{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bc91af91-5cfd-4a3f-8902-2c23727d950b",
          "code": "111-01-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=111-01-3",
          "code_system": "CAS",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36",
            "700e6162-8513-48bd-95d1-5811261d46d4"
          ]
        },
        {
          "uuid": "948a46d0-2e25-4d2a-8457-27b2dc7b25fa",
          "code": "C76734",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76734",
          "code_system": "NCI_THESAURUS",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "b4480e2a-7d32-47db-99a0-727096bdbc2f",
          "code": "C019556",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67019556",
          "code_system": "MESH",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "4365d867-5640-4ec8-ae38-eff398b6d9ac",
          "code": "SQUALANE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Squalane",
          "code_system": "WIKIPEDIA",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "f1e4a009-e195-4aab-bc40-43092d98a8e5",
          "code": "45503",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2525",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "52cc2899-8a33-4190-8f34-fccf406caddf",
          "code": "203-825-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.478",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "f571fa84-e6a9-48e9-8b86-6020f11da0a8",
          "code": "1363644",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363644/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "9a685732-c253-47b9-92ef-9714ced8d469",
          "code": "m10165",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10165?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "8858d32d-bc6a-49ad-9128-d22485940952",
          "code": "CHEMBL1552157",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1552157",
          "code_system": "ChEMBL",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "797c91f8-1a65-4162-b7c7-dbeb131e2e5e",
          "code": "SUB15360MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "95da461a-3599-4d9a-9489-a0ef454ff68e",
          "code": "8089",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8089",
          "code_system": "PUBCHEM",
          "references": [
            "333f6b43-7fc3-4348-acf1-7b3c2313ec36"
          ]
        },
        {
          "uuid": "9b00384b-6ddc-2f97-363a-6afe62552175",
          "code": "DTXSID0046513",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0046513",
          "code_system": "EPA CompTox",
          "references": [
            "6d3c9e8c-f92b-9fc4-fdcf-2b30454f5888"
          ]
        },
        {
          "uuid": "b4425325-c30a-f7be-a1a0-dcee2c4194a0",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7b59ddb9-9f5f-f20f-406d-61321f2b50c8"
          ]
        },
        {
          "uuid": "ab63c54a-528e-c060-c004-b9be454476f1",
          "code": "DB11420",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11420",
          "code_system": "DRUG BANK",
          "references": [
            "7b59ddb9-9f5f-f20f-406d-61321f2b50c8"
          ]
        },
        {
          "uuid": "137f0177-fa1a-4fa2-83d2-cc2b5ce0ba6d",
          "code": "GW89575KF9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "acff89d6-41fb-4aa5-0d22-bd6e0cdfd8fd",
          "code": "1619505",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1619505",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "7b59ddb9-9f5f-f20f-406d-61321f2b50c8"
          ]
        },
        {
          "uuid": "b9c7a6f3-529e-9281-536e-9634994c4991",
          "code": "GW89575KF9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=GW89575KF9",
          "code_system": "DAILYMED",
          "references": [
            "d9bc62a9-38ed-5cee-8649-1d7173826cc4"
          ]
        },
        {
          "uuid": "3350c86c-e136-e01b-9103-eea955510ac6",
          "code": "100000088505",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9535c7a5-b5b6-2cb6-5229-aa3499a57bde"
          ]
        },
        {
          "uuid": "52360ef0-9c8d-1969-8a88-78bac42a9d7a",
          "code": "6851",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6851",
          "code_system": "NSC",
          "references": [
            "05f08b37-b822-e7fd-ff1f-fcb869497d80"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "aba76094-9643-437c-8bd8-6f901aba4843",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "be540c1f-258e-477f-9ad7-6e788eca6f4b",
            "refuuid": "0a256ec3-2739-4cfb-90cf-2316df3d76c9",
            "name": "SQUALANE",
            "unii": "GW89575KF9",
            "linking_id": "GW89575KF9",
            "ref_pname": "SQUALANE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "aa6e497a-9e06-494d-a270-cfd0ad24c60d",
          "name": "2,6,10,15,19,23-Hexamethyltetracosane",
          "stdName": "2,6,10,15,19,23-HEXAMETHYLTETRACOSANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f874aa9-97b4-421f-add6-c88106495418",
            "b5ae474b-75fb-413f-ae8d-1959825180cf"
          ],
          "display_name": false
        },
        {
          "uuid": "3521a4be-b3fc-432b-9eb4-11ac22b4677e",
          "name": "HEXAMETHYLTETRACOSANE",
          "stdName": "HEXAMETHYLTETRACOSANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5175fc26-1e05-461a-87e8-a3b00467d6d2",
            "b5ae474b-75fb-413f-ae8d-1959825180cf"
          ],
          "display_name": false
        },
        {
          "uuid": "07fd0cd6-8f2e-46fe-98be-a3dcf2e5be30",
          "name": "NSC-6851",
          "stdName": "NSC-6851",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93e0c901-7e3d-4774-8da3-d3c683db8fd4",
            "0f874aa9-97b4-421f-add6-c88106495418"
          ],
          "display_name": false
        },
        {
          "uuid": "ec081ddc-83f1-4e91-aff2-0d77f576ac57",
          "name": "PRIPURE 3759",
          "stdName": "PRIPURE 3759",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f874aa9-97b4-421f-add6-c88106495418",
            "b5ae474b-75fb-413f-ae8d-1959825180cf"
          ],
          "display_name": false
        },
        {
          "uuid": "8d282f29-e51b-40d7-aacf-1e12a0f9f56e",
          "name": "SQUALANE",
          "stdName": "SQUALANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79121e34-abc0-4a16-9cd6-85f824b98edb",
            "db84f6a3-e98e-4d4d-9b5f-15003c9eab4b",
            "955ea4d4-6920-4074-9162-3783ea0b6615",
            "1c79f7e6-d0fe-4959-be8d-035ee23129c8",
            "b5ae474b-75fb-413f-ae8d-1959825180cf",
            "11211a7d-55a6-4d59-8395-ff5a3e279926",
            "435119c8-309a-433a-a71f-232a488d6554",
            "e0e65d42-351e-42b2-a3ae-d368030d6b27",
            "4870a88f-7b2a-48c0-afc1-60ef742cee64",
            "28c91295-128e-4d0a-ad93-0314556f4b3b",
            "bc36e845-1257-437a-9b98-da8eb987b820",
            "e008bf40-c8be-4637-a219-9a189b92c096",
            "6eea2b39-2a60-4525-8ed8-7df7a4a01605",
            "ee2a5579-20ca-4179-869c-e742c3ae34cf",
            "e904ac82-b151-4eed-a4bb-395ee0477a02",
            "1c3337cc-cf30-46a9-b685-f983e6bbe906",
            "38365b04-086f-47b3-85b3-5c5f549f14d2"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7274ef40-55c3-498c-8d9d-925f18ebcc96",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "346567e3-18d7-3e57-4c29-6a66d5cbece9",
          "name": "SQUALANE [EP IMPURITY]",
          "stdName": "SQUALANE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79121e34-abc0-4a16-9cd6-85f824b98edb"
          ],
          "display_name": false
        },
        {
          "uuid": "7780b4ff-e471-e24b-a94b-fa60a1ba4124",
          "name": "SQUALANE [EP MONOGRAPH]",
          "stdName": "SQUALANE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7904038e-13e9-3d96-889a-364c902ffb0c"
          ],
          "display_name": false
        },
        {
          "uuid": "722af0cd-555b-4a60-9890-fc1699b4cc2e",
          "name": "SQUALANE [II]",
          "stdName": "SQUALANE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38365b04-086f-47b3-85b3-5c5f549f14d2"
          ],
          "display_name": false
        },
        {
          "uuid": "a60555b8-46d9-4dd0-8439-e1492bea9ab5",
          "name": "SQUALANE [MART.]",
          "stdName": "SQUALANE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee2a5579-20ca-4179-869c-e742c3ae34cf"
          ],
          "display_name": false
        },
        {
          "uuid": "a467335a-5df2-40ef-9e32-2363f87962c2",
          "name": "SQUALANE [MI]",
          "stdName": "SQUALANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "435119c8-309a-433a-a71f-232a488d6554",
            "b5ae474b-75fb-413f-ae8d-1959825180cf"
          ],
          "display_name": false
        },
        {
          "uuid": "8ba35b7e-9b78-4e10-afb9-a7a3e782e904",
          "name": "SQUALANE [USP-RS]",
          "stdName": "SQUALANE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5ae474b-75fb-413f-ae8d-1959825180cf",
            "e904ac82-b151-4eed-a4bb-395ee0477a02"
          ],
          "display_name": false
        },
        {
          "uuid": "852dfe33-ec22-47a7-a62c-e8338a2aafa8",
          "name": "SQUALANE [VANDF]",
          "stdName": "SQUALANE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db84f6a3-e98e-4d4d-9b5f-15003c9eab4b",
            "b5ae474b-75fb-413f-ae8d-1959825180cf"
          ],
          "display_name": false
        },
        {
          "uuid": "2dab2f0e-dcc9-4e28-9c76-1e8ca1464324",
          "name": "Squalane [WHO-DD]",
          "stdName": "SQUALANE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d03c6d3-7195-3cd4-41f6-dcff09cb9d47"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "38365b04-086f-47b3-85b3-5c5f549f14d2",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f874aa9-97b4-421f-add6-c88106495418",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93e0c901-7e3d-4774-8da3-d3c683db8fd4",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79121e34-abc0-4a16-9cd6-85f824b98edb",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee2a5579-20ca-4179-869c-e742c3ae34cf",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "435119c8-309a-433a-a71f-232a488d6554",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5ae474b-75fb-413f-ae8d-1959825180cf",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0e65d42-351e-42b2-a3ae-d368030d6b27",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e904ac82-b151-4eed-a4bb-395ee0477a02",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e008bf40-c8be-4637-a219-9a189b92c096",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db84f6a3-e98e-4d4d-9b5f-15003c9eab4b",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "439aa49c-ddf0-4b40-b201-f20fbeeba23c",
          "citation": "DMFF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5175fc26-1e05-461a-87e8-a3b00467d6d2",
          "citation": "EPA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "333f6b43-7fc3-4348-acf1-7b3c2313ec36",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390729000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c666694-bdfc-462e-a7a5-b54316c94da1",
          "citation": "SRS import [GW89575KF9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GW89575KF9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390729000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "955ea4d4-6920-4074-9162-3783ea0b6615",
          "citation": "SQUALANE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4870a88f-7b2a-48c0-afc1-60ef742cee64",
          "citation": "SQUALANE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "11211a7d-55a6-4d59-8395-ff5a3e279926",
          "citation": "SQUALANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc36e845-1257-437a-9b98-da8eb987b820",
          "citation": "SQUALANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c79f7e6-d0fe-4959-be8d-035ee23129c8",
          "citation": "SQUALANE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c3337cc-cf30-46a9-b685-f983e6bbe906",
          "citation": "SQUALANE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "28c91295-128e-4d0a-ad93-0314556f4b3b",
          "citation": "SQUALANE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6eea2b39-2a60-4525-8ed8-7df7a4a01605",
          "citation": "SQUALANE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6d3c9e8c-f92b-9fc4-fdcf-2b30454f5888",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=111-01-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7b59ddb9-9f5f-f20f-406d-61321f2b50c8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "700e6162-8513-48bd-95d1-5811261d46d4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7904038e-13e9-3d96-889a-364c902ffb0c",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "05f08b37-b822-e7fd-ff1f-fcb869497d80",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d9bc62a9-38ed-5cee-8649-1d7173826cc4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0d03c6d3-7195-3cd4-41f6-dcff09cb9d47",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9535c7a5-b5b6-2cb6-5229-aa3499a57bde",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b2ca36b6-c1b6-4697-82c6-3149e495ae83",
          "id": "b2ca36b6-c1b6-4697-82c6-3149e495ae83",
          "molfile": "\n  Marvin  01132109162D          \n\n 30 29  0  0  0  0            999 V2000\n   12.2236   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2389   -2.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9460   -2.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5138   -2.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8016   -2.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0765   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3643   -2.0778    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.3489   -1.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6418   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9116   -2.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2045   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4589   -2.0778    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.4589   -1.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7672   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0267   -2.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3657   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6228   -2.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9284   -2.4903    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.9284   -3.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1854   -2.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4937   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7481   -2.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0564   -2.4903    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.0564   -3.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6841   -2.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3809   -2.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1214   -2.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8336   -2.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5561   -2.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8490   -3.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 28  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C",
          "formula": "C30H62",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "01bf29cb-e1a3-429a-9bd4-c4d84381f437"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "422.8144",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0a256ec3-2739-4cfb-90cf-2316df3d76c9",
      "version": "19",
      "structure": {
        "id": "a9e6a12d-87ec-44e0-8862-42264ce193f5",
        "molfile": "\n  Marvin  01132108492D          \n\n 30 29  0  0  0  0            999 V2000\n   10.8016   -2.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9116   -2.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4937   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3809   -2.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5138   -2.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1214   -2.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1854   -2.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6418   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7481   -2.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6841   -2.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0765   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2045   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0564   -2.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3643   -2.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2389   -2.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8336   -2.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4589   -2.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9284   -2.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6228   -2.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7672   -2.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0267   -2.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3657   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2236   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9460   -2.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5561   -2.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8490   -3.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4589   -1.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0564   -3.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3489   -1.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9284   -3.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4 10  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7 18  1  0  0  0  0\n  8 14  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  6  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 22  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 15  1  0  0  0  0\n 24 15  1  0  0  0  0\n 25 16  1  0  0  0  0\n 26 16  1  0  0  0  0\n 17 27  1  0  0  0  0\n 13 28  1  0  0  0  0\n 14 29  1  0  0  0  0\n 18 30  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C",
        "formula": "C30H62",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "422.8144",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2c666694-bdfc-462e-a7a5-b54316c94da1",
          "38365b04-086f-47b3-85b3-5c5f549f14d2"
        ],
        "stereo_centers": 4
      },
      "unii": "GW89575KF9"
    }
  ]
}