{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "969bc145-b52d-2396-bd64-b1dd9f11b44e", "code": "2483-17-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2483-17-2", "code_system": "CAS", "references": [ "123953fb-a8a4-46c3-a2c9-af4d72a7ec07" ] }, { "uuid": "21a79380-9415-3a3e-6245-78eb8c13c919", "code": "7019985", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7019985", "code_system": "PUBCHEM", "references": [ "5ff0c8f6-0300-3072-1496-5700c03f77c1" ] }, { "uuid": "76ad706b-1ef5-3f62-794d-7fdc13259e3e", "code": "899822", "comments": "ORPHAN DRUG|Designated|Prevention of Retinopathy of Prematurity", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=899822", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "ac929484-d6de-4b81-884a-1cd8fe172d46", "code": "H694N9A9AP", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "953da0b8-0ff1-1c63-67cf-0dcebe2a8001", "code": "DTXSID30427206", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30427206", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "3bcfed53-49bf-af92-d6de-1d16cbc6f2ec", "name": "(2S)-5-AZANYL-2-(((2R)-2-AZANYL-5-CARBAMIMIDAMIDO-PENTANOYL)AMINO)-5-OXIDANYLIDENE-PENTANOIC ACID", "stdName": "(2S)-5-AZANYL-2-(((2R)-2-AZANYL-5-CARBAMIMIDAMIDO-PENTANOYL)AMINO)-5-OXIDANYLIDENE-PENTANOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b40f6808-e558-12a9-a679-75a96904127a" ], "display_name": false }, { "uuid": "c3ded3cd-ed1b-4dde-bf9f-2fd45ae1b361", "name": "Arginyl-Glutamine Dipeptide", "stdName": "ARGINYL-GLUTAMINE DIPEPTIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "17aa0c83-35b7-4ecb-9c2f-bebd7bcfd799" ], "display_name": true }, { "uuid": "25b8c792-7c64-4d27-ad2f-78142f78243b", "name": "Arginylglutamine", "stdName": "ARGINYLGLUTAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "123953fb-a8a4-46c3-a2c9-af4d72a7ec07" ], "display_name": false }, { "uuid": "24ca8c57-55f8-4054-964a-a1048d79ae2b", "name": "L-Glutamine, L-arginyl-", "stdName": "L-GLUTAMINE, L-ARGINYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "123953fb-a8a4-46c3-a2c9-af4d72a7ec07" ], "display_name": false } ], "references": [ { "uuid": "b40f6808-e558-12a9-a679-75a96904127a", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "123953fb-a8a4-46c3-a2c9-af4d72a7ec07", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5ff0c8f6-0300-3072-1496-5700c03f77c1", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "17aa0c83-35b7-4ecb-9c2f-bebd7bcfd799", "citation": "FDA", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=899822", "doc_type": "ORPHAN DRUG", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "48c7a830-a004-4a65-b65e-c8d48557695e", "id": "48c7a830-a004-4a65-b65e-c8d48557695e", "molfile": "\n Marvin 01132103492D \n\n 21 20 0 0 0 0 999 V2000\n -1.4290 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4290 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7144 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7144 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 0.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.1434 1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.0013 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1447 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 6 0 0 0\n 8 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 1 0 0 0\n 13 19 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 1 0 0 0 0\nM END", "smiles": "C(C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N)CNC(=N)N", "formula": "C11H22N6O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e13f2180-d842-4a3d-bbf1-b7a440a937d7" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "302.3306", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "3a8b0f45-4c39-45c3-bea5-2ad69a4312f8", "version": "9", "structure": { "id": "d3339f5c-4f1d-45ef-a817-449675dc1dc8", "molfile": "ZINC000002560957\n Marvin 01132110552D \n\n 21 20 0 0 1 0 999 V2000\n -1.4290 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4290 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7144 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7144 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 0.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.1434 1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.0013 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1447 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 6 0 0 0\n 8 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 1 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 13 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 1 0 0 0 0\nM END", "smiles": "C(C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N)CNC(=N)N", "formula": "C11H22N6O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "302.3306", "optical_activity": "UNSPECIFIED", "references": [ "b40f6808-e558-12a9-a679-75a96904127a", "17aa0c83-35b7-4ecb-9c2f-bebd7bcfd799" ], "stereo_centers": 2 }, "modifications": { "uuid": "8eb857fc-7951-4550-82af-82b271ff5392" }, "unii": "H694N9A9AP" } ] }