{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e7bd15b6-41a7-4c33-919e-bc195ac2ce39",
          "code": "209-170-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.338",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ba42c12b-694e-4468-a820-8130ca5c66a6"
          ]
        },
        {
          "uuid": "d191e7d0-2203-493d-9ab8-36a5bb3fb089",
          "code": "557-34-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=557-34-6",
          "code_system": "CAS",
          "references": [
            "ba42c12b-694e-4468-a820-8130ca5c66a6",
            "09d00ccc-e34a-466e-b9bb-71d61a657af4"
          ]
        },
        {
          "uuid": "c4808f41-d136-4278-998f-1c544bd571c2",
          "code": "1299637",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1299637/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ba42c12b-694e-4468-a820-8130ca5c66a6"
          ]
        },
        {
          "uuid": "75ef0925-67f3-404f-8561-f08b9b06131a",
          "code": "m11597",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11597?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ba42c12b-694e-4468-a820-8130ca5c66a6"
          ]
        },
        {
          "uuid": "43a0c9ed-681f-4845-8281-132bb265496a",
          "code": "11192",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11192",
          "code_system": "PUBCHEM",
          "references": [
            "ba42c12b-694e-4468-a820-8130ca5c66a6"
          ]
        },
        {
          "uuid": "1876afde-43df-4168-770f-dadfc6657e56",
          "code": "1043",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1043",
          "code_system": "HSDB",
          "references": [
            "85a03f98-28d2-8078-e8a7-26a4c95fe074"
          ]
        },
        {
          "uuid": "decbd15a-b45c-33ea-6b65-41ef6db4d566",
          "code": "DTXSID8038770",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8038770",
          "code_system": "EPA CompTox",
          "references": [
            "5f71c485-cbf4-e60a-ba6e-58240a24559b"
          ]
        },
        {
          "uuid": "0c7042a9-546b-4159-a949-dcb99b515d68",
          "code": "H2ZEY72PME",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0ae46b4b-dcc6-e41f-59c3-ca3fac670328",
          "code": "62984",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:62984",
          "code_system": "CHEBI",
          "references": [
            "515c5613-8e4a-8be3-d39e-5dcf372465d0"
          ]
        },
        {
          "uuid": "a0153c75-ceff-2fa8-b867-13b45a6183fb",
          "code": "75801",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=75801",
          "code_system": "NSC",
          "references": [
            "8aa45cb2-6679-fa4d-5a24-43b2d6286418"
          ]
        },
        {
          "uuid": "2096ba2d-cc1a-c99d-4a98-70e86be840e4",
          "code": "H2ZEY72PME",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=H2ZEY72PME",
          "code_system": "DAILYMED",
          "references": [
            "45eb9299-ba93-06df-ac04-2fecde254cf8"
          ]
        },
        {
          "uuid": "f9701938-c7b4-b603-dcc3-de91d33bbd4f",
          "code": "100000089315",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "06117952-78b0-0e60-3e78-942c2944f6a3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cdd4fda9-48d7-4c3e-8ede-5f7017e8a601",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4fc31abe-7021-45d4-92e4-14755b3cd062",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ed79f07f-8122-4dc6-b123-68029d677aa9",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "778c1917-1748-4285-b247-e2d47bec1aa5",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b5d58de3-6917-248f-2612-d757117b03b5",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "09d00ccc-e34a-466e-b9bb-71d61a657af4"
          ],
          "related_substance": {
            "uuid": "b5b564ce-6469-4692-a465-39b32bcc3a31",
            "refuuid": "46fca64d-6ff3-42d2-a2c0-92a1c6fc65ed",
            "name": "ZINC ACETATE",
            "unii": "FM5526K07A",
            "linking_id": "FM5526K07A",
            "ref_pname": "ZINC ACETATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bef54d5a-8eeb-4852-a0e6-ea82f1ebf1ed",
          "name": "ACETIC ACID, ZINC(II) SALT",
          "stdName": "ACETIC ACID, ZINC(II) SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c2319a4-fbf7-46d6-b307-0cdd5d1e8fbb"
          ],
          "display_name": false
        },
        {
          "uuid": "4ab616ae-b708-49e6-85d3-1670631ecde5",
          "name": "ANHYDROUS ZINC ACETATE",
          "stdName": "ANHYDROUS ZINC ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e910876e-9cf5-4e01-b401-b90375f84a08",
            "2811bcc3-e795-4cb3-b9f8-cc0c355a96d1"
          ],
          "display_name": false
        },
        {
          "uuid": "921de946-09d7-4847-b06e-ad50ddfe45d9",
          "name": "ANHYDROUS ZINC ACETATE [MART.]",
          "stdName": "ANHYDROUS ZINC ACETATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e910876e-9cf5-4e01-b401-b90375f84a08"
          ],
          "display_name": false
        },
        {
          "uuid": "2ad8d51a-a67d-c67b-a721-550dac2fcc26",
          "name": "NANO-DTPA CAPSULE COMPONENT ZINC ACETATE",
          "stdName": "NANO-DTPA CAPSULE COMPONENT ZINC ACETATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adcddfe2-c69c-ee9c-d3fd-e41e040a9c85"
          ],
          "display_name": false
        },
        {
          "uuid": "b6267161-e92f-f6f6-4e0f-db351efdabf1",
          "name": "NANODTPA COMPONENT ZINC ACETATE",
          "stdName": "NANODTPA COMPONENT ZINC ACETATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0597a53-bfe3-f993-ea0e-344e09f59c0f",
            "adcddfe2-c69c-ee9c-d3fd-e41e040a9c85"
          ],
          "display_name": false
        },
        {
          "uuid": "c806c4bd-abea-1430-559c-ac186eb5fadc",
          "name": "NANODTPA ZN-DTPA COMPONENT ZINC ACETATE",
          "stdName": "NANODTPA ZN-DTPA COMPONENT ZINC ACETATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adcddfe2-c69c-ee9c-d3fd-e41e040a9c85",
            "c0597a53-bfe3-f993-ea0e-344e09f59c0f"
          ],
          "display_name": false
        },
        {
          "uuid": "1a92d919-9f77-49ac-8b4f-3af6cb6e0466",
          "name": "NSC-75801",
          "stdName": "NSC-75801",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c2319a4-fbf7-46d6-b307-0cdd5d1e8fbb"
          ],
          "display_name": false
        },
        {
          "uuid": "505db875-08da-4583-afa1-5fa67c1bacd8",
          "name": "ZINC ACETATE ANHYDROUS",
          "stdName": "ZINC ACETATE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29f4f8e1-40e6-49c5-b890-c90a6ce21e89",
            "d49d4c4d-e175-4bb6-b834-290943bf4aea",
            "7d4e4eff-858b-4544-acad-0464284d429a"
          ],
          "display_name": true
        },
        {
          "uuid": "c35af13e-bf8d-4eea-a400-59e9e9507625",
          "name": "ZINC ACETATE ANHYDROUS [HSDB]",
          "stdName": "ZINC ACETATE ANHYDROUS [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d49d4c4d-e175-4bb6-b834-290943bf4aea"
          ],
          "display_name": false
        },
        {
          "uuid": "91f26fd9-ed24-4739-a7f4-83f962e18142",
          "name": "ZINC ACETATE [MI]",
          "stdName": "ZINC ACETATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49115b75-79a3-4572-b998-8fe96c985baa"
          ],
          "display_name": false
        },
        {
          "uuid": "23518b05-3444-4b68-b9ed-68b40b3aec21",
          "name": "ZINC(II) ACETATE",
          "stdName": "ZINC(II) ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c2319a4-fbf7-46d6-b307-0cdd5d1e8fbb"
          ],
          "display_name": false
        },
        {
          "uuid": "3d16deb0-d36d-486d-9f4d-cd39e31bb726",
          "name": "ZINCUM ACETICUM",
          "stdName": "ZINCUM ACETICUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f29c21f-7f91-41ee-a136-154203012e6f",
            "9820d4d5-d30e-4897-989a-15f43e983ae3",
            "534e6f57-15f6-44f2-80f2-db8ce1400c62"
          ],
          "display_name": false
        },
        {
          "uuid": "2119f16a-c2df-47e3-b0dd-2defe8608860",
          "name": "ZINCUM ACETICUM [HPUS]",
          "stdName": "ZINCUM ACETICUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9820d4d5-d30e-4897-989a-15f43e983ae3",
            "534e6f57-15f6-44f2-80f2-db8ce1400c62"
          ],
          "display_name": false
        },
        {
          "uuid": "885df395-0e91-dcd1-07f7-fad85370aa01",
          "name": "Zinc acetate [WHO-DD]",
          "stdName": "ZINC ACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5b125d9-5abc-e963-a6b5-f23031a0c2f9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7d4e4eff-858b-4544-acad-0464284d429a",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0c2319a4-fbf7-46d6-b307-0cdd5d1e8fbb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "534e6f57-15f6-44f2-80f2-db8ce1400c62",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9820d4d5-d30e-4897-989a-15f43e983ae3",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49115b75-79a3-4572-b998-8fe96c985baa",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d49d4c4d-e175-4bb6-b834-290943bf4aea",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f709bfa9-a58d-41e4-bc4c-d44fa1d7be37",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e910876e-9cf5-4e01-b401-b90375f84a08",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8026dd30-0244-457e-a22f-3e5440a6f8a0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba42c12b-694e-4468-a820-8130ca5c66a6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390847000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b80f679-2d49-4ffa-9345-d6777aed549e",
          "citation": "SRS import [H2ZEY72PME]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H2ZEY72PME",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390847000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f29c21f-7f91-41ee-a136-154203012e6f",
          "citation": "ZINCUM ACETICUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29f4f8e1-40e6-49c5-b890-c90a6ce21e89",
          "citation": "ZINC ACETATE ANHYDROUS [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2811bcc3-e795-4cb3-b9f8-cc0c355a96d1",
          "citation": "ANHYDROUS ZINC ACETATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "85a03f98-28d2-8078-e8a7-26a4c95fe074",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+557-34-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5f71c485-cbf4-e60a-ba6e-58240a24559b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=557-34-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c0597a53-bfe3-f993-ea0e-344e09f59c0f",
          "citation": "https://adisinsight.springer.com/drugs/800032785",
          "url": "https://adisinsight.springer.com/drugs/800032785",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adcddfe2-c69c-ee9c-d3fd-e41e040a9c85",
          "url": "https://patentimages.storage.googleapis.com/95/1d/01/abb714af7ddfba/US9040091.pdf",
          "doc_type": "PATENT",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "09d00ccc-e34a-466e-b9bb-71d61a657af4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "515c5613-8e4a-8be3-d39e-5dcf372465d0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8aa45cb2-6679-fa4d-5a24-43b2d6286418",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f5b125d9-5abc-e963-a6b5-f23031a0c2f9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "45eb9299-ba93-06df-ac04-2fecde254cf8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5bf08fca-48bb-40a6-a561-2f5624188574",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "06117952-78b0-0e60-3e78-942c2944f6a3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a06eea9b-e5a0-4485-a804-c4554f41065b",
          "id": "a06eea9b-e5a0-4485-a804-c4554f41065b",
          "molfile": "\n  Marvin  01132108202D          \n\n  1  0  0  0  0  0            999 V2000\n    0.7127   -0.6385    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5f32cd5b-d389-4943-aeb5-ac9b5bc7cf07"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "58d21e6c-3214-4bf2-89af-0e9d6f8e6ef8",
          "id": "58d21e6c-3214-4bf2-89af-0e9d6f8e6ef8",
          "molfile": "\n  Marvin  01132104362D          \n\n  4  3  0  0  0  0            999 V2000\n    3.0267   -1.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7445   -0.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7445    0.0912    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4384   -1.1462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\nM  CHG  1   3  -1\nM  END",
          "smiles": "CC(=O)[O-]",
          "formula": "C2H3O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "2b6951eb-c867-4ee7-ae22-c5da146c6177"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "59.0441",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0738123f-1e1d-4f9c-9469-6a17f4715503",
      "version": "14",
      "structure": {
        "id": "f97386ce-add7-483d-bcea-39cfe520bfe7",
        "molfile": "\n  Marvin  01132112552D          \n\n  9  6  0  0  0  0            999 V2000\n    3.7445   -0.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0267   -1.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7445    0.0912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4384   -1.1462    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.7127   -0.6385    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    3.7445   -0.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0267   -1.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7445    0.0912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4384   -1.1462    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  4  1  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  6  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\nM  CHG  3   4  -1   5   2   9  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  8   1   2   3   4   6   7   8   9\nM  SPA   1  4   1   2   3   4\nM  SDI   1  4    2.6067   -1.5662    2.6067    0.5112\nM  SDI   1  4    4.8584    0.5112    4.8584   -1.5662\nM  SMT   1 2\nM  END",
        "smiles": "CC(=O)[O-].CC(=O)[O-].[Zn+2]",
        "formula": "2C2H3O2.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "183.4838",
        "optical_activity": "NONE",
        "references": [
          "0c2319a4-fbf7-46d6-b307-0cdd5d1e8fbb",
          "7b80f679-2d49-4ffa-9345-d6777aed549e"
        ],
        "stereo_centers": 0
      },
      "unii": "H2ZEY72PME"
    }
  ]
}