{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b1b4a8e8-19fe-4e6e-8f40-595cfda0026e",
          "code": "6049-95-2",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6049-95-2",
          "code_system": "CAS",
          "references": [
            "80af6406-2360-400e-80e1-26f837294042",
            "154027af-74eb-4195-87b7-82354ea15f4a"
          ]
        },
        {
          "uuid": "84c63e87-e725-4ecf-888a-120fba4f39e9",
          "code": "857657-29-5",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=857657-29-5",
          "code_system": "CAS",
          "references": [
            "80af6406-2360-400e-80e1-26f837294042",
            "621d0fcf-64f6-4128-bd68-2de2f7315777"
          ]
        },
        {
          "uuid": "e2dbd090-b569-4c70-aa8a-199c1328652a",
          "code": "494-08-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=494-08-6",
          "code_system": "CAS",
          "references": [
            "80af6406-2360-400e-80e1-26f837294042",
            "1b8886b4-1ed7-4592-9e84-588e53c59978"
          ]
        },
        {
          "uuid": "3f0d69d5-8968-4b06-b8e0-d700c5dbc447",
          "code": "C443341",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67443341",
          "code_system": "MESH",
          "references": [
            "80af6406-2360-400e-80e1-26f837294042"
          ]
        },
        {
          "uuid": "bdd0af33-4663-446f-8905-e7e99a662d63",
          "code": "m5770",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5770?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "80af6406-2360-400e-80e1-26f837294042"
          ]
        },
        {
          "uuid": "3644985a-70ae-4b58-9f21-2c5e0610f985",
          "code": "6452133",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6452133",
          "code_system": "PUBCHEM",
          "references": [
            "80af6406-2360-400e-80e1-26f837294042"
          ]
        },
        {
          "uuid": "9eefe120-f8eb-4bcc-a20c-90f43db04e64",
          "code": "H81U1KBS6E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f97a421c-c6df-2309-68eb-94c05deb0e79",
          "code": "DTXSID00197782",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00197782",
          "code_system": "EPA CompTox",
          "references": [
            "6d2f3f6e-b1b6-6759-079b-deb3b7048e3d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0923e2cb-5e17-4a5c-9c7c-6e273af8f438",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "50b91168-7c78-48c6-ae48-d2c7563314be"
          ],
          "related_substance": {
            "uuid": "e286b233-8a32-4527-b2a1-350f4d824b53",
            "refuuid": "db9c181d-a6db-426f-9663-868476245d7f",
            "name": "ELYMUS REPENS ROOT",
            "unii": "3IXW0F6P8W",
            "linking_id": "3IXW0F6P8W",
            "ref_pname": "ELYMUS REPENS ROOT",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c86e933-5715-4e91-9000-a2482c28dda3",
          "name": "4-(.BETA.-D-GLUCOPYRANOSYLOXY)-3-METHOXYBENZALDEHYDE",
          "stdName": "4-(.BETA.-D-GLUCOPYRANOSYLOXY)-3-METHOXYBENZALDEHYDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f8932d2-d658-4e39-8c97-2924c9a1048d",
            "99eed50f-7c37-4b5d-853d-6c5a0987c8c6"
          ],
          "display_name": false
        },
        {
          "uuid": "4a1a38f8-1426-417e-9dae-14e2672f25ad",
          "name": "4-(BETA-D-GLUCOPYRANOSYLOXY)-3-METHOXY-BENZALDEHYDE",
          "stdName": "4-(BETA-D-GLUCOPYRANOSYLOXY)-3-METHOXY-BENZALDEHYDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74c8eb5c-7d45-46a6-840f-aa70a15aee1c",
            "4f8932d2-d658-4e39-8c97-2924c9a1048d"
          ],
          "display_name": false
        },
        {
          "uuid": "55e45e0c-0c17-416f-8d23-347a4832ae01",
          "name": "AVENEIN",
          "stdName": "AVENEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f8932d2-d658-4e39-8c97-2924c9a1048d",
            "99eed50f-7c37-4b5d-853d-6c5a0987c8c6"
          ],
          "display_name": false
        },
        {
          "uuid": "fa4e96d4-359b-4f87-9f90-cd805ad98ccf",
          "name": "BENZALDEHYDE, 4-(.BETA.-D-GLUCOPYRANOSYLOXY)-3-METHOXY-",
          "stdName": "BENZALDEHYDE, 4-(.BETA.-D-GLUCOPYRANOSYLOXY)-3-METHOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74c8eb5c-7d45-46a6-840f-aa70a15aee1c",
            "4f8932d2-d658-4e39-8c97-2924c9a1048d"
          ],
          "display_name": false
        },
        {
          "uuid": "51801c02-05b4-4715-a146-54722f18a4bb",
          "name": "GLUCOVANILLIN",
          "stdName": "GLUCOVANILLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce9a5b9c-3e7f-4002-acc3-2bdc24e5c693",
            "4f8932d2-d658-4e39-8c97-2924c9a1048d",
            "99eed50f-7c37-4b5d-853d-6c5a0987c8c6",
            "f476c706-9e6e-49aa-86e2-b606ec2252d2"
          ],
          "display_name": false
        },
        {
          "uuid": "69b87009-2f49-4386-b287-e9b802a9f378",
          "name": "GLUCOVANILLIN [MI]",
          "stdName": "GLUCOVANILLIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f8932d2-d658-4e39-8c97-2924c9a1048d",
            "f476c706-9e6e-49aa-86e2-b606ec2252d2"
          ],
          "display_name": false
        },
        {
          "uuid": "a35d0b7a-753f-4a10-af9e-496cc70eb83f",
          "name": "VANILLIN .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "VANILLIN .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74c8eb5c-7d45-46a6-840f-aa70a15aee1c",
            "4f8932d2-d658-4e39-8c97-2924c9a1048d"
          ],
          "display_name": false
        },
        {
          "uuid": "c3533982-965a-4911-b729-687bd2d68436",
          "name": "VANILLIN GLUCOSIDE",
          "stdName": "VANILLIN GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74c8eb5c-7d45-46a6-840f-aa70a15aee1c",
            "4f8932d2-d658-4e39-8c97-2924c9a1048d"
          ],
          "display_name": false
        },
        {
          "uuid": "0f419440-fe3b-4217-91f8-8710fe9526f1",
          "name": "VANILLIN-4-O-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "VANILLIN-4-O-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74c8eb5c-7d45-46a6-840f-aa70a15aee1c",
            "4f8932d2-d658-4e39-8c97-2924c9a1048d"
          ],
          "display_name": false
        },
        {
          "uuid": "4f23be46-1ec6-4474-a18f-72cdca5234fd",
          "name": "VANILLIN-D-GLUCOSIDE",
          "stdName": "VANILLIN-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f8932d2-d658-4e39-8c97-2924c9a1048d",
            "99eed50f-7c37-4b5d-853d-6c5a0987c8c6"
          ],
          "display_name": false
        },
        {
          "uuid": "bb3c7c7b-5b80-4a1b-b3cb-6108cf57b83c",
          "name": "VANILLIN-O-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "VANILLIN-O-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74c8eb5c-7d45-46a6-840f-aa70a15aee1c",
            "4f8932d2-d658-4e39-8c97-2924c9a1048d"
          ],
          "display_name": false
        },
        {
          "uuid": "3c51115f-4df9-49af-9641-f5f654863713",
          "name": "VANILLOSIDE",
          "stdName": "VANILLOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f1f4fae-1e6d-4024-9746-ee322b9c607d"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "7f1f4fae-1e6d-4024-9746-ee322b9c607d",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f476c706-9e6e-49aa-86e2-b606ec2252d2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f8932d2-d658-4e39-8c97-2924c9a1048d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99eed50f-7c37-4b5d-853d-6c5a0987c8c6",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74c8eb5c-7d45-46a6-840f-aa70a15aee1c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80af6406-2360-400e-80e1-26f837294042",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391100000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50b91168-7c78-48c6-ae48-d2c7563314be",
          "citation": "HERBAL MEDICINES 4TH ED",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37fa1b00-7177-4493-acf0-428f13710ae2",
          "citation": "SRS import [H81U1KBS6E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H81U1KBS6E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391100000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa0d09e6-0ab1-486f-8cde-311282e37480",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce9a5b9c-3e7f-4002-acc3-2bdc24e5c693",
          "citation": "GLUCOVANILLIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c9d77bea-0d33-ba6b-3df1-8f053b2eec16",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=494-08-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "154027af-74eb-4195-87b7-82354ea15f4a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "621d0fcf-64f6-4128-bd68-2de2f7315777",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1b8886b4-1ed7-4592-9e84-588e53c59978",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6d2f3f6e-b1b6-6759-079b-deb3b7048e3d",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "01e86684-017d-4287-b774-e9d476aae9d9",
          "id": "01e86684-017d-4287-b774-e9d476aae9d9",
          "molfile": "\n  Marvin  01132100252D          \n\n 22 23  0  0  1  0            999 V2000\n    9.4587   -6.9724    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.7482   -6.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0331   -6.9724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1737   -6.5599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8843   -6.9724    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.6039   -6.5599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3189   -6.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3189   -7.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0295   -8.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7445   -7.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4595   -8.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1746   -7.7974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7445   -6.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0295   -6.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0295   -5.7348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7445   -5.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8843   -7.7974    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.6039   -8.2100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1737   -8.2100    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.1737   -9.0351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4587   -7.7974    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.7482   -8.2100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 21  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 17  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 14  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 13  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  6  0  0  0\nM  END",
          "smiles": "COc1cc(ccc1O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C=O",
          "formula": "C14H18O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2e1325e3-bd71-4a5e-bea6-075ce752e6bb"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "314.2885",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9baa49b5-3e6d-4578-bc5c-c24e25fa28d0",
      "version": "5",
      "structure": {
        "id": "739df187-faf7-4f19-958d-42331a16c97d",
        "molfile": "\n  Marvin  01132106002D          \n\n 22 23  0  0  1  0            999 V2000\n   10.8843   -6.9724    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.8843   -7.7974    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.1737   -8.2100    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.4587   -7.7974    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.4587   -6.9724    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.1737   -9.0351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1737   -6.5599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7482   -6.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0331   -6.9724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7482   -8.2100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6039   -8.2100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6039   -6.5599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3189   -6.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0295   -6.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7445   -6.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7445   -7.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0295   -8.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3189   -7.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4595   -8.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1746   -7.7974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0295   -5.7348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7445   -5.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  1  1  0  0  0  0\n  5  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n  4 10  1  6  0  0  0\n  2 11  1  6  0  0  0\n  1 12  1  1  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 14  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(ccc1O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C=O",
        "formula": "C14H18O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "314.2885",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fa0d09e6-0ab1-486f-8cde-311282e37480",
          "37fa1b00-7177-4493-acf0-428f13710ae2"
        ],
        "stereo_centers": 5
      },
      "unii": "H81U1KBS6E"
    }
  ]
}