{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "84c500c5-9f6f-4d61-8953-e4bdb02cc528",
          "code": "C80777",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80777",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "e6d3607d-269a-4176-95c0-9c7f60352a65",
          "code": "131-48-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131-48-6",
          "code_system": "CAS",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac",
            "c69ed54c-6a6c-414f-919f-96bac2fdcb34"
          ]
        },
        {
          "uuid": "932cf26b-3712-4680-b7a3-a1285618fd93",
          "code": "N-ACETYLNEURAMINIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/N-Acetylneuraminic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "8ab40b9b-d21f-4c1a-988e-549c20ec6a89",
          "code": "SUB05210MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "2947fe2b-8636-4d55-8d7d-1dc1e32137b9",
          "code": "6697",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6697",
          "code_system": "INN",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "b50105a5-8d49-44a8-96e0-596f1c26dec0",
          "code": "205-023-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.568",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "0b77942d-ccd2-4772-af62-f58e82b69dcb",
          "code": "489-46-3",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=489-46-3",
          "code_system": "CAS",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac",
            "2f6586b6-b7c0-4a94-829d-50a249846499"
          ]
        },
        {
          "uuid": "de1ec6fe-585d-4202-8bf2-13527ccf6a3e",
          "code": "m9893",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9893?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "f3ebc18c-041e-4079-a269-f6e06158757a",
          "code": "19342-33-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19342-33-7",
          "code_system": "CAS",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac",
            "df723456-ffb3-4f81-8d5c-66684529fab7"
          ]
        },
        {
          "uuid": "7c869ef8-e45b-4ab5-b9b6-25ee085a7dc3",
          "code": "CHEMBL2105945",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2105945",
          "code_system": "ChEMBL",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "dab28fa5-2e3f-4bcc-bb14-bb3542cbb433",
          "code": "M09AX05",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|OTHER DRUGS FOR DISORDERS OF THE MUSCULO-SKELETAL SYSTEM|OTHER DRUGS FOR DISORDERS OF THE MUSCULO-SKELETAL SYSTEM|Other drugs for disorders of the musculo-skeletal system|aceneuramic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M09AX05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "2f5175bb-17b5-45be-aa2a-22f3bd2055fc",
          "code": "14017587",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14017587",
          "code_system": "PUBCHEM",
          "references": [
            "7687f51f-09ee-44d3-8ad5-7959f5c48aac"
          ]
        },
        {
          "uuid": "042aea78-0254-20de-354c-8bb2cdfad999",
          "code": "DTXSID0050425",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0050425",
          "code_system": "EPA CompTox",
          "references": [
            "5090377e-5be0-703a-9742-b42311842766"
          ]
        },
        {
          "uuid": "e489e4b4-67c2-5ec6-07c6-548fc6c3c23b",
          "code": "C28188",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Carbohydrate[C344]|Sialic Acid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28188",
          "code_system": "NCI_THESAURUS",
          "references": [
            "64eac69d-8286-05d9-d3e8-3b240cbc9400"
          ]
        },
        {
          "uuid": "6656fd43-0af7-4d26-9ae7-a57133bc320a",
          "code": "GZP2782OP0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "96f2471d-e63f-a7e2-3cfb-994a34234751",
          "code": "DB11797",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11797",
          "code_system": "DRUG BANK",
          "references": [
            "64eac69d-8286-05d9-d3e8-3b240cbc9400"
          ]
        },
        {
          "uuid": "35527ab0-745a-e85b-96f9-7b6071e6fee0",
          "code": "17012",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17012",
          "code_system": "CHEBI",
          "references": [
            "64eac69d-8286-05d9-d3e8-3b240cbc9400"
          ]
        },
        {
          "uuid": "9c4d2163-ad03-6aa1-1337-8ab8a6167c34",
          "code": "1612619",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1612619",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "64eac69d-8286-05d9-d3e8-3b240cbc9400"
          ]
        },
        {
          "uuid": "3f5f1c75-7a35-e2de-e45d-0da1bdad35dd",
          "code": "CD-39",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/CD-39/relevant/1/",
          "code_system": "USAN",
          "references": [
            "355ce988-c363-5626-22a4-d9ae94f2d40b"
          ]
        },
        {
          "uuid": "d695b013-fba4-2444-ae3b-eaff309df849",
          "code": "111756",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=111756",
          "code_system": "NSC",
          "references": [
            "5fe244e3-e065-67cc-d54b-5fdc6440039d"
          ]
        },
        {
          "uuid": "d18430d3-91cc-05d6-0748-fd2ad6ce7828",
          "code": "351511",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of hereditary inclusion body myopathy",
          "codeText": "ORPHAN DRUG|Designated/Withdrawn|Treatment of hereditary inclusion body myopathy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=351511",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "f1319fa6-e1e2-6d90-8e27-1197b433a13c",
          "code": "100000087915",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8c0a1057-5bb2-eb2e-a872-87300556db42"
          ]
        },
        {
          "uuid": "60aef5ba-85a9-4665-2e66-aad263afb760",
          "code": "2613558",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2613558/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "fe93ce80-6322-cc14-f53e-23717158a0f8"
          ]
        },
        {
          "uuid": "f4118000-e36e-98cf-9e5f-0857a234c84b",
          "code": "173082",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:173082",
          "code_system": "CHEBI",
          "references": [
            "64eac69d-8286-05d9-d3e8-3b240cbc9400"
          ]
        },
        {
          "uuid": "675db89f-3c6d-8956-2cca-b30d03e0ab0a",
          "code": "602",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=602",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "64eac69d-8286-05d9-d3e8-3b240cbc9400"
          ]
        },
        {
          "uuid": "3170aaa5-c6f1-e7be-2467-7a01441a4aed",
          "code": "GZP2782OP0",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(GZP2782OP0)",
          "code_system": "DAILYMED",
          "references": [
            "d5fc4d20-cfad-3b03-1827-1d7d8c267d04"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4c2a8070-3631-49f6-a9f0-4993930d7bf4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "43165f13-c3ac-4280-a451-11574f8372a4",
            "refuuid": "5c53564c-e0af-49fd-bc6a-d768370b9e47",
            "name": "ACENEURAMIC ACID",
            "unii": "GZP2782OP0",
            "linking_id": "GZP2782OP0",
            "ref_pname": "ACENEURAMIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1f61603c-5e17-4b99-aca3-238ce9a438b8",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "69366518-8fc1-40b4-8579-2b2fbf497b87",
            "refuuid": "e75347d4-12a6-4766-96af-1f12d6ee20cc",
            "name": "SODIUM ACENEURAMATE",
            "unii": "H87DON401P",
            "linking_id": "H87DON401P",
            "ref_pname": "SODIUM ACENEURAMATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4dded6ec-d01a-4893-adcb-543d7cd602fc",
          "name": "(-)-5-ACETAMIDO-3,5-DIDEOXY-D-GLYCERO-D-GALACTO-NONULOSONIC ACID",
          "stdName": "(-)-5-ACETAMIDO-3,5-DIDEOXY-D-GLYCERO-D-GALACTO-NONULOSONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee5f8d2a-8422-4a53-99a4-e768a7317dd1"
          ],
          "display_name": false
        },
        {
          "uuid": "1afa3601-2a6f-484f-a2d5-9442e625c1e2",
          "name": "(2S,4S,5R,6R)-5-ACETAMIDO-2,4-DIHYDROXY- 6-((1R,2R)-1,2,3-TRIHYDROXYPROPYL)OXANE-2-CARBOXYLIC ACID",
          "stdName": "(2S,4S,5R,6R)-5-ACETAMIDO-2,4-DIHYDROXY- 6-((1R,2R)-1,2,3-TRIHYDROXYPROPYL)OXANE-2-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5e39379-e20f-4558-8bf2-160e24357e8d",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "b0ca206e-9a87-4b3e-a30e-3d401819dff5",
          "name": "5-N-ACETYL-D-NEURAMINIC ACID",
          "stdName": "5-N-ACETYL-D-NEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "07d03262-4387-476c-b28b-75b2e909a17c",
          "name": "5-N-ACETYLNEURAMINIC ACID",
          "stdName": "5-N-ACETYLNEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "a9049cb3-33d2-4c1b-b2a3-8d3ade5a13a6",
          "name": "ACENEURAMIC ACID",
          "stdName": "ACENEURAMIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b13c717d-6b78-4623-af34-29190d79f438",
            "c5e39379-e20f-4558-8bf2-160e24357e8d",
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "1302f0d1-4db8-4041-93e8-592cd51db5e0",
            "9ab9452d-3f92-44ea-b096-be0f206cf5fd",
            "1175eb79-c221-4377-ac8a-2766f90df035",
            "ee5f8d2a-8422-4a53-99a4-e768a7317dd1",
            "b3ab3354-9a4e-412b-8877-70c4b9981bdd"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "13e5e63a-4e7e-4923-afdf-1a9233eee551",
              "name_org": "INN"
            },
            {
              "uuid": "e1b0491f-8311-43a1-ac36-61385f932f3a",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "910f7665-b2b6-c2c9-dbb7-95c3191452ce",
          "name": "ACENEURAMIC ACID [JAN]",
          "stdName": "ACENEURAMIC ACID [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d178c12f-50d4-ea4a-0a1d-6ab8834286b8"
          ],
          "display_name": false
        },
        {
          "uuid": "191d3569-18ac-40a3-8323-97cc56a5847e",
          "name": "ACENEURAMIC ACID [USAN]",
          "stdName": "ACENEURAMIC ACID [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5e39379-e20f-4558-8bf2-160e24357e8d",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "5e99d5f2-0c1d-4943-b099-8dd99f2de421",
          "name": "ACETYLNEURAMINIC ACID",
          "stdName": "ACETYLNEURAMINIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "583c98d7-1586-4f00-b075-afc72d479979",
            "61b3fc8c-5ff6-4db3-80d1-038ea58a4ecd",
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "8e3674d6-6fbe-402f-be21-413eef10c7f3"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bc5ce69b-3e0f-4b46-93f8-c2f405f92400",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "49f104cc-29ed-e4ef-879c-4500875a2d21",
          "name": "Aceneuramic acid [WHO-DD]",
          "stdName": "ACENEURAMIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b7a277d-4132-60be-aaa0-765187e43395"
          ],
          "display_name": false
        },
        {
          "uuid": "6cd7a5e0-8ba5-41d4-aad0-a8748f00cdd9",
          "name": "D-GLYCERO-D-GALACTO-2-NONULOSONIC ACID, 5-(ACETYLAMINO)-3,5-DIDEOXY-",
          "stdName": "D-GLYCERO-D-GALACTO-2-NONULOSONIC ACID, 5-(ACETYLAMINO)-3,5-DIDEOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "44e71ac0-259b-45f5-abcc-e086ea3362ab",
          "name": "D-GLYCERO-D-GALACTO-NONULOSONIC ACID, 5-ACETAMIDO-3,5-DIDEOXY-",
          "stdName": "D-GLYCERO-D-GALACTO-NONULOSONIC ACID, 5-ACETAMIDO-3,5-DIDEOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "55afa224-666e-4d6b-883c-446c1efa6eed",
          "name": "LACTAMINIC ACID",
          "stdName": "LACTAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "93264017-4f6e-4629-a2fb-206764992478",
          "name": "N-ACETYL-D-NEURAMINIC ACID",
          "stdName": "N-ACETYL-D-NEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "7e98f97d-1575-494e-a7e3-c34b2d0640f7",
          "name": "N-ACETYLNEURAMIC ACID",
          "stdName": "N-ACETYLNEURAMIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "d9cb9d4e-5b4f-41b1-acb9-793816ddfebf",
          "name": "N-ACETYLNEURAMINIC ACID",
          "stdName": "N-ACETYLNEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53eb044a-c256-4447-ad31-24b4aa55de72",
            "583c98d7-1586-4f00-b075-afc72d479979",
            "ec147201-7581-4982-8595-01ba9860df1f",
            "0a931bf6-a04b-4ecd-8ee6-ae27cbae8186",
            "c8071cd9-ba3f-4f85-ae03-d7f249c1d8ab",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "66f9fc43-bcdb-44e9-b12a-3a27451178b6",
          "name": "N-ACETYLNEURAMINIC ACID [MI]",
          "stdName": "N-ACETYLNEURAMINIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8071cd9-ba3f-4f85-ae03-d7f249c1d8ab",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "1ee7beed-6e7b-4665-a217-e020321c8261",
          "name": "N-ACETYLNEURAMINIC ACID [USP-RS]",
          "stdName": "N-ACETYLNEURAMINIC ACID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a931bf6-a04b-4ecd-8ee6-ae27cbae8186",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "3300213f-c1b0-4e69-ae95-6a60ac970e53",
          "name": "N-ACETYLSIALIC ACID",
          "stdName": "N-ACETYLSIALIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "c1c0a850-adcb-40db-8017-0da66f6fd78c",
          "name": "NSC-111756",
          "stdName": "NSC-111756",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "aa177f64-94a9-4e1f-b15d-0c185bd3c557"
          ],
          "display_name": false
        },
        {
          "uuid": "a9824f5f-7bc7-4f9c-964b-a389e2d6b2f6",
          "name": "SIALIC ACID",
          "stdName": "SIALIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3821196b-43ea-489c-97cf-bd0860323bae",
            "ec54a796-37ed-4342-b162-3a10376f0404"
          ],
          "display_name": false
        },
        {
          "uuid": "1a78cb62-1f14-49ea-85ca-586f708dd307",
          "name": "SIALIC ACIDS N-ACETYLNEURAMINIC ACID",
          "stdName": "SIALIC ACIDS N-ACETYLNEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2516c1eb-4b7c-429c-b020-f4a31e5470d5",
            "acdac391-e4c5-422f-82c2-086323ee6c5d",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "b7fc1f58-c9cd-463b-8603-d6e454c66fab",
          "name": "SIALIC ACIDS N-ACETYLNEURAMINIC ACID [MI]",
          "stdName": "SIALIC ACIDS N-ACETYLNEURAMINIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2516c1eb-4b7c-429c-b020-f4a31e5470d5",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "2083859e-fd14-44a1-bcf4-d32bc435f4d9",
          "name": "UX-001",
          "stdName": "UX-001",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69dc6fc8-5a04-4694-8c02-e209f1543643",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "4d20bcf7-bb76-42ba-820b-f0c1beac5125",
          "name": "UX001",
          "stdName": "UX001",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69dc6fc8-5a04-4694-8c02-e209f1543643",
            "3821196b-43ea-489c-97cf-bd0860323bae"
          ],
          "display_name": false
        },
        {
          "uuid": "142b8d5e-d6d3-4395-ba2f-fd80146440f9",
          "name": "aceneuramic acid [INN]",
          "stdName": "ACENEURAMIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ab9452d-3f92-44ea-b096-be0f206cf5fd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ee5f8d2a-8422-4a53-99a4-e768a7317dd1",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9ab9452d-3f92-44ea-b096-be0f206cf5fd",
          "citation": "INN Proposed List 65",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL65.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aa177f64-94a9-4e1f-b15d-0c185bd3c557",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3821196b-43ea-489c-97cf-bd0860323bae",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "583c98d7-1586-4f00-b075-afc72d479979",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a931bf6-a04b-4ecd-8ee6-ae27cbae8186",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec54a796-37ed-4342-b162-3a10376f0404",
          "citation": "CLINICAL TRIALS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61b3fc8c-5ff6-4db3-80d1-038ea58a4ecd",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2516c1eb-4b7c-429c-b020-f4a31e5470d5",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69dc6fc8-5a04-4694-8c02-e209f1543643",
          "citation": "USAN COUN  2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5e39379-e20f-4558-8bf2-160e24357e8d",
          "citation": "USAN COUN 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8071cd9-ba3f-4f85-ae03-d7f249c1d8ab",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3ab3354-9a4e-412b-8877-70c4b9981bdd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7687f51f-09ee-44d3-8ad5-7959f5c48aac",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390557000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52874751-e128-49f5-8842-de72473d2d68",
          "citation": "SRS import [GZP2782OP0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GZP2782OP0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390557000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b13c717d-6b78-4623-af34-29190d79f438",
          "citation": "ACENEURAMIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e3674d6-6fbe-402f-be21-413eef10c7f3",
          "citation": "ACETYLNEURAMINIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ec147201-7581-4982-8595-01ba9860df1f",
          "citation": "N-ACETYLNEURAMINIC ACID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "acdac391-e4c5-422f-82c2-086323ee6c5d",
          "citation": "SIALIC ACIDS N-ACETYLNEURAMINIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53eb044a-c256-4447-ad31-24b4aa55de72",
          "citation": "N-ACETYLNEURAMINIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1175eb79-c221-4377-ac8a-2766f90df035",
          "citation": "ACENEURAMIC ACID [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1302f0d1-4db8-4041-93e8-592cd51db5e0",
          "citation": "ACENEURAMIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af9b72e5-a2ec-c4b1-14b4-694ab3398608",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d178c12f-50d4-ea4a-0a1d-6ab8834286b8",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "5090377e-5be0-703a-9742-b42311842766",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=131-48-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe93ce80-6322-cc14-f53e-23717158a0f8",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "64eac69d-8286-05d9-d3e8-3b240cbc9400",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a3140434-855d-972f-2670-2d5b8e228f27",
          "citation": "USAN COUN 2017",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "df723456-ffb3-4f81-8d5c-66684529fab7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2f6586b6-b7c0-4a94-829d-50a249846499",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c69ed54c-6a6c-414f-919f-96bac2fdcb34",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "355ce988-c363-5626-22a4-d9ae94f2d40b",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "5fe244e3-e065-67cc-d54b-5fdc6440039d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9b7a277d-4132-60be-aaa0-765187e43395",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8c0a1057-5bb2-eb2e-a872-87300556db42",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d5fc4d20-cfad-3b03-1827-1d7d8c267d04",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b0d7f607-2232-4843-b9ed-a52941e2e139",
          "id": "b0d7f607-2232-4843-b9ed-a52941e2e139",
          "molfile": "\n  Marvin  01132109102D          \n\n 21 20  0  0  1  0            999 V2000\n    5.2891   -6.8830    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.2891   -7.7068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5741   -6.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8592   -6.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0039   -6.4711    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.0039   -5.6473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7188   -6.8830    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.7188   -7.7068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4292   -6.4711    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.4292   -5.6473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1441   -5.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8589   -5.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1441   -4.4116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1441   -6.8830    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.1441   -7.7068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8589   -6.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5739   -6.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5739   -7.7068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2888   -6.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0036   -6.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2888   -5.6473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n 14  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@H]([C@H](CC(=O)C(=O)O)O)[C@H]([C@@H]([C@@H](CO)O)O)O",
          "formula": "C11H19NO9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "55c932ed-ab96-4de1-865a-f3d13505f72a"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "309.2703",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5c53564c-e0af-49fd-bc6a-d768370b9e47",
      "version": "36",
      "structure": {
        "id": "3ab69b90-600c-4737-b1a1-3726d81ec166",
        "molfile": "\n  Marvin  01132103072D          \n\n 21 20  0  0  1  0            999 V2000\n    3.8592   -6.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5741   -6.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2891   -6.8830    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.2891   -7.7068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0039   -6.4711    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0039   -5.6473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7188   -6.8830    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4292   -6.4711    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.1441   -6.8830    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.8589   -6.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5739   -6.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2888   -6.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0036   -6.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2888   -5.6473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5739   -7.7068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1441   -7.7068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4292   -5.6473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1441   -5.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8589   -5.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1441   -4.4116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7188   -7.7068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 11 15  2  0  0  0  0\n  9 16  1  6  0  0  0\n  8 17  1  6  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n  7 21  1  1  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@H]([C@H](CC(=O)C(=O)O)O)[C@H]([C@@H]([C@@H](CO)O)O)O",
        "formula": "C11H19NO9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "309.2703",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "52874751-e128-49f5-8842-de72473d2d68",
          "ee5f8d2a-8422-4a53-99a4-e768a7317dd1",
          "9ab9452d-3f92-44ea-b096-be0f206cf5fd"
        ],
        "stereo_centers": 5
      },
      "unii": "GZP2782OP0"
    }
  ]
}