{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7efdc955-df89-4c8d-8588-66edb389ce4b",
          "code": "13466-78-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13466-78-9",
          "code_system": "CAS",
          "references": [
            "ef1d2b6e-ed76-427f-b5da-fb5565192010",
            "1916abd0-10f2-45e9-92dc-225b446e854f"
          ]
        },
        {
          "uuid": "9d17096d-efb6-473d-8df5-4d822687c183",
          "code": "C030218",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67030218",
          "code_system": "MESH",
          "references": [
            "ef1d2b6e-ed76-427f-b5da-fb5565192010"
          ]
        },
        {
          "uuid": "63b6f5aa-03b3-4df0-846f-715bc78ce871",
          "code": "m3105",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3105?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ef1d2b6e-ed76-427f-b5da-fb5565192010"
          ]
        },
        {
          "uuid": "fb5e8103-c3e4-42cc-90a2-492d5d1d3939",
          "code": "236-719-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.367",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ef1d2b6e-ed76-427f-b5da-fb5565192010"
          ]
        },
        {
          "uuid": "adb1443a-6b33-2ef8-2586-0a935ba1ae18",
          "code": "DTXSID4047462",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4047462",
          "code_system": "EPA CompTox",
          "references": [
            "59aa2827-88d1-0021-808e-1831fcbe5066"
          ]
        },
        {
          "uuid": "3453ae14-e2bb-be63-bb67-b0e7b16eb195",
          "code": "2395760",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2395760/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "64ea8849-d105-6243-3bc4-e6bb75ea286a"
          ]
        },
        {
          "uuid": "683d63a0-1396-4f1a-a8b0-a902401289f3",
          "code": "H2M15SNR6N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5dd5b007-2aed-4d09-ee0d-f9878f6016b3",
          "code": "35661",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:35661",
          "code_system": "CHEBI",
          "references": [
            "ba3ad080-981a-1a98-0b7b-210ae4cf73cf"
          ]
        },
        {
          "uuid": "66c4f617-c5c1-d6c0-8e6a-f0961659f209",
          "code": "3-Carene",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/3-Carene",
          "code_system": "WIKIPEDIA",
          "references": [
            "b214b5b3-448d-ff7d-7065-da1a880f6ec5"
          ]
        },
        {
          "uuid": "26300ffb-0540-c96a-28e6-baf8fe5fe51d",
          "code": "H2M15SNR6N",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=H2M15SNR6N",
          "code_system": "DAILYMED",
          "references": [
            "171e0be5-b8ac-9455-6e38-c6e364034320"
          ]
        },
        {
          "uuid": "a5052b09-60b4-b2b2-2e89-373825124c37",
          "code": "1341",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1341/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "92dc690d-b5d2-3089-983c-ddd49e39f9ba"
          ]
        },
        {
          "uuid": "d766287e-2bb3-943e-b39f-019401ae91b6",
          "code": "300000048795",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2b60cf7b-7b0e-424d-52d6-b55987088498"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a26042e6-cff2-4eef-9466-61885422b89c",
          "comments": "Cannabis essential oil terpenoid.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "18e04038-2161-476d-8eac-1993c3fe2a03"
          ],
          "related_substance": {
            "uuid": "98bfc20e-562f-4820-8b78-6ccd77156ca5",
            "refuuid": "8e61faef-71bb-4cbd-8b70-716ea0fd1d02",
            "name": "CANNABIS SATIVA SUBSP. INDICA TOP",
            "unii": "FTS5RM302N",
            "linking_id": "FTS5RM302N",
            "ref_pname": "CANNABIS SATIVA SUBSP. INDICA TOP",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "652af5ff-f236-48ed-a038-8e4bbaa19a8f",
          "name": "(±)-.DELTA.3-CARENE",
          "stdName": "(+/-)-.DELTA.3-CARENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0faa84d0-ace7-4c77-b341-d58f34d5f427",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        },
        {
          "uuid": "f5b1b13e-0dae-4a41-96e4-8ccd09ecc32f",
          "name": "(±)-3-CARENE",
          "stdName": "(+/-)-3-CARENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0faa84d0-ace7-4c77-b341-d58f34d5f427",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        },
        {
          "uuid": "009a5d9d-ec8a-4ee9-91b1-3cdab8afa837",
          "name": ".DELTA.3-CARENE",
          "stdName": ".DELTA.3-CARENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adbd5eb9-65fa-4239-815b-9fbab7f64b73",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        },
        {
          "uuid": "a7b3ebaf-ce9a-4287-9610-26b183591469",
          "name": "3,7,7-TRIMETHYLBICYCLO(4.1.0)HEPT-3-ENE",
          "stdName": "3,7,7-TRIMETHYLBICYCLO(4.1.0)HEPT-3-ENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3afce72e-766f-4cb0-a8eb-c0dc1b336a6d",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        },
        {
          "uuid": "b99e1c7c-533e-4e56-9b35-73d8de07fb6e",
          "name": "3-CARENE",
          "stdName": "3-CARENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adbd5eb9-65fa-4239-815b-9fbab7f64b73",
            "44191217-38c2-4c0b-a8fd-3dd9bb44317f",
            "9dfaddfd-adc8-4482-94b8-44078efe6458",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705",
            "39b9a386-1f54-4dbe-a1ec-6af62c8011a3",
            "e1284c38-8f80-4ab6-93ee-596ce2f02521"
          ],
          "display_name": true
        },
        {
          "uuid": "461d7d52-bc0e-460b-9a90-8e75dd5b2cea",
          "name": "3-CARENE [FHFI]",
          "stdName": "3-CARENE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705",
            "e1284c38-8f80-4ab6-93ee-596ce2f02521"
          ],
          "display_name": false
        },
        {
          "uuid": "3c3b415e-82e8-48d8-8b5e-9d91229b3076",
          "name": "3-CARENE [MI]",
          "stdName": "3-CARENE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9dfaddfd-adc8-4482-94b8-44078efe6458",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        },
        {
          "uuid": "22bf9665-f311-410f-85c5-0e5b34f0fc18",
          "name": "3-KAREN",
          "stdName": "3-KAREN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3afce72e-766f-4cb0-a8eb-c0dc1b336a6d",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        },
        {
          "uuid": "9da83dcf-fa31-47ec-869c-ca6bc812dc2f",
          "name": "3-NORCARENE, 3,7,7-TRIMETHYL-",
          "stdName": "3-NORCARENE, 3,7,7-TRIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3afce72e-766f-4cb0-a8eb-c0dc1b336a6d",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        },
        {
          "uuid": "35c67c51-1833-468e-ba85-76053ed888a7",
          "name": "BICYCLO(4.1.0)HEPT-3-ENE, 3,7,7-TRIMETHYL-",
          "stdName": "BICYCLO(4.1.0)HEPT-3-ENE, 3,7,7-TRIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3afce72e-766f-4cb0-a8eb-c0dc1b336a6d",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        },
        {
          "uuid": "ea42e89e-d604-4c34-8747-65e18ba44cae",
          "name": "FEMA NO. 3821",
          "stdName": "FEMA NO. 3821",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705",
            "e1284c38-8f80-4ab6-93ee-596ce2f02521"
          ],
          "display_name": false
        },
        {
          "uuid": "b9dc27f9-54a8-4596-b400-0c6805d97f6c",
          "name": "S-3-CARENE",
          "stdName": "S-3-CARENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3afce72e-766f-4cb0-a8eb-c0dc1b336a6d",
            "e59e3429-398a-4cc8-8ae0-41dc6f9b5705"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "adbd5eb9-65fa-4239-815b-9fbab7f64b73",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e59e3429-398a-4cc8-8ae0-41dc6f9b5705",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0faa84d0-ace7-4c77-b341-d58f34d5f427",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3afce72e-766f-4cb0-a8eb-c0dc1b336a6d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1284c38-8f80-4ab6-93ee-596ce2f02521",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dfaddfd-adc8-4482-94b8-44078efe6458",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef1d2b6e-ed76-427f-b5da-fb5565192010",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391321000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18e04038-2161-476d-8eac-1993c3fe2a03",
          "citation": "CHAPTER 2 : CHEMISTRY AND ANALYSIS OF PHYTOCANNABINOIDS AND OTHER CANNABIS CONSTITUENTS BY RUDOLF BRENNEISEN; PAGES 17-49",
          "url": "http://www.medicinalgenomics.com/wp-content/uploads/2011/12/Chemical-constituents-of-cannabis.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1296ea79-3e2c-429c-a676-0f50773cb9f7",
          "citation": "SRS import [H2M15SNR6N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H2M15SNR6N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391321000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44191217-38c2-4c0b-a8fd-3dd9bb44317f",
          "citation": "3-CARENE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39b9a386-1f54-4dbe-a1ec-6af62c8011a3",
          "citation": "3-CARENE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "59aa2827-88d1-0021-808e-1831fcbe5066",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13466-78-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b214b5b3-448d-ff7d-7065-da1a880f6ec5",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "64ea8849-d105-6243-3bc4-e6bb75ea286a",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "1916abd0-10f2-45e9-92dc-225b446e854f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ba3ad080-981a-1a98-0b7b-210ae4cf73cf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "171e0be5-b8ac-9455-6e38-c6e364034320",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "92dc690d-b5d2-3089-983c-ddd49e39f9ba",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "ccba508e-5f9f-a620-1746-13c5fc4d4932",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "2b60cf7b-7b0e-424d-52d6-b55987088498",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bf0daa6e-17d2-4507-81ce-145b336561cb",
          "id": "bf0daa6e-17d2-4507-81ce-145b336561cb",
          "molfile": "\n  Marvin  01132109532D          \n\n 10 11  0  0  0  0            999 V2000\n    6.5981   -4.0779    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.8838   -3.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8838   -2.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5981   -2.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5981   -1.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3127   -2.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3127   -3.6654    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.3127   -4.4904    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0305   -5.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1251   -4.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  0  0  0  0\n  1  8  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC[C@H]2[C@@H](C1)C2(C)C",
          "formula": "C10H16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "52720047-7ddc-487f-836c-0fff19b962f3"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "136.2344",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9a64f057-6198-4844-9714-510472950996",
      "version": "13",
      "structure": {
        "id": "0a40c9c3-256f-4123-8fbd-d01211a7724b",
        "molfile": "\n  Marvin  01132100472D          \n\n 10 11  0  0  0  0            999 V2000\n    6.5981   -1.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5981   -2.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8838   -2.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8838   -3.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5981   -4.0779    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3127   -3.6654    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3127   -2.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3127   -4.4904    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0305   -5.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1251   -4.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  6  8  1  1  0  0  0\n  5  8  1  1  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\nM  END",
        "smiles": "CC1=CC[C@H]2[C@@H](C1)C2(C)C",
        "formula": "C10H16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "136.2344",
        "optical_activity": "( + / - )",
        "references": [
          "adbd5eb9-65fa-4239-815b-9fbab7f64b73",
          "1296ea79-3e2c-429c-a676-0f50773cb9f7"
        ],
        "stereo_centers": 2
      },
      "unii": "H2M15SNR6N"
    }
  ]
}