{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4b413039-d823-486f-a163-824e8b3dc958",
          "code": "89482-00-8",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=89482-00-8",
          "code_system": "CAS",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25",
            "86a6eca3-2fe8-472c-99ee-d9366d81f396"
          ]
        },
        {
          "uuid": "50a6a1e3-4711-4ce1-9eb4-bb5c833c2330",
          "code": "C66681",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66681",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25"
          ]
        },
        {
          "uuid": "c60e3c9e-8ebc-4c4a-b1fb-24fe1f619467",
          "code": "74711-43-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74711-43-6",
          "code_system": "CAS",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25",
            "182855bf-a1ea-4b68-9d22-0ab14f8aeab2"
          ]
        },
        {
          "uuid": "7e7ec107-4324-4cda-97c8-fa81877412d4",
          "code": "SUB00135MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25"
          ]
        },
        {
          "uuid": "647f8c80-09cd-40f6-9181-232ecbbe600e",
          "code": "6703",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6703",
          "code_system": "INN",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25"
          ]
        },
        {
          "uuid": "009d2634-c238-44c9-b750-19d52871e2a9",
          "code": "277-973-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.863",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25"
          ]
        },
        {
          "uuid": "83e7ba69-b441-46d7-a1b4-7414275fe754",
          "code": "m11580",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11580?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25"
          ]
        },
        {
          "uuid": "152a03a6-a423-43d9-b17c-ee8501e01f3b",
          "code": "CHEMBL1765291",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1765291",
          "code_system": "ChEMBL",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25"
          ]
        },
        {
          "uuid": "cc3bfff7-b315-4d61-bc75-c8b308d9e01d",
          "code": "5720",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5720",
          "code_system": "PUBCHEM",
          "references": [
            "8dd968be-e71c-4e06-af3a-a6889b05bd25"
          ]
        },
        {
          "uuid": "da26311c-263d-8e79-6234-a5732688b75e",
          "code": "DTXSID0049076",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0049076",
          "code_system": "EPA CompTox",
          "references": [
            "49c48b1e-6629-f452-7200-4c56c42bb5db"
          ]
        },
        {
          "uuid": "60b13599-e997-d565-e597-bb22c39d7394",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e4dfc9d8-6fdc-720b-e8c7-11c753651c52"
          ]
        },
        {
          "uuid": "0005659e-3ed2-463c-90d9-76f2baae49b7",
          "code": "H8635NG3PY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aa4f3bfb-acc5-b2e3-31c7-61834ebcfd8d",
          "code": "2858",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2858",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e4dfc9d8-6fdc-720b-e8c7-11c753651c52"
          ]
        },
        {
          "uuid": "7764dbe9-ce92-05d5-9fe1-d2e5b2a8ac80",
          "code": "DB06737",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB06737",
          "code_system": "DRUG BANK",
          "references": [
            "e4dfc9d8-6fdc-720b-e8c7-11c753651c52"
          ]
        },
        {
          "uuid": "0c9c8108-d426-504d-9415-09cd82371d55",
          "code": "Zaltoprofen",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zaltoprofen",
          "code_system": "WIKIPEDIA",
          "references": [
            "8df79413-d795-3c14-84de-f4dbdbeceeca"
          ]
        },
        {
          "uuid": "ba6966b3-c361-c4bd-df58-e8e9fd49a0bf",
          "code": "100000079388",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5073d66c-c6d4-da85-e5d2-04d29439e664"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c9d818a9-671d-45cc-839a-83cc4aedd15a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "aff05030-210e-44ca-9267-9ba56a3b8be6",
            "refuuid": "fe20ba8f-8242-424f-bc5e-4212ef3862a7",
            "name": "ZALTOPROFEN",
            "unii": "H8635NG3PY",
            "linking_id": "H8635NG3PY",
            "ref_pname": "ZALTOPROFEN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "18ad877f-0a29-4663-9d1b-2d6791faf6ae",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "d8f315ac-3f1c-47ea-bc43-67525e556288",
            "refuuid": "0d7b1dc7-0e02-48bd-94de-e438f2b51b26",
            "name": "ZALTOPROFEN, (R)-",
            "unii": "UZY1Q3BDNW",
            "linking_id": "UZY1Q3BDNW",
            "ref_pname": "ZALTOPROFEN, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1e1cb1b4-4737-476e-a6da-62fb2183e19a",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "33b2a78d-572f-4cc7-8a95-9a477e5dd543",
            "refuuid": "22e83359-8d4c-471b-ac7d-7fe382fb663a",
            "name": "ZALTOPROFEN, (S)-",
            "unii": "6MG32PF05M",
            "linking_id": "6MG32PF05M",
            "ref_pname": "ZALTOPROFEN, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6423027d-0eae-41cb-89e6-fa9ed0b2bbaa",
          "name": "CN-100",
          "stdName": "CN-100",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884e943f-5d3d-4eaf-b4aa-97a043c36979",
            "7e83ae2d-6910-4b7a-8a01-a39585f7af7b"
          ],
          "display_name": false
        },
        {
          "uuid": "f4214fde-d835-4a93-94cb-94c723ec1ca0",
          "name": "PEON",
          "stdName": "PEON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b55debdc-7d4d-4602-a7ee-c2aa68002b70",
            "da6eb924-0416-4571-b63d-b3bb754a657f"
          ],
          "display_name": false
        },
        {
          "uuid": "548b24c4-38f3-4506-90e5-e8eb1872b96a",
          "name": "SORETON",
          "stdName": "SORETON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884e943f-5d3d-4eaf-b4aa-97a043c36979",
            "7e83ae2d-6910-4b7a-8a01-a39585f7af7b"
          ],
          "display_name": false
        },
        {
          "uuid": "c8b7dad6-5659-420a-abb7-e1190542cbe0",
          "name": "ZALTOPROFEN",
          "stdName": "ZALTOPROFEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d13f3e2-e677-46b0-b813-f6025a9ef102",
            "e03ecb7c-1449-4caf-bca8-0f0b342f4c16",
            "740d50ff-0b23-4d5e-80c4-853c85c057f8",
            "8a829e82-e011-41a2-be08-4022e8149703",
            "884e943f-5d3d-4eaf-b4aa-97a043c36979",
            "7e83ae2d-6910-4b7a-8a01-a39585f7af7b",
            "f989c2a9-4126-4ae1-b552-5ce9e74710a0",
            "c57a51c3-b216-4bf3-936c-b08882f1b250",
            "7e30ca60-6032-479a-a26a-d0180bc0c499",
            "90983111-e2ec-4a13-89e5-280905cae875"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "81d3c430-ec46-4d6c-94a9-3bc44d90285b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "b90b4787-15ff-46ff-a71a-ac712c361655",
          "name": "ZALTOPROFEN [JAN]",
          "stdName": "ZALTOPROFEN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91f8b513-178c-6a6e-51bf-62faea44ba49"
          ],
          "display_name": false
        },
        {
          "uuid": "b79b0b8e-2221-4ef8-aecc-787024054168",
          "name": "ZALTOPROFEN [MART.]",
          "stdName": "ZALTOPROFEN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90983111-e2ec-4a13-89e5-280905cae875"
          ],
          "display_name": false
        },
        {
          "uuid": "b05cff5d-8d77-4bd8-94e6-9eb6aa95139a",
          "name": "ZALTOPROFEN [MI]",
          "stdName": "ZALTOPROFEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884e943f-5d3d-4eaf-b4aa-97a043c36979",
            "7e83ae2d-6910-4b7a-8a01-a39585f7af7b"
          ],
          "display_name": false
        },
        {
          "uuid": "f0f19d48-61b9-bab0-d38d-d1821cc313cc",
          "name": "Zaltoprofen [WHO-DD]",
          "stdName": "ZALTOPROFEN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa7c6c02-b30f-40a1-8905-fddd93a661b3"
          ],
          "display_name": false
        },
        {
          "uuid": "f510f4c3-fc78-4782-bf19-04f9eea9fae0",
          "name": "zaltoprofen [INN]",
          "stdName": "ZALTOPROFEN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e03ecb7c-1449-4caf-bca8-0f0b342f4c16"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7e30ca60-6032-479a-a26a-d0180bc0c499",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e03ecb7c-1449-4caf-bca8-0f0b342f4c16",
          "citation": "INN Proposed List 64",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL64.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "90983111-e2ec-4a13-89e5-280905cae875",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da6eb924-0416-4571-b63d-b3bb754a657f",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b55debdc-7d4d-4602-a7ee-c2aa68002b70",
          "citation": "D01547",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d13f3e2-e677-46b0-b813-f6025a9ef102",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e83ae2d-6910-4b7a-8a01-a39585f7af7b",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "884e943f-5d3d-4eaf-b4aa-97a043c36979",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dd968be-e71c-4e06-af3a-a6889b05bd25",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec15cc43-22d3-42e0-98b3-1b42b451df52",
          "citation": "SRS import [H8635NG3PY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H8635NG3PY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c57a51c3-b216-4bf3-936c-b08882f1b250",
          "citation": "ZALTOPROFEN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "740d50ff-0b23-4d5e-80c4-853c85c057f8",
          "citation": "ZALTOPROFEN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a829e82-e011-41a2-be08-4022e8149703",
          "citation": "ZALTOPROFEN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f989c2a9-4126-4ae1-b552-5ce9e74710a0",
          "citation": "ZALTOPROFEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "91f8b513-178c-6a6e-51bf-62faea44ba49",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "49c48b1e-6629-f452-7200-4c56c42bb5db",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=74711-43-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4dfc9d8-6fdc-720b-e8c7-11c753651c52",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "182855bf-a1ea-4b68-9d22-0ab14f8aeab2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "86a6eca3-2fe8-472c-99ee-d9366d81f396",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8df79413-d795-3c14-84de-f4dbdbeceeca",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "aa7c6c02-b30f-40a1-8905-fddd93a661b3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5073d66c-c6d4-da85-e5d2-04d29439e664",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ad99324-0a91-4366-9e01-ec277c709486",
          "id": "5ad99324-0a91-4366-9e01-ec277c709486",
          "molfile": "\n  Marvin  01132104422D          \n\n 21 23  0  0  0  0            999 V2000\n   -3.4310   -3.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2747   -3.8305    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -3.8942   -4.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6700   -4.1014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7378   -5.1743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4988   -4.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3387   -4.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5569   -5.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9343   -4.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2032   -5.0258    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5595   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1361   -5.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9323   -5.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1463   -4.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5651   -3.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7757   -3.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2815   -3.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6648   -2.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5497   -3.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0899   -3.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8719   -3.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  6  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n 21  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 20  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CC(c1ccc2c(c1)CC(=O)c3ccccc3S2)C(=O)O",
          "formula": "C17H14O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e73fbe3d-0ed1-4166-b69d-e3034e88385a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "298.358",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fe20ba8f-8242-424f-bc5e-4212ef3862a7",
      "version": "17",
      "structure": {
        "id": "13f3918b-eb18-4307-9763-cc7bbe51ba26",
        "molfile": "\n  Marvin  01132101142D          \n\n 21 23  0  0  0  0            999 V2000\n    1.1361   -5.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9323   -5.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1463   -4.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5651   -3.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7757   -3.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5595   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2032   -5.0258    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2815   -3.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5497   -3.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9343   -4.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0899   -3.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8719   -3.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4988   -4.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3387   -4.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5569   -5.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2747   -3.8305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4310   -3.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8942   -4.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6700   -4.1014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7378   -5.1743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6648   -2.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  1  2  2  0  0  0  0\n 10 11  2  0  0  0  0\n  6  1  1  0  0  0  0\n 11 12  1  0  0  0  0\n  5  6  2  0  0  0  0\n 12 13  2  0  0  0  0\n  2  3  1  0  0  0  0\n 13 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 10  1  0  0  0  0\n 13 16  1  0  0  0  0\n  5  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n  7 10  1  0  0  0  0\n 16 18  1  0  0  0  0\n  3  4  2  0  0  0  0\n 18 19  1  0  0  0  0\n  8  9  1  0  0  0  0\n 18 20  2  0  0  0  0\n  9 11  1  0  0  0  0\n  8 21  2  0  0  0  0\nM  END",
        "smiles": "CC(c1ccc2c(c1)CC(=O)c3ccccc3S2)C(=O)O",
        "formula": "C17H14O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "298.358",
        "optical_activity": "( + / - )",
        "references": [
          "ec15cc43-22d3-42e0-98b3-1b42b451df52",
          "e03ecb7c-1449-4caf-bca8-0f0b342f4c16"
        ],
        "stereo_centers": 1
      },
      "unii": "H8635NG3PY"
    }
  ]
}