{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "03fa9fd5-b1e9-45c2-9240-4773dd8cf038",
          "code": "158069-88-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=158069-88-6",
          "code_system": "CAS",
          "references": [
            "13b682cc-8b5a-4bf6-a932-24ea39355e11",
            "0fbc3b8f-4d2e-4879-86e0-a6b2defd2e60"
          ]
        },
        {
          "uuid": "40313830-1309-4647-b1c1-e681a6456b64",
          "code": "46829552",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/46829552",
          "code_system": "PUBCHEM",
          "references": [
            "13b682cc-8b5a-4bf6-a932-24ea39355e11"
          ]
        },
        {
          "uuid": "c9029c97-f40e-5a50-20e3-e5f63e58b0e2",
          "code": "DTXSID50166367",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50166367",
          "code_system": "EPA CompTox",
          "references": [
            "80337621-c2a2-126b-91f6-e3f9c4791d6e"
          ]
        },
        {
          "uuid": "fa91250e-aefc-4b9b-a87d-0d2baec59940",
          "code": "H9UT0KZO8S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e3f4935a-fedf-4a25-8612-bbf7b8dd0348",
          "name": "BIS-ISOPROPYLACETOMETHYL BENZATHINE",
          "stdName": "BIS-ISOPROPYLACETOMETHYL BENZATHINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a64fa75d-1758-4222-94a1-eace4b8ee883",
            "02cb33df-5604-479c-9374-a69fdff481a8",
            "b00aec73-c997-43df-96c5-22d24c875202"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7a68b04d-c183-4fac-9a6b-1981a9e391c0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "41fbca85-2b85-4b91-9d22-ae7236a808f2",
          "name": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(PHENYLMETHYL)-, 1,1'-BIS(1-METHYLETHYL) ESTER",
          "stdName": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(PHENYLMETHYL)-, 1,1'-BIS(1-METHYLETHYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a64fa75d-1758-4222-94a1-eace4b8ee883",
            "b0338cc7-cc49-4cc9-8104-dfe8018d78a5"
          ],
          "display_name": false
        },
        {
          "uuid": "f49c9ca9-aff8-45f7-ab99-faa4df65f0ff",
          "name": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(PHENYLMETHYL)-, BIS(1-METHYLETHYL) ESTER",
          "stdName": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(PHENYLMETHYL)-, BIS(1-METHYLETHYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a64fa75d-1758-4222-94a1-eace4b8ee883",
            "b0338cc7-cc49-4cc9-8104-dfe8018d78a5"
          ],
          "display_name": false
        },
        {
          "uuid": "eda72b36-ae28-435c-96f0-72513b88f095",
          "name": "MEXORYL SBR",
          "stdName": "MEXORYL SBR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a64fa75d-1758-4222-94a1-eace4b8ee883",
            "02cb33df-5604-479c-9374-a69fdff481a8"
          ],
          "display_name": false
        },
        {
          "uuid": "077cc389-fe6c-4b23-9d69-6f21d8360727",
          "name": "SIDEROXYL",
          "stdName": "SIDEROXYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a64fa75d-1758-4222-94a1-eace4b8ee883",
            "b0338cc7-cc49-4cc9-8104-dfe8018d78a5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "02cb33df-5604-479c-9374-a69fdff481a8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a64fa75d-1758-4222-94a1-eace4b8ee883",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0338cc7-cc49-4cc9-8104-dfe8018d78a5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13b682cc-8b5a-4bf6-a932-24ea39355e11",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391413000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "090b963c-1b3c-45b5-8784-b12be2dfb24e",
          "citation": "SRS import [H9UT0KZO8S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H9UT0KZO8S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391413000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b00aec73-c997-43df-96c5-22d24c875202",
          "citation": "BIS-ISOPROPYLACETOMETHYL BENZATHINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "80337621-c2a2-126b-91f6-e3f9c4791d6e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=158069-88-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0fbc3b8f-4d2e-4879-86e0-a6b2defd2e60",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f3d9d5db-5a4f-43b6-a24d-86a9321ad9f3",
          "id": "f3d9d5db-5a4f-43b6-a24d-86a9321ad9f3",
          "molfile": "\n  Marvin  01132112392D          \n\n 32 33  0  0  0  0            999 V2000\n    1.2060   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9205   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9205   -2.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6350   -3.9018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3494   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3494   -2.6643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0639   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7784   -3.4893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9218   -3.9018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6362   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3507   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3507   -4.7268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0652   -3.4893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7796   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4941   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7796   -4.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9218   -4.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -5.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -4.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7784   -5.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7784   -5.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -6.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -5.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7784   -2.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -2.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -2.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9218   -2.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9218   -1.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -1.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4929   -1.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 26  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 25  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  1  0  0  0  0\n 27 32  2  0  0  0  0\n 29 28  2  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  2  0  0  0  0\n 32 31  1  0  0  0  0\nM  END",
          "smiles": "CC(C)OC(=O)CN(CCN(Cc1ccccc1)CC(=O)OC(C)C)Cc2ccccc2",
          "formula": "C26H36N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "68bceea9-e7a0-4bbf-bdf7-defc17683120"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "440.576",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "46e3c703-bfb9-4d2a-8fdc-b18c70d1685d",
      "version": "4",
      "structure": {
        "id": "92b2e05d-b3fb-434a-9a39-5e33dc9f4d73",
        "molfile": "\n  Marvin  01132107362D          \n\n 32 33  0  0  0  0            999 V2000\n    1.2060   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9205   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6350   -3.9018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3494   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0639   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7784   -3.4893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9218   -3.9018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6362   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3507   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0652   -3.4893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7796   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4941   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9205   -2.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7784   -2.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9218   -4.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7796   -4.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3494   -2.6643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3507   -4.7268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -2.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -5.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -2.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9218   -2.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9218   -1.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -1.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4929   -1.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -4.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7784   -5.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7784   -5.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -6.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2073   -5.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  2 15  1  0  0  0  0\n  6 16  1  0  0  0  0\n  9 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n  4 19  2  0  0  0  0\n 11 20  2  0  0  0  0\n 16 21  1  0  0  0  0\n 17 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\n 23 21  2  0  0  0  0\n 21 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  2  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  2  0  0  0  0\n 28 22  2  0  0  0  0\n 22 32  1  0  0  0  0\nM  END",
        "smiles": "CC(C)OC(=O)CN(CCN(Cc1ccccc1)CC(=O)OC(C)C)Cc2ccccc2",
        "formula": "C26H36N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "440.576",
        "optical_activity": "NONE",
        "references": [
          "090b963c-1b3c-45b5-8784-b12be2dfb24e",
          "b0338cc7-cc49-4cc9-8104-dfe8018d78a5"
        ],
        "stereo_centers": 0
      },
      "unii": "H9UT0KZO8S"
    }
  ]
}