{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "53b863cb-5959-4bbe-bb77-9fd9bb88ae15",
          "code": "110-33-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=110-33-8",
          "code_system": "CAS",
          "references": [
            "2d1d1d2b-23bd-44ef-8f61-e0a718e29cec",
            "d600a52b-87a7-4174-b28b-4e2cee7a21ff"
          ]
        },
        {
          "uuid": "c0f26dfc-2813-4f96-bf79-0ec349a40955",
          "code": "203-757-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.417",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2d1d1d2b-23bd-44ef-8f61-e0a718e29cec"
          ]
        },
        {
          "uuid": "366d4aef-919f-4abd-87ca-abf57652c432",
          "code": "8046",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8046",
          "code_system": "PUBCHEM",
          "references": [
            "2d1d1d2b-23bd-44ef-8f61-e0a718e29cec"
          ]
        },
        {
          "uuid": "e554ad2c-8793-f303-0f93-18176a8ea53b",
          "code": "DTXSID9026841",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9026841",
          "code_system": "EPA CompTox",
          "references": [
            "e9bed8e8-2994-7290-707e-0eaea5db3013"
          ]
        },
        {
          "uuid": "2333e500-56b9-439c-9654-85b5157e4f77",
          "code": "H16ECG10GB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c7b8193f-180b-4312-b007-17cfddf041ec",
          "name": "ADIPIC ACID, DIHEXYL ESTER",
          "stdName": "ADIPIC ACID, DIHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51e228f-02f9-4157-b0da-6812a531cc13",
            "387d6921-9657-4159-b141-bd8fd5be4e50"
          ],
          "display_name": false
        },
        {
          "uuid": "8542bb70-2d49-47a2-9416-b1f2605f9226",
          "name": "DI-N-HEXYL ADIPATE",
          "stdName": "DI-N-HEXYL ADIPATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46f2f9f3-db51-498f-846e-64611d03c83c",
            "d51e228f-02f9-4157-b0da-6812a531cc13"
          ],
          "display_name": false
        },
        {
          "uuid": "c1cbd538-e111-40ed-8e94-420d32bab30e",
          "name": "DIHEXYL ADIPATE",
          "stdName": "DIHEXYL ADIPATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51e228f-02f9-4157-b0da-6812a531cc13",
            "f1190f2b-c7c6-4a24-9b16-8f0a6f2fd363",
            "d6a25d05-1cb9-4588-aeab-1b2f67692e62"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a72c5794-cb14-4d6f-a6d9-33a496249106",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cc72442e-e744-4ec9-a9ab-c2145aa19d54",
          "name": "DIHEXYL HEXANEDIOATE",
          "stdName": "DIHEXYL HEXANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51e228f-02f9-4157-b0da-6812a531cc13",
            "387d6921-9657-4159-b141-bd8fd5be4e50"
          ],
          "display_name": false
        },
        {
          "uuid": "91a054b2-5837-4ebd-b81e-03bbb2224e76",
          "name": "HEXANEDIOIC ACID, 1,6-DIHEXYL ESTER",
          "stdName": "HEXANEDIOIC ACID, 1,6-DIHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51e228f-02f9-4157-b0da-6812a531cc13",
            "387d6921-9657-4159-b141-bd8fd5be4e50"
          ],
          "display_name": false
        },
        {
          "uuid": "46908faf-f95a-461b-9749-641ade8f4a7b",
          "name": "HEXANEDIOIC ACID, DIHEXYL ESTER",
          "stdName": "HEXANEDIOIC ACID, DIHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51e228f-02f9-4157-b0da-6812a531cc13",
            "387d6921-9657-4159-b141-bd8fd5be4e50"
          ],
          "display_name": false
        },
        {
          "uuid": "5666e5d4-99a7-4f95-b062-e8b1f910557b",
          "name": "PLASTOMOLL DHA",
          "stdName": "PLASTOMOLL DHA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51e228f-02f9-4157-b0da-6812a531cc13",
            "387d6921-9657-4159-b141-bd8fd5be4e50"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "46f2f9f3-db51-498f-846e-64611d03c83c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d51e228f-02f9-4157-b0da-6812a531cc13",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "387d6921-9657-4159-b141-bd8fd5be4e50",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6a25d05-1cb9-4588-aeab-1b2f67692e62",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d1d1d2b-23bd-44ef-8f61-e0a718e29cec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb152e9a-11be-4220-a1f0-73a296770c4d",
          "citation": "SRS import [H16ECG10GB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=H16ECG10GB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1190f2b-c7c6-4a24-9b16-8f0a6f2fd363",
          "citation": "DIHEXYL ADIPATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e9bed8e8-2994-7290-707e-0eaea5db3013",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=110-33-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d600a52b-87a7-4174-b28b-4e2cee7a21ff",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "87648eae-6a00-4eab-b358-7f35155c0db9",
          "id": "87648eae-6a00-4eab-b358-7f35155c0db9",
          "molfile": "\n  Marvin  01132107012D          \n\n 22 21  0  0  0  0            999 V2000\n   15.0621   -5.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3256   -5.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5835   -5.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8853   -5.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1379   -5.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4177   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7084   -5.3678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9773   -5.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9773   -6.6282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2626   -5.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5533   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8551   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1239   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4146   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4146   -4.5876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6891   -5.8316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9361   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1996   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4740   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7593   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0391   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3136   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCOC(=O)CCCCC(=O)OCCCCCC",
          "formula": "C18H34O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7aa69e6a-b613-4eb1-8dbd-2d37e19daa97"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "314.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6b0bf549-9a95-480c-8366-b3523750180c",
      "version": "5",
      "structure": {
        "id": "26826320-6ac8-4323-8851-aa6eeeeedc60",
        "molfile": "\n  Marvin  01132102082D          \n\n 22 21  0  0  0  0            999 V2000\n   15.0621   -5.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3256   -5.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5835   -5.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3136   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8853   -5.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0391   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1379   -5.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7593   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4177   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4740   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9773   -6.6282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7084   -5.3678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1996   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9773   -5.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9361   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2626   -5.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4146   -4.5876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6891   -5.8316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5533   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4146   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8551   -5.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1239   -5.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  8  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 10  1  0  0  0  0\n 14 11  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20 17  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCOC(=O)CCCCC(=O)OCCCCCC",
        "formula": "C18H34O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "314.4609",
        "optical_activity": "NONE",
        "references": [
          "bb152e9a-11be-4220-a1f0-73a296770c4d",
          "387d6921-9657-4159-b141-bd8fd5be4e50"
        ],
        "stereo_centers": 0
      },
      "unii": "H16ECG10GB"
    }
  ]
}