{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3930e8e8-19a5-414c-952a-d24a7bc640c6",
          "code": "GYP6Z2JR6Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "76a29299-71ef-4801-925a-671fa4403682",
          "code": "61817",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61817",
          "code_system": "PUBCHEM",
          "references": [
            "9a62acd2-fd5a-43e5-bab1-459328172b35"
          ]
        },
        {
          "uuid": "f0d69539-8070-ee68-fe09-1064bc4dcc44",
          "code": "12227-60-0",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12227-60-0",
          "code_system": "CAS",
          "references": [
            "d056283b-00bb-e13c-7d2d-bf145038955a"
          ]
        },
        {
          "uuid": "be833bcb-86b6-f06a-c213-d69bdd6c105c",
          "code": "239-888-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.247",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9dfc6ab3-0e1a-aabc-50be-a2d737613977",
            "01b2b68f-0008-4f6c-8e79-ac5a41aae623"
          ]
        },
        {
          "uuid": "ba30a68e-7c26-44f3-dc68-3a58b2939885",
          "code": "15790-07-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15790-07-5",
          "code_system": "CAS",
          "references": [
            "9dfc6ab3-0e1a-aabc-50be-a2d737613977",
            "f133f1cb-9bfd-4b89-9981-380454495ca0"
          ]
        },
        {
          "uuid": "5eb433a9-2b37-c535-7564-8709889104f5",
          "code": "SUB26882",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9dfc6ab3-0e1a-aabc-50be-a2d737613977"
          ]
        },
        {
          "uuid": "7891fe91-3501-e25b-c109-5b5502d3aa6f",
          "code": "DTXSID6044222",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6044222",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "02a0efab-472e-4cd1-af43-ff2c557efda6",
          "code": "131311-70-1",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131311-70-1",
          "code_system": "CAS",
          "references": [
            "d056283b-00bb-e13c-7d2d-bf145038955a"
          ]
        },
        {
          "uuid": "0ab9045f-b5f3-b762-c116-6d63620c9727",
          "code": "GYP6Z2JR6Q",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(GYP6Z2JR6Q)",
          "code_system": "DAILYMED",
          "references": [
            "62e5c344-60aa-cb01-574c-ef94a5beaad0"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "9a62acd2-fd5a-43e5-bab1-459328172b35",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "01b2b68f-0008-4f6c-8e79-ac5a41aae623",
          "citation": "ECHA",
          "doc_type": "ECHA (EC/EINECS)",
          "public_domain": true
        },
        {
          "uuid": "2aa54f7d-76d9-48b4-a422-a59b3d4260f2",
          "citation": "https://www.ewg.org/skindeep/ingredients/702445-FDC_Yellow_No_6_CI_15985_Aluminum_Lake/",
          "url": "https://www.ewg.org/skindeep/ingredients/702445-FDC_Yellow_No_6_CI_15985_Aluminum_Lake/",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "327fcd4f-a136-45ca-80c4-e9d3aff5a707",
          "citation": "21CFR82.706",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e47bf935-4ecf-4c25-abd5-04458b5a998a",
          "citation": "21CFR74.1706",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63d8b5ea-34a7-4f60-9423-986dcf4e150f",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d74f4af-21fb-4f83-8e61-d788597b6296",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70ac79e5-6775-4c84-ab0a-9d643fb0a9d4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394620000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3445e5a0-ae75-4525-9267-a5758eab8a4d",
          "citation": "SRS import [[ingredient] 0054557AA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=[ingredient] 0054557AA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394620000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "670b96d8-f9aa-4646-a9e0-fbe6853806f5",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b24bc11-79a8-43df-b2d7-99d25fb8bed0",
          "citation": "FD&C YELLOW NO. 6--ALUMINUM LAKE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d056283b-00bb-e13c-7d2d-bf145038955a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "52d3a357-3643-0f7e-7bbe-cf8bdc62e938",
          "citation": "YELLOW 6 LAKE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f2555bc4-c6e3-6dbd-a7b6-565ffcefa292",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cfeae23-5f6f-3635-3881-b9ee0791e5d5",
          "citation": "SRS import [[ingredient] 0527071AA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=[ingredient] 0527071AA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394626000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dfc6ab3-0e1a-aabc-50be-a2d737613977",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394626000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc0378c5-fd85-9a7a-a98d-e0f235dab1e1",
          "citation": "https://archive.org/stream/gov.law.cfta.cosmetic.1977/cfta.cosmetic.1977_djvu.txt",
          "url": "https://archive.org/stream/gov.law.cfta.cosmetic.1977/cfta.cosmetic.1977_djvu.txt",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c96b3551-877c-d399-e2b7-c90e75eb3b6a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b732176-ac67-6421-48c2-476344bd00fd",
          "citation": "http://www.artiscreation.com/yellow.html#PY104",
          "url": "http://www.artiscreation.com/yellow.html#PY104",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64b43807-4f81-57ba-e44a-83e4fa074060",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "868e1c04-9fd1-0902-5084-8db5086067cd",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de994b15-88d4-0438-436a-dc4a244dddf3",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89de9865-6442-bd19-660f-94ed30169a2a",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f133f1cb-9bfd-4b89-9981-380454495ca0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "62e5c344-60aa-cb01-574c-ef94a5beaad0",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4ec16321-f9a1-4d0f-beea-a1ff39d89fc4",
          "id": "4ec16321-f9a1-4d0f-beea-a1ff39d89fc4",
          "molfile": "\n  CDK     01152404522D\n\n  1  0  0  0  0  0  0  0  0  0999 V2000\n   11.0240   -7.5804    0.0000 Al  0  1  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   3\nM  END",
          "smiles": "[Al+3]",
          "formula": "Al",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "47472691-a6c7-42e5-8af0-e528132fdb1d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "26.9815",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e720c97c-a0e8-4d98-acac-906975299f14",
          "id": "e720c97c-a0e8-4d98-acac-906975299f14",
          "molfile": "\n  CDK     01152404522D\n\n 27 29  0  0  0  0  0  0  0  0999 V2000\n   19.1443   -5.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8499   -6.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8461   -5.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4901   -4.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4926   -7.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1430   -6.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7931   -7.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7904   -8.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1491   -9.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4933   -8.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1970   -7.4173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5437   -6.6393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8957   -7.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8927   -8.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2432   -9.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5948   -8.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5879   -7.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2362   -6.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.9465   -9.7462    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2930   -8.9626    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   29.1628  -11.0929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.7245  -11.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1915   -4.2881    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.4365   -9.7518    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0902   -8.9681    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.2147  -11.1039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6530  -11.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  5  6  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n  6  7  1  0  0  0  0\n 15 16  2  0  0  0  0\n  2  3  1  0  0  0  0\n 16 17  1  0  0  0  0\n  7  8  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 13  1  0  0  0  0\n  1  6  2  0  0  0  0\n 16 19  1  0  0  0  0\n  8  9  1  0  0  0  0\n 19 20  1  0  0  0  0\n  3  4  2  0  0  0  0\n 19 21  2  0  0  0  0\n  9 10  2  0  0  0  0\n 19 22  2  0  0  0  0\n 10  5  1  0  0  0  0\n  3 23  1  0  0  0  0\n  4  1  1  0  0  0  0\n  8 24  1  0  0  0  0\n  2 11  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 11 12  2  0  0  0  0\n 24 27  2  0  0  0  0\n  5  2  2  0  0  0  0\n 12 13  1  0  0  0  0\nM  CHG  1  20  -1\nM  CHG  1  23  -1\nM  CHG  1  25  -1\nM  END",
          "smiles": "c1cc(c(c2ccc(cc12)S(=O)(=O)[O-])/N=N/c3ccc(cc3)S(=O)(=O)[O-])[O-]",
          "formula": "C16H9N2O7S2",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e9bfc266-eb69-425b-a9ec-8002fae3b171"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "405.3847",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bfdeef7e-18c5-4c6d-bf7c-bd180bd98812",
      "version": "22",
      "structure": {
        "id": "6aaf657b-c91f-4790-96b5-7dbf12b6ad5d",
        "molfile": "\n   JSDraw201152404522D\n\n 28 29  0  0  0  0              0 V2000\n   19.1443   -5.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8499   -6.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8461   -5.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4901   -4.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4926   -7.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1430   -6.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7931   -7.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7904   -8.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1491   -9.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4933   -8.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1970   -7.4173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5437   -6.6393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8957   -7.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8927   -8.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2432   -9.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5948   -8.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5879   -7.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2362   -6.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.9465   -9.7462    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2930   -8.9626    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   29.1628  -11.0929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.7245  -11.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1915   -4.2881    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.4365   -9.7518    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0902   -8.9681    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.2147  -11.1039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6530  -11.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0240   -7.5804    0.0000 Al  0  1  0  0  0  0  0  0  0  0  0  0\n  5  6  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n  6  7  1  0  0  0  0\n 15 16  2  0  0  0  0\n  2  3  1  0  0  0  0\n 16 17  1  0  0  0  0\n  7  8  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 13  1  0  0  0  0\n  1  6  2  0  0  0  0\n 16 19  1  0  0  0  0\n  8  9  1  0  0  0  0\n 19 20  1  0  0  0  0\n  3  4  2  0  0  0  0\n 19 21  2  0  0  0  0\n  9 10  2  0  0  0  0\n 19 22  2  0  0  0  0\n 10  5  1  0  0  0  0\n  3 23  1  0  0  0  0\n  4  1  1  0  0  0  0\n  8 24  1  0  0  0  0\n  2 11  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 11 12  2  0  0  0  0\n 24 27  2  0  0  0  0\n  5  2  2  0  0  0  0\n 12 13  1  0  0  0  0\nM  CHG  4  20  -1  23  -1  25  -1  28   3\nM  END",
        "smiles": "c1cc(c(c2ccc(cc12)S(=O)(=O)[O-])/N=N/c3ccc(cc3)S(=O)(=O)[O-])[O-].[Al+3]",
        "formula": "C16H9N2O7S2.Al",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "432.3662",
        "optical_activity": "NONE",
        "references": [
          "2aa54f7d-76d9-48b4-a422-a59b3d4260f2"
        ],
        "stereo_centers": 0
      },
      "unii": "GYP6Z2JR6Q",
      "relationships": [
        {
          "uuid": "40093f10-5421-49d2-b807-407632260411",
          "amount": {
            "uuid": "e4823b29-924f-4ab5-814c-64dc0bf1a6be"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "f133f1cb-9bfd-4b89-9981-380454495ca0"
          ],
          "related_substance": {
            "uuid": "dc5adc3f-5f0d-41b0-aefa-8992bbf6490a",
            "refuuid": "88dd7764-c39e-4dec-8a9e-6eec8c9c98ed",
            "name": "FOOD YELLOW 3 FREE ACID",
            "unii": "G2B7JWK1GG",
            "linking_id": "G2B7JWK1GG",
            "ref_pname": "FOOD YELLOW 3 FREE ACID",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "d9369e43-b343-b771-12b7-7ceb23705cc6",
          "name": "2-Naphthalenesulfonic acid, 6-hydroxy-5-[(4-sulfophenyl)azo]-, aluminum complex",
          "stdName": "2-NAPHTHALENESULFONIC ACID, 6-HYDROXY-5-((4-SULFOPHENYL)AZO)-, ALUMINUM COMPLEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c96b3551-877c-d399-e2b7-c90e75eb3b6a"
          ],
          "display_name": false
        },
        {
          "uuid": "0221283c-ea78-4ad0-9963-b73ac502fe57",
          "name": "2-Naphthalenesulfonic acid, 6-hydroxy-5-[(4-sulfophenyl)azo]-, aluminum salt",
          "stdName": "2-NAPHTHALENESULFONIC ACID, 6-HYDROXY-5-((4-SULFOPHENYL)AZO)-, ALUMINUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f133f1cb-9bfd-4b89-9981-380454495ca0"
          ],
          "display_name": false
        },
        {
          "uuid": "fcf98455-f017-40e2-853e-872026bfd977",
          "name": "2-Naphthalenesulfonic acid, 6-hydroxy-5-[2-(4-sulfophenyl)diazenyl]-, aluminum salt",
          "stdName": "2-NAPHTHALENESULFONIC ACID, 6-HYDROXY-5-(2-(4-SULFOPHENYL)DIAZENYL)-, ALUMINUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d056283b-00bb-e13c-7d2d-bf145038955a"
          ],
          "display_name": false
        },
        {
          "uuid": "81b0ba23-19a4-a236-02a8-3ca173b8d69f",
          "name": "A510 TUDOR CELANDINE",
          "stdName": "A510 TUDOR CELANDINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "868e1c04-9fd1-0902-5084-8db5086067cd"
          ],
          "display_name": false
        },
        {
          "uuid": "298654c3-b40c-7abb-0285-a87ab5d16566",
          "name": "A510.06 TUDOR CELANDINE",
          "stdName": "A510.06 TUDOR CELANDINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "868e1c04-9fd1-0902-5084-8db5086067cd"
          ],
          "display_name": false
        },
        {
          "uuid": "de6e5784-7de5-666b-32b4-32e2e8bedf20",
          "name": "ALUMINUM LAKE SUNSET YELLOW",
          "stdName": "ALUMINUM LAKE SUNSET YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c96b3551-877c-d399-e2b7-c90e75eb3b6a"
          ],
          "display_name": false
        },
        {
          "uuid": "0b94751e-6422-7832-bf42-1c781c97c4da",
          "name": "Aluminum, 6-hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalenesulfonic acid complex",
          "stdName": "ALUMINUM, 6-HYDROXY-5-((4-SULFOPHENYL)AZO)-2-NAPHTHALENESULFONIC ACID COMPLEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c96b3551-877c-d399-e2b7-c90e75eb3b6a"
          ],
          "display_name": false
        },
        {
          "uuid": "722db83e-63f5-426e-e3fd-2627b6dd3eaa",
          "name": "C.I. Pigment Yellow 104",
          "stdName": "C.I. PIGMENT YELLOW 104",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64b43807-4f81-57ba-e44a-83e4fa074060"
          ],
          "display_name": false
        },
        {
          "uuid": "be82e933-57e6-d2b8-4d3f-045c51e1c390",
          "name": "C70-5270 PERSIAN ORANGE",
          "stdName": "C70-5270 PERSIAN ORANGE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "868e1c04-9fd1-0902-5084-8db5086067cd"
          ],
          "display_name": false
        },
        {
          "uuid": "d0aeb2a5-36cc-5273-9c84-cb4f50e056e3",
          "name": "CALSIHA ART DECO YELLOW 6 AL LAKE",
          "stdName": "CALSIHA ART DECO YELLOW 6 AL LAKE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "868e1c04-9fd1-0902-5084-8db5086067cd"
          ],
          "display_name": false
        },
        {
          "uuid": "49eb815c-a29d-d1b3-8e0b-cbf4911adbb3",
          "name": "CERTOLAKE SUNSET YELLOW",
          "stdName": "CERTOLAKE SUNSET YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b732176-ac67-6421-48c2-476344bd00fd"
          ],
          "display_name": false
        },
        {
          "uuid": "3a2ebab5-acfe-def9-8c93-658e40d3694f",
          "name": "CI 15985:1",
          "stdName": "CI 15985:1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64b43807-4f81-57ba-e44a-83e4fa074060"
          ],
          "display_name": false
        },
        {
          "uuid": "7599e5bd-2895-91a9-4787-7e12f10e1eb2",
          "name": "D&C YELLOW NO. 6 ALUMINUM LAKE",
          "stdName": "D&C YELLOW NO. 6 ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "868e1c04-9fd1-0902-5084-8db5086067cd"
          ],
          "display_name": false
        },
        {
          "uuid": "d11c8bbd-d424-4021-b811-1f7ef039d98d",
          "name": "DYE FDC YELLOW NO. 6 ALUMINIUM LAKE",
          "stdName": "DYE FDC YELLOW NO. 6 ALUMINIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d74f4af-21fb-4f83-8e61-d788597b6296"
          ],
          "display_name": false
        },
        {
          "uuid": "29d38191-6691-4819-b3a8-ab28bdf2d39c",
          "name": "DYE FDC YELLOW NO. 6 ALUMINUM LAKE",
          "stdName": "DYE FDC YELLOW NO. 6 ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2555bc4-c6e3-6dbd-a7b6-565ffcefa292"
          ],
          "display_name": false
        },
        {
          "uuid": "369cbc30-1bdd-4577-8ed4-859af3e20b6a",
          "name": "DYE FDC YELLOW NO. 6 HT LAKE",
          "stdName": "DYE FDC YELLOW NO. 6 HT LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "670b96d8-f9aa-4646-a9e0-fbe6853806f5"
          ],
          "display_name": false
        },
        {
          "uuid": "afff7424-e265-4ed8-91e2-2843bc56d281",
          "name": "DYE FDC YELLOW NO. 6 LAKE",
          "stdName": "DYE FDC YELLOW NO. 6 LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "670b96d8-f9aa-4646-a9e0-fbe6853806f5"
          ],
          "display_name": false
        },
        {
          "uuid": "cd3cf741-3aa6-448d-8208-2c18961388c4",
          "name": "DYE YELLOW NO. 6 LAKE",
          "stdName": "DYE YELLOW NO. 6 LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2555bc4-c6e3-6dbd-a7b6-565ffcefa292"
          ],
          "display_name": false
        },
        {
          "uuid": "8cc04565-5da4-4d41-ab01-d887feaf7dbb",
          "name": "FD&C YELLOW NO. 6 ALUMINUM LAKE",
          "stdName": "FD&C YELLOW NO. 6 ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f133f1cb-9bfd-4b89-9981-380454495ca0"
          ],
          "display_name": true
        },
        {
          "uuid": "b4491b1d-1d3f-4fd4-9900-4b5d5cbd8ab9",
          "name": "FD&C YELLOW NO. 6 LAKE",
          "stdName": "FD&C YELLOW NO. 6 LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e47bf935-4ecf-4c25-abd5-04458b5a998a",
            "670b96d8-f9aa-4646-a9e0-fbe6853806f5"
          ],
          "display_name": false
        },
        {
          "uuid": "838b98a0-7208-4619-8b37-7af7efdc2628",
          "name": "FD&C YELLOW NO. 6--ALUMINIUM LAKE",
          "stdName": "FD&C YELLOW NO. 6--ALUMINIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63d8b5ea-34a7-4f60-9423-986dcf4e150f"
          ],
          "display_name": false
        },
        {
          "uuid": "10c2e032-6e5b-4c70-aedf-77c1cccbcae5",
          "name": "FD&C YELLOW NO. 6--ALUMINUM LAKE",
          "stdName": "FD&C YELLOW NO. 6--ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b24bc11-79a8-43df-b2d7-99d25fb8bed0",
            "327fcd4f-a136-45ca-80c4-e9d3aff5a707",
            "670b96d8-f9aa-4646-a9e0-fbe6853806f5"
          ],
          "display_name": false
        },
        {
          "uuid": "7de8b174-6211-7482-9e30-a0a255e29855",
          "name": "FD&C YELLOW NO. 6-ALUMINUM LAKE",
          "stdName": "FD&C YELLOW NO. 6-ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89de9865-6442-bd19-660f-94ed30169a2a"
          ],
          "display_name": false
        },
        {
          "uuid": "6a62c639-98a5-cbd0-c0a7-b81155d98c0b",
          "name": "FDC YELLOW NO. 6-ALUMINUM LAKE",
          "stdName": "FDC YELLOW NO. 6-ALUMINUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de994b15-88d4-0438-436a-dc4a244dddf3"
          ],
          "display_name": false
        },
        {
          "uuid": "06f547f5-7caa-8dbd-1155-69c8b7853427",
          "name": "LAKOLENE B-3015",
          "stdName": "LAKOLENE B-3015",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc0378c5-fd85-9a7a-a98d-e0f235dab1e1"
          ],
          "display_name": false
        },
        {
          "uuid": "5f2f723b-0f3b-c39c-d050-cd4468180387",
          "name": "Pigment Yellow 104",
          "stdName": "PIGMENT YELLOW 104",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b732176-ac67-6421-48c2-476344bd00fd"
          ],
          "display_name": false
        },
        {
          "uuid": "0eb34668-f6d0-ef91-eef8-1864b358b39c",
          "name": "ULTRAPEARL YELLOW 6 LUSTER",
          "stdName": "ULTRAPEARL YELLOW 6 LUSTER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "868e1c04-9fd1-0902-5084-8db5086067cd"
          ],
          "display_name": false
        },
        {
          "uuid": "d510bedd-c054-421b-e9dd-9f45296df59c",
          "name": "UNIPURE ORANGE LC 226",
          "stdName": "UNIPURE ORANGE LC 226",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "868e1c04-9fd1-0902-5084-8db5086067cd"
          ],
          "display_name": false
        },
        {
          "uuid": "9998b687-34ff-70a8-1109-132799ba1ae2",
          "name": "YELLOW 6 LAKE",
          "stdName": "YELLOW 6 LAKE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "868e1c04-9fd1-0902-5084-8db5086067cd",
            "52d3a357-3643-0f7e-7bbe-cf8bdc62e938"
          ],
          "display_name": false,
          "name_orgs": [
            {
              "uuid": "39a99be2-24df-0e5a-9ea2-c030200759f9",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "modifications": {
        "uuid": "225c52f1-eacf-4285-bedb-8274f2b0adef"
      }
    }
  ]
}