{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3e39463a-44da-4777-b2b5-728c087a50a2",
          "code": "125-67-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=125-67-7",
          "code_system": "CAS",
          "references": [
            "7ae39ec1-dc1d-4ca8-8281-762a36eb5352",
            "323ad938-ceb5-4450-9720-8ac14e861854"
          ]
        },
        {
          "uuid": "04efef2f-9ca0-4382-ab72-763cecbc172c",
          "code": "C007842",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007842",
          "code_system": "MESH",
          "references": [
            "7ae39ec1-dc1d-4ca8-8281-762a36eb5352"
          ]
        },
        {
          "uuid": "13bb7c3f-5683-4b9e-874e-55b9de5821fa",
          "code": "21 CFR 172.725",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart H--Other Specific Usage Additives|Sec. 172.725 Gibberellic acid and its potassium salt.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=172.725",
          "code_system": "CFR",
          "references": [
            "7ae39ec1-dc1d-4ca8-8281-762a36eb5352"
          ]
        },
        {
          "uuid": "629b930e-8dca-4260-9701-7ab75391425b",
          "code": "43802",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2454",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7ae39ec1-dc1d-4ca8-8281-762a36eb5352"
          ]
        },
        {
          "uuid": "f7d158c9-3dec-45cb-9040-4b69f98cf4a4",
          "code": "204-749-6",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7ae39ec1-dc1d-4ca8-8281-762a36eb5352"
          ]
        },
        {
          "uuid": "ce90e28f-4849-4b21-b192-6de9dcf9fde5",
          "code": "71299661",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71299661",
          "code_system": "PUBCHEM",
          "references": [
            "7ae39ec1-dc1d-4ca8-8281-762a36eb5352"
          ]
        },
        {
          "uuid": "c334292f-6c85-eead-d77b-9912719a7cfa",
          "code": "DTXSID6035605",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6035605",
          "code_system": "EPA CompTox",
          "references": [
            "18493f64-019c-7d9c-cce3-2576790e52a8"
          ]
        },
        {
          "uuid": "45034fe8-6e31-45df-a4d4-9279f0a91861",
          "code": "H52L7VZB7S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "918c68a7-f5d9-2772-9968-577dfd57365c",
          "code": "potassium gibberellate",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/potassium gibberellate.html",
          "code_system": "ALANWOOD",
          "references": [
            "a7f4c852-9250-c8b5-14e6-40197d70de89"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "feffe68a-5c69-42ba-96c3-140f356e236d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "40aa8518-c863-4dab-8674-c7b4f2eac216",
            "refuuid": "00957841-7dae-403d-ad3a-fc75928221d1",
            "name": "GIBBERELLIC ACID",
            "unii": "BU0A7MWB6L",
            "linking_id": "BU0A7MWB6L",
            "ref_pname": "GIBBERELLIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8e73caf7-75b8-4294-a785-a477540a9bb3",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "6e3e572a-ea0f-40de-81e5-e62bfb6ee194",
            "refuuid": "00957841-7dae-403d-ad3a-fc75928221d1",
            "name": "GIBBERELLIC ACID",
            "unii": "BU0A7MWB6L",
            "linking_id": "BU0A7MWB6L",
            "ref_pname": "GIBBERELLIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ba980888-0ca2-4284-90d4-59616602ca02",
          "name": "GIBB-3-ENE-1,10-DICARBOXYLIC ACID, 2,4A,7-TRIHYDROXY-1-METHYL-8-METHYLENE-, 1,4A-LACTONE, MONOPOTASSIUM SALT, (1.ALPHA.,2.BETA.,4A.ALPHA.,4B.BETA.,10.BETA.)-",
          "stdName": "GIBB-3-ENE-1,10-DICARBOXYLIC ACID, 2,4A,7-TRIHYDROXY-1-METHYL-8-METHYLENE-, 1,4A-LACTONE, MONOPOTASSIUM SALT, (1.ALPHA.,2.BETA.,4A.ALPHA.,4B.BETA.,10.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fce654f-f4d4-407f-a4bf-0ffec3bc1ad2",
            "5eb81d4b-314f-4360-a598-b724fa077078"
          ],
          "display_name": false
        },
        {
          "uuid": "bb1f571c-b0aa-44ef-8d98-3157f2813da3",
          "name": "GIBBERELLIC ACID, MONOPOTASSIUM SALT",
          "stdName": "GIBBERELLIC ACID, MONOPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fce654f-f4d4-407f-a4bf-0ffec3bc1ad2",
            "5eb81d4b-314f-4360-a598-b724fa077078"
          ],
          "display_name": false
        },
        {
          "uuid": "c8e8436d-fb63-2325-9f52-710b467fc264",
          "name": "GIBBERELLIC ACID, POTASSIUM SALT",
          "stdName": "GIBBERELLIC ACID, POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b95de8d-90a5-65e5-2ba7-671f8292299c"
          ],
          "display_name": false
        },
        {
          "uuid": "ae99affc-475d-43fa-ac0f-5afa3188f8f3",
          "name": "K-GA",
          "stdName": "K-GA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fce654f-f4d4-407f-a4bf-0ffec3bc1ad2",
            "5eb81d4b-314f-4360-a598-b724fa077078"
          ],
          "display_name": false
        },
        {
          "uuid": "d965f6ff-6ee0-4b58-ad3f-fab14b210e5c",
          "name": "POTASSIUM GIBBERELLATE",
          "stdName": "POTASSIUM GIBBERELLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fce654f-f4d4-407f-a4bf-0ffec3bc1ad2",
            "59ea03fb-ac38-4c9c-b8e3-6200885d7db8",
            "34b7de46-e589-4242-9fbd-c70b4d3539ae",
            "5eb81d4b-314f-4360-a598-b724fa077078"
          ],
          "display_name": true
        },
        {
          "uuid": "ce5e4b62-fb7e-49d1-89c6-0baae1432e48",
          "name": "POTASSIUM GIBBERELLATE [FCC]",
          "stdName": "POTASSIUM GIBBERELLATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fce654f-f4d4-407f-a4bf-0ffec3bc1ad2",
            "34b7de46-e589-4242-9fbd-c70b4d3539ae"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5eb81d4b-314f-4360-a598-b724fa077078",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1fce654f-f4d4-407f-a4bf-0ffec3bc1ad2",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34b7de46-e589-4242-9fbd-c70b4d3539ae",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ae39ec1-dc1d-4ca8-8281-762a36eb5352",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fbbbb5d-8ff2-445c-af13-820041f4f1dc",
          "citation": "SRS import [H52L7VZB7S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H52L7VZB7S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e85210e-af09-4bfe-90d7-10184c30e933",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59ea03fb-ac38-4c9c-b8e3-6200885d7db8",
          "citation": "POTASSIUM GIBBERELLATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "18493f64-019c-7d9c-cce3-2576790e52a8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=125-67-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b95de8d-90a5-65e5-2ba7-671f8292299c",
          "citation": "tkb",
          "doc_type": "TOBACCO KNOWLEDGE BASE",
          "public_domain": true
        },
        {
          "uuid": "a7f4c852-9250-c8b5-14e6-40197d70de89",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "323ad938-ceb5-4450-9720-8ac14e861854",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3448ba78-578a-4fe4-a846-7c62e944d5d7",
          "id": "3448ba78-578a-4fe4-a846-7c62e944d5d7",
          "molfile": "\n  Marvin  01132102472D          \n\n  1  0  0  0  1  0            999 V2000\n    9.3027  -10.3971    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f956e9ea-7604-4e5a-b56e-56ca7205367e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "c516c1de-e748-4094-b83a-2f6c51f22506",
          "id": "c516c1de-e748-4094-b83a-2f6c51f22506",
          "molfile": "\n  Marvin  01132110112D          \n\n 25 29  0  0  1  0            999 V2000\n    9.2304   -6.4259    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.9342   -6.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6589   -6.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6589   -7.2393    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.4829   -7.2393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9498   -7.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2304   -7.2446    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.5484   -8.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3723   -8.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7841   -8.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4534   -7.5157    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.0364   -8.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2124   -8.2247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4431   -8.9392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9686   -6.8482    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.1760   -6.5928    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.7537   -7.3020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1760   -5.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9049   -4.9869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9529   -5.5135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4482   -6.1756    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.2553   -4.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0353   -4.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2218   -5.0337    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4085   -4.8618    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  7  1  1  0  0  0  0\n 21  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  4  9  1  0  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n 11  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 12  1  0  0  0  0\n 15 11  1  6  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 18  1  0  0  0  0\n 16 24  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 20  1  0  0  0  0\n 21 20  1  6  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  1  0  0  0\nM  CHG  1  25  -1\nM  END",
          "smiles": "C=C1C[C@]23C[C@]1(CC[C@H]2[C@]45C=C[C@@H]([C@](C)([C@H]4[C@H]3C(=O)O)C(=O)O5)[O-])O",
          "formula": "C19H21O6",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d69e873e-4b2b-4fea-bdd4-60ce31d15503"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "345.3672",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1b443f68-2537-48d4-9efa-67ebe4a93881",
      "version": "5",
      "structure": {
        "id": "2c3d2055-70b9-4321-ba00-8eee6dedf1f2",
        "molfile": "\n  Marvin  01132102232D          \n\n 28 31  0  0  1  0            999 V2000\n    8.4423   -6.1711    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9629   -6.8434    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1711   -6.5881    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7490   -7.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1711   -5.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9472   -5.5097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9001   -4.9834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2173   -5.0302    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0304   -4.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2495   -4.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4048   -4.8583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4475   -7.5102    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.0307   -8.2189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2075   -8.2189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4372   -8.9330    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.2237   -7.2396    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2237   -6.4213    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.9272   -6.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6516   -6.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6516   -7.2343    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.4748   -7.2343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9428   -7.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3651   -8.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5416   -8.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7763   -8.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2237   -5.5930    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5460   -7.5571    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3003  -10.3947    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  5  1  6  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  6  0  0  0\n  7  5  2  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  1  1  0  0  0  0\n  8 11  1  1  0  0  0\n 12  2  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 12  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17  1  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  6  0  0  0\n 20 22  1  0  0  0  0\n 16 22  1  0  0  0  0\n 20 23  1  1  0  0  0\n 23 24  1  0  0  0  0\n 16 24  1  1  0  0  0\n 25 23  2  0  0  0  0\n 17 26  1  1  0  0  0\n  2 27  1  1  0  0  0\nM  CHG  2  15  -1  28   1\nM  END",
        "smiles": "C=C1C[C@]23C[C@]1(CC[C@@]2([H])[C@]45C=C[C@@H]([C@](C)([C@@]4([H])[C@@H]3C(=O)[O-])C(=O)O5)O)O.[K+]",
        "formula": "C19H21O6.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "384.4655",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8e85210e-af09-4bfe-90d7-10184c30e933",
          "5fbbbb5d-8ff2-445c-af13-820041f4f1dc"
        ],
        "stereo_centers": 8
      },
      "unii": "H52L7VZB7S"
    }
  ]
}