{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "46f0f408-da4f-4605-91fe-2287d3aa3bd9",
          "code": "N05BB02",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANXIOLYTICS|Diphenylmethane derivatives|captodiame",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05BB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "51b76908-91ac-4956-8411-e97eba21c843",
          "code": "486-17-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=486-17-9",
          "code_system": "CAS",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12",
            "3c4aceb4-8249-461f-bdcd-ecd42e9be9a3"
          ]
        },
        {
          "uuid": "139c482d-58b9-4baa-adda-589e587fd7b3",
          "code": "C81137",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81137",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "49d1b55b-81a4-4d49-ab8f-60e8bc63d584",
          "code": "C495502",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67495502",
          "code_system": "MESH",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "d984863f-4412-4f76-92da-203923f91aa0",
          "code": "CAPTODIAME",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Captodiame",
          "code_system": "WIKIPEDIA",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "1be2a5ff-aa69-431e-8e99-03a349ef77b2",
          "code": "QN05BB02",
          "comments": "VATC|PSYCHOLEPTICS|ANXIOLYTICS|Diphenylmethane derivatives|captodiame",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05BB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "d1c6e9d4-edff-4d31-bc09-db131535b638",
          "code": "SUB06080MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "a2d2f48b-7df7-46ce-9006-6deb97346e88",
          "code": "625",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=625",
          "code_system": "INN",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "65a661cd-4d7c-4203-8943-7601ffbc0eb7",
          "code": "207-629-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.936",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "aa6189c0-53cf-4fe8-8c4b-7d2acac570de",
          "code": "89812",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/89812/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "580acea6-7943-4575-aeb9-b3c5c2422093",
          "code": "m3045",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3045?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "82914d59-76f6-4d44-b3a0-79165ea50bda",
          "code": "DB09014",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09014",
          "code_system": "DRUG BANK",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "977052a7-d0bf-4793-b2d7-42b60a4d4725",
          "code": "CHEMBL2110809",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110809",
          "code_system": "ChEMBL",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "e5b20557-0bc6-4443-867e-6ef60355c93e",
          "code": "10240",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10240",
          "code_system": "PUBCHEM",
          "references": [
            "e4f439de-6e07-42dc-a6ba-1d81ec65be12"
          ]
        },
        {
          "uuid": "9c173857-8e1a-d589-3627-eddbf31a322a",
          "code": "C29578",
          "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bf4c4fb5-1794-103f-6771-bf5fa59a4d0c"
          ]
        },
        {
          "uuid": "286253a4-6286-6c8d-d4a8-5297a55f8ec0",
          "code": "C28197",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28197",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bf4c4fb5-1794-103f-6771-bf5fa59a4d0c"
          ]
        },
        {
          "uuid": "e927ecc0-e48d-45a7-b061-9c20e072e585",
          "code": "H93K9455DD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8f7d8bfc-276a-6048-7cbe-eea5034f98cf",
          "code": "483",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/483",
          "code_system": "DRUG CENTRAL",
          "references": [
            "bf4c4fb5-1794-103f-6771-bf5fa59a4d0c"
          ]
        },
        {
          "uuid": "16ea4447-6602-3940-4498-ec705c9298c0",
          "code": "100000081625",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "23edb240-8cd4-3793-659d-bfe763a953b5"
          ]
        },
        {
          "uuid": "cfabb412-014d-a909-b620-73918a99591d",
          "code": "DTXSID50862014",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50862014",
          "code_system": "EPA CompTox",
          "references": [
            "bf4c4fb5-1794-103f-6771-bf5fa59a4d0c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "449b61c3-17cd-410a-92dd-d0a35815c6e6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5a4c1c59-0a50-43a6-b364-ebf0eee2227c",
            "refuuid": "94216e53-9ef9-4ec1-b1d6-9b0e7d762cb7",
            "name": "CAPTODIAME",
            "unii": "H93K9455DD",
            "linking_id": "H93K9455DD",
            "ref_pname": "CAPTODIAME",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "836f344c-e49a-4f27-bd5e-d2026826a46a",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "af575d44-fa1f-436d-a572-9baca2cc969f",
            "refuuid": "a4e0753f-c9fc-4940-bce6-a4a73690b8d0",
            "name": "CAPTODIAME HYDROCHLORIDE",
            "unii": "9I7N9PR9J2",
            "linking_id": "9I7N9PR9J2",
            "ref_pname": "CAPTODIAME HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "14d8a913-33ec-44bd-8e72-9d427eedb570",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "ec83a4ec-5062-46cf-9c76-2331d654a4c4",
            "refuuid": "0166680b-a2e2-4149-b778-c1619e9cf8c7",
            "name": "CAPTODIAME, (R)-",
            "unii": "GW65E1W110",
            "linking_id": "GW65E1W110",
            "ref_pname": "CAPTODIAME, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e8a967b6-3c09-428f-9135-e5ec254cd214",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "9788edc0-7dbf-4c83-b0ee-5fc509dadcbd",
            "refuuid": "3d6866d5-4b54-409f-9d4c-350a89e40853",
            "name": "CAPTODIAME, (S)-",
            "unii": "A6VHZ79D4O",
            "linking_id": "A6VHZ79D4O",
            "ref_pname": "CAPTODIAME, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a8fb62f1-17bc-4ef9-ab80-841560da853a",
          "name": "2-(P-(BUTYLTHIO)-.ALPHA.-PHENYLBENZYLTHIO)-N,N-DIMETHYLETHYLAMINE",
          "stdName": "2-(P-(BUTYLTHIO)-.ALPHA.-PHENYLBENZYLTHIO)-N,N-DIMETHYLETHYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a15ad1b1-7538-4d93-89e6-6a29908341f8"
          ],
          "display_name": false
        },
        {
          "uuid": "872f2129-32fa-4121-aa33-4b2e73d0c50a",
          "name": "BUTYLTHIODIPHENYLMETHYL 2-DIMETHYLAMINOETHYL SULFIDE",
          "stdName": "BUTYLTHIODIPHENYLMETHYL 2-DIMETHYLAMINOETHYL SULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "510a3a13-c6de-491d-a834-cfeb1cd4c07b",
            "fdff24ba-cd9d-4d07-9da7-9694ee9160f1"
          ],
          "display_name": false
        },
        {
          "uuid": "2d681bdb-9e3c-4787-bcdf-4303c86ce1ef",
          "name": "CAPTODIAME",
          "stdName": "CAPTODIAME",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "340b2fbb-4edc-49d0-a1de-ac076179810e",
            "ba6b3992-2b3d-4eac-9f6e-8176911095b2",
            "fdff24ba-cd9d-4d07-9da7-9694ee9160f1",
            "a15ad1b1-7538-4d93-89e6-6a29908341f8",
            "87e363c5-0b59-4496-a5e2-e237a4c1197c",
            "de16df46-808a-42e6-ac3a-c467786e8ba2"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "19f9e22b-bc4b-49e8-bc4e-da2306e68a23",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "80dd393b-d491-4086-94bd-01e82f4d48eb",
          "name": "CAPTODIAMINE",
          "stdName": "CAPTODIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f7cd67b-0080-43c0-9e8a-858519665c91",
            "80361f7c-76b6-49b6-b0f0-8ee6868a1635",
            "fdff24ba-cd9d-4d07-9da7-9694ee9160f1",
            "a15ad1b1-7538-4d93-89e6-6a29908341f8"
          ],
          "display_name": false
        },
        {
          "uuid": "3c6f0488-f92c-478a-8a15-e1f6928ee720",
          "name": "CAPTODIAMINE [MI]",
          "stdName": "CAPTODIAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80361f7c-76b6-49b6-b0f0-8ee6868a1635",
            "fdff24ba-cd9d-4d07-9da7-9694ee9160f1"
          ],
          "display_name": false
        },
        {
          "uuid": "54064dff-1417-5675-7fac-b4cb1af28792",
          "name": "Captodiame [WHO-DD]",
          "stdName": "CAPTODIAME [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d16af753-753c-7d1f-7e34-a172cd6b88fb"
          ],
          "display_name": false
        },
        {
          "uuid": "3bb11210-1dee-40aa-9e42-c071a3caa443",
          "name": "ETHYLAMINE, 2-((P-(BUTYLTHIO)-.ALPHA.-PHENYLBENZYL)THIO)-N,N-DIMETHYL-",
          "stdName": "ETHYLAMINE, 2-((P-(BUTYLTHIO)-.ALPHA.-PHENYLBENZYL)THIO)-N,N-DIMETHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d179bf7a-2bbf-45ac-a73c-2071359fef44",
            "eb56cf82-e589-4f89-92fe-1085292076c3"
          ],
          "display_name": false
        },
        {
          "uuid": "ae3165ab-93b3-4338-8a93-714c3a262a6d",
          "name": "P-BUTYLTHIODIPHENYLMETHYL 2-DIMETHYLAMINOETHYL SULFIDE",
          "stdName": "P-BUTYLTHIODIPHENYLMETHYL 2-DIMETHYLAMINOETHYL SULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d179bf7a-2bbf-45ac-a73c-2071359fef44",
            "eb56cf82-e589-4f89-92fe-1085292076c3"
          ],
          "display_name": false
        },
        {
          "uuid": "6d12b653-4b25-4f08-9df3-b3461a6c3045",
          "name": "P-BUTYLTHIODIPHENYLMETHYL 2-DIMETHYLAMINOETHYL SULPHIDE",
          "stdName": "P-BUTYLTHIODIPHENYLMETHYL 2-DIMETHYLAMINOETHYL SULPHIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67b2bdae-898b-4838-91fa-d4b7a1ae4b00"
          ],
          "display_name": false
        },
        {
          "uuid": "c47d072c-4e56-4316-ad98-3e7c18deb5c1",
          "name": "captodiame [INN]",
          "stdName": "CAPTODIAME [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba6b3992-2b3d-4eac-9f6e-8176911095b2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a15ad1b1-7538-4d93-89e6-6a29908341f8",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eb56cf82-e589-4f89-92fe-1085292076c3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d179bf7a-2bbf-45ac-a73c-2071359fef44",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67b2bdae-898b-4838-91fa-d4b7a1ae4b00",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba6b3992-2b3d-4eac-9f6e-8176911095b2",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "80361f7c-76b6-49b6-b0f0-8ee6868a1635",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdff24ba-cd9d-4d07-9da7-9694ee9160f1",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "510a3a13-c6de-491d-a834-cfeb1cd4c07b",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87e363c5-0b59-4496-a5e2-e237a4c1197c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4f439de-6e07-42dc-a6ba-1d81ec65be12",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7c9fbd2-963b-4e52-b10e-4f90920fc75b",
          "citation": "SRS import [H93K9455DD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H93K9455DD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c72badca-5ac8-4770-a954-2b5588d09b61",
          "citation": "USP DICTIONARY 2008; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de16df46-808a-42e6-ac3a-c467786e8ba2",
          "citation": "CAPTODIAME [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f7cd67b-0080-43c0-9e8a-858519665c91",
          "citation": "CAPTODIAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "340b2fbb-4edc-49d0-a1de-ac076179810e",
          "citation": "CAPTODIAME [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bf4c4fb5-1794-103f-6771-bf5fa59a4d0c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3c4aceb4-8249-461f-bdcd-ecd42e9be9a3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d16af753-753c-7d1f-7e34-a172cd6b88fb",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "23edb240-8cd4-3793-659d-bfe763a953b5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "df0125e1-99ab-45e2-b22b-ae1fc736df4b",
          "id": "df0125e1-99ab-45e2-b22b-ae1fc736df4b",
          "molfile": "\n  Marvin  01132111332D          \n\n 24 25  0  0  0  0            999 V2000\n   -3.1158   -1.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3996   -1.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6937   -1.9652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9696   -1.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2560   -1.9652    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4551   -1.5566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4629   -0.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1740   -0.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8876   -0.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8876   -1.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1714   -1.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5961   -0.3103    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.3097   -0.7291    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0312   -0.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7578   -0.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4637   -0.3052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1852   -0.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4715    0.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6013    0.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8876    0.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8901    1.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6039    2.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3175    1.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3150    0.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 12  1  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 19  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 24 19  2  0  0  0  0\n 21 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCSc1ccc(cc1)C(c2ccccc2)SCCN(C)C",
          "formula": "C21H29NS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6cb38629-7864-44a6-abbb-536c73b76af8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "359.5946",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "94216e53-9ef9-4ec1-b1d6-9b0e7d762cb7",
      "version": "11",
      "structure": {
        "id": "968d1b72-88d1-430e-a0b1-4e6a66e94834",
        "molfile": "\n  Marvin  01132107492D          \n\n 24 25  0  0  0  0            999 V2000\n    2.5961   -0.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8876   -0.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6013    0.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1740   -0.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8876   -1.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3097   -0.7291    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4551   -1.5566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4637   -0.3052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2560   -1.9652    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4629   -0.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1714   -1.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0312   -0.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7578   -0.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3150    0.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8876    0.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9696   -1.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1852   -0.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4715    0.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6937   -1.9652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3996   -1.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1158   -1.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8901    1.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3175    1.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6039    2.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7 11  2  0  0  0  0\n  8 13  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  5  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14  3  2  0  0  0  0\n 15  3  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17  8  1  0  0  0  0\n 18  8  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 15  2  0  0  0  0\n 23 14  1  0  0  0  0\n 24 23  2  0  0  0  0\n 10  7  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
        "smiles": "CCCCSc1ccc(cc1)C(c2ccccc2)SCCN(C)C",
        "formula": "C21H29NS2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "359.5946",
        "optical_activity": "( + / - )",
        "references": [
          "f7c9fbd2-963b-4e52-b10e-4f90920fc75b",
          "c72badca-5ac8-4770-a954-2b5588d09b61",
          "ba6b3992-2b3d-4eac-9f6e-8176911095b2"
        ],
        "stereo_centers": 1
      },
      "unii": "H93K9455DD"
    }
  ]
}