{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b0b2c095-deb2-4928-9112-7c8230502c9f",
          "code": "108-80-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=108-80-5",
          "code_system": "CAS",
          "references": [
            "726c33c9-d673-49ac-a811-ee8b4e5ccbaa",
            "47b96054-f19c-4203-aaf5-f132756110fa"
          ]
        },
        {
          "uuid": "bea0dc1c-4d39-4adc-bd4c-94e8f8328936",
          "code": "C004632",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004632",
          "code_system": "MESH",
          "references": [
            "726c33c9-d673-49ac-a811-ee8b4e5ccbaa"
          ]
        },
        {
          "uuid": "e60edb19-4b7f-4dbc-a19f-9a9b6f46292b",
          "code": "81402",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4535",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "726c33c9-d673-49ac-a811-ee8b4e5ccbaa"
          ]
        },
        {
          "uuid": "6b7e5119-a0c9-4fce-a187-4bb5209cf759",
          "code": "m3960",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3960?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "726c33c9-d673-49ac-a811-ee8b4e5ccbaa"
          ]
        },
        {
          "uuid": "2bf9ea35-9841-4aee-91a6-a7ee6e27dd9f",
          "code": "203-618-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.290",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "726c33c9-d673-49ac-a811-ee8b4e5ccbaa"
          ]
        },
        {
          "uuid": "c2f0e83b-251c-44af-9070-309be869ee68",
          "code": "7956",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7956",
          "code_system": "PUBCHEM",
          "references": [
            "726c33c9-d673-49ac-a811-ee8b4e5ccbaa"
          ]
        },
        {
          "uuid": "675e2218-acc2-953a-df8d-5de4194e2c39",
          "code": "Cyanuric acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cyanuric_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "1a452f9a-a880-a644-29dd-8c4e688e8b7d"
          ]
        },
        {
          "uuid": "4bbb4834-5196-5a5c-e988-2c8489b2b125",
          "code": "2818",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2818",
          "code_system": "HSDB",
          "references": [
            "0aab3a82-e184-bf18-d1f5-dcfe11ed5653"
          ]
        },
        {
          "uuid": "19a41355-38f7-b25c-ce28-e85861bb5c5a",
          "code": "DTXSID7024873",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7024873",
          "code_system": "EPA CompTox",
          "references": [
            "b5543b71-c7da-834c-60f8-33a4ee907dd6"
          ]
        },
        {
          "uuid": "329f7bd1-ee35-49ee-8683-a80c471d82c8",
          "code": "H497R4QKTZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "39d1038b-3a27-5076-57cc-86e8e1e5e003",
          "code": "38028",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38028",
          "code_system": "CHEBI",
          "references": [
            "ded9e547-4b57-1915-0218-4e269b08c917"
          ]
        },
        {
          "uuid": "f7cfaa2d-1135-85d6-65c2-1f1f2d774a34",
          "code": "17696",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17696",
          "code_system": "CHEBI",
          "references": [
            "ded9e547-4b57-1915-0218-4e269b08c917"
          ]
        },
        {
          "uuid": "fd3b82e9-9694-92a3-6b9f-d6c830d836da",
          "code": "6284",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6284",
          "code_system": "NSC",
          "references": [
            "ea04f764-841a-b571-4df6-c48ac8622d94"
          ]
        },
        {
          "uuid": "ae432db8-8d13-39d3-d788-d38e956b76d9",
          "code": "trihydroxytriazine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/trihydroxytriazine.html",
          "code_system": "ALANWOOD",
          "references": [
            "8fe40ba5-011e-e141-fe81-6bcb85890d2c"
          ]
        },
        {
          "uuid": "c44f8761-06d2-4f11-94c4-1801b5c3315c",
          "code": "135581-61-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=135581-61-2",
          "code_system": "CAS",
          "references": [
            "47b96054-f19c-4203-aaf5-f132756110fa"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e96917dd-86de-4f5b-b9a6-2ad9534d119f",
          "amount": {
            "uuid": "5b4b6186-51ef-4dd7-9f4f-927c7e2fed2b"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f949c8a8-0506-4a6b-b73f-3c09c374811f",
            "refuuid": "978a9ced-0034-4b9f-9ba8-6b22faf9d781",
            "name": "SODIUM CYANURATE",
            "unii": "8OQZ70DYX0",
            "linking_id": "8OQZ70DYX0",
            "ref_pname": "SODIUM CYANURATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6a529f7a-3201-46cc-a7f9-309be4121527",
          "name": "1,3,5-Triazine-2,4,6(1H,3H,5H)-trione",
          "stdName": "1,3,5-TRIAZINE-2,4,6(1H,3H,5H)-TRIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61ee01a1-7502-43c8-b402-945018711c59",
            "b6652460-fc0a-4b44-85a3-a77a3b4f764b"
          ],
          "display_name": false
        },
        {
          "uuid": "8cd707f6-5c0a-46e8-b0a2-4f03c38ba871",
          "name": "1,3,5-Triazine-2,4,6-triol",
          "stdName": "1,3,5-TRIAZINE-2,4,6-TRIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61ee01a1-7502-43c8-b402-945018711c59",
            "a3ace53f-627e-4cff-bcc7-2bd4dd94e9ae"
          ],
          "display_name": false
        },
        {
          "uuid": "9ebd2c53-b1a6-4fa7-9913-f73324db7c74",
          "name": "1,3,5-Triazine-2,4,6-trione",
          "stdName": "1,3,5-TRIAZINE-2,4,6-TRIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47b96054-f19c-4203-aaf5-f132756110fa"
          ],
          "display_name": false
        },
        {
          "uuid": "30f61ecb-16aa-4600-9e87-2880318d5c38",
          "name": "CYANURIC ACID [HSDB]",
          "stdName": "CYANURIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0602445a-ec68-402d-9f37-2a57da7f2bed",
            "48a569d4-7161-47a8-bc54-0bb342d7eef2"
          ],
          "display_name": false
        },
        {
          "uuid": "ec4d2076-b340-47f8-978a-4c0a654286fc",
          "name": "CYANURIC ACID [MI]",
          "stdName": "CYANURIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c9a7a9b-1da1-4f6d-96c1-e0912b9861b1",
            "0602445a-ec68-402d-9f37-2a57da7f2bed"
          ],
          "display_name": false
        },
        {
          "uuid": "e13809db-5fd2-4e25-a20e-1661e40b2c7e",
          "name": "Cyanuric acid",
          "stdName": "CYANURIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0827dcce-2c5d-4c07-8454-faf254cdcefe",
            "0602445a-ec68-402d-9f37-2a57da7f2bed",
            "8c9a7a9b-1da1-4f6d-96c1-e0912b9861b1",
            "746c6af6-0616-425d-bf56-a13d63ce33a5",
            "c858fdbe-8a4c-488e-a226-b737e31e567a",
            "48a569d4-7161-47a8-bc54-0bb342d7eef2"
          ],
          "display_name": true
        },
        {
          "uuid": "3f0b240d-b69d-46c0-836e-b5c24158b11c",
          "name": "Isocyanuric acid",
          "stdName": "ISOCYANURIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0602445a-ec68-402d-9f37-2a57da7f2bed",
            "bba6b626-3dab-43c5-a565-0986abb88964"
          ],
          "display_name": false
        },
        {
          "uuid": "d7908ba6-09cc-4a1c-bdc3-8d4a5ca00fd3",
          "name": "NSC-6284",
          "stdName": "NSC-6284",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0602445a-ec68-402d-9f37-2a57da7f2bed",
            "0d7267f1-c237-4ac2-b144-9c67b7ef9deb"
          ],
          "display_name": false
        },
        {
          "uuid": "14aa4a32-3d20-4e79-b55e-842121984a1c",
          "name": "Trihydroxycyanidine",
          "stdName": "TRIHYDROXYCYANIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0384c11b-d846-4290-9d72-ac41094dcdd0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "61ee01a1-7502-43c8-b402-945018711c59",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a3ace53f-627e-4cff-bcc7-2bd4dd94e9ae",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6652460-fc0a-4b44-85a3-a77a3b4f764b",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0384c11b-d846-4290-9d72-ac41094dcdd0",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c9a7a9b-1da1-4f6d-96c1-e0912b9861b1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0602445a-ec68-402d-9f37-2a57da7f2bed",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c858fdbe-8a4c-488e-a226-b737e31e567a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48a569d4-7161-47a8-bc54-0bb342d7eef2",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bba6b626-3dab-43c5-a565-0986abb88964",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d7267f1-c237-4ac2-b144-9c67b7ef9deb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "726c33c9-d673-49ac-a811-ee8b4e5ccbaa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390983000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e7a8789-12e6-481a-aadb-6f9e0ba86f48",
          "citation": "SRS import [H497R4QKTZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H497R4QKTZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390983000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e3ca653-7092-4405-af05-cff419e93f5d",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0827dcce-2c5d-4c07-8454-faf254cdcefe",
          "citation": "CYANURIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "746c6af6-0616-425d-bf56-a13d63ce33a5",
          "citation": "CYANURIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a452f9a-a880-a644-29dd-8c4e688e8b7d",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Cyanuric_acid",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0aab3a82-e184-bf18-d1f5-dcfe11ed5653",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+108-80-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b5543b71-c7da-834c-60f8-33a4ee907dd6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=108-80-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8fe40ba5-011e-e141-fe81-6bcb85890d2c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "47b96054-f19c-4203-aaf5-f132756110fa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ded9e547-4b57-1915-0218-4e269b08c917",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ea04f764-841a-b571-4df6-c48ac8622d94",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "54f9b2a0-5c76-4f41-87b2-f9d79f13ef42",
          "id": "54f9b2a0-5c76-4f41-87b2-f9d79f13ef42",
          "molfile": "\n  CDK     10222408292D\n\n  9  9  0  0  0  0  0  0  0  0999 V2000\n   23.8273   -9.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8273   -7.7148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1463   -6.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5091   -7.7101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5091   -9.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1656  -10.0234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8615  -10.0234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1463   -5.3586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4745  -10.0334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  3  8  2  0  0  0  0\n  1  9  2  0  0  0  0\nM  END",
          "smiles": "c1(=O)[nH]c(=O)[nH]c(=O)[nH]1",
          "formula": "C3H3N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7570f354-778a-41b9-9d52-8530d2f9f6aa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "129.0744",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "92e55ffc-849b-4a16-bfae-3bd935856a15",
      "version": "16",
      "structure": {
        "id": "6d0de13e-a004-48ed-955e-6844dbdaeb6d",
        "molfile": "\n   JSDraw210222408292D\n\n  9  9  0  0  0  0              0 V2000\n   23.8273   -9.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8273   -7.7148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1463   -6.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5091   -7.7101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5091   -9.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1656  -10.0234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8615  -10.0234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1463   -5.3586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4745  -10.0334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  3  8  2  0  0  0  0\n  1  9  2  0  0  0  0\nM  END",
        "smiles": "c1(=O)[nH]c(=O)[nH]c(=O)[nH]1",
        "formula": "C3H3N3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "129.0744",
        "optical_activity": "NONE",
        "references": [
          "0e7a8789-12e6-481a-aadb-6f9e0ba86f48",
          "5e3ca653-7092-4405-af05-cff419e93f5d"
        ],
        "stereo_centers": 0
      },
      "unii": "H497R4QKTZ"
    }
  ]
}