC ACID, 7(OR 12)-(1-HYDROXYETHYL)-12(OR 7)-(1-METHOXYETHYL)-3,8,13,17-TETRAMETHYL-",
          "stdName": "21H,23H-PORPHINE-2,18-DIPROPANOIC ACID, 7(OR 12)-(1-HYDROXYETHYL)-12(OR 7)-(1-METHOXYETHYL)-3,8,13,17-TETRAMETHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "040e4303-b700-45cd-d107-3ff38c31488d",
            "0e2f59bc-fcb2-4f38-25da-5f136fa8449d"
          ],
          "display_name": false
        },
        {
          "uuid": "502f48d7-f1f7-478b-92fd-2d8808ce3310",
          "name": "21H,23H-PORPHINE-2,18-DIPROPANOIC ACID, 7,12-BIS(1-HYDROXYETHYL)-3,8,13,17-TETRAMETHYL-",
          "stdName": "21H,23H-PORPHINE-2,18-DIPROPANOIC ACID, 7,12-BIS(1-HYDROXYETHYL)-3,8,13,17-TETRAMETHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "d6540624-7092-484c-bf24-301a2549c47c"
          ],
          "display_name": false
        },
        {
          "uuid": "cd0ac7de-de7f-4d99-906e-984ecdfbb72b",
          "name": "7,12-BIS(1-HYDROXYETHYL)-2,8,13,17-TETRAMETHYL-21H,23H-PORPHIN-2,18-DIPROPIONSAEURE",
          "stdName": "7,12-BIS(1-HYDROXYETHYL)-2,8,13,17-TETRAMETHYL-21H,23H-PORPHIN-2,18-DIPROPIONSAEURE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "fee15d6d-c4ad-467e-907d-bf3490ac38cb"
          ],
          "display_name": false
        },
        {
          "uuid": "e86673a4-39b6-4a8b-bf86-d24d3b697ca1",
          "name": "7,12-BIS(1-HYDROXYETHYL)-3,8,13,17-TETRAMETHYL-21H,23H-PORPHINE-2,18-DIPROPANOIC ACID",
          "stdName": "7,12-BIS(1-HYDROXYETHYL)-3,8,13,17-TETRAMETHYL-21H,23H-PORPHINE-2,18-DIPROPANOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "fee15d6d-c4ad-467e-907d-bf3490ac38cb"
          ],
          "display_name": false
        },
        {
          "uuid": "c49ba3c3-e55f-4a99-bd3a-952ea8c00f1d",
          "name": "HAEMATOPORPHYRIN",
          "stdName": "HAEMATOPORPHYRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "fee15d6d-c4ad-467e-907d-bf3490ac38cb"
          ],
          "display_name": false
        },
        {
          "uuid": "10557a77-a6b0-4473-b54b-d41034d33e9f",
          "name": "HEMATOPORPHYRIN",
          "stdName": "HEMATOPORPHYRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "ae4b0da7-b17e-4949-9e71-4f685f981977",
            "bdfb1cfd-7bba-4b43-8996-34843c60eccd",
            "d6540624-7092-484c-bf24-301a2549c47c",
            "d0a84613-3a84-4cb2-bdcf-0955c84fa89b",
            "951958e7-5471-4d3a-96f4-0ebfe6423e59"
          ],
          "display_name": true
        },
        {
          "uuid": "e6fad6bf-bdd3-485e-8651-e4f156033e44",
          "name": "HEMATOPORPHYRIN IX",
          "stdName": "HEMATOPORPHYRIN IX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "d6540624-7092-484c-bf24-301a2549c47c"
          ],
          "display_name": false
        },
        {
          "uuid": "1d85d05a-3d00-4a17-9b05-e511e138cce6",
          "name": "HEMATOPORPHYRIN [MI]",
          "stdName": "HEMATOPORPHYRIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "bdfb1cfd-7bba-4b43-8996-34843c60eccd"
          ],
          "display_name": false
        },
        {
          "uuid": "d7aeb869-e68a-0938-c6ad-094988c2f5f5",
          "name": "HEMOPORFIN",
          "stdName": "HEMOPORFIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "040e4303-b700-45cd-d107-3ff38c31488d"
          ],
          "display_name": false
        },
        {
          "uuid": "9e8f7f64-f4df-c3a1-cfe7-903ffb78410f",
          "name": "Hematoporphyrin [WHO-DD]",
          "stdName": "HEMATOPORPHYRIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0f99cba-20b5-435c-498f-33140a8d14bf"
          ],
          "display_name": false
        },
        {
          "uuid": "0d28154c-603c-494a-e4a3-85fde61114f0",
          "name": "Hemoporfin [WHO-DD]",
          "stdName": "HEMOPORFIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0f99cba-20b5-435c-498f-33140a8d14bf"
          ],
          "display_name": false
        },
        {
          "uuid": "1f9d651f-6eb6-47b7-89f8-c89b7465e3ae",
          "name": "NSC-267084",
          "stdName": "NSC-267084",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "fee15d6d-c4ad-467e-907d-bf3490ac38cb"
          ],
          "display_name": false
        },
        {
          "uuid": "769f73c2-ff0f-440b-9bca-9daab10a1473",
          "name": "NSC-59265",
          "stdName": "NSC-59265",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "fee15d6d-c4ad-467e-907d-bf3490ac38cb"
          ],
          "display_name": false
        },
        {
          "uuid": "174afe7b-c703-4fd0-9e51-0f2fc40835da",
          "name": "PHOTODYN",
          "stdName": "PHOTODYN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3627915-c04f-4c5c-af7e-81ed9942a636",
            "fee15d6d-c4ad-467e-907d-bf3490ac38cb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d6540624-7092-484c-bf24-301a2549c47c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b3627915-c04f-4c5c-af7e-81ed9942a636",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae4b0da7-b17e-4949-9e71-4f685f981977",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fee15d6d-c4ad-467e-907d-bf3490ac38cb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdfb1cfd-7bba-4b43-8996-34843c60eccd",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "004a2c93-d61a-4a3d-beff-8b5c90047081",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390900000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9788f0b8-2595-4bb0-a4c2-b26b2d71d8d2",
          "citation": "SRS import [HBT6M5H379]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HBT6M5H379",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390900000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0a84613-3a84-4cb2-bdcf-0955c84fa89b",
          "citation": "HEMATOPORPHYRIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "951958e7-5471-4d3a-96f4-0ebfe6423e59",
          "citation": "HEMATOPORPHYRIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d49b5775-aa9d-e353-69ad-fc1c09d769e1",
          "citation": "pubchem",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "efd7e7cf-509f-8fd8-6cc2-cb93c1319914",
          "citation": "who",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "0e2f59bc-fcb2-4f38-25da-5f136fa8449d",
          "citation": "pubchem",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "040e4303-b700-45cd-d107-3ff38c31488d",
          "citation": "who",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "2ec1bf38-6609-43f4-ad06-f727394406f2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "773e7b18-0e54-49ca-a95e-ef2e12681fcd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "df73721e-f65d-3a7b-b1f7-628fb3b1800e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "754f5b28-d2f1-d250-816a-11921c32fb8f",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "af62dc23-8c46-e47c-464c-1726e5944660",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c0f99cba-20b5-435c-498f-33140a8d14bf",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2c16d58d-7b30-b2d3-b687-a3280118cb2c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f84ee641-4396-48bf-b7c4-2c70bf96a044",
          "id": "f84ee641-4396-48bf-b7c4-2c70bf96a044",
          "molfile": "\n  Marvin  01132112522D          \n\n 44 48  0  0  0  0            999 V2000\n    3.5500   -0.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2667   -0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9792   -0.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2708   -1.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6833   -2.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8583   -2.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0458   -2.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6667   -3.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0542   -4.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8833   -4.4083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0083   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7458   -5.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4542   -5.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5917   -4.3916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4167   -4.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7917   -3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3750   -2.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6083   -2.6541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4542   -1.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7417   -1.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0083   -1.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8375   -2.6416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2125   -1.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2083   -0.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7792   -1.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6042   -1.9958    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.0125   -2.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0125   -1.2750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8083   -5.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6333   -4.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2500   -5.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2458   -6.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9583   -6.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6708   -6.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3833   -6.7958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6667   -5.5583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2458   -5.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2417   -6.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5250   -6.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8083   -6.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0917   -6.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8042   -5.5833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6792   -5.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8542   -5.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4 21  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 22  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 43  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 37  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 31  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 29 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 25  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 23 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 26 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 29  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 36 34  2  0  0  0  0\n 38 37  1  0  0  0  0\n 37 43  2  0  0  0  0\n 39 38  1  0  0  0  0\n 40 39  1  0  0  0  0\n 41 40  1  0  0  0  0\n 42 40  2  0  0  0  0\n 44 43  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(CCC(=O)O)c2cc3c(CCC(=O)O)c(C)c(cc4C(=C(C)c(cc5C(=C(C)c(cc1[nH]2)n5)C(C)O)n4)C(C)O)[nH]3",
          "formula": "C34H38N4O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ba9effd1-9658-4dac-92a5-8ae026b3f6e4"
          },
          "defined_stereo": 0,
          "ez_centers": 4,
          "molecular_weight": "598.69",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "277df8a1-814c-4f20-a029-dae6cb417893",
      "version": "19",
      "structure": {
        "id": "ef3d3513-e27b-4e98-84d6-42dbc478e0aa",
        "molfile": "\n  Marvin  01132112242D          \n\n 44 48  0  0  0  0            999 V2000\n    6.4542   -1.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0542   -4.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0083   -1.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4542   -5.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0458   -2.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4167   -4.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3750   -2.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0083   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6083   -2.6541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8833   -4.4083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2708   -1.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7792   -1.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8375   -2.6416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5917   -4.3916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2500   -5.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2458   -5.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7417   -1.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6667   -3.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2125   -1.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6833   -2.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7917   -3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7458   -5.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6792   -5.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8083   -5.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2458   -6.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2417   -6.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6708   -6.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8083   -6.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2667   -0.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6042   -1.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8042   -5.5833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6667   -5.5583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5250   -6.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9583   -6.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0917   -6.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3833   -6.7958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8583   -2.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2083   -0.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6333   -4.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8542   -5.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0125   -1.2750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9792   -0.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0125   -2.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5500   -0.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 18  2  0  0  0  0\n  3 17  1  0  0  0  0\n  4 14  1  0  0  0  0\n  5 13  1  0  0  0  0\n  6 21  2  0  0  0  0\n  7  9  2  0  0  0  0\n  8 22  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  3  2  0  0  0  0\n 12 19  2  0  0  0  0\n 13  3  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15 24  2  0  0  0  0\n 16 23  2  0  0  0  0\n 17  1  2  0  0  0  0\n 18  5  1  0  0  0  0\n 19  1  1  0  0  0  0\n 20 11  1  0  0  0  0\n 21  7  1  0  0  0  0\n 22  4  2  0  0  0  0\n 23  2  1  0  0  0  0\n 24  6  1  0  0  0  0\n 25 15  1  0  0  0  0\n 26 16  1  0  0  0  0\n 27 34  1  0  0  0  0\n 28 33  1  0  0  0  0\n 29 11  1  0  0  0  0\n 30 12  1  0  0  0  0\n 31 28  2  0  0  0  0\n 32 27  2  0  0  0  0\n 33 26  1  0  0  0  0\n 34 25  1  0  0  0  0\n 35 28  1  0  0  0  0\n 36 27  1  0  0  0  0\n 37 20  1  0  0  0  0\n 38 19  1  0  0  0  0\n 39 24  1  0  0  0  0\n 40 23  1  0  0  0  0\n 30 41  1  0  0  0  0\n 29 42  1  0  0  0  0\n 43 30  1  0  0  0  0\n 44 29  1  0  0  0  0\n  7 12  1  0  0  0  0\n  5 20  2  0  0  0  0\n  4 15  1  0  0  0  0\n 10  8  2  0  0  0  0\n  8 16  1  0  0  0  0\nM  END",
        "smiles": "CC1=C(CCC(=O)O)c2cc3c(CCC(=O)O)c(C)c(cc4C(=C(C)c(cc5c(c(C)c(cc1n2)[nH]5)C(C)O)n4)C(C)O)[nH]3",
        "formula": "C34H38N4O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 4,
        "molecular_weight": "598.69",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9788f0b8-2595-4bb0-a4c2-b26b2d71d8d2",
          "d6540624-7092-484c-bf24-301a2549c47c"
        ],
        "stereo_centers": 2
      },
      "unii": "HBT6M5H379"
    }
  ]
}