{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "14a85757-377b-4ce1-8284-e6e6c16d4304",
          "code": "N06BX13",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|idebenone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BX13&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "aa36a689-4b9e-4657-ad95-e9abef05c590",
          "code": "QN06BX13",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|idebenone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BX13&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "c4f2c031-3239-4863-ac14-0c6dc22b43da",
          "code": "58186-27-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58186-27-9",
          "code_system": "CAS",
          "references": [
            "81b23fb1-b47a-aa0c-6434-80eb4301a345",
            "b19379ad-9bad-402c-8c77-0aace160bf6d"
          ]
        },
        {
          "uuid": "9564f9c5-1e83-4ced-b87d-d6fd5f177511",
          "code": "C74158",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74158",
          "code_system": "NCI_THESAURUS",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "b48134ef-30a8-4de9-9f44-0c104f4256bf",
          "code": "C036619",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67036619",
          "code_system": "MESH",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "99bc9012-a1c3-483b-ac1f-ad2a09d76bb5",
          "code": "SUB08114MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "928bf998-27ed-46eb-9767-9a11eab91c38",
          "code": "5465",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5465",
          "code_system": "INN",
          "references": [
            "81b23fb1-b47a-aa0c-6434-80eb4301a345"
          ]
        },
        {
          "uuid": "93aa90a6-ee7a-4e49-a05c-bbd0220d8c67",
          "code": "SOVRIMA (REFUSED: FRIEDREICH ATAXIA)",
          "comments": "EMA EPAR|DISEASES|NERVOUS SYSTEM DISEASES|CENTRAL NERVOUS SYSTEM DISEASES|BRAIN DISEASES|CEREBELLAR DISEASES|SPINOCEREBELLAR DEGENERATIONS|FRIEDREICH ATAXIA",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000908/human_med_001060.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "50f7d1d1-0757-4a35-b2d4-4d98687ac5ee",
          "code": "51296",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/51296/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "5fee9fc8-8da4-459e-88ec-d8ba08ee3236",
          "code": "m6199",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6199?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "3cdc041e-58a1-4cfd-b883-67087e3fc7a4",
          "code": "DB09081",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09081",
          "code_system": "DRUG BANK",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "bb35d3d2-b52d-4bb8-9bc9-4498cec90af8",
          "code": "RAXONE (AUTHORIZED: OPTIC ATROPHY, HEREDITARY, LEBER)",
          "comments": "EMA EMPR|DISEASES|CONGENITAL, HEREDITARY, AND NEONATAL DISESES AND ABNORMALITIES|GENETIC DISEASES, INBORN|EYE DISEASES, HEREDITARY|OPTIC ATROPHIES, HEREDITARY|OPTIC ATROPHY, HEREDITARY, LEBER",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/003834/human_med_001900.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "a0d1a4bd-ac46-4eba-998b-a720f691ce75",
          "code": "CHEMBL252556",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL252556",
          "code_system": "ChEMBL",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "293eabd3-fec6-4295-bd6d-5b773283f282",
          "code": "3686",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3686",
          "code_system": "PUBCHEM",
          "references": [
            "00bd84e8-df01-404e-8bc1-d3d854ea88fc"
          ]
        },
        {
          "uuid": "0f4c28d0-dd65-3a1f-11c9-2ce7f71a72ea",
          "code": "Idebenone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Idebenone",
          "code_system": "WIKIPEDIA",
          "references": [
            "983f4846-6281-1bfe-1903-2b7f24b11318"
          ]
        },
        {
          "uuid": "ef0209d2-7f80-e0e3-b114-938a8cb8a54c",
          "code": "DTXSID0040678",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0040678",
          "code_system": "EPA CompTox",
          "references": [
            "dc380543-b0c2-d251-7222-563c5d2fa172"
          ]
        },
        {
          "uuid": "78d807f9-c840-edd7-385f-580c64026302",
          "code": "178303",
          "comments": "ORPHAN DRUG|Designated|Treatment of Friedreich's ataxia",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=178303",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "8076de0d-8b69-ad31-e619-72f148393564",
          "code": "231906",
          "comments": "ORPHAN DRUG|Designated|Treatment of Duchenne muscular dystrophy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=231906",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "28eff5c1-5726-a850-703c-37b498a0af7e",
          "code": "232006",
          "comments": "ORPHAN DRUG|Designated|Treatment of Leber's hereditary optic neuropathy.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=232006",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "961ed2f5-f7c8-d94d-2f48-6c2f36f0346d",
          "code": "C275",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C275",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c0231611-aa64-5194-2e2f-3b4407449c45"
          ]
        },
        {
          "uuid": "6fb9fd5e-e888-a2cf-ec73-1480b08ab2af",
          "code": "EU/3/07/434",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of Leber's hereditary optic neuropathy",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu307434",
          "code_system": "EU-Orphan Drug",
          "references": [
            "c0231611-aa64-5194-2e2f-3b4407449c45"
          ]
        },
        {
          "uuid": "a0c89959-f396-4955-815a-c0ddd9ddade0",
          "code": "HB6PN45W4J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "40b05735-cd59-dd8a-6d14-5c1e75547c51",
          "code": "1468 (Number of products:13)",
          "comments": "Dietary Supplement Label Database|Other|Idebenone",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1468&item=Idebenone",
          "code_system": "DSLD",
          "references": [
            "c0231611-aa64-5194-2e2f-3b4407449c45"
          ]
        },
        {
          "uuid": "e781fab0-acc9-82a3-7685-9d7bd43bded1",
          "code": "1416",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1416",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c0231611-aa64-5194-2e2f-3b4407449c45"
          ]
        },
        {
          "uuid": "2f7a6212-27c0-1247-41bb-05854142e843",
          "code": "31687",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31687",
          "code_system": "CHEBI",
          "references": [
            "c0231611-aa64-5194-2e2f-3b4407449c45"
          ]
        },
        {
          "uuid": "6ae34d61-8b87-4d79-fb1d-20d32342d95e",
          "code": "FG-11",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/FG-11/relevant/1/",
          "code_system": "USAN",
          "references": [
            "471ebde9-cb39-d1e8-1410-b8477cc73ef5"
          ]
        },
        {
          "uuid": "1d39d5fc-c643-e44c-fe57-ea2b77a38b97",
          "code": "100000092647",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d5126c98-9e48-7e98-ae56-2d793245c24f"
          ]
        },
        {
          "uuid": "34defb29-ab52-ebf7-56c7-02c514ebb7af",
          "code": "HB6PN45W4J",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=HB6PN45W4J",
          "code_system": "DAILYMED",
          "references": [
            "8159b014-0d24-f35d-f9ac-b41bcfc809c3"
          ]
        },
        {
          "uuid": "2d5c97a9-427c-06c8-0a8a-3cf628c00070",
          "code": "281909",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of mitochondrial myopathy, encephalopathy, lactic acidosis with stroke-like episodes syndrome (MELAS)",
          "codeText": "ORPHAN DRUG|Designated/Withdrawn|Treatment of mitochondrial myopathy, encephalopathy, lactic acidosis with stroke-like episodes syndrome (MELAS)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=281909",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "b7979b3d-1913-cee3-e358-df98cffb58f6",
          "code": "759228",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759228",
          "code_system": "NSC",
          "references": [
            "5eb9c530-9383-e241-f622-a82f7e193cb8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "44341980-9bd7-4cd7-97c7-2351742311c4",
          "type": "ACTIVE MOIETY",
          "references": [
            "81b23fb1-b47a-aa0c-6434-80eb4301a345"
          ],
          "related_substance": {
            "uuid": "470edfce-c7cd-44fd-8d9d-644c058ac540",
            "refuuid": "f5b28a0c-1fca-48f4-8c33-bc69cdebdb9f",
            "name": "IDEBENONE",
            "unii": "HB6PN45W4J",
            "linking_id": "HB6PN45W4J",
            "ref_pname": "IDEBENONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4dce849d-c5b5-2328-3ed6-d7b32e722e36",
          "name": "2,5-CYCLOHEXADIENE-1,4-DIONE, 2-(10-HYDROXYDECYL)-5,6-DIMETHOXY-3-METHYL-",
          "stdName": "2,5-CYCLOHEXADIENE-1,4-DIONE, 2-(10-HYDROXYDECYL)-5,6-DIMETHOXY-3-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81b23fb1-b47a-aa0c-6434-80eb4301a345"
          ],
          "display_name": false
        },
        {
          "uuid": "b2caa007-6a5d-48b0-bd5b-0d0f66c9f4d3",
          "name": "2-(10-HYDROXYDECYL)-5,6-DIMETHOXY-3-METHYL-P-BENZOQUINONE",
          "stdName": "2-(10-HYDROXYDECYL)-5,6-DIMETHOXY-3-METHYL-P-BENZOQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b48849f-d38e-44d7-9910-08d5a0169ef7"
          ],
          "display_name": false
        },
        {
          "uuid": "0ab19f1b-bf79-8915-6e75-81a061d66322",
          "name": "2-(10-Hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione",
          "stdName": "2-(10-HYDROXYDECYL)-5,6-DIMETHOXY-3-METHYLCYCLOHEXA-2,5-DIENE-1,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81b23fb1-b47a-aa0c-6434-80eb4301a345"
          ],
          "display_name": false
        },
        {
          "uuid": "6d1bc282-0603-4d78-a694-6994482e2808",
          "name": "HYDROXYDECYL UBIQUINONE",
          "stdName": "HYDROXYDECYL UBIQUINONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "d722ef2b-dc2f-4114-b790-ad45b4b10c81",
            "01827bf0-6ec5-49ff-89b4-8c668e1119ca",
            "2b8644ea-7b69-4364-a52c-6cac04f1b53b"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "df306ae1-012b-4de0-9a30-b67ef2423cbc",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "854dc2ed-a7ef-4d00-a4b1-38b6369f9900",
          "name": "IDEBENONE",
          "stdName": "IDEBENONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81b23fb1-b47a-aa0c-6434-80eb4301a345",
            "6b48849f-d38e-44d7-9910-08d5a0169ef7",
            "ef6329b9-f703-4f8e-b8e1-f426039b39f2",
            "5457906f-7e99-4033-94f8-f1c691d68cad",
            "bb4a0b94-963e-4c0f-af11-09141b47e39f",
            "f3115515-e2b8-49b4-977b-157670ae4281",
            "35045ad1-9558-44b3-85e2-7b3a785ced8a",
            "38941df6-5a9a-4bc5-aba1-8f91df461470",
            "f8d7769c-f3b5-49e2-9a05-08a9bd80decf",
            "dbe6efce-c6ea-43d9-86d3-59a1cf2b5dc6",
            "cd0b8b3a-1895-47ec-bb3a-4258fe06747d",
            "19d16e22-499e-4512-8932-e74ed852a2ab",
            "185f746a-710c-45f8-9f25-7cd562ab4455"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "0d29d685-3eab-4261-991c-6669c28fe53d",
              "name_org": "INN"
            },
            {
              "uuid": "7e941baf-2661-421c-becc-958573e45144",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "7c7fb49c-f20e-4426-9b50-1c4580cd67b5",
          "name": "IDEBENONE [EMA EPAR]",
          "stdName": "IDEBENONE [EMA EPAR]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35045ad1-9558-44b3-85e2-7b3a785ced8a"
          ],
          "display_name": false
        },
        {
          "uuid": "fefd347a-0f18-450a-9d7f-e4f77b4cee33",
          "name": "IDEBENONE [JAN]",
          "stdName": "IDEBENONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5457906f-7e99-4033-94f8-f1c691d68cad"
          ],
          "display_name": false
        },
        {
          "uuid": "97ed846a-3246-452e-8117-e89ee45d407f",
          "name": "IDEBENONE [MART.]",
          "stdName": "IDEBENONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb4a0b94-963e-4c0f-af11-09141b47e39f"
          ],
          "display_name": false
        },
        {
          "uuid": "3a4b390a-1ffd-4505-831e-46e0db071960",
          "name": "IDEBENONE [MI]",
          "stdName": "IDEBENONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3115515-e2b8-49b4-977b-157670ae4281"
          ],
          "display_name": false
        },
        {
          "uuid": "70019d40-f243-2551-ecf0-033f101442bf",
          "name": "IDEBENONE [USAN]",
          "stdName": "IDEBENONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81b23fb1-b47a-aa0c-6434-80eb4301a345"
          ],
          "display_name": false
        },
        {
          "uuid": "a1c103b1-3317-3f8e-562b-440840032e2e",
          "name": "Idebenone [WHO-DD]",
          "stdName": "IDEBENONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c96ce540-2f44-817b-8567-a049b1d924c8"
          ],
          "display_name": false
        },
        {
          "uuid": "d75dcde0-5d28-3d48-bc20-bad763de98cf",
          "name": "NSC-759228",
          "stdName": "NSC-759228",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5eb9c530-9383-e241-f622-a82f7e193cb8"
          ],
          "display_name": false
        },
        {
          "uuid": "d572fbd7-42da-469b-adb7-c99da7bd1d10",
          "name": "ORISTAR HDU",
          "stdName": "ORISTAR HDU",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d722ef2b-dc2f-4114-b790-ad45b4b10c81"
          ],
          "display_name": false
        },
        {
          "uuid": "2111849a-d82a-493d-862c-c3db519da0ce",
          "name": "SOVRIMA",
          "stdName": "SOVRIMA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31af2546-74f8-47e3-ba6d-a2015e8fbcbe"
          ],
          "display_name": false
        },
        {
          "uuid": "1c98258d-4c7f-493a-a7cf-a136a41625c0",
          "name": "idebenone [INN]",
          "stdName": "IDEBENONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef6329b9-f703-4f8e-b8e1-f426039b39f2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6b48849f-d38e-44d7-9910-08d5a0169ef7",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ef6329b9-f703-4f8e-b8e1-f426039b39f2",
          "citation": "INN Proposed List 50",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL50.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5457906f-7e99-4033-94f8-f1c691d68cad",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb4a0b94-963e-4c0f-af11-09141b47e39f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3115515-e2b8-49b4-977b-157670ae4281",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35045ad1-9558-44b3-85e2-7b3a785ced8a",
          "citation": "EMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d722ef2b-dc2f-4114-b790-ad45b4b10c81",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38941df6-5a9a-4bc5-aba1-8f91df461470",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01827bf0-6ec5-49ff-89b4-8c668e1119ca",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31af2546-74f8-47e3-ba6d-a2015e8fbcbe",
          "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000908/human_med_001060.",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000908/human_med_001060.",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00bd84e8-df01-404e-8bc1-d3d854ea88fc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390167000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b215fb4-0e90-49d1-880e-a8cb664733fe",
          "citation": "SRS import [HB6PN45W4J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HB6PN45W4J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390167000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8d7769c-f3b5-49e2-9a05-08a9bd80decf",
          "citation": "IDEBENONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dbe6efce-c6ea-43d9-86d3-59a1cf2b5dc6",
          "citation": "IDEBENONE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd0b8b3a-1895-47ec-bb3a-4258fe06747d",
          "citation": "IDEBENONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "19d16e22-499e-4512-8932-e74ed852a2ab",
          "citation": "IDEBENONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "185f746a-710c-45f8-9f25-7cd562ab4455",
          "citation": "IDEBENONE [EMA EPAR]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b8644ea-7b69-4364-a52c-6cac04f1b53b",
          "citation": "HYDROXYDECYL UBIQUINONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "11b1f251-9857-44dd-8223-9c20f8c8748d",
          "citation": "IDEBENONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "983f4846-6281-1bfe-1903-2b7f24b11318",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Idebenone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dc380543-b0c2-d251-7222-563c5d2fa172",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58186-27-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "81b23fb1-b47a-aa0c-6434-80eb4301a345",
          "citation": "USAN COUN DEC 2017",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "c0231611-aa64-5194-2e2f-3b4407449c45",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b19379ad-9bad-402c-8c77-0aace160bf6d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "471ebde9-cb39-d1e8-1410-b8477cc73ef5",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "5eb9c530-9383-e241-f622-a82f7e193cb8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c96ce540-2f44-817b-8567-a049b1d924c8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8159b014-0d24-f35d-f9ac-b41bcfc809c3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d5126c98-9e48-7e98-ae56-2d793245c24f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f32d4e4f-e082-4389-8068-59fa0d6977b4",
          "id": "f32d4e4f-e082-4389-8068-59fa0d6977b4",
          "molfile": "\n  Marvin  01132112372D          \n\n 24 24  0  0  0  0            999 V2000\n    0.0000   -1.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7155   -0.8240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4567   -1.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4438   -2.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7155   -2.4512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7155   -3.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1412   -2.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1412   -3.2778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8619   -2.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5799   -2.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2877   -2.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0161   -2.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7134   -2.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4186   -2.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1367   -2.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8675   -2.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5728   -2.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2934   -2.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9985   -2.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7191   -2.4202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8619   -1.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5799   -0.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1309   -0.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1309    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n 23  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 21  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  1  0  0  0  0\n 24 23  2  0  0  0  0\nM  END",
          "smiles": "CC1=C(CCCCCCCCCCO)C(=O)C(=C(C1=O)OC)OC",
          "formula": "C19H30O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "87d6e0af-fcba-47cb-be9e-a05126c0f2d9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "338.4392",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f5b28a0c-1fca-48f4-8c33-bc69cdebdb9f",
      "version": "35",
      "structure": {
        "id": "214cb5da-119c-4ae6-a809-1b164c415d32",
        "molfile": "\n  Marvin  01132101532D          \n\n 24 24  0  0  0  0            999 V2000\n   11.3641   -3.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3512   -4.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0382   -3.2408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0486   -4.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7692   -3.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7692   -4.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0486   -5.7047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0382   -2.4272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6229   -3.2511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6229   -4.8783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4872   -4.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4872   -3.2408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6260   -4.8473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6229   -5.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9074   -3.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9054   -4.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1949   -4.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2003   -4.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9232   -4.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6205   -4.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3256   -4.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0436   -4.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7746   -4.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4797   -4.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  4  2  0  0  0  0\n  8  3  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15  9  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18 24  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n  6  4  1  0  0  0  0\nM  END",
        "smiles": "CC1=C(CCCCCCCCCCO)C(=O)C(=C(C1=O)OC)OC",
        "formula": "C19H30O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "338.4392",
        "optical_activity": "NONE",
        "references": [
          "81b23fb1-b47a-aa0c-6434-80eb4301a345",
          "6b48849f-d38e-44d7-9910-08d5a0169ef7",
          "ef6329b9-f703-4f8e-b8e1-f426039b39f2"
        ],
        "stereo_centers": 0
      },
      "unii": "HB6PN45W4J"
    }
  ]
}