{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7d39f074-0f74-4efa-a501-a4d2bffc5d2f",
          "code": "LISDEXAMFETAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lisdexamfetamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "6c59c8ed-d3a6-4bf4-8806-1d2064ebfd9d",
          "code": "SUB32170",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "7d535831-6f07-4f4a-bcf1-311cc68024f5",
          "code": "8690",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=8690",
          "code_system": "INN",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "a5e92d4c-6da3-40b3-855a-a9e57e555063",
          "code": "1205",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.12 Schedule II.|Stimulants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "401129e8-bd4b-411b-9ef4-e94c280947bc",
          "code": "7213",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7213",
          "code_system": "IUPHAR",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "47fb95dc-d1a7-4e66-ab01-ea51958c07b2",
          "code": "700810",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/700810/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "56dc003c-d72c-4aff-a840-af5a6a344593",
          "code": "m6841",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6841?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "3ef5e680-4f68-4391-9b4d-9829369fa5db",
          "code": "DB01255",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01255",
          "code_system": "DRUG BANK",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "f73f4ef1-ef10-42b5-9ed0-229315fc224d",
          "code": "CHEMBL1201222",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1201222",
          "code_system": "ChEMBL",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "22cf7937-8c44-4ace-94e2-3024da15119e",
          "code": "11597698",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11597698",
          "code_system": "PUBCHEM",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "ad4479cd-bf9f-42d7-bb16-63a7070b7e94",
          "code": "N06BA12",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Centrally acting sympathomimetics|lisdexamfetamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BA12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "1ad7a51d-647d-41b0-9dea-abdfbc6a034b",
          "code": "N0000175739",
          "comments": "Established Pharmacologic Class [EPC]|Central Nervous System Stimulant [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175739",
          "code_system": "NDF-RT",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "5b644e23-63e1-4260-af00-8edaeb5d2cd2",
          "code": "N0000175729",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Nervous System Activity Alteration [PE]|Central Nervous System Activity Alteration [PE]|Central Nervous System Stimulation [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175729",
          "code_system": "NDF-RT",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "3f1e468d-55a8-4567-9e8d-f18b335f2a16",
          "code": "C75114",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75114",
          "code_system": "NCI_THESAURUS",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "b71f0695-80cd-4955-a15a-0e1ba2c57cb5",
          "code": "QN06BA12",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Centrally acting sympathomimetics|lisdexamfetamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BA12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "dc00758a-ea89-45bb-9859-55a0ae05eba6",
          "code": "608137-32-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=608137-32-2",
          "code_system": "CAS",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63",
            "a6343bc3-b6c7-4ae3-9ad6-4d6167565545"
          ]
        },
        {
          "uuid": "e1aabedb-9081-4ea8-b65d-a54ebed6a2fd",
          "code": "562",
          "comments": "LiverTox|CNS|Stimulant|Sympathomimetic amine",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Amphetamines.htm",
          "code_system": "LIVERTOX",
          "references": [
            "14d55146-0e36-4083-a3f5-5f2479d8ae63"
          ]
        },
        {
          "uuid": "a39eb562-7a0e-00f1-db4c-3bf1a180e859",
          "code": "DTXSID00209652",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00209652",
          "code_system": "EPA CompTox",
          "references": [
            "ac833978-bbd7-9158-38b4-a6e4976c23e2"
          ]
        },
        {
          "uuid": "382b93bd-c3a6-61f7-276a-a9c1d8d2789c",
          "code": "C29728",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anorexiant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29728",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dbf0f326-bc26-c483-2655-ff9f2ac71107"
          ]
        },
        {
          "uuid": "fd1fa28c-6c0a-45ea-af3c-b9f84dca63a3",
          "code": "H645GUL8KJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9290bd4e-3fa2-5ff0-08cc-4a41bfa8c719",
          "code": "Lisdexamfetamine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM834/",
          "code_system": "LACTMED",
          "references": [
            "dbf0f326-bc26-c483-2655-ff9f2ac71107"
          ]
        },
        {
          "uuid": "8fa78f93-0739-cb72-7eab-92e8ab5f68d6",
          "code": "4135",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4135",
          "code_system": "DRUG CENTRAL",
          "references": [
            "dbf0f326-bc26-c483-2655-ff9f2ac71107"
          ]
        },
        {
          "uuid": "3b3d4868-b598-9342-cd21-e5ad4c66969b",
          "code": "H645GUL8KJ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=H645GUL8KJ",
          "code_system": "DAILYMED",
          "references": [
            "9e5ea642-92c2-9b91-0a0f-8c33d741b22e"
          ]
        },
        {
          "uuid": "7ce3b1bd-8f37-a9b2-8e59-ed4d74cd29cc",
          "code": "100000124476",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4bb210c8-c3f3-2037-167b-b4ce44444167"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "e4f59ca0-eeea-4d9e-b12b-4e61142ed828",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d275fb6f-9954-44b1-81ab-e19ef77c4316",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c8aa50f-f5c7-4677-9bcf-250e0a6098d5",
          "citation": "INN Proposed List 95",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL95.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a70d773b-bf26-4e95-b748-1c5f04ce68a5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "368a5251-1087-4f78-bb09-f8ab2907a588",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ee4631b-582a-4e24-a6e8-4037a58075e9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "147ccf86-7253-4cc1-b241-73010f0d7b64",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3816c816-cf30-40a5-9154-264b8648978d",
          "citation": "https://en.wikipedia.org/wiki/Lisdexamfetamine",
          "url": "https://en.wikipedia.org/wiki/Lisdexamfetamine",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14d55146-0e36-4083-a3f5-5f2479d8ae63",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390731000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdba9038-07eb-4287-a38c-339908ff2d02",
          "citation": "VYVANSE LABEL ACCESSED 1/12/2015",
          "url": "http://www.accessdata.fda.gov/drugsatfda_docs/label/2012/021977s022lbl.pdf",
          "doc_type": "FDA APPROVED DRUG LABEL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d84ca84e-a6ea-471d-89a9-00fb642f5e35",
          "citation": "SRS import [H645GUL8KJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H645GUL8KJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390731000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "991853b4-8c26-459f-9254-da99783c6507",
          "citation": "LISDEXAMFETAMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29faa027-4da2-4e56-8221-fd43e0061de6",
          "citation": "LISDEXAMFETAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e74f7aa0-2e1f-4091-bf27-847472e50c48",
          "citation": "LISDEXAMFETAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3ff7726e-ba37-47fb-b97e-88032a3ea542",
          "citation": "LISDEXAMFETAMINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ac833978-bbd7-9158-38b4-a6e4976c23e2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=608137-32-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3170d9f1-9c95-1955-aaf2-5e45da9435f7",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+608137-32-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d3ba47c0-cdd0-162e-06f9-2e6f3327b7ac",
          "citation": "Drug Information Handbook, 2016-2017 - 25th edition;  Lexicomp Drug Reference Handbook;  ISBN13: 9781591953531",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dbf0f326-bc26-c483-2655-ff9f2ac71107",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "88260ae8-3725-4ff9-8d5d-78ca9bc5ab4d",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2007/021977s000_ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d3b4384c-a5b8-4bf0-88f2-c15f55440b6e",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2007/021977s000_ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "076730ef-38dc-42b3-bbdd-0db56fb39a46",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2007/021977s000_ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fdbdb834-eca8-4859-bd11-5a09df1a9502",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2007/021977s000_ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a6343bc3-b6c7-4ae3-9ad6-4d6167565545",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "107f3277-df1c-4bf9-8c09-a9b692db48ec",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2007/021977lbl.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b585b527-c6a5-49e2-a40e-31150c0fd946",
          "citation": "https://www.drugbank.ca/drugs/DB01255",
          "doc_type": "DRUGBANK",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "79e33b13-3a3b-47db-a392-6ef74f26bec0",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2007/021977s000_ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "00c8065e-8982-4bd2-bf38-493fe6c2326f",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2007/021977s000_ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "65932d9c-8f6d-a0ba-fb44-bc1ba46f22c2",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2017/208510lbl.pdf",
          "doc_type": "FDA APPROVED DRUG LABEL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9e5ea642-92c2-9b91-0a0f-8c33d741b22e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1ce48fc7-691d-643f-eb2c-d32f12eccee0",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c5d747cc-8377-45ac-9a50-3bc9c49d0710",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2007/021977s000_ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4bb210c8-c3f3-2037-167b-b4ce44444167",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e7c369b-0642-47e0-a0a5-e6e6aac0c2b3",
          "id": "5e7c369b-0642-47e0-a0a5-e6e6aac0c2b3",
          "molfile": "\n  Marvin  01132104532D          \n\n 19 19  0  0  1  0            999 V2000\n    2.7731   -4.3424    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7764   -5.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0572   -3.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3447   -4.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6268   -3.9389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0858   -4.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0866   -5.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6280   -5.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3468   -5.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4861   -3.9274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2021   -4.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2054   -5.1635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9151   -3.9216    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.9118   -3.0946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6310   -4.3307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3440   -3.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0600   -4.3249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7730   -3.9099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4889   -4.3190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)N",
          "formula": "C15H25N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fb125b85-8786-4881-98b7-ba8532d8cf25"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "263.3791",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1b4238d3-bf7b-4115-a8b7-93bd85d3b269",
      "version": "36",
      "structure": {
        "id": "12532994-904a-44b6-923c-0d0d737e4517",
        "molfile": "\n  Marvin  01132101102D          \n\n 19 19  0  0  1  0            999 V2000\n   10.9749   -4.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9740   -4.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6886   -5.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4073   -4.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4053   -4.0736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6874   -3.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1177   -3.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8336   -4.0674    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.5466   -3.6524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2624   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9754   -3.6466    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.6912   -4.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4043   -3.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1202   -4.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8332   -3.6349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5490   -4.0440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8369   -4.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2657   -4.8884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9722   -2.8197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  5  6  2  0  0  0  0\n 12 13  1  0  0  0  0\n  6  1  1  0  0  0  0\n 13 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n 14 15  1  0  0  0  0\n  5  7  1  0  0  0  0\n 15 16  1  0  0  0  0\n  8 17  1  1  0  0  0\n  7  8  1  0  0  0  0\n 10 18  2  0  0  0  0\n  3  4  2  0  0  0  0\n 11 19  1  1  0  0  0\n  8  9  1  0  0  0  0\n  1  2  2  0  0  0  0\n  9 10  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)N",
        "formula": "C15H25N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "263.3791",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d275fb6f-9954-44b1-81ab-e19ef77c4316",
          "d84ca84e-a6ea-471d-89a9-00fb642f5e35",
          "1c8aa50f-f5c7-4677-9bcf-250e0a6098d5"
        ],
        "stereo_centers": 2
      },
      "unii": "H645GUL8KJ",
      "relationships": [
        {
          "uuid": "5c903020-5fc5-461e-9cb3-b0a8428763a3",
          "amount": {
            "uuid": "59f02e2d-9e02-46d9-90d6-656d85f4aac1"
          },
          "type": "METABOLITE ACTIVE->PRODRUG",
          "references": [
            "fdba9038-07eb-4287-a38c-339908ff2d02"
          ],
          "related_substance": {
            "uuid": "2bbc4c63-5770-4219-81ac-e43f558739a1",
            "refuuid": "5011382e-879d-4a4e-9307-46621a7d0a53",
            "name": "DEXTROAMPHETAMINE",
            "unii": "TZ47U051FI",
            "linking_id": "TZ47U051FI",
            "ref_pname": "DEXTROAMPHETAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ed4a42dc-6f9f-42d6-ba06-7f95cedd17c6",
          "amount": {
            "uuid": "556ca33f-27ca-4f66-a1cf-a6171a23a600"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b8f68e79-83fd-492b-8749-ab1f9f5f5559",
            "refuuid": "1794a4ca-4ee4-41f0-bf7a-6ca9640cb4d4",
            "name": "LISDEXAMFETAMINE DIMESYLATE",
            "unii": "SJT761GEGS",
            "linking_id": "SJT761GEGS",
            "ref_pname": "LISDEXAMFETAMINE DIMESYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "997c44c0-569f-4106-8702-15c6a8faf65f",
          "amount": {
            "uuid": "5aa9e2ad-659f-4e72-8d3f-c2674a8cab06"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "076730ef-38dc-42b3-bbdd-0db56fb39a46"
          ],
          "related_substance": {
            "uuid": "ef04ef00-3eef-4f43-af43-0182a8bfcc37",
            "refuuid": "8ac99325-651e-46b4-becd-a180b670ea9c",
            "name": "Phenylacetone",
            "unii": "O7IZH10V9Y",
            "linking_id": "O7IZH10V9Y",
            "ref_pname": "Phenylacetone"
          }
        },
        {
          "uuid": "06798eef-48bd-40f5-bed8-9773b8d78c8c",
          "amount": {
            "uuid": "6f84a0e3-864e-49a6-b7e1-bd62dc9c6af0"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "fdbdb834-eca8-4859-bd11-5a09df1a9502"
          ],
          "related_substance": {
            "uuid": "6e98dc95-9868-432c-a645-09b7dd557218",
            "refuuid": "947a15e3-7fe9-4ed1-bd40-4693ae32e1b7",
            "name": "HYDROXYAMPHETAMINE",
            "unii": "FQR280JW2N",
            "linking_id": "FQR280JW2N",
            "ref_pname": "HYDROXYAMPHETAMINE"
          }
        },
        {
          "uuid": "47e7c3ae-de48-4d2d-9b90-4a71c0f686d2",
          "amount": {
            "uuid": "f8abcfeb-a305-4084-9ffd-55171d24fd23"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "107f3277-df1c-4bf9-8c09-a9b692db48ec",
            "b585b527-c6a5-49e2-a40e-31150c0fd946"
          ],
          "related_substance": {
            "uuid": "773ad5dd-f8b3-4d6d-8a6b-9968a109ea8d",
            "refuuid": "e86b6ffd-b009-4d29-a2fd-c10b944f4ece",
            "name": "LYSINE",
            "unii": "K3Z4F929H6",
            "linking_id": "K3Z4F929H6",
            "ref_pname": "LYSINE"
          }
        },
        {
          "uuid": "f6f22f63-ff78-4f52-b196-327a16944259",
          "amount": {
            "uuid": "cb3303be-63ce-4da2-8026-a6b873f8f6c5"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "79e33b13-3a3b-47db-a392-6ef74f26bec0"
          ],
          "related_substance": {
            "uuid": "26213756-0d4c-40d8-bb5e-7eaf5c501beb",
            "refuuid": "20344093-4b38-4d4d-b0fc-a04a06d0efe0",
            "name": "P-HYDROXYNOREPHEDRINE",
            "unii": "O6914L7189",
            "linking_id": "O6914L7189",
            "ref_pname": "P-HYDROXYNOREPHEDRINE"
          }
        },
        {
          "uuid": "c5b6e73d-453c-4f3a-9fe3-399dba710ec6",
          "amount": {
            "uuid": "7a96ac3a-f734-401a-8080-a8cf44fd4f62"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "00c8065e-8982-4bd2-bf38-493fe6c2326f"
          ],
          "related_substance": {
            "uuid": "833a92c7-c79c-45b6-9748-fc154d5652f8",
            "refuuid": "0caf03cc-9b4c-4fc3-81c0-59527111aeb9",
            "name": "HIPPURIC ACID",
            "unii": "TE0865N2ET",
            "linking_id": "TE0865N2ET",
            "ref_pname": "HIPPURIC ACID"
          }
        },
        {
          "uuid": "35238df7-6cd2-4973-9fcc-d46c8e3ba399",
          "amount": {
            "uuid": "bb8ad055-3c94-4cae-85b0-84c9f7818abf"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "c5d747cc-8377-45ac-9a50-3bc9c49d0710"
          ],
          "related_substance": {
            "uuid": "8b964d2b-0cd8-4493-a1d6-b579a04ba50d",
            "refuuid": "cfb742e5-bda3-44d8-9d65-1d348ac29e90",
            "name": "PHENYLACETIC ACID",
            "unii": "ER5I1W795A",
            "linking_id": "ER5I1W795A",
            "ref_pname": "PHENYLACETIC ACID"
          }
        },
        {
          "uuid": "35d30b86-a827-4d77-828d-e359cf7a6432",
          "amount": {
            "uuid": "dc7bde35-9794-4a74-b024-5680b4b92067",
            "average": 2,
            "units": "%",
            "non_numeric_value": "of the radioactivity recovered in the urine"
          },
          "qualification": "URINE",
          "type": "EXCRETED UNCHANGED",
          "references": [
            "65932d9c-8f6d-a0ba-fb44-bc1ba46f22c2"
          ],
          "related_substance": {
            "uuid": "a63acd22-6a83-410d-9961-7fc4f0752fec",
            "refuuid": "1b4238d3-bf7b-4115-a8b7-93bd85d3b269",
            "name": "LISDEXAMFETAMINE",
            "unii": "H645GUL8KJ",
            "linking_id": "H645GUL8KJ",
            "ref_pname": "LISDEXAMFETAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d674ffad-437a-4f80-bd4f-c351f3511b3d",
          "amount": {
            "uuid": "22a832cd-44e1-4c08-81c0-9c5d4248a297"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "329a12e2-4793-4b71-8e48-1c921b8f30a4",
            "refuuid": "116bcbc2-dae0-4eeb-81f1-2241086ac717",
            "name": "LISDEXAMFETAMINE SULFATE",
            "unii": "49I8A1C26Y",
            "linking_id": "49I8A1C26Y",
            "ref_pname": "LISDEXAMFETAMINE SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2ed5905b-5fc1-431c-bdf9-ef3885686433",
          "amount": {
            "uuid": "c6760169-a85a-40fb-808c-7ae6d84da7e5"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "78522a74-a820-4b59-80c8-abf562cad089",
            "refuuid": "5011382e-879d-4a4e-9307-46621a7d0a53",
            "name": "DEXTROAMPHETAMINE",
            "unii": "TZ47U051FI",
            "linking_id": "TZ47U051FI",
            "ref_pname": "DEXTROAMPHETAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "be403c74-cc10-40d5-b56a-f017479f328d",
          "name": "(2S)-2,6-Diamino-N-[(1S)-1-methyl-2-phenylethyl]hexanamide",
          "stdName": "(2S)-2,6-DIAMINO-N-((1S)-1-METHYL-2-PHENYLETHYL)HEXANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4f59ca0-eeea-4d9e-b12b-4e61142ed828"
          ],
          "display_name": false
        },
        {
          "uuid": "972bfe4f-2489-4b99-9092-fe241d9141e9",
          "name": "Hexanamide, 2,6-diamino-N-[(1S)-1-methyl-2-phenylethyl]-, (2S)-",
          "stdName": "HEXANAMIDE, 2,6-DIAMINO-N-((1S)-1-METHYL-2-PHENYLETHYL)-, (2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4f59ca0-eeea-4d9e-b12b-4e61142ed828"
          ],
          "display_name": false
        },
        {
          "uuid": "3a3d1b8e-e3ba-4bf6-88f4-1603f9eeb1d5",
          "name": "L-LYSINE-DEXTROAMPHETAMINE",
          "stdName": "L-LYSINE-DEXTROAMPHETAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "368a5251-1087-4f78-bb09-f8ab2907a588",
            "3816c816-cf30-40a5-9154-264b8648978d"
          ],
          "display_name": false
        },
        {
          "uuid": "7f1d3acf-73c3-4368-b002-fb4c5e5f2bd3",
          "name": "LISDEXAMFETAMINE",
          "stdName": "LISDEXAMFETAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "147ccf86-7253-4cc1-b241-73010f0d7b64",
            "3ff7726e-ba37-47fb-b97e-88032a3ea542",
            "368a5251-1087-4f78-bb09-f8ab2907a588",
            "a70d773b-bf26-4e95-b748-1c5f04ce68a5",
            "1ee4631b-582a-4e24-a6e8-4037a58075e9",
            "991853b4-8c26-459f-9254-da99783c6507",
            "d275fb6f-9954-44b1-81ab-e19ef77c4316",
            "e74f7aa0-2e1f-4091-bf27-847472e50c48",
            "1c8aa50f-f5c7-4677-9bcf-250e0a6098d5",
            "29faa027-4da2-4e56-8221-fd43e0061de6"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "cdbc6e1d-6e07-4bfd-8a0d-93b40f3429d1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e9b0ea3e-4a2c-42df-a643-54c8c27bcb69",
          "name": "LISDEXAMFETAMINE [MI]",
          "stdName": "LISDEXAMFETAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "368a5251-1087-4f78-bb09-f8ab2907a588",
            "a70d773b-bf26-4e95-b748-1c5f04ce68a5"
          ],
          "display_name": false
        },
        {
          "uuid": "dc142341-a557-41db-a19d-3afd3571db8d",
          "name": "LISDEXAMFETAMINE [VANDF]",
          "stdName": "LISDEXAMFETAMINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "147ccf86-7253-4cc1-b241-73010f0d7b64",
            "368a5251-1087-4f78-bb09-f8ab2907a588"
          ],
          "display_name": false
        },
        {
          "uuid": "3f5e9e47-ca63-4ed4-8895-fd2a18a3e1d0",
          "name": "LISDEXAMPHETAMINE",
          "stdName": "LISDEXAMPHETAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "368a5251-1087-4f78-bb09-f8ab2907a588",
            "3816c816-cf30-40a5-9154-264b8648978d"
          ],
          "display_name": false
        },
        {
          "uuid": "0293fd5c-0045-0521-5b47-b1c51926d483",
          "name": "Lisdexamfetamine [WHO-DD]",
          "stdName": "LISDEXAMFETAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ce48fc7-691d-643f-eb2c-d32f12eccee0"
          ],
          "display_name": false
        },
        {
          "uuid": "ae34f351-814c-4dcf-88f2-4a8f1c8cc0a3",
          "name": "N-[(1S)-1-Methyl-2-phenylethyl]-L-lysinamide",
          "stdName": "N-((1S)-1-METHYL-2-PHENYLETHYL)-L-LYSINAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6343bc3-b6c7-4ae3-9ad6-4d6167565545"
          ],
          "display_name": false
        },
        {
          "uuid": "68902408-3b6d-4ef3-a493-12da4f7f28b3",
          "name": "lisdexamfetamine [INN]",
          "stdName": "LISDEXAMFETAMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c8aa50f-f5c7-4677-9bcf-250e0a6098d5"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "c661f57c-a4f5-46b3-b03d-7167d5a4b1ad",
          "name": "Biological Half-life",
          "value": {
            "uuid": "c934c650-f2ab-4efd-a497-fd315f6c78c2",
            "average": 1,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "d3ba47c0-cdd0-162e-06f9-2e6f3327b7ac"
          ]
        },
        {
          "uuid": "e166a483-8bc4-4c75-bb49-da7401ad546e",
          "name": "Tmax",
          "value": {
            "uuid": "8e836e51-12ad-4a77-a4fd-a2022019cf2b",
            "average": 1,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "d3ba47c0-cdd0-162e-06f9-2e6f3327b7ac"
          ]
        }
      ]
    }
  ]
}