{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b6f762a8-126e-45e2-99de-1aef5affb630", "code": "117907-43-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=117907-43-4", "code_system": "CAS", "references": [ "abef4093-58ad-4745-8d85-8ec19829ee87", "d91a740f-dc04-4655-8a9e-9b673e32cde2" ] }, { "uuid": "e8ae77f0-fb35-4daf-aac4-eb96888d5b66", "code": "9860314", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9860314", "code_system": "PUBCHEM", "references": [ "abef4093-58ad-4745-8d85-8ec19829ee87" ] }, { "uuid": "c7cb1b04-225b-07af-54e1-9a05c699bcfb", "code": "DTXSID70151952", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70151952", "code_system": "EPA CompTox", "references": [ "14370aa8-25e2-15bb-10ea-c7a6f9add5fd" ] }, { "uuid": "393ef591-146d-4c8b-bd0c-83024926913d", "code": "GZJ1P1FS40", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "c474dac6-da76-4a59-b392-f31ea4a5833f", "name": "4-AMINO-2-NITRODIPHENYLAMINE-2'-CARBOXYLIC ACID", "stdName": "4-AMINO-2-NITRODIPHENYLAMINE-2'-CARBOXYLIC ACID", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3b631bf1-af1e-44d7-97a7-980c793671aa", "80a07098-8337-494b-98df-b1b09ab5b2eb", "63ae8a04-5057-49e9-80c4-3652f22962f4" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "235cf76f-3ffb-4e93-9869-3088536cc427", "name_org": "INCI" } ] }, { "uuid": "16b2fa46-1691-42fb-97a2-062a3a43ec3a", "name": "BENZOIC ACID, 2-((4-AMINO-2-NITROPHENYL)AMINO)-", "stdName": "BENZOIC ACID, 2-((4-AMINO-2-NITROPHENYL)AMINO)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "80a07098-8337-494b-98df-b1b09ab5b2eb", "76511277-916a-428e-b022-f331028dabd8" ], "display_name": false } ], "references": [ { "uuid": "76511277-916a-428e-b022-f331028dabd8", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "80a07098-8337-494b-98df-b1b09ab5b2eb", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3b631bf1-af1e-44d7-97a7-980c793671aa", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "abef4093-58ad-4745-8d85-8ec19829ee87", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391408000, "tags": [ "NOMEN" ] }, { "uuid": "9d3c6210-dc1f-4765-a24b-a9fbbb1665d5", "citation": "SRS import [GZJ1P1FS40]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GZJ1P1FS40", "doc_type": "SRS", "public_domain": true, "document_date": 1493391408000, "tags": [ "NOMEN" ] }, { "uuid": "63ae8a04-5057-49e9-80c4-3652f22962f4", "citation": "4-AMINO-2-NITRODIPHENYLAMINE-2'-CARBOXYLIC ACID [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "14370aa8-25e2-15bb-10ea-c7a6f9add5fd", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=117907-43-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d91a740f-dc04-4655-8a9e-9b673e32cde2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "939596db-683d-4ea2-b3fd-6c31e213e450", "id": "939596db-683d-4ea2-b3fd-6c31e213e450", "molfile": "\n Marvin 01132107392D \n\n 20 21 0 0 0 0 999 V2000\n 5.1243 -11.3403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8361 -10.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5525 -11.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2690 -10.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2690 -10.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9807 -9.6859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6972 -10.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6972 -10.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4135 -11.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1254 -10.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1254 -10.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4135 -9.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4135 -8.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1254 -8.4485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6972 -8.4485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5525 -9.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8361 -10.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5525 -8.8611 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 7.4429 -8.2398 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.8361 -8.4485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 17 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 16 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 12 7 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\nM CHG 2 18 1 19 -1\nM END", "smiles": "c1ccc(c(c1)C(=O)O)Nc2ccc(cc2[N+](=O)[O-])N", "formula": "C13H11N3O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6662a3e9-165c-48d6-94bd-1e626dafc02b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "273.2446", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "35d9cc82-fd39-4e42-8007-acc4106bbbe3", "version": "4", "structure": { "id": "087dfadb-34b5-45fc-b330-4dae0ac83c10", "molfile": "\n Marvin 01132100432D \n\n 20 21 0 0 0 0 999 V2000\n 9.4135 -9.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1254 -10.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1254 -10.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4135 -11.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6972 -10.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6972 -10.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9807 -9.6859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2690 -10.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2690 -10.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5525 -11.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8361 -10.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8361 -10.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5525 -9.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5525 -8.8611 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 7.4429 -8.2398 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.8361 -8.4485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1243 -11.3403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4135 -8.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1254 -8.4485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6972 -8.4485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 8 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\n 11 17 1 0 0 0 0\n 1 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\nM CHG 2 14 1 15 -1\nM END", "smiles": "c1ccc(c(c1)C(=O)O)Nc2ccc(cc2[N+](=O)[O-])N", "formula": "C13H11N3O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "273.2446", "optical_activity": "NONE", "references": [ "3b631bf1-af1e-44d7-97a7-980c793671aa", "9d3c6210-dc1f-4765-a24b-a9fbbb1665d5" ], "stereo_centers": 0 }, "unii": "GZJ1P1FS40" } ] }