{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5f24eef0-63c1-4c90-8bd7-f2c44a47f0e9",
          "code": "22224-92-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22224-92-6",
          "code_system": "CAS",
          "references": [
            "7ef9124b-bac0-49b8-9a61-b2ef91aa9c13",
            "24a5ad1b-d614-4ef8-819f-ff898ee1d664"
          ]
        },
        {
          "uuid": "9313f721-a607-4912-b9b4-6ceb1f2840ba",
          "code": "C002698",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67002698",
          "code_system": "MESH",
          "references": [
            "7ef9124b-bac0-49b8-9a61-b2ef91aa9c13"
          ]
        },
        {
          "uuid": "4c9e3a1c-fa97-4e98-9c91-53127576c699",
          "code": "FENAMIPHOS",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fenamiphos",
          "code_system": "WIKIPEDIA",
          "references": [
            "7ef9124b-bac0-49b8-9a61-b2ef91aa9c13"
          ]
        },
        {
          "uuid": "b2cc0e8a-2e11-4fc8-bf9f-57548bb7c6fd",
          "code": "100601",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2347",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7ef9124b-bac0-49b8-9a61-b2ef91aa9c13"
          ]
        },
        {
          "uuid": "bef1c09c-1cb0-451c-a543-58dde57358dc",
          "code": "244-848-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.040.756",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7ef9124b-bac0-49b8-9a61-b2ef91aa9c13"
          ]
        },
        {
          "uuid": "e499b389-c5c6-4e83-aca9-9ccc3bc12f18",
          "code": "m5261",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5261?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7ef9124b-bac0-49b8-9a61-b2ef91aa9c13"
          ]
        },
        {
          "uuid": "737cc74d-a11d-4fe5-9ba2-e02329fca2f3",
          "code": "31070",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31070",
          "code_system": "PUBCHEM",
          "references": [
            "7ef9124b-bac0-49b8-9a61-b2ef91aa9c13"
          ]
        },
        {
          "uuid": "b693e548-c3b3-9500-cd6d-106f1101c20f",
          "code": "C163656",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C163656",
          "code_system": "NCI_THESAURUS",
          "references": [
            "23186277-0917-d145-0db1-12a805a1ffd3"
          ]
        },
        {
          "uuid": "41d22850-b471-38a9-4f39-6a679b6216eb",
          "code": "6452",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6452",
          "code_system": "HSDB",
          "references": [
            "f53a4de0-46c2-f32f-3c52-88241a7b5b30"
          ]
        },
        {
          "uuid": "7cd993a4-5d19-4754-02af-8cb36a1601bd",
          "code": "DTXSID3024102",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3024102",
          "code_system": "EPA CompTox",
          "references": [
            "2e627425-ba93-6d7c-62fc-157b286782fe"
          ]
        },
        {
          "uuid": "cf9be198-3143-9ee6-d38d-da456a1c40ce",
          "code": "1869713",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1869713/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "2131e927-7025-4568-a2d4-72a0b6ee40ca",
          "code": "H4NO3L2HBE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9c158aaf-a97e-7241-4158-4d78046cf283",
          "code": "38680",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38680",
          "code_system": "CHEBI",
          "references": [
            "421704d7-7431-0ff5-4422-2dc62b5e3a30"
          ]
        },
        {
          "uuid": "34e2d2f8-f706-3189-3da4-c6aa786bc462",
          "code": "H4NO3L2HBE",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=H4NO3L2HBE",
          "code_system": "DAILYMED",
          "references": [
            "9a7efdb1-647e-a761-edc6-78b71b721787"
          ]
        },
        {
          "uuid": "e270547d-7bf3-9ec6-c1e1-b06d6d265063",
          "code": "fenamiphos",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenamiphos.html",
          "code_system": "ALANWOOD",
          "references": [
            "5b0164e6-60bb-9f38-f2b3-5c946cf78e34"
          ]
        },
        {
          "uuid": "6b8421bf-0172-c999-e354-c2cc2fb168cd",
          "code": "195106",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=195106",
          "code_system": "NSC",
          "references": [
            "774422dd-fe46-4709-7cce-23aa611f27d5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2112cd96-0d03-48aa-bb2f-1ef248feb64e",
          "name": "(RS)-(ETHYL 4-METHYLTHIO-M-TOLYL ISOPROPYLPHOSPHORAMIDATE)",
          "stdName": "(RS)-(ETHYL 4-METHYLTHIO-M-TOLYL ISOPROPYLPHOSPHORAMIDATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b142553-e741-417c-a523-56ffe29007f3",
            "381de925-6a65-4219-981e-f4b46463fd54"
          ],
          "display_name": false
        },
        {
          "uuid": "8834e493-c079-4ccb-9e3b-1f1bf1eb892a",
          "name": "B-68138",
          "stdName": "B-68138",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        },
        {
          "uuid": "5e3bae0a-1e26-4183-a541-f233a35a62a9",
          "name": "BAY 68138",
          "stdName": "BAY 68138",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        },
        {
          "uuid": "d3606943-4d80-487b-a6ff-0c879c98f0e6",
          "name": "BAY-68138",
          "stdName": "BAY-68138",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "7c8f68c6-df55-47e9-9473-24b82730a919"
          ],
          "display_name": false
        },
        {
          "uuid": "31e79b01-8e4c-4dd9-9e5e-14d0fa747cd7",
          "name": "BAYER 68138",
          "stdName": "BAYER 68138",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        },
        {
          "uuid": "4c7dd7cc-36bf-4979-85d1-97a012c0b22d",
          "name": "ETHYL 3-METHYL-4-(METHYLTHIO)PHENYL (1-METHYLETHYL)PHOSPHORAMIDATE",
          "stdName": "ETHYL 3-METHYL-4-(METHYLTHIO)PHENYL (1-METHYLETHYL)PHOSPHORAMIDATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b142553-e741-417c-a523-56ffe29007f3",
            "80221a2f-e067-4a6e-9f90-4fceb07ecf4f"
          ],
          "display_name": false
        },
        {
          "uuid": "b2b492d0-1dd6-4f2a-a3d8-c49499afb60f",
          "name": "ETHYL 4-(METHYLTHIO)-M-TOLYL ISOPROPYLPHOSPHORAMIDATE",
          "stdName": "ETHYL 4-(METHYLTHIO)-M-TOLYL ISOPROPYLPHOSPHORAMIDATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        },
        {
          "uuid": "a2cb1cb1-425a-4f2d-a234-b50e9f8302ed",
          "name": "FENAMIPHOS",
          "stdName": "FENAMIPHOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aabbb852-da1f-4bca-a4ca-be795bb87d54",
            "d5ecc401-e5cb-4eb0-b170-0f2fb31f0a4b",
            "4be06137-529b-4cdc-8edc-9ddd19ef2230",
            "77ecaae4-2d73-46cd-8782-10055a6434a8",
            "66623023-ec5b-460e-8b23-d746967d2244",
            "37c52108-f425-4ab8-9202-e8850a8b2428",
            "eb81d933-4ae1-43d4-b8ec-8414c0b48836",
            "3a420618-1474-4b31-be59-207e77a268ce"
          ],
          "display_name": true
        },
        {
          "uuid": "d280cc85-5594-4ae9-9716-8a89e378d06d",
          "name": "FENAMIPHOS [HSDB]",
          "stdName": "FENAMIPHOS [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5ecc401-e5cb-4eb0-b170-0f2fb31f0a4b",
            "66623023-ec5b-460e-8b23-d746967d2244"
          ],
          "display_name": false
        },
        {
          "uuid": "0b90c3ab-fff5-4971-8b27-906ca1258115",
          "name": "FENAMIPHOS [ISO]",
          "stdName": "FENAMIPHOS [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "37c52108-f425-4ab8-9202-e8850a8b2428"
          ],
          "display_name": false
        },
        {
          "uuid": "20b8d5ca-575f-442a-8599-5c0ddf4d5bc5",
          "name": "FENAMIPHOS [MI]",
          "stdName": "FENAMIPHOS [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aabbb852-da1f-4bca-a4ca-be795bb87d54",
            "66623023-ec5b-460e-8b23-d746967d2244"
          ],
          "display_name": false
        },
        {
          "uuid": "1cbe049e-75e2-4d84-9be5-a90c2d8496e3",
          "name": "ISOPROPYLPHOSPHORAMIDIC ACID ETHYL 4-(METHYLTHIO)-M-TOLYL ESTER",
          "stdName": "ISOPROPYLPHOSPHORAMIDIC ACID ETHYL 4-(METHYLTHIO)-M-TOLYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        },
        {
          "uuid": "1cfb95be-b352-458c-9e7c-64fbdebf0ce7",
          "name": "N-(1-METHYLETHYL)PHOSPHORAMIDIC ACID ETHYL 3-METHYL-4-(METHYLTHIO)PHENYL ESTER",
          "stdName": "N-(1-METHYLETHYL)PHOSPHORAMIDIC ACID ETHYL 3-METHYL-4-(METHYLTHIO)PHENYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        },
        {
          "uuid": "c850caaf-572a-4560-8ba1-850df5adb0eb",
          "name": "NEMACUR (BAYER CROPSCI.)",
          "stdName": "NEMACUR (BAYER CROPSCI.)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        },
        {
          "uuid": "d20c0c0f-d22a-4899-95e1-272dec72dbff",
          "name": "NSC-195106",
          "stdName": "NSC-195106",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "dd7b37e3-f235-4ed1-b309-f3c4c63915c1"
          ],
          "display_name": false
        },
        {
          "uuid": "ecc26683-8c91-4e05-9974-161bfa2ef8dc",
          "name": "PHENAMIPHOS",
          "stdName": "PHENAMIPHOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        },
        {
          "uuid": "f8e52c9a-1223-41c7-8bf3-b3e34ee2b689",
          "name": "SRA-3886",
          "stdName": "SRA-3886",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66623023-ec5b-460e-8b23-d746967d2244",
            "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "77ecaae4-2d73-46cd-8782-10055a6434a8",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5b142553-e741-417c-a523-56ffe29007f3",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "381de925-6a65-4219-981e-f4b46463fd54",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80221a2f-e067-4a6e-9f90-4fceb07ecf4f",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aabbb852-da1f-4bca-a4ca-be795bb87d54",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66623023-ec5b-460e-8b23-d746967d2244",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b0c4ced-f6ca-4cd6-bf39-2d433ab12059",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd7b37e3-f235-4ed1-b309-f3c4c63915c1",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c8f68c6-df55-47e9-9473-24b82730a919",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5ecc401-e5cb-4eb0-b170-0f2fb31f0a4b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37c52108-f425-4ab8-9202-e8850a8b2428",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ef9124b-bac0-49b8-9a61-b2ef91aa9c13",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390939000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed383ceb-5f44-4fe2-92c3-a790f6ccc3fd",
          "citation": "SRS import [H4NO3L2HBE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H4NO3L2HBE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390939000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c87626d-40ec-4bc7-878c-862d60a572e1",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4be06137-529b-4cdc-8edc-9ddd19ef2230",
          "citation": "FENAMIPHOS [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a420618-1474-4b31-be59-207e77a268ce",
          "citation": "FENAMIPHOS [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb81d933-4ae1-43d4-b8ec-8414c0b48836",
          "citation": "FENAMIPHOS [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f53a4de0-46c2-f32f-3c52-88241a7b5b30",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+22224-92-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2e627425-ba93-6d7c-62fc-157b286782fe",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22224-92-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "24a5ad1b-d614-4ef8-819f-ff898ee1d664",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "23186277-0917-d145-0db1-12a805a1ffd3",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "5b0164e6-60bb-9f38-f2b3-5c946cf78e34",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "421704d7-7431-0ff5-4422-2dc62b5e3a30",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "774422dd-fe46-4709-7cce-23aa611f27d5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9a7efdb1-647e-a761-edc6-78b71b721787",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "58f75235-18ee-4675-9554-19d8dceca7e7",
          "id": "58f75235-18ee-4675-9554-19d8dceca7e7",
          "molfile": "\n  Marvin  01132104372D          \n\n 19 19  0  0  0  0            999 V2000\n    3.8438   -4.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4554   -5.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2682   -4.8474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0695   -4.6690    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0695   -3.7208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8626   -5.6601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9704   -6.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9704   -7.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1098   -5.5806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8586   -4.8985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5685   -4.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5685   -3.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3057   -3.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9838   -3.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7383   -3.3679    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6305   -3.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9838   -4.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6701   -4.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2628   -4.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 17 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=O)(NC(C)C)Oc1ccc(c(C)c1)SC",
          "formula": "C13H22NO3PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2af4c1ec-8a39-46c9-80a0-d18dd8841767"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "303.359",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ab3fab8b-b837-4b77-9667-836f91035fe7",
      "version": "11",
      "structure": {
        "id": "0e24c6d5-a7d3-4633-a742-19b7538bfd83",
        "molfile": "\n  Marvin  01132100582D          \n\n 19 19  0  0  0  0            999 V2000\n    6.0695   -4.6690    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8586   -4.8985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5685   -4.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2628   -4.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9838   -4.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9838   -3.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7383   -3.3679    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6305   -3.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3057   -3.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5685   -3.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6701   -4.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8626   -5.6601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9704   -6.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9704   -7.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1098   -5.5806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2682   -4.8474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4554   -5.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8438   -4.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0695   -3.7208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  9  2  0  0  0  0\n  3 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n  1 19  2  0  0  0  0\nM  END",
        "smiles": "CCOP(=O)(NC(C)C)Oc1ccc(c(C)c1)SC",
        "formula": "C13H22NO3PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "303.359",
        "optical_activity": "( + / - )",
        "references": [
          "ed383ceb-5f44-4fe2-92c3-a790f6ccc3fd",
          "8c87626d-40ec-4bc7-878c-862d60a572e1"
        ],
        "stereo_centers": 1
      },
      "unii": "H4NO3L2HBE"
    }
  ]
}