{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f2a57015-e4e1-423b-a530-6295b72da303", "code": "364364-06-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=364364-06-7", "code_system": "CAS", "references": [ "7dc54078-a5b4-44ab-8553-42f8dc7ef3ab", "30a3bb29-e723-4905-8dac-cadd418d81cc" ] }, { "uuid": "c9b48cb9-7059-469f-9117-e3588b8bc3f1", "code": "1715135", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1715135", "code_system": "PUBCHEM", "references": [ "7dc54078-a5b4-44ab-8553-42f8dc7ef3ab" ] }, { "uuid": "b19ee08d-0766-488f-8640-51adc9790f06", "code": "H2WS93I0OP", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "4ae22760-4c2e-4db1-86b1-e0ac8512eb34", "name": ".ALPHA.-HEXYLCINNAMALDEHYDE, (2Z)-", "stdName": ".ALPHA.-HEXYLCINNAMALDEHYDE, (2Z)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "225e3528-7d7f-4de2-81d9-192e0b24d271", "d4179eac-5d37-429e-ab8c-30c16be67f3b" ], "display_name": true }, { "uuid": "b38bbb61-37b8-4b8e-9b5f-ec7820393446", "name": "OCTANAL, 2-(PHENYLMETHYLENE)-, (2Z)-", "stdName": "OCTANAL, 2-(PHENYLMETHYLENE)-, (2Z)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d4179eac-5d37-429e-ab8c-30c16be67f3b", "8cbc75bd-578b-4395-93aa-9b2bb69da92d" ], "display_name": false } ], "references": [ { "uuid": "8cbc75bd-578b-4395-93aa-9b2bb69da92d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d4179eac-5d37-429e-ab8c-30c16be67f3b", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "225e3528-7d7f-4de2-81d9-192e0b24d271", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7dc54078-a5b4-44ab-8553-42f8dc7ef3ab", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390906000, "tags": [ "NOMEN" ] }, { "uuid": "29dfda14-1ef4-4a17-9310-a313c7791b9b", "citation": "SRS import [H2WS93I0OP]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H2WS93I0OP", "doc_type": "SRS", "public_domain": true, "document_date": 1493390906000, "tags": [ "NOMEN" ] }, { "uuid": "30a3bb29-e723-4905-8dac-cadd418d81cc", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4823412c-cde2-445e-a087-f2d13846abbb", "id": "4823412c-cde2-445e-a087-f2d13846abbb", "molfile": "\n Marvin 01132103472D \n\n 16 16 0 0 0 0 999 V2000\n 7.1733 -0.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4830 -1.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7284 -1.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0329 -1.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3143 -1.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6111 -1.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9054 -1.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8616 -0.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1198 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2022 -1.6330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4630 -1.2621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4089 -0.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6800 -0.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0335 -1.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7521 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 10 2 0 0 0 0\n 9 8 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 16 11 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "CCCCCC/C(=C/c1ccccc1)/C=O", "formula": "C15H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a3c4d92d-40d5-4b55-b659-b9a7e77c126a" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "216.3193", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c68a275b-9a64-4cb2-9962-205430944f2c", "version": "4", "structure": { "id": "34c641e6-f8d5-45a9-809c-ea92128e0805", "molfile": "\n Marvin 01132102492D \n\n 16 16 0 0 0 0 999 V2000\n 2.2022 -1.6330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9054 -1.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1198 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8616 -0.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4630 -1.2621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6111 -1.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4089 -0.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7521 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3143 -1.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4830 -1.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7284 -1.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0329 -1.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1733 -0.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6800 -0.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0335 -1.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 5 2 0 0 0 0\n 8 5 1 0 0 0 0\n 9 6 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 9 1 0 0 0 0\n 13 10 1 0 0 0 0\n 14 7 1 0 0 0 0\n 15 8 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 14 2 0 0 0 0\nM END", "smiles": "CCCCCC/C(=C/c1ccccc1)/C=O", "formula": "C15H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "216.3193", "optical_activity": "NONE", "references": [ "29dfda14-1ef4-4a17-9310-a313c7791b9b", "8cbc75bd-578b-4395-93aa-9b2bb69da92d" ], "stereo_centers": 0 }, "unii": "H2WS93I0OP" } ] }