{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a2683c3d-6263-4875-a341-67a52ac31c41",
          "code": "45234-02-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=45234-02-4",
          "code_system": "CAS",
          "references": [
            "d0bd5058-3090-48af-92e9-2013cd54b2ed",
            "668b12ef-f2a0-474b-985e-85cec355352b"
          ]
        },
        {
          "uuid": "223afe1b-541e-d42b-7bc3-2ae7ee6f0401",
          "code": "7010501",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7010501",
          "code_system": "PUBCHEM",
          "references": [
            "68f69b7f-1040-1e5a-2ebb-da0eaa8e0b01"
          ]
        },
        {
          "uuid": "ebcd0573-44ea-68f4-4058-ef991232090f",
          "code": "DTXSID50196442",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50196442",
          "code_system": "EPA CompTox",
          "references": [
            "ed506766-9835-c1e1-b01a-deb8af93af58"
          ]
        },
        {
          "uuid": "9a76a6df-8f89-4207-a7e8-e1f24b861a29",
          "code": "H34V7IM5ML",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "13447675-6405-0892-0d28-7bdd8abc1387",
          "code": "74557",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:74557",
          "code_system": "CHEBI",
          "references": [
            "5916bfcd-ce55-9eb8-4079-6bf8ab8b4371"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "40273cc2-e1c0-4f7c-840f-67464c6396c5",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "eaa69721-d922-4ad2-9fd1-b994c933d455",
            "refuuid": "1327ff13-e274-41aa-a2b5-f807d14acb50",
            "name": "LYSYLGLUTAMIC ACID DIHYDRATE",
            "unii": "832IRM2G6W",
            "linking_id": "832IRM2G6W",
            "ref_pname": "LYSYLGLUTAMIC ACID DIHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7436a0a8-b0f0-473d-886e-75fbcb91dc12",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "db9ea34d-18ac-40eb-bff6-3db2c80e1c63"
          ],
          "related_substance": {
            "uuid": "da85d37e-93df-488f-a7a1-12eb05eea6e8",
            "refuuid": "1327ff13-e274-41aa-a2b5-f807d14acb50",
            "name": "LYSYLGLUTAMIC ACID DIHYDRATE",
            "unii": "832IRM2G6W",
            "linking_id": "832IRM2G6W",
            "ref_pname": "LYSYLGLUTAMIC ACID DIHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf08bb08-2693-4f4e-8062-bd89166f2b91",
          "name": "L-GLUTAMIC ACID, L-LYSYL-",
          "stdName": "L-GLUTAMIC ACID, L-LYSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5043e704-180a-4084-a5a4-33cc792bac3e",
            "97ee144e-f0d9-4966-b50b-9a06f104b05b"
          ],
          "display_name": false
        },
        {
          "uuid": "b9460ef6-85bd-4769-a88b-8ce7fba7b987",
          "name": "LYSYLGLUTAMIC ACID",
          "stdName": "LYSYLGLUTAMIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5043e704-180a-4084-a5a4-33cc792bac3e",
            "97ee144e-f0d9-4966-b50b-9a06f104b05b"
          ],
          "display_name": true
        },
        {
          "uuid": "65e1f9e5-1008-4812-9561-23348d980622",
          "name": "VILON",
          "stdName": "VILON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5043e704-180a-4084-a5a4-33cc792bac3e",
            "97ee144e-f0d9-4966-b50b-9a06f104b05b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5043e704-180a-4084-a5a4-33cc792bac3e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "97ee144e-f0d9-4966-b50b-9a06f104b05b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0bd5058-3090-48af-92e9-2013cd54b2ed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391929000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0bd3155-1d8b-4412-a57e-2120b5a83a6b",
          "citation": "SRS import [H34V7IM5ML]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H34V7IM5ML",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391929000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed506766-9835-c1e1-b01a-deb8af93af58",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=45234-02-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "db9ea34d-18ac-40eb-bff6-3db2c80e1c63",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "68f69b7f-1040-1e5a-2ebb-da0eaa8e0b01",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5916bfcd-ce55-9eb8-4079-6bf8ab8b4371",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "668b12ef-f2a0-474b-985e-85cec355352b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "531d7f02-2c68-421a-b7d2-55c53b2339fd",
          "id": "531d7f02-2c68-421a-b7d2-55c53b2339fd",
          "molfile": "\n  Marvin  01132104202D          \n\n 19 18  0  0  1  0            999 V2000\n   -1.2337   -1.5517    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.2337   -0.7277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9677   -1.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6609   -1.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3949   -1.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0882   -1.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.8221   -1.7874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5405   -1.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5405   -2.8230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1934   -1.6223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7985   -2.1831    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.5867   -1.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7699   -1.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5581   -0.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1632   -1.4524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7413   -0.0872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6153   -2.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2204   -3.5484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1729   -3.2311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 11 17  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  END",
          "smiles": "C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N",
          "formula": "C11H21N3O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f0b20dae-f082-467e-ae03-e81b463e5525"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "275.302",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3c3d5468-4e34-4e1d-ac8a-60aaae105055",
      "version": "7",
      "structure": {
        "id": "1b1899f4-aa15-4200-a5da-a748d13da942",
        "molfile": "\n  Marvin  01132101352D          \n\n 19 18  0  0  1  0            999 V2000\n   -1.2337   -0.7277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2337   -1.5517    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.5405   -1.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5405   -2.8230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1934   -1.6223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7985   -2.1831    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.5867   -1.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7699   -1.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5581   -0.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1632   -1.4524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7413   -0.0872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6153   -2.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2204   -3.5484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1729   -3.2311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9677   -1.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6609   -1.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3949   -1.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0882   -1.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.8221   -1.7874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n  2 15  1  6  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N",
        "formula": "C11H21N3O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "275.302",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5043e704-180a-4084-a5a4-33cc792bac3e",
          "c0bd3155-1d8b-4412-a57e-2120b5a83a6b"
        ],
        "stereo_centers": 2
      },
      "unii": "H34V7IM5ML"
    }
  ]
}