{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "29d4b3dd-cd34-4792-aeda-afd11f34f6b4",
          "code": "126-13-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126-13-6",
          "code_system": "CAS",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a",
            "1feacf36-1d23-4bd3-a261-4c6c8e9b787b"
          ]
        },
        {
          "uuid": "3c3dc370-1dc8-4d09-be0f-097ff13f8d38",
          "code": "C002885",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67002885",
          "code_system": "MESH",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a"
          ]
        },
        {
          "uuid": "8b59406b-8bb1-45b0-8d53-20d510f948e0",
          "code": "21 CFR 172.833",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart I--Multipurpose Additives|Sec. 172.833 Sucrose acetate isobutyrate (SAIB).",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=172.833",
          "code_system": "CFR",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a"
          ]
        },
        {
          "uuid": "90fa1b67-724c-4b95-adf6-b1dc1160d7a2",
          "code": "SUCROSE ACETATE ISOBUTYRATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sucrose_acetate_isobutyrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a"
          ]
        },
        {
          "uuid": "9d54b1a6-0a9b-42a9-a511-634d5dcca842",
          "code": "INS-444",
          "comments": "JECFA|Functional Classification|ADJUVANT|CLOUDING AGENT|EMULSIFYING SALT",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=444",
          "code_system": "JECFA EVALUATION",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a"
          ]
        },
        {
          "uuid": "93c811f6-c6ca-4b74-b36f-eecb2468e9c1",
          "code": "INS-444",
          "comments": "Codex Alimentarius|Functional Classification|Emulsifier|Stabilizer",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=335",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a"
          ]
        },
        {
          "uuid": "8f50a65e-2cc4-4d10-bd56-d346bc0bccd1",
          "code": "1363646",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363646/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a"
          ]
        },
        {
          "uuid": "9eae86a0-ee50-483e-a261-3bfad7cc1e19",
          "code": "204-771-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.338",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a"
          ]
        },
        {
          "uuid": "66982b62-8c89-4a9f-949a-ff28bbd7b938",
          "code": "31339",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31339",
          "code_system": "PUBCHEM",
          "references": [
            "3b445cec-2b00-487b-97d2-4e5c3191950a"
          ]
        },
        {
          "uuid": "46bb4834-98ec-19a3-e677-1c252637f8cb",
          "code": "5657",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5657",
          "code_system": "HSDB",
          "references": [
            "47422c78-c085-536b-10f8-12cb59c95178"
          ]
        },
        {
          "uuid": "ce9d9e6e-208d-022f-bd55-75c27c4ca5f1",
          "code": "DTXSID3027035",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3027035",
          "code_system": "EPA CompTox",
          "references": [
            "873f6c00-8fcc-8703-6a3a-3c593afe3fbd"
          ]
        },
        {
          "uuid": "14621bab-6180-43c5-b778-0d5a0c2c1ae8",
          "code": "27216-37-1",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27216-37-1",
          "code_system": "CAS",
          "references": [
            "40a8cafa-46a2-40b5-ab4f-ed6ac902ec5d",
            "6f196e90-1638-4e8c-8d40-673e58224e9b"
          ]
        },
        {
          "uuid": "952ba238-260b-c612-9d72-3925c72f7a89",
          "code": "1623580",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1623580",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "86ca86a4-a287-5e33-8320-71d5c3820019"
          ]
        },
        {
          "uuid": "e3b106e2-298d-483b-a03f-2f7893914f43",
          "code": "H5KI1C3YTV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b3e19449-00c2-4fc3-3ae4-04e609734549",
          "code": "H5KI1C3YTV",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=H5KI1C3YTV",
          "code_system": "DAILYMED",
          "references": [
            "a4a8b424-ee7e-9cd7-cb31-8511c9c89a9d"
          ]
        },
        {
          "uuid": "1f9e003c-14d2-bb18-7076-573fa60eef44",
          "code": "100000172964",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6fa49231-5ff9-1c48-8284-1e5b7117b119"
          ]
        },
        {
          "uuid": "fb2847d8-6656-1102-d405-6da5ee8a16d7",
          "code": "104",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=104",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "86ca86a4-a287-5e33-8320-71d5c3820019"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5bc95025-59ac-4883-8e15-e936e4438692",
          "name": ".ALPHA.-D-GLUCOPYRANOSIDE, 6-O-ACETYL-1,3,4-TRIS-O-(2-METHYL-1-OXOPROPYL)-.BETA.-D-FRUCTOFURANOSYL, 6-ACETATE 2,3,4-TRIS(2-METHYLPROPANOATE)",
          "stdName": ".ALPHA.-D-GLUCOPYRANOSIDE, 6-O-ACETYL-1,3,4-TRIS-O-(2-METHYL-1-OXOPROPYL)-.BETA.-D-FRUCTOFURANOSYL, 6-ACETATE 2,3,4-TRIS(2-METHYLPROPANOATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a8cafa-46a2-40b5-ab4f-ed6ac902ec5d"
          ],
          "display_name": false
        },
        {
          "uuid": "638533e7-29ed-4f50-99de-e9124bf8d946",
          "name": "E-444",
          "stdName": "E-444",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ffc8e15-4a68-4284-bda9-4be04ad23f16"
          ],
          "display_name": false
        },
        {
          "uuid": "d26ce555-ebeb-4f92-b14d-d8c261d939dc",
          "name": "E444",
          "stdName": "E444",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a8cafa-46a2-40b5-ab4f-ed6ac902ec5d"
          ],
          "display_name": false
        },
        {
          "uuid": "cb6be07d-f856-4fd8-857e-9e3b840f7494",
          "name": "INS NO.444",
          "stdName": "INS NO.444",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "780ec3da-6796-4302-afd3-8e31454ec221"
          ],
          "display_name": false
        },
        {
          "uuid": "38d89095-545a-42dd-9120-60fd3df3f46f",
          "name": "INS-444",
          "stdName": "INS-444",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "780ec3da-6796-4302-afd3-8e31454ec221"
          ],
          "display_name": false
        },
        {
          "uuid": "47486ba0-36d9-4568-9e6b-56cc06a8e6f8",
          "name": "ISOBUTYRIC ACID, HEXAESTER WITH SUCROSE DIACETATE",
          "stdName": "ISOBUTYRIC ACID, HEXAESTER WITH SUCROSE DIACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74080848-0faa-4617-b0f7-f0d77c9af978"
          ],
          "display_name": false
        },
        {
          "uuid": "bdb9033d-e28c-45c8-8441-b48ea244f133",
          "name": "SAIB",
          "stdName": "SAIB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f1e06ed-b956-45bf-b4cb-2e4b2a5fd717"
          ],
          "display_name": false
        },
        {
          "uuid": "2e7a56e1-909f-42aa-a7c1-88310d3d7ec7",
          "name": "SUCROSE ACETATE ISOBUTANOATE",
          "stdName": "SUCROSE ACETATE ISOBUTANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74080848-0faa-4617-b0f7-f0d77c9af978"
          ],
          "display_name": false
        },
        {
          "uuid": "a8467ced-52dd-4537-a292-6468d8ecceb1",
          "name": "SUCROSE ACETATE ISOBUTYLATE",
          "stdName": "SUCROSE ACETATE ISOBUTYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a8cafa-46a2-40b5-ab4f-ed6ac902ec5d"
          ],
          "display_name": false
        },
        {
          "uuid": "4124ab52-8798-495a-a588-f1f598db295a",
          "name": "SUCROSE ACETATE ISOBUTYRATE",
          "stdName": "SUCROSE ACETATE ISOBUTYRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fad524a-e871-446b-8d97-2d7d6a83cfee",
            "d4e88f42-dd3b-425b-b06c-ce44dd3f0cf0",
            "b7614848-caf7-44a8-8447-ca3091fad4b9",
            "40a8cafa-46a2-40b5-ab4f-ed6ac902ec5d",
            "258e0c99-3850-4caa-bdb8-2e5d4e843945",
            "c343e911-d177-48e9-9962-8866b6772bb3",
            "962c8b6e-15af-41ec-a3cd-a8e6b8534511",
            "724a29d7-df48-485e-af31-4425f8d011d1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "28d5c262-1285-4ae7-990d-4fcc19af9433",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2d2f3ef4-3933-4be1-839e-b036c27bbb11",
          "name": "SUCROSE ACETATE ISOBUTYRATE [FCC]",
          "stdName": "SUCROSE ACETATE ISOBUTYRATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4e88f42-dd3b-425b-b06c-ce44dd3f0cf0"
          ],
          "display_name": false
        },
        {
          "uuid": "4f6b79a0-a493-4a5d-90ba-b7687356d351",
          "name": "SUCROSE ACETATE ISOBUTYRATE [HSDB]",
          "stdName": "SUCROSE ACETATE ISOBUTYRATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "962c8b6e-15af-41ec-a3cd-a8e6b8534511"
          ],
          "display_name": false
        },
        {
          "uuid": "2aeaa579-2580-f607-597b-42f2131bf0bd",
          "name": "SUCROSE DIACETATE HEXAISOBUTYRATE",
          "stdName": "SUCROSE DIACETATE HEXAISOBUTYRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a8cafa-46a2-40b5-ab4f-ed6ac902ec5d"
          ],
          "display_name": false
        },
        {
          "uuid": "22af4ed1-f9dc-2561-4d14-1256686158bd",
          "name": "SUCROSE DIACETATE HEXAISOBUTYRATE [USP-RS]",
          "stdName": "SUCROSE DIACETATE HEXAISOBUTYRATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62ee8c1f-7b03-04bc-8c68-d9b90491a806"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "40a8cafa-46a2-40b5-ab4f-ed6ac902ec5d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "724a29d7-df48-485e-af31-4425f8d011d1",
          "citation": "CTFA DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f1e06ed-b956-45bf-b4cb-2e4b2a5fd717",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ffc8e15-4a68-4284-bda9-4be04ad23f16",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74080848-0faa-4617-b0f7-f0d77c9af978",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7614848-caf7-44a8-8447-ca3091fad4b9",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4e88f42-dd3b-425b-b06c-ce44dd3f0cf0",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "962c8b6e-15af-41ec-a3cd-a8e6b8534511",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "780ec3da-6796-4302-afd3-8e31454ec221",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=335",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=335",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b445cec-2b00-487b-97d2-4e5c3191950a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390901000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5b2ee17-3bde-40ef-a3c7-8efa1e31cd2b",
          "citation": "SRS import [H5KI1C3YTV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H5KI1C3YTV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390901000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03b64184-4a7f-4b57-97ae-c21ddb5f59fb",
          "citation": "personal care products council",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fad524a-e871-446b-8d97-2d7d6a83cfee",
          "citation": "SUCROSE ACETATE ISOBUTYRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c343e911-d177-48e9-9962-8866b6772bb3",
          "citation": "SUCROSE ACETATE ISOBUTYRATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "258e0c99-3850-4caa-bdb8-2e5d4e843945",
          "citation": "SUCROSE ACETATE ISOBUTYRATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "47422c78-c085-536b-10f8-12cb59c95178",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+126-13-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "873f6c00-8fcc-8703-6a3a-3c593afe3fbd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126-13-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62ee8c1f-7b03-04bc-8c68-d9b90491a806",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "1feacf36-1d23-4bd3-a261-4c6c8e9b787b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6f196e90-1638-4e8c-8d40-673e58224e9b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "86ca86a4-a287-5e33-8320-71d5c3820019",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a4a8b424-ee7e-9cd7-cb31-8511c9c89a9d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "6fa49231-5ff9-1c48-8284-1e5b7117b119",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f406af0b-8b0e-4df6-9479-fbe7f011dc71",
          "id": "f406af0b-8b0e-4df6-9479-fbe7f011dc71",
          "molfile": "\n  Marvin  01132112392D          \n\n 59 60  0  0  1  0            999 V2000\n    8.8203   -8.0176    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.0996   -8.4294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0996   -9.2461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3676   -9.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6771   -9.2175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3676  -10.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6725  -11.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9606  -11.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0507   -7.6762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1368   -6.8634    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.4275   -7.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7001   -6.8546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9908   -7.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9908   -8.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2748   -6.8556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4615   -5.6915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7732   -4.5244    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.9424   -4.5244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5281   -3.8181    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.7039   -3.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2778   -4.5301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4547   -4.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0440   -5.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0428   -3.8209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9364   -3.0976    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.5246   -2.3888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6956   -2.3888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2797   -3.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2768   -1.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6282   -0.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7423   -1.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7609   -3.0976    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.1608   -2.3783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7490   -1.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9175   -1.6641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1548   -0.9446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7426   -0.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7366    0.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1774   -3.8113    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.0082   -3.8113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7177   -3.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4319   -3.8014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7177   -2.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1938   -1.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3524   -1.9979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9410   -6.6978    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.2812   -5.9455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9904   -5.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9904   -4.7110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7043   -5.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5246   -5.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7465   -6.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3578   -7.4154    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.1815   -7.5009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5933   -8.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1801   -8.9221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4134   -8.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7864   -7.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5940   -9.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  9  1  0  0  0  0\n 53  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 16  1  1  0  0  0\n 46 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 17 16  1  1  0  0  0\n 17 18  1  0  0  0  0\n 39 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  6  0  0  0\n 25 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 26  1  1  0  0  0\n 32 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 27  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 32 33  1  6  0  0  0\n 32 39  1  0  0  0  0\n 34 33  1  0  0  0  0\n 35 34  2  0  0  0  0\n 36 34  1  0  0  0  0\n 36 37  1  0  0  0  0\n 36 38  1  0  0  0  0\n 39 40  1  1  0  0  0\n 41 40  1  0  0  0  0\n 42 41  2  0  0  0  0\n 43 41  1  0  0  0  0\n 43 44  1  0  0  0  0\n 43 45  1  0  0  0  0\n 46 47  1  1  0  0  0\n 53 46  1  0  0  0  0\n 48 47  1  0  0  0  0\n 49 48  2  0  0  0  0\n 50 48  1  0  0  0  0\n 50 51  1  0  0  0  0\n 50 52  1  0  0  0  0\n 53 54  1  6  0  0  0\n 55 54  1  0  0  0  0\n 56 55  2  0  0  0  0\n 57 55  1  0  0  0  0\n 57 58  1  0  0  0  0\n 57 59  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C(=O)OC[C@@H]1[C@H]([C@@H]([C@@](COC(=O)C)(O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](COC(=O)C)O2)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C",
          "formula": "C40H62O19",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fddc4e8a-40a0-4bd8-b500-525fd97f09ed"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "846.9105",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b26fdff1-1b2c-491b-b41c-33b0f5cbfee2",
      "version": "17",
      "structure": {
        "id": "1c807f0b-f3a3-45f3-a7a2-aa0af6774c7d",
        "molfile": "\n  Marvin  01132101392D          \n\n 60 61  0  0  1  0            999 V2000\n    5.9871   -8.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9871   -7.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2715   -6.8514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6960   -6.8504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4229   -7.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1318   -6.8592    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4569   -5.6880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7690   -4.5216    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9387   -4.5216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5247   -3.8157    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7010   -3.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2752   -4.5273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4526   -4.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0421   -5.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0409   -3.8185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9327   -3.0957    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.5212   -2.3873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6927   -2.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2742   -1.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6253   -0.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7400   -1.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2771   -3.0966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7567   -3.0957    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1564   -2.3768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7448   -1.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1504   -0.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7378   -0.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7324    0.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9138   -1.6631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1730   -3.8089    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.0033   -3.8089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7123   -3.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7123   -2.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1887   -1.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3466   -1.9967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4261   -3.7991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7702   -4.5216    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0457   -7.6715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8149   -8.0126    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.0946   -8.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -9.2404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3630   -9.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3630  -10.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6684  -11.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9557  -11.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6730   -9.2118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3520   -7.4108    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.1752   -7.4963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5868   -8.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4064   -8.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7791   -7.4861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5868   -9.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1738   -8.9166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9355   -6.6937    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2755   -5.9418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9842   -5.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6977   -5.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5175   -5.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7399   -6.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9842   -4.7081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  6  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  6  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 10 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 22 18  2  0  0  0  0\n 16 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 29 25  2  0  0  0  0\n 23 30  1  0  0  0  0\n 30 31  1  1  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 35  1  0  0  0  0\n 36 32  2  0  0  0  0\n 30  8  1  0  0  0  0\n  8 37  1  6  0  0  0\n 38  6  1  0  0  0  0\n 39 38  1  0  0  0  0\n 39 40  1  1  0  0  0\n 41 40  1  0  0  0  0\n 42 41  1  0  0  0  0\n 43 42  1  0  0  0  0\n 43 44  1  0  0  0  0\n 43 45  1  0  0  0  0\n 46 42  2  0  0  0  0\n 47 39  1  0  0  0  0\n 47 48  1  6  0  0  0\n 49 48  1  0  0  0  0\n 50 49  1  0  0  0  0\n 50 51  1  0  0  0  0\n 50 52  1  0  0  0  0\n 53 49  2  0  0  0  0\n 47 54  1  0  0  0  0\n 54 55  1  1  0  0  0\n 56 55  1  0  0  0  0\n 57 56  1  0  0  0  0\n 57 58  1  0  0  0  0\n 57 59  1  0  0  0  0\n 60 56  2  0  0  0  0\n 54  6  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C(=O)OC[C@@H]1[C@H]([C@@H]([C@@](COC(=O)C)(O1)O[C@]2([H])[C@@H]([C@H]([C@@H]([C@@H](COC(=O)C)O2)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C",
        "formula": "C40H62O19",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "846.9105",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b5b2ee17-3bde-40ef-a3c7-8efa1e31cd2b",
          "03b64184-4a7f-4b57-97ae-c21ddb5f59fb"
        ],
        "stereo_centers": 9
      },
      "unii": "H5KI1C3YTV"
    }
  ]
}