{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "97efd238-c435-4410-9219-ad70df08ccec",
          "code": "255-350-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.302",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b7444ac1-d3a1-4181-9db4-4edde26cea88"
          ]
        },
        {
          "uuid": "775cc4f5-6281-4774-ad05-bf93d847e1c5",
          "code": "38855",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/38855",
          "code_system": "PUBCHEM",
          "references": [
            "b7444ac1-d3a1-4181-9db4-4edde26cea88"
          ]
        },
        {
          "uuid": "aea83934-bf78-4923-b7d8-a682dafab2cb",
          "code": "41395-83-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41395-83-9",
          "code_system": "CAS",
          "references": [
            "b7444ac1-d3a1-4181-9db4-4edde26cea88",
            "71a4f1ab-d816-4c02-8148-7f8e966be8f4"
          ]
        },
        {
          "uuid": "e8d83091-9804-4f4f-ab8d-23fcbede990b",
          "code": "SUB23560",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b7444ac1-d3a1-4181-9db4-4edde26cea88"
          ]
        },
        {
          "uuid": "9866c0b1-d000-341e-7797-6d8a7e2a9fe6",
          "code": "DTXSID3047182",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3047182",
          "code_system": "EPA CompTox",
          "references": [
            "687a08e2-87e0-2561-32f3-b4b430cfbc65"
          ]
        },
        {
          "uuid": "f86b3693-4ff4-497f-9a54-a3bdb8e09159",
          "code": "H33537B5VD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1127942a-116b-3c3c-b09a-ca40d05da4ca",
          "code": "100000089019",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7557b772-3f22-e91d-6354-f919be05d55b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "198d9201-8f33-4a2c-8755-471d18a5735d",
          "name": "1,2-PROPANEDIOL DINONANOATE",
          "stdName": "1,2-PROPANEDIOL DINONANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fbb67df-1daf-4b8e-bb07-8d0e8a920156",
            "a4f13041-b2a2-4323-a77f-6c69d5a8f99c"
          ],
          "display_name": false
        },
        {
          "uuid": "6998dbff-65f6-45a0-a91c-b7ddf4df1ebe",
          "name": "DERMOL PGDP",
          "stdName": "DERMOL PGDP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fbb67df-1daf-4b8e-bb07-8d0e8a920156",
            "a4f13041-b2a2-4323-a77f-6c69d5a8f99c"
          ],
          "display_name": false
        },
        {
          "uuid": "628c0198-4e9f-4124-abcc-7a62d820beaa",
          "name": "PELEMOL PGDP",
          "stdName": "PELEMOL PGDP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fbb67df-1daf-4b8e-bb07-8d0e8a920156",
            "a4f13041-b2a2-4323-a77f-6c69d5a8f99c"
          ],
          "display_name": false
        },
        {
          "uuid": "80f80348-9d4d-4c0b-b81d-9fd83f596939",
          "name": "PROPYLENE GLYCOL DINONANOATE",
          "stdName": "PROPYLENE GLYCOL DINONANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fbb67df-1daf-4b8e-bb07-8d0e8a920156",
            "a4f13041-b2a2-4323-a77f-6c69d5a8f99c"
          ],
          "display_name": false
        },
        {
          "uuid": "b6d1958a-3835-4ef4-bc7a-a6d61345be55",
          "name": "PROPYLENE GLYCOL DIPELARGONATE",
          "stdName": "PROPYLENE GLYCOL DIPELARGONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8ca33e3-47fc-4c08-b9a2-ccf97eb736e3",
            "4f37afcc-96da-4adf-8fa0-408a4fdf47f9",
            "5fbb67df-1daf-4b8e-bb07-8d0e8a920156",
            "a4f13041-b2a2-4323-a77f-6c69d5a8f99c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d8cd1bbb-1432-4998-8250-61c0adf7da7c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "224be48c-d313-4882-8a4c-b4018e901985",
          "name": "SCHERCEMOL PGDP ESTER",
          "stdName": "SCHERCEMOL PGDP ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fbb67df-1daf-4b8e-bb07-8d0e8a920156",
            "a4f13041-b2a2-4323-a77f-6c69d5a8f99c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5fbb67df-1daf-4b8e-bb07-8d0e8a920156",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4f37afcc-96da-4adf-8fa0-408a4fdf47f9",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4f13041-b2a2-4323-a77f-6c69d5a8f99c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7444ac1-d3a1-4181-9db4-4edde26cea88",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390170000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2907be09-6a5f-4b17-af24-782bc5926b4a",
          "citation": "SRS import [H33537B5VD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H33537B5VD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390170000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26744653-b38f-49a8-8bb1-68505cbab40b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8ca33e3-47fc-4c08-b9a2-ccf97eb736e3",
          "citation": "PROPYLENE GLYCOL DIPELARGONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "687a08e2-87e0-2561-32f3-b4b430cfbc65",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41395-83-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "71a4f1ab-d816-4c02-8148-7f8e966be8f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7557b772-3f22-e91d-6354-f919be05d55b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "833b0a11-081c-45b6-8348-a39858493741",
          "id": "833b0a11-081c-45b6-8348-a39858493741",
          "molfile": "\n  Marvin  01132106482D          \n\n 25 24  0  0  0  0            999 V2000\n    0.0000   -0.9040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7252   -1.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323   -0.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1757   -1.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8854   -0.8729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5925   -1.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3073   -0.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0300   -1.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7577   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7422    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4830   -1.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1901   -0.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9179   -1.2225    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.9179   -2.0384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6276   -0.8003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3398   -1.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3554   -2.0229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0806   -0.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7877   -1.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5026   -0.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2252   -1.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9374   -0.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6627   -1.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3698   -0.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1131   -1.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCC(=O)OCC(C)OC(=O)CCCCCCCC",
          "formula": "C21H40O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b404466f-530b-437c-b7d5-70807e3eae6a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "356.5407",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "77920798-38fd-49a5-8798-9d0c384c895a",
      "version": "6",
      "structure": {
        "id": "c39e4924-8d88-410a-8d58-87c9e6f87e68",
        "molfile": "\n  Marvin  01132110072D          \n\n 25 24  0  0  0  0            999 V2000\n    9.3398   -1.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7577   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3554   -2.0229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7422    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6276   -0.8003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4830   -1.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1901   -0.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9179   -1.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0806   -0.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0300   -1.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7877   -1.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3073   -0.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9179   -2.0384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3698   -0.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7252   -1.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323   -0.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6627   -1.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9374   -0.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5925   -1.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8854   -0.8729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1757   -1.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2252   -1.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5026   -0.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1131   -1.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.9040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 22  1  0  0  0  0\n 19 12  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 11  1  0  0  0  0\n 24 14  1  0  0  0  0\n 25 15  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCC(=O)OCC(C)OC(=O)CCCCCCCC",
        "formula": "C21H40O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "356.5407",
        "optical_activity": "( + / - )",
        "references": [
          "2907be09-6a5f-4b17-af24-782bc5926b4a",
          "26744653-b38f-49a8-8bb1-68505cbab40b"
        ],
        "stereo_centers": 1
      },
      "unii": "H33537B5VD"
    }
  ]
}