{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6338c4ff-b464-427b-a1ed-52b85fed4c2d",
          "code": "73398-25-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=73398-25-1",
          "code_system": "CAS",
          "references": [
            "dbb92fa6-1dbb-4522-94f5-1adea5f19194",
            "920810a6-dcf7-42ed-8622-5bdb0045e928"
          ]
        },
        {
          "uuid": "c673c909-8030-46b3-a4bd-dc7d5944be6b",
          "code": "277-426-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.366",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dbb92fa6-1dbb-4522-94f5-1adea5f19194"
          ]
        },
        {
          "uuid": "09716e2f-7f21-4201-90c6-19318de2927e",
          "code": "44153362",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44153362",
          "code_system": "PUBCHEM",
          "references": [
            "dbb92fa6-1dbb-4522-94f5-1adea5f19194"
          ]
        },
        {
          "uuid": "0d930edb-8bbe-466a-a2d7-c71faddb0a80",
          "code": "H84HHH838R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c7bc03e0-022a-bae8-205f-eb48f7648b8a",
          "code": "DTXSID80994110",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80994110",
          "code_system": "EPA CompTox",
          "references": [
            "d7f03d70-0c2e-4df4-12cf-1cda85112324"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5a2ee7ef-4b14-4772-a5a0-297e360d0d1c",
          "name": "AHC BLUE SP",
          "stdName": "AHC BLUE SP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2b97c08-85d7-4be5-af1b-83250917f93e",
            "ad6c5057-4355-4d6e-89f5-a431f13ec45e"
          ],
          "display_name": false
        },
        {
          "uuid": "bd3e4913-f0d9-4bfa-b24f-b1c583d7ee67",
          "name": "BASIC BLUE 75",
          "stdName": "BASIC BLUE 75",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2b97c08-85d7-4be5-af1b-83250917f93e",
            "ad6c5057-4355-4d6e-89f5-a431f13ec45e",
            "c721542e-55d0-4197-8eb6-51e8e76e647a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7598226f-5e09-424f-acb4-c2a9f08eb371",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3a7bce08-8c1e-49ad-9059-71a3d3025be9",
          "name": "PHENOXAZIN-5-IUM, 3-(DIETHYLAMINO)-7-(PHENYLAMINO)-, TRICHLOROZINCATE(1-)",
          "stdName": "PHENOXAZIN-5-IUM, 3-(DIETHYLAMINO)-7-(PHENYLAMINO)-, TRICHLOROZINCATE(1-)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2b97c08-85d7-4be5-af1b-83250917f93e",
            "9eef9c09-f9de-41e2-9d49-e9ab7b6266d2"
          ],
          "display_name": false
        },
        {
          "uuid": "fcd67e6b-d595-447f-8812-5f6c6b188605",
          "name": "PHENOXAZIN-5-IUM, 3-(DIETHYLAMINO)-7-(PHENYLAMINO)-, TRICHLOROZINCATE(1-) (1:1)",
          "stdName": "PHENOXAZIN-5-IUM, 3-(DIETHYLAMINO)-7-(PHENYLAMINO)-, TRICHLOROZINCATE(1-) (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2b97c08-85d7-4be5-af1b-83250917f93e",
            "9eef9c09-f9de-41e2-9d49-e9ab7b6266d2"
          ],
          "display_name": false
        },
        {
          "uuid": "e33738af-5b36-416e-a3d5-fabdafa96958",
          "name": "ZINCATE(1-), TRICHLORO-, 3-(DIETHYLAMINO)-7-(PHENYLAMINO)PHENOXAZIN-5-IUM",
          "stdName": "ZINCATE(1-), TRICHLORO-, 3-(DIETHYLAMINO)-7-(PHENYLAMINO)PHENOXAZIN-5-IUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2b97c08-85d7-4be5-af1b-83250917f93e",
            "9eef9c09-f9de-41e2-9d49-e9ab7b6266d2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ad6c5057-4355-4d6e-89f5-a431f13ec45e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c2b97c08-85d7-4be5-af1b-83250917f93e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9eef9c09-f9de-41e2-9d49-e9ab7b6266d2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbb92fa6-1dbb-4522-94f5-1adea5f19194",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391603000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9c99f26-8b72-4673-9e2f-8d349db2c37a",
          "citation": "SRS import [H84HHH838R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H84HHH838R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391603000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c721542e-55d0-4197-8eb6-51e8e76e647a",
          "citation": "BASIC BLUE 75 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "920810a6-dcf7-42ed-8622-5bdb0045e928",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d7f03d70-0c2e-4df4-12cf-1cda85112324",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d6995cc9-d767-42ae-9c55-07f58c62d66c",
          "id": "d6995cc9-d767-42ae-9c55-07f58c62d66c",
          "molfile": "\n  Marvin  01132111072D          \n\n  1  0  0  0  0  0            999 V2000\n   14.7184   -8.1851    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 3,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 3,
            "units": "MOL RATIO",
            "uuid": "c1a8a4cd-b8de-4dac-9dbe-9d3e63da09ce"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "8513ed15-4f44-4779-a118-0795ee001a14",
          "id": "8513ed15-4f44-4779-a118-0795ee001a14",
          "molfile": "\n  Marvin  01132106542D          \n\n  1  0  0  0  0  0            999 V2000\n   13.3991   -8.2263    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "070a03a6-c97d-4e57-b65e-4ad041573420"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "40ffe4dc-1a2d-4421-b636-17ede840cdd2",
          "id": "40ffe4dc-1a2d-4421-b636-17ede840cdd2",
          "molfile": "\n  Marvin  01132103262D          \n\n 26 29  0  0  0  0            999 V2000\n   10.4490  -10.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1636   -9.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1636   -9.0921    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   11.8782   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8782   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4490   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4490   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7344   -7.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0198   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3052   -7.4430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5905   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8759   -7.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1613   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1613   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4467   -9.0921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7321   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7321   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0175   -7.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3028   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3028   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0175   -9.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8759   -9.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5905   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3052   -9.0921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0198   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7344   -9.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  2  3  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 26  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 25  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 23 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 22 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\nM  CHG  1   3   1\nM  END",
          "smiles": "CC[N+](=c1ccc2-c(c1)oc3cc(ccc3n2)Nc4ccccc4)CC",
          "formula": "C22H22N3O",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "994b2fe3-a8ab-4d39-9d9d-2f652b0cef98"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "344.4304",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "56cf1019-7b15-4961-8104-caea30313fc3",
      "version": "6",
      "structure": {
        "id": "6d6db608-d9b9-4fbc-9a9f-037818052cbb",
        "molfile": "\n  Marvin  01132105412D          \n\n 30 29  0  0  0  0            999 V2000\n   10.4490  -10.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1636   -9.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8782   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8782   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1636   -9.0921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7321   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0175   -7.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3028   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3028   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0175   -9.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7321   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4467   -9.0921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0198   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3052   -7.4430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5905   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8759   -7.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1613   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1613   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8759   -9.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5905   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3052   -9.0921    0.0000 O   0  3  0  0  0  0  0  0  0  0  0  0\n    9.0198   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7344   -9.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4490   -8.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4490   -7.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7344   -7.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3991   -8.2263    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n   14.7184   -8.1851    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n   14.7184   -8.1851    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n   14.7184   -8.1851    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n 24  5  1  0  0  0  0\n  5  2  1  0  0  0  0\n  2  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  3  1  0  0  0  0\n 18 12  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 26 13  1  0  0  0  0\n 22 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 20 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\nM  CHG  5  21   1  27   2  28  -1  29  -1  30  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  3  28  29  30\nM  SPA   1  1  28\nM  SDI   1  4   14.2984   -8.6051   14.2984   -7.7651\nM  SDI   1  4   15.1384   -7.7651   15.1384   -8.6051\nM  SMT   1 3\nM  END",
        "smiles": "CCN(CC)c1ccc2c(c1)[o+]c3cc(ccc3n2)Nc4ccccc4.[Cl-].[Cl-].[Cl-].[Zn+2]",
        "formula": "C22H22N3O.3Cl.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "516.1848",
        "optical_activity": "NONE",
        "references": [
          "a9c99f26-8b72-4673-9e2f-8d349db2c37a",
          "9eef9c09-f9de-41e2-9d49-e9ab7b6266d2"
        ],
        "stereo_centers": 0
      },
      "unii": "H84HHH838R"
    }
  ]
}