{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "29cdbc5c-3001-4057-a8e5-72bd9d1ed34f", "code": "1036207-61-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1036207-61-0", "code_system": "CAS", "references": [ "31e20fad-a2b8-bb27-22da-bb38ca8a74df", "5877bc3d-eb9c-4686-47e6-2753e472a2d7" ] }, { "uuid": "17b1f18d-e72d-b84c-dc8a-00f3f40398bf", "code": "25001762", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25001762", "code_system": "PUBCHEM", "references": [ "860c3af7-9015-bb93-12bf-13e00714127f" ] }, { "uuid": "683193dd-0e9e-4c9d-9ef6-207bde11c370", "code": "H9G9QJT7E2", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "387cbe1e-f95a-4a99-8807-a5bb8e252385", "amount": { "uuid": "14f63a87-fdac-4c0b-b26d-d48ea0b2dc7e" }, "type": "SUBSTANCE->SUB_ALTERNATE", "related_substance": { "uuid": "b382a739-6899-4632-9924-4a3b584ace88", "refuuid": "bbaaf855-c455-4229-8311-809443fc3cad", "name": "ALTERNATIVE DEFINITION for [Tetrapeptide-30]", "linking_id": "bbaaf855-c455-4229-8311-809443fc3cad", "ref_pname": "NO NAME" } }, { "uuid": "bc936f0f-bef3-4058-a18f-feda8af91800", "amount": { "uuid": "0c28fcdf-03d1-4d79-89d2-6150047435d0" }, "type": "TARGET->INHIBITOR OF EXPRESSION", "references": [ "7b2d9f8b-2fd2-426c-9ca7-e9b51fd835ba" ], "related_substance": { "uuid": "77a5cdbc-cdd5-4f4b-91ae-fd0cbf90f45e", "refuuid": "c8e7ead5-cfcb-4d4a-a327-938877c82bda", "name": "TYROSINASE", "unii": "G2UX40NTG9", "linking_id": "G2UX40NTG9", "ref_pname": "TYROSINASE", "substance_class": "reference" } }, { "uuid": "b84cfa4d-e20d-4489-8f49-511e0a56667b", "amount": { "uuid": "fc62ca9d-48c5-46ec-aec5-a0051ffd1b2f" }, "type": "SALT/SOLVATE->PARENT", "references": [ "95fc0326-919d-4a8e-82bb-0f73b514c541" ], "related_substance": { "uuid": "539e5f7c-ddf7-4333-97ed-dcc59ca52ce6", "refuuid": "a23c5f94-42fd-4e7d-a52c-32871281f14f", "name": "Tetrapeptide-30 triacetate", "unii": "LUQ6M3WS3R", "linking_id": "LUQ6M3WS3R", "ref_pname": "Tetrapeptide-30 triacetate", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "aae91c5d-9d5b-ab87-deed-78df6dac2834", "name": "L-Lysine, L-prolyl-L-lysyl-L-α-glutamyl-", "stdName": "L-LYSINE, L-PROLYL-L-LYSYL-L-.ALPHA.-GLUTAMYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5877bc3d-eb9c-4686-47e6-2753e472a2d7" ], "display_name": false }, { "uuid": "22a6c09c-d0c6-79b2-a7d4-f2d6b5884e0d", "name": "L-Prolyl-L-lysyl-L-α-glutamyl-L-lysine", "stdName": "L-PROLYL-L-LYSYL-L-.ALPHA.-GLUTAMYL-L-LYSINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5877bc3d-eb9c-4686-47e6-2753e472a2d7" ], "display_name": false }, { "uuid": "72b5e087-f558-1c06-4033-3477f76c6f9d", "name": "PRO-LYS-GLU-LYS", "stdName": "PRO-LYS-GLU-LYS", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "172571cf-2d8c-dc54-89ee-b41b54012fa9" ], "display_name": false }, { "uuid": "450e12fb-1719-1204-66c4-6344db1114b7", "name": "Tetrapeptide-30", "stdName": "TETRAPEPTIDE-30", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "31e20fad-a2b8-bb27-22da-bb38ca8a74df" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "5089c1ae-76c4-4763-9574-90197ab1cef0", "name_org": "INCI" } ] } ], "references": [ { "uuid": "172571cf-2d8c-dc54-89ee-b41b54012fa9", "citation": "https://www.ncbi.nlm.nih.gov/pubmed/21896134", "doc_type": "JA", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "31e20fad-a2b8-bb27-22da-bb38ca8a74df", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5877bc3d-eb9c-4686-47e6-2753e472a2d7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7b2d9f8b-2fd2-426c-9ca7-e9b51fd835ba", "citation": "Mentel, M., et al. \"Innovative peptide technologies for even, young and healthy looking skin.\" SOFW Journal-Seifen Ole Fette Wachse 138.3 (2012): 22.", "url": "https://personal-care.evonik.com/product/personal-care/downloads/public/2012_03_pub_evonik_peptides_innovative_peptide_technologies_sofw.pdf", "doc_type": "JA", "public_domain": true }, { "uuid": "860c3af7-9015-bb93-12bf-13e00714127f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "95fc0326-919d-4a8e-82bb-0f73b514c541", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5a22a56b-7f2c-ae47-8de5-081a07577607", "id": "5a22a56b-7f2c-ae47-8de5-081a07577607", "molfile": "\n Marvin 01132104402D \n\n 35 35 0 0 1 0 999 V2000\n 12.7002 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7002 -3.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9858 -4.6887 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.8995 -5.5092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0926 -5.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6800 -4.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2321 -4.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4147 -4.6887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1292 -4.2762 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.8437 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8437 -5.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5581 -4.2762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2726 -4.6887 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.9871 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9870 -3.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7015 -4.6887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4160 -4.2762 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 19.1305 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1305 -5.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8450 -4.2762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4160 -3.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1304 -3.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1304 -2.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8450 -1.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8450 -0.9762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2726 -5.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9871 -5.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9871 -6.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2726 -7.1637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7015 -7.1637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1292 -3.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4147 -3.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4147 -2.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7002 -1.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7002 -0.9762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 3 1 1 1 0 0 0\n 1 8 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 31 1 1 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 26 1 6 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 21 1 1 0 0 0\n 18 19 2 0 0 0 0\n 20 18 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\nM END", "smiles": "C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@@H]1CCCN1", "formula": "C22H40N6O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fd5b57e7-d80b-424b-b9d6-8ddcab072a97" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "500.5899", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "6614feb5-67ee-4d74-86a4-e1a2b1759905", "version": "12", "structure": { "id": "9c90607d-ed7c-058e-7cfd-cf3fe2c89060", "molfile": "chem1.mol\n Marvin 01132108082D \n\n 35 35 0 0 1 0 999 V2000\n 12.7002 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7002 -3.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9858 -4.6887 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.8995 -5.5092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0926 -5.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6800 -4.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2321 -4.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4147 -4.6887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1292 -4.2762 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.8437 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8437 -5.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5581 -4.2762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2726 -4.6887 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.9871 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9870 -3.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7015 -4.6887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4160 -4.2762 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 19.1305 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1305 -5.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8450 -4.2762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4160 -3.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1304 -3.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1304 -2.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8450 -1.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8450 -0.9762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2726 -5.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9871 -5.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9871 -6.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2726 -7.1637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7015 -7.1637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1292 -3.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4147 -3.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4147 -2.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7002 -1.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7002 -0.9762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 3 1 1 1 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 1 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 20 18 1 0 0 0 0\n 17 21 1 1 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 13 26 1 6 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 9 31 1 1 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\nM END", "smiles": "C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@@H]1CCCN1", "formula": "C22H40N6O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "500.5899", "optical_activity": "UNSPECIFIED", "references": [ "31e20fad-a2b8-bb27-22da-bb38ca8a74df", "5877bc3d-eb9c-4686-47e6-2753e472a2d7" ], "stereo_centers": 4 }, "unii": "H9G9QJT7E2" } ] }