{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "09ec0b00-74b5-4503-aa94-11ded5f4466e", "code": "40158-98-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=40158-98-3", "code_system": "CAS", "references": [ "80b2549b-4e44-fdeb-715e-a895379af25f" ] }, { "uuid": "12244315-f208-b55d-c982-60e514b1fe51", "code": "13932543", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13932543", "code_system": "PUBCHEM", "references": [ "b82b88c8-956d-405f-3529-b378451b75d0" ] }, { "uuid": "78d20725-2fa3-4620-b07a-bcf1a5086c23", "code": "H8T6RER0YI", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "334cc884-b663-6510-667b-95d05cbbe06e", "code": "DTXSID701043313", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701043313", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "f529f59a-a634-acc4-87cc-55f9293332b3", "name": "ERGOLINE-8-CARBOXAMIDE, 9,10-DIDEHYDRO-N,6-DIMETHYL-N-PROPYL-, (8.BETA.)-", "stdName": "ERGOLINE-8-CARBOXAMIDE, 9,10-DIDEHYDRO-N,6-DIMETHYL-N-PROPYL-, (8.BETA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "80b2549b-4e44-fdeb-715e-a895379af25f" ], "display_name": false }, { "uuid": "3ded110f-72d7-4305-4201-e4cfd6d00f27", "name": "LYSERGIC ACID METHYLPROPYLAMIDE", "stdName": "LYSERGIC ACID METHYLPROPYLAMIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "80b2549b-4e44-fdeb-715e-a895379af25f" ], "display_name": true }, { "uuid": "b1fae24a-7049-9cb3-4103-10ef2cc0370c", "name": "N-METHYL-N-PROPYL-D-LYSERGAMIDE", "stdName": "N-METHYL-N-PROPYL-D-LYSERGAMIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "80b2549b-4e44-fdeb-715e-a895379af25f" ], "display_name": false } ], "references": [ { "uuid": "18b48568-531a-48bc-a77f-de66a9919922", "citation": "SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "80b2549b-4e44-fdeb-715e-a895379af25f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b82b88c8-956d-405f-3529-b378451b75d0", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "254dbbda-358c-0ca0-9bac-e2fec3cffad3", "id": "254dbbda-358c-0ca0-9bac-e2fec3cffad3", "molfile": "\n Marvin 01132102042D \n\n 24 27 0 0 1 0 999 V2000\n 14.8143 -3.8596 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.8143 -4.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5268 -5.0936 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 15.5268 -5.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2403 -4.6851 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 16.9518 -5.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6706 -4.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0888 -4.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0888 -3.8532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3806 -3.4622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3806 -2.6372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6833 -2.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9546 -2.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9546 -3.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2403 -3.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5268 -3.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6706 -3.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1172 -3.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1172 -2.6563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4226 -3.8637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4226 -4.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7255 -3.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0308 -3.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3337 -3.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 16 1 0 0 0 0\n 1 18 1 6 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 3 1 1 0 0 0\n 5 6 1 0 0 0 0\n 5 15 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 17 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 17 2 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 17 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 18 19 2 0 0 0 0\n 20 18 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\nM END", "smiles": "CCCN(C)C(=O)[C@@H]1C=C2c3cccc4c3c(C[C@H]2N(C)C1)c[nH]4", "formula": "C20H25N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5f133da0-9ace-40be-99bf-6d1ce14cfa18" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "323.4328", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "256f3bd5-5ce5-44f4-a587-48566af4ee28", "version": "7", "structure": { "id": "ee400ea9-93be-4060-a428-e0c7b68dc9f1", "molfile": "\n Marvin 01132112202D \n\n 25 28 0 0 1 0 999 V2000\n 16.2580 -5.4946 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5437 -3.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2580 -3.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4007 -2.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7026 -2.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9731 -2.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9731 -3.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6899 -3.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4007 -3.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1096 -3.8574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1096 -4.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6899 -4.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9703 -5.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2580 -4.6902 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.5437 -5.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5437 -5.0992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8305 -4.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8305 -3.8638 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.1326 -2.6592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1326 -3.4637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4372 -4.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4372 -3.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7394 -3.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0439 -3.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3461 -3.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14 1 1 6 0 0 0\n 3 2 2 0 0 0 0\n 7 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 9 4 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 12 8 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 3 1 0 0 0 0\n 16 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 2 1 0 0 0 0\n 18 20 1 6 0 0 0\n 20 19 2 0 0 0 0\n 22 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\nM END", "smiles": "CCCN(C)C(=O)[C@@H]1C=C2c3cccc4c3c(C[C@@]2([H])N(C)C1)c[nH]4", "formula": "C20H25N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "323.4328", "optical_activity": "UNSPECIFIED", "references": [ "18b48568-531a-48bc-a77f-de66a9919922" ], "stereo_centers": 2 }, "unii": "H8T6RER0YI" } ] }