{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "68ab009e-ee5d-4032-8059-3cc0cc840092",
          "code": "C73184",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C73184",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f3bf43e3-98f1-4149-8137-e45961ebb469"
          ]
        },
        {
          "uuid": "609580d1-d5d8-4d51-82ad-13b2b0ce46b4",
          "code": "5486-77-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5486-77-1",
          "code_system": "CAS",
          "references": [
            "f3bf43e3-98f1-4149-8137-e45961ebb469",
            "13fdd23e-9686-4a84-9dc0-01ef784ef51b"
          ]
        },
        {
          "uuid": "7ed340e5-3be7-4fd4-ab3b-a94bdd309fcf",
          "code": "C000055",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67000055",
          "code_system": "MESH",
          "references": [
            "f3bf43e3-98f1-4149-8137-e45961ebb469"
          ]
        },
        {
          "uuid": "e7c66196-c493-43c0-a424-50e5d358718f",
          "code": "SUB05335MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f3bf43e3-98f1-4149-8137-e45961ebb469"
          ]
        },
        {
          "uuid": "2118c4be-ed88-4f6c-a0bc-47a5e92aee40",
          "code": "1979",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1979",
          "code_system": "INN",
          "references": [
            "f3bf43e3-98f1-4149-8137-e45961ebb469"
          ]
        },
        {
          "uuid": "a259d160-ea2d-4bd3-96b0-d3d1807320da",
          "code": "m9",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f3bf43e3-98f1-4149-8137-e45961ebb469"
          ]
        },
        {
          "uuid": "fba77ae7-7f4c-4287-8f14-d7b63afa95bb",
          "code": "CHEMBL2103989",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2103989",
          "code_system": "ChEMBL",
          "references": [
            "f3bf43e3-98f1-4149-8137-e45961ebb469"
          ]
        },
        {
          "uuid": "104578f7-82e3-4f94-8974-e19a5903ed6f",
          "code": "71837",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71837",
          "code_system": "PUBCHEM",
          "references": [
            "f3bf43e3-98f1-4149-8137-e45961ebb469"
          ]
        },
        {
          "uuid": "b29f0957-7ea1-012d-5e22-5f0a954a48af",
          "code": "DTXSID9048853",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9048853",
          "code_system": "EPA CompTox",
          "references": [
            "463984fa-c396-764c-b1f7-fcbe9b721630"
          ]
        },
        {
          "uuid": "60f0763a-5329-79af-5d76-feeb085e7560",
          "code": "C66917",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Antitussive Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66917",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7b6ddbeb-e135-f932-0838-286ead29b318"
          ]
        },
        {
          "uuid": "381793e2-999e-4d72-bdef-abefa6325cfa",
          "code": "H7B263Z7AQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "906cb90f-49a7-d86f-e910-6bf5ad7ab74c",
          "code": "123",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/123",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7b6ddbeb-e135-f932-0838-286ead29b318"
          ]
        },
        {
          "uuid": "e6094f19-8b34-0aee-d154-4ec265cfeebc",
          "code": "Alloclamide",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Alloclamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "8a13960e-dfc2-ecf0-acbf-08e2a337ce0c"
          ]
        },
        {
          "uuid": "76f4586e-a58d-ddda-0e48-c487a18d8fe1",
          "code": "100000087436",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "883a045f-02d6-dd21-fe11-548c6b85d56a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5637d881-61f7-4dae-a0b1-18efe5f64cc1",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1761cb2b-cffe-4105-926a-2a84e3d529c1",
            "refuuid": "22b2ce85-2926-4072-801d-c02e4d68f48c",
            "name": "ALLOCLAMIDE",
            "unii": "H7B263Z7AQ",
            "linking_id": "H7B263Z7AQ",
            "ref_pname": "ALLOCLAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "05a0fba2-06c8-405c-b65f-0e38b0ad3517",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "567f7e3a-dc05-4543-93f7-a517bd326a45",
            "refuuid": "fd23a4db-f469-4758-a2aa-4dabaaea0c0e",
            "name": "ALLOCLAMIDE HYDROCHLORIDE",
            "unii": "P6ASX4Y422",
            "linking_id": "P6ASX4Y422",
            "ref_pname": "ALLOCLAMIDE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "99ab9eb9-8978-44e3-8675-300a375eb903",
          "name": "2-(ALLYLOXY)-4-CHLORO-N-(2-(DIETHYLAMINO)ETHYL)BENZAMIDE",
          "stdName": "2-(ALLYLOXY)-4-CHLORO-N-(2-(DIETHYLAMINO)ETHYL)BENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f26c04d-06db-498d-a119-6e6d5b227d03"
          ],
          "display_name": false
        },
        {
          "uuid": "1eee626f-e1c5-42dc-a2d8-af2d229fb394",
          "name": "ALLOCLAMIDE",
          "stdName": "ALLOCLAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d6e40d-9565-40dc-99a8-bf7e724ac4bc",
            "b711b3d8-8c11-44c4-9ec2-eae819475870",
            "2caa052b-0ee2-4cb5-8034-88195bcbb746",
            "de1eac6e-7c72-476f-9668-b6da0675cc14",
            "9121210e-5744-4ac4-b782-fec9d09e2852",
            "6c1bb8a5-bfe2-4ced-81ff-46629811acaa",
            "daba3fbf-00a8-4b6f-a893-7d0cc366c1c0",
            "e1b63a8d-a1ac-439e-8796-386ff32177ad"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "9b680327-4db1-4513-a93b-eca333e2097b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "2a843964-d0ec-413b-a357-a26acf912a2d",
          "name": "ALLOCLAMIDE [MI]",
          "stdName": "ALLOCLAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9121210e-5744-4ac4-b782-fec9d09e2852",
            "6c1bb8a5-bfe2-4ced-81ff-46629811acaa"
          ],
          "display_name": false
        },
        {
          "uuid": "d1849878-bba0-c0bd-1a9c-683267634d8e",
          "name": "Alloclamide [WHO-DD]",
          "stdName": "ALLOCLAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffd3e157-2a9a-44fa-0a59-777a59a15da1"
          ],
          "display_name": false
        },
        {
          "uuid": "4b0df22a-39c0-41c5-ad0d-5b989714b976",
          "name": "alloclamide [INN]",
          "stdName": "ALLOCLAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de1eac6e-7c72-476f-9668-b6da0675cc14"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e1b63a8d-a1ac-439e-8796-386ff32177ad",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1f26c04d-06db-498d-a119-6e6d5b227d03",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de1eac6e-7c72-476f-9668-b6da0675cc14",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "daba3fbf-00a8-4b6f-a893-7d0cc366c1c0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9121210e-5744-4ac4-b782-fec9d09e2852",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c1bb8a5-bfe2-4ced-81ff-46629811acaa",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3bf43e3-98f1-4149-8137-e45961ebb469",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390738000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec189976-f20a-41b7-ba08-fe2a8c8db322",
          "citation": "SRS import [H7B263Z7AQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H7B263Z7AQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390738000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2caa052b-0ee2-4cb5-8034-88195bcbb746",
          "citation": "ALLOCLAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b711b3d8-8c11-44c4-9ec2-eae819475870",
          "citation": "ALLOCLAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "90d6e40d-9565-40dc-99a8-bf7e724ac4bc",
          "citation": "ALLOCLAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "463984fa-c396-764c-b1f7-fcbe9b721630",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5486-77-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7b6ddbeb-e135-f932-0838-286ead29b318",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8a13960e-dfc2-ecf0-acbf-08e2a337ce0c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "13fdd23e-9686-4a84-9dc0-01ef784ef51b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ffd3e157-2a9a-44fa-0a59-777a59a15da1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "883a045f-02d6-dd21-fe11-548c6b85d56a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a2b013b6-073d-4f63-b654-81a3bba090db",
          "id": "a2b013b6-073d-4f63-b654-81a3bba090db",
          "molfile": "\n  Marvin  01132108272D          \n\n 21 21  0  0  0  0            999 V2000\n    9.0951   -2.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3829   -2.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3875   -3.5958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1043   -4.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8164   -3.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6750   -4.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9625   -3.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2500   -4.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5387   -3.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5333   -2.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8258   -4.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1104   -3.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3986   -4.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3974   -4.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6826   -5.2643    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122   -5.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8287   -4.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5438   -5.2632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2542   -4.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9667   -5.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6792   -4.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
          "smiles": "C=CCOc1cc(ccc1C(=O)NCCN(CC)CC)Cl",
          "formula": "C16H23ClN2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2225f1a3-0e5d-4af1-a49b-8d8c3f442a14"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "310.8196",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "22b2ce85-2926-4072-801d-c02e4d68f48c",
      "version": "10",
      "structure": {
        "id": "d0fb6d0a-c504-412e-85f5-8c0174eaeb16",
        "molfile": "\n  Marvin  01132110482D          \n\n 21 21  0  0  0  0            999 V2000\n    3.3986   -4.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3974   -4.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122   -5.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8287   -4.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8258   -4.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1104   -3.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6826   -5.2643    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5438   -5.2632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5387   -3.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5333   -2.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2500   -4.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9625   -3.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6750   -4.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3875   -3.5958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1043   -4.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3829   -2.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0951   -2.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8164   -3.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2542   -4.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9667   -5.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6792   -4.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  9 11  1  0  0  0  0\n  5  6  2  0  0  0  0\n 11 12  1  0  0  0  0\n  6  1  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1  2  2  0  0  0  0\n 13 14  1  0  0  0  0\n  2  7  1  0  0  0  0\n 14 15  1  0  0  0  0\n  3  4  2  0  0  0  0\n 14 16  1  0  0  0  0\n  4  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n  5  9  1  0  0  0  0\n  8 19  1  0  0  0  0\n  4  5  1  0  0  0  0\n 19 20  1  0  0  0  0\n  9 10  2  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
        "smiles": "C=CCOc1cc(ccc1C(=O)NCCN(CC)CC)Cl",
        "formula": "C16H23ClN2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "310.8196",
        "optical_activity": "NONE",
        "references": [
          "ec189976-f20a-41b7-ba08-fe2a8c8db322",
          "1f26c04d-06db-498d-a119-6e6d5b227d03",
          "de1eac6e-7c72-476f-9668-b6da0675cc14"
        ],
        "stereo_centers": 0
      },
      "unii": "H7B263Z7AQ"
    }
  ]
}