{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c1b46d6b-4e7c-4e22-a693-fbbc5770f005", "code": "R06AB01", "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Substituted alkylamines|brompheniramine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=R06AB01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "9169a0d5-a408-4c90-a73c-49b8de1c1edb", "code": "QR06AB51", "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Substituted alkylamines|brompheniramine, combinations", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AB51&showdescription=yes", "code_system": "WHO-VATC", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "38ae604c-4806-4858-b7b1-d2a09d210000", "code": "QR06AB01", "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Substituted alkylamines|brompheniramine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AB01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "24711d89-bbbf-4571-bbf2-1d5b0cf1927e", "code": "C61655", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61655", "code_system": "NCI_THESAURUS", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "05409efb-51c1-4c2e-b6cf-08153034b738", "code": "86-22-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=86-22-6", "code_system": "CAS", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497", "42f2d25a-a3e0-4370-9a68-149a86c178b7" ] }, { "uuid": "007f8688-7230-47cf-89d2-67912d7a874d", "code": "D001977", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68001977", "code_system": "MESH", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "63381e5a-7eaf-41aa-a3d4-8caabbd0df7c", "code": "124", "comments": "LiverTox|Respiratory|Allergy symptoms|Antihistamine", "type": "PRIMARY", "url": "https://livertox.nlm.nih.gov/Brompheniramine.htm", "code_system": "LIVERTOX", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "06a664e9-5230-4d2f-9cb6-531e07ec3e2f", "code": "BROMPHENIRAMINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Brompheniramine", "code_system": "WIKIPEDIA", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "c50c99e5-668f-497a-be83-3e9c890f09fc", "code": "R06AB51", "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Substituted alkylamines|brompheniramine, combinations", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=R06AB51&showdescription=yes", "code_system": "WHO-ATC", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "87af7a5f-1731-485c-b96a-0d0135bbde72", "code": "SUB05924MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "ba940a7c-4791-4653-a07a-0dafc59cd245", "code": "770", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=770", "code_system": "INN", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "40718cef-79d1-47a7-8076-ed5dbf76bdfe", "code": "201-657-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.507", "code_system": "ECHA (EC/EINECS)", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "859c89d8-39f6-4ae0-94be-e8d6a58121ee", "code": "7133", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7133", "code_system": "IUPHAR", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "b996b5f8-680d-4221-9804-eb83d28fb669", "code": "1767", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1767/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "b927e70f-e499-4cfb-9fc5-a1e308f67b38", "code": "m2723", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m2723?q=authorize", "code_system": "MERCK INDEX", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "3a298391-9f9a-4beb-9e9c-18a8792fa3da", "code": "DB00835", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00835", "code_system": "DRUG BANK", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "3ad7ea3b-2237-4cd7-ba2b-c55ca72d56c5", "code": "32188-07-1", "type": "SUPERSEDED", "url": "https://commonchemistry.cas.org/detail?cas_rn=32188-07-1", "code_system": "CAS", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497", "da3e856c-83ae-4bfb-a6c1-62776de54ff6" ] }, { "uuid": "6f06b639-45f8-42dd-a71a-3adc0598fd71", "code": "156428-33-0", "type": "SUPERSEDED", "url": "https://commonchemistry.cas.org/detail?cas_rn=156428-33-0", "code_system": "CAS", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497", "dadccc44-6765-4331-a73a-42a947310263" ] }, { "uuid": "3474e1ec-956b-4cd4-bd64-219e388ab02e", "code": "CHEMBL811", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL811", "code_system": "ChEMBL", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "210a10ad-f028-4312-bc65-b3f5824eaaf9", "code": "6834", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6834", "code_system": "PUBCHEM", "references": [ "fc059b5a-fa32-4df6-872c-39d9bfacc497" ] }, { "uuid": "396c0b62-2733-e239-1309-3a4071d37283", "code": "3017", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3017", "code_system": "HSDB", "references": [ "a47cba31-708c-f06b-ce0c-e0a495b51fc0" ] }, { "uuid": "6ab174e7-0138-37b5-406c-ba254ea509ff", "code": "DTXSID5022691", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5022691", "code_system": "EPA CompTox", "references": [ "1e5ca8b1-e2ed-8860-ed1a-da60dce53a93" ] }, { "uuid": "a01258ab-f0fd-56c5-5e0c-3b456242b80c", "code": "C29578", "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578", "code_system": "NCI_THESAURUS", "references": [ "481e7921-888e-8b06-2df4-13bf26c03ee7" ] }, { "uuid": "5d9f048a-403b-42d7-8728-1a41a2eb45e8", "code": "H57G17P2FN", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d5e41af1-1ef1-ab92-2759-724863d05abd", "code": "Brompheniramine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM34/", "code_system": "LACTMED", "references": [ "481e7921-888e-8b06-2df4-13bf26c03ee7" ] }, { "uuid": "321856a5-b7e5-4414-1c9b-9ac51662be34", "code": "408", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/408", "code_system": "DRUG CENTRAL", "references": [ "481e7921-888e-8b06-2df4-13bf26c03ee7" ] }, { "uuid": "d121d45b-00ae-1999-cb55-972d5e58f13e", "code": "3183", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3183", "code_system": "CHEBI", "references": [ "481e7921-888e-8b06-2df4-13bf26c03ee7" ] }, { "uuid": "9d88bbd5-653b-9ac1-714d-8909f534c9d3", "code": "100000092553", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "7ce164e3-c83d-1076-12bd-e4a60d8a02ef" ] }, { "uuid": "48c126f4-3259-41cd-ed9b-024bc89ec84c", "code": "H57G17P2FN", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=H57G17P2FN", "code_system": "DAILYMED", "references": [ "0969ac8a-f386-04c2-a9fb-c834f171f764" ] } ], "substance_class": "chemical", "references": [ { "uuid": "9a7c3e86-e3ab-40e7-9652-bc59e3e50537", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2f667a69-8d3f-437b-8f2b-b6a771ead66b", "citation": "INN Proposed List 8", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6e7e0048-7479-4181-8753-083a7c725d11", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "01db9a3b-8925-404a-bf56-b6cd86cde3dc", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8da1df77-ad78-48cb-9eb8-fc3de4339d03", "citation": "D07543", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1133542c-68c2-484c-b44a-203997889596", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "379c9d96-13f0-445e-8d80-ea0b40e83afa", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "75a9fde0-08d2-4823-b3a6-fadeba07b913", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fc059b5a-fa32-4df6-872c-39d9bfacc497", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390965000, "tags": [ "NOMEN" ] }, { "uuid": "374e8a05-5cba-482e-9dfe-20d08124d923", "citation": "https://en.wikipedia.org/wiki/Brompheniramine", "url": "https://en.wikipedia.org/wiki/Brompheniramine", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9574c4b1-9a7f-4d1e-ae45-a331eef78a27", "citation": "SRS import [H57G17P2FN]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H57G17P2FN", "doc_type": "SRS", "public_domain": true, "document_date": 1493390965000, "tags": [ "NOMEN" ] }, { "uuid": "5e7d8abd-8d71-4e62-ab02-7ec1a89e1feb", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e4c72538-b4ba-40e8-ada7-2b3cded6e479", "citation": "BROMPHENIRAMINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "24fbecda-06b0-4b84-8a01-60eefbc863e8", "citation": "BROMPHENIRAMINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1c263403-7b9a-4128-9a00-7f258928e7ea", "citation": "BROMPHENIRAMINE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "825f16ad-1994-43d0-b68b-96ba9cc0c36f", "citation": "BROMPHENIRAMINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "366f9026-3817-41b5-9f48-b45d518bba02", "citation": "BROMPHENIRAMINE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a47cba31-708c-f06b-ce0c-e0a495b51fc0", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+86-22-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1e5ca8b1-e2ed-8860-ed1a-da60dce53a93", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=86-22-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5432f373-b317-83e1-bce2-9ac6aa38f016", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+86-22-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a64d8b13-8a87-d7e5-d831-fd5343f982f1", "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549064#f_pharmacokinetics", "doc_type": "LEPINDEX", "public_domain": true }, { "uuid": "481e7921-888e-8b06-2df4-13bf26c03ee7", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "da3e856c-83ae-4bfb-a6c1-62776de54ff6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "dadccc44-6765-4331-a73a-42a947310263", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "42f2d25a-a3e0-4370-9a68-149a86c178b7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "f375fd78-398f-34df-670b-29d8ff967d3e", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "0969ac8a-f386-04c2-a9fb-c834f171f764", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "7ce164e3-c83d-1076-12bd-e4a60d8a02ef", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "dbf9c275-9b4f-44b9-a783-eb3d9f46bc65", "id": "dbf9c275-9b4f-44b9-a783-eb3d9f46bc65", "molfile": "\n Marvin 01132111242D \n\n 19 20 0 0 0 0 999 V2000\n 4.8833 -5.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6066 -4.8833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3181 -5.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6144 -4.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8989 -3.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9068 -2.8072 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.6261 -2.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6301 -1.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3612 -1.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0650 -1.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7843 -1.1769 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0650 -2.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3338 -2.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2772 -2.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5696 -2.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8463 -2.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8307 -1.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5345 -1.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2617 -1.5679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 14 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 13 7 2 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 19 14 2 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "CN(C)CCC(c1ccc(cc1)Br)c2ccccn2", "formula": "C16H19BrN2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c387554e-095e-46ee-905b-6df34bb247ee" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "319.2396", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "629d4c55-b52c-4f95-8b4d-9b41eec59233", "version": "18", "structure": { "id": "df5609cf-1ec2-4538-a161-85e8b32fd561", "molfile": "\n Marvin 01132111342D \n\n 19 20 0 0 0 0 999 V2000\n 4.9068 -2.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8989 -3.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2617 -1.5679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6261 -2.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2772 -2.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3338 -2.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6301 -1.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6144 -4.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6066 -4.8833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0650 -1.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3612 -1.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0650 -2.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7843 -1.1769 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5345 -1.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5696 -2.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8833 -5.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3181 -5.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8307 -1.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8463 -2.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 5 2 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 4 2 0 0 0 0\n 7 4 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 7 2 0 0 0 0\n 12 6 1 0 0 0 0\n 13 10 1 0 0 0 0\n 14 3 1 0 0 0 0\n 15 5 1 0 0 0 0\n 16 9 1 0 0 0 0\n 17 9 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 15 2 0 0 0 0\n 10 12 2 0 0 0 0\n 18 14 2 0 0 0 0\nM END", "smiles": "CN(C)CCC(c1ccc(cc1)Br)c2ccccn2", "formula": "C16H19BrN2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "319.2396", "optical_activity": "( + / - )", "references": [ "5e7d8abd-8d71-4e62-ab02-7ec1a89e1feb", "9574c4b1-9a7f-4d1e-ae45-a331eef78a27", "2f667a69-8d3f-437b-8f2b-b6a771ead66b" ], "stereo_centers": 1 }, "unii": "H57G17P2FN", "relationships": [ { "uuid": "330cbf98-d771-468c-8d6d-0595294eb66a", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "e8225c08-3365-47df-b266-e775b1c14aca", "refuuid": "629d4c55-b52c-4f95-8b4d-9b41eec59233", "name": "BROMPHENIRAMINE", "unii": "H57G17P2FN", "linking_id": "H57G17P2FN", "ref_pname": "BROMPHENIRAMINE", "substance_class": "reference" } }, { "uuid": "ffcf4183-846c-489b-b4a3-bb2a71811fdf", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "1aad6fd4-e6ba-4a83-9e43-2354d450de89", "refuuid": "9cbb4e4c-63d9-4302-a61d-6f555248b0ce", "name": "BROMPHENIRAMINE MALEATE", "unii": "IXA7C9ZN03", "linking_id": "IXA7C9ZN03", "ref_pname": "BROMPHENIRAMINE MALEATE", "substance_class": "reference" } }, { "uuid": "8a788dd0-4ca5-4fed-a40f-aa3b0541f78b", "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "09111a82-0563-4a64-bc16-f6591e2d7856", "refuuid": "1407062a-704e-4a72-831b-79c5e23ef588", "name": "DEXBROMPHENIRAMINE", "unii": "75T64B71RP", "linking_id": "75T64B71RP", "ref_pname": "DEXBROMPHENIRAMINE", "substance_class": "reference" } }, { "uuid": "a9179d21-9fa0-4fba-97a8-85ea8b61fc25", "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "ce74a979-aec4-449a-976a-b08d78226abb", "refuuid": "84fe0fe7-a509-47f1-b7c2-db8fb7481b78", "name": "BROMPHENIRAMINE, (R)-", "unii": "Z4L2A7J0MC", "linking_id": "Z4L2A7J0MC", "ref_pname": "BROMPHENIRAMINE, (R)-", "substance_class": "reference" } }, { "uuid": "df9be59e-faa7-46b6-971c-1427f74d58b7", "type": "TARGET->INHIBITOR", "references": [ "374e8a05-5cba-482e-9dfe-20d08124d923" ], "related_substance": { "uuid": "729c9423-7225-4655-80a6-2c5ec3aa699b", "refuuid": "23559f52-21c8-4b43-92f1-981b36cdfe1d", "name": "HISTAMINE H1 RECEPTOR", "unii": "28XBT591QG", "linking_id": "28XBT591QG", "ref_pname": "HISTAMINE H1 RECEPTOR", "substance_class": "reference" } }, { "uuid": "82ca08e1-8744-47f4-b077-46be8c06b072", "amount": { "uuid": "38c109e0-a0e9-4789-8c6c-4bc2543cc641", "high": 49, "low": 39, "units": "%" }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "a64d8b13-8a87-d7e5-d831-fd5343f982f1" ], "related_substance": { "uuid": "f3a363dc-2ac0-4825-af0f-d25fd73ab80c", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } } ], "names": [ { "uuid": "f2d41aa0-0c2d-41b2-9433-c568a21d515c", "name": "BROMPHENIRAMINE", "stdName": "BROMPHENIRAMINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "24fbecda-06b0-4b84-8a01-60eefbc863e8", "366f9026-3817-41b5-9f48-b45d518bba02", "379c9d96-13f0-445e-8d80-ea0b40e83afa", "6e7e0048-7479-4181-8753-083a7c725d11", "e4c72538-b4ba-40e8-ada7-2b3cded6e479", "1133542c-68c2-484c-b44a-203997889596", "75a9fde0-08d2-4823-b3a6-fadeba07b913", "9a7c3e86-e3ab-40e7-9652-bc59e3e50537", "2f667a69-8d3f-437b-8f2b-b6a771ead66b", "825f16ad-1994-43d0-b68b-96ba9cc0c36f", "1c263403-7b9a-4128-9a00-7f258928e7ea" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "93efd133-9c99-4534-865f-e72aa5bce565", "name_org": "INN" } ] }, { "uuid": "d7ed7fd9-98d1-4f5a-b19c-f4e8b6472e2f", "name": "BROMPHENIRAMINE [HSDB]", "stdName": "BROMPHENIRAMINE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1133542c-68c2-484c-b44a-203997889596" ], "display_name": false }, { "uuid": "e52642cc-6c7b-4a2d-a2d0-d987103108bf", "name": "BROMPHENIRAMINE [MI]", "stdName": "BROMPHENIRAMINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6e7e0048-7479-4181-8753-083a7c725d11" ], "display_name": false }, { "uuid": "e0abb7eb-1860-46ea-9f2f-40c4bcb0d88c", "name": "BROMPHENIRAMINE [VANDF]", "stdName": "BROMPHENIRAMINE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "75a9fde0-08d2-4823-b3a6-fadeba07b913" ], "display_name": false }, { "uuid": "68b34e31-e597-4d43-977a-5d8597125e0b", "name": "BROTANE", "stdName": "BROTANE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "01db9a3b-8925-404a-bf56-b6cd86cde3dc", "8da1df77-ad78-48cb-9eb8-fc3de4339d03" ], "display_name": false }, { "uuid": "28959c2b-69fb-8512-2172-27be7132a99f", "name": "Brompheniramine [WHO-DD]", "stdName": "BROMPHENIRAMINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f375fd78-398f-34df-670b-29d8ff967d3e" ], "display_name": false }, { "uuid": "acfc0245-09bf-4613-8c68-3750fbbdfb88", "name": "brompheniramine [INN]", "stdName": "BROMPHENIRAMINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2f667a69-8d3f-437b-8f2b-b6a771ead66b" ], "display_name": false } ], "properties": [ { "uuid": "c1633944-5c6a-4216-9287-396cd45d0d33", "name": "Biological Half-life", "value": { "uuid": "28580af8-d671-488c-b627-77fe26bc5790", "average": 25, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "a64d8b13-8a87-d7e5-d831-fd5343f982f1" ] }, { "uuid": "b9a376b1-a637-4590-bc44-1e7ed019e5ac", "name": "Volume of Distribution", "value": { "uuid": "9d2d687e-271a-487c-ba8b-c1c8c0c8324a", "average": 12, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "a64d8b13-8a87-d7e5-d831-fd5343f982f1" ] } ] } ] }