{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3b9222a6-b346-40de-9a82-36a7b6ce4ff4",
          "code": "831213-72-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=831213-72-0",
          "code_system": "CAS",
          "references": [
            "7c044c4b-84d0-4805-bf23-d285145c079e",
            "d22a1b1f-cf8e-49ca-8d3f-aac93ec39d1d"
          ]
        },
        {
          "uuid": "27cdf375-16cd-4c2a-9c6b-c06addf403ae",
          "code": "11264633",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11264633",
          "code_system": "PUBCHEM",
          "references": [
            "7c044c4b-84d0-4805-bf23-d285145c079e"
          ]
        },
        {
          "uuid": "2ef3ff59-a6ff-41c9-b364-fc0b8ec93de6",
          "code": "GX6FA6GRM7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9c7ecf4b-03a0-dbac-0678-dcc02a6f2eb0",
          "code": "DTXSID701003121",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701003121",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "708f7820-0219-5312-5eaa-0946cb5caf0a",
          "code": "1838",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1838/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "2b36fa0d-025f-e7d9-df44-4aa1d979e2fd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5d1f323b-1d4c-45e3-b4be-5e66f2e59e9a",
          "name": "(±)-3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE",
          "stdName": "(+/-)-3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "f10609de-40d7-4f83-b743-cc3942e17a80"
          ],
          "display_name": false
        },
        {
          "uuid": "89794fac-4d07-4c9f-8222-2033f2ba7894",
          "name": "1,4-DIOXASPIRO(4.5)DECAN-2-ONE, 3,9-DIMETHYL-6-(1-METHYLETHYL)-",
          "stdName": "1,4-DIOXASPIRO(4.5)DECAN-2-ONE, 3,9-DIMETHYL-6-(1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "153dd5da-cb70-4cce-b3d0-8ceb747bab30"
          ],
          "display_name": false
        },
        {
          "uuid": "b3aead26-4532-4718-89c0-69e9585bcd72",
          "name": "3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE",
          "stdName": "3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "f34d72d5-716f-4cae-a31d-ff5b5480e795",
            "fef959e2-aa53-456f-887e-106f39f6f9f1",
            "ae0017f1-3c54-4965-ba4c-19c14acbb6bb"
          ],
          "display_name": true
        },
        {
          "uuid": "f1b6ace1-9166-4a2e-adf5-c025dd4df2d0",
          "name": "3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE [FHFI]",
          "stdName": "3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "f34d72d5-716f-4cae-a31d-ff5b5480e795"
          ],
          "display_name": false
        },
        {
          "uuid": "ea8aa4da-03e8-4afe-ab70-ee9a8b0361af",
          "name": "3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE, (±)-",
          "stdName": "3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "f10609de-40d7-4f83-b743-cc3942e17a80"
          ],
          "display_name": false
        },
        {
          "uuid": "5c58cb82-281d-4feb-af91-cd023e3affb3",
          "name": "3,9-DIMETHYL-6-ISOPROPYL-1,4-DIOXASPIRO(4.5)DECAN-2-ONE",
          "stdName": "3,9-DIMETHYL-6-ISOPROPYL-1,4-DIOXASPIRO(4.5)DECAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "b4b45cbf-b9ab-4639-869e-25b7799d2659"
          ],
          "display_name": false
        },
        {
          "uuid": "d5293180-f3aa-4ac1-9b22-143d38ec4334",
          "name": "FEMA NO. 4285",
          "stdName": "FEMA NO. 4285",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "f34d72d5-716f-4cae-a31d-ff5b5480e795"
          ],
          "display_name": false
        },
        {
          "uuid": "874400df-2a07-4c12-aee4-3a4c70fe6b55",
          "name": "FRESH DECAN-2-ONE",
          "stdName": "FRESH DECAN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "16945888-0599-4b56-b2f7-c598d7dfd1c6"
          ],
          "display_name": false
        },
        {
          "uuid": "3ac1f000-818e-4a0a-b04b-12d557a58663",
          "name": "FRESHONE",
          "stdName": "FRESHONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67c2c131-2896-4ca7-a640-e6906e1a3c71",
            "fef959e2-aa53-456f-887e-106f39f6f9f1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fef959e2-aa53-456f-887e-106f39f6f9f1",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "67c2c131-2896-4ca7-a640-e6906e1a3c71",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f34d72d5-716f-4cae-a31d-ff5b5480e795",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f10609de-40d7-4f83-b743-cc3942e17a80",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16945888-0599-4b56-b2f7-c598d7dfd1c6",
          "citation": "http://www.thegoodscentscompany.com/data/rw1593791.html#torefrc",
          "url": "http://www.thegoodscentscompany.com/data/rw1593791.html#torefrc",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "153dd5da-cb70-4cce-b3d0-8ceb747bab30",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4b45cbf-b9ab-4639-869e-25b7799d2659",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c044c4b-84d0-4805-bf23-d285145c079e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391122000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a8d2155-e400-49f2-b3ca-5831159081f6",
          "citation": "SRS import [GX6FA6GRM7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GX6FA6GRM7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391122000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae0017f1-3c54-4965-ba4c-19c14acbb6bb",
          "citation": "3,9-DIMETHYL-6-(1-METHYLETHYL)-1,4-DIOXASPIRO(4.5)DECAN-2-ONE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d22a1b1f-cf8e-49ca-8d3f-aac93ec39d1d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2b36fa0d-025f-e7d9-df44-4aa1d979e2fd",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "143e8d4d-daa3-4a9f-9760-1be9ff91e103",
          "id": "143e8d4d-daa3-4a9f-9760-1be9ff91e103",
          "molfile": "\n  Marvin  01132101152D          \n\n 16 17  0  0  0  0            999 V2000\n    3.8147   -1.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5292   -2.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2436   -1.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5292   -3.0339    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.8147   -3.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8147   -4.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5292   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.5292   -5.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2436   -4.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2436   -3.4465    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.9973   -3.7820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5494   -3.1689    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.3698   -3.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1368   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4724   -1.7008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3298   -2.6259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 10  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 16  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C1CCC(C)CC12OC(C)C(=O)O2",
          "formula": "C13H22O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4f3dd476-9204-4197-9a16-694e07310162"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "226.3125",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a8b4e8a6-37ee-4c62-8d0e-220852663610",
      "version": "4",
      "structure": {
        "id": "c3db52f5-eb00-482f-9642-90aac41a8da8",
        "molfile": "\n  Marvin  01132110072D          \n\n 16 17  0  0  0  0            999 V2000\n    3.8147   -3.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5292   -3.0339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2436   -4.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5292   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8147   -4.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2436   -3.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3298   -2.6259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1368   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5494   -3.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9973   -3.7820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4724   -1.7008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3698   -3.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5292   -5.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5292   -2.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8147   -1.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2436   -1.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  6  1  0  0  0  0\n  3  6  1  0  0  0  0\n  6  2  1  0  0  0  0\n  8 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n  4 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C1CCC(C)CC12OC(C)C(=O)O2",
        "formula": "C13H22O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "226.3125",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "153dd5da-cb70-4cce-b3d0-8ceb747bab30",
          "4a8d2155-e400-49f2-b3ca-5831159081f6"
        ],
        "stereo_centers": 4
      },
      "unii": "GX6FA6GRM7"
    }
  ]
}