{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "32c8375f-5b26-4356-abda-72cafec27804",
          "code": "391900-25-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=391900-25-7",
          "code_system": "CAS",
          "references": [
            "f9f9961e-881c-49e3-a89a-549476dce2ed",
            "5326da9a-35d0-4b57-84b3-fbd3ad2b6766"
          ]
        },
        {
          "uuid": "77c90ff1-5547-4a47-80a9-60375ad5709a",
          "code": "11961066",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11961066",
          "code_system": "PUBCHEM",
          "references": [
            "f9f9961e-881c-49e3-a89a-549476dce2ed"
          ]
        },
        {
          "uuid": "0ad9b23a-fd66-42da-91c1-6174f1f848a4",
          "code": "GV3ERH4H4P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e4ce840f-3a80-4552-b853-e8acf9050008",
          "name": "(±)-ETHYLHEXYL FERULATE",
          "stdName": "(+/-)-ETHYLHEXYL FERULATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dbfc7e7-ff52-4816-bd22-82755ae725ce",
            "8318cc53-dd4d-4135-bb5b-c3a58f242d30"
          ],
          "display_name": false
        },
        {
          "uuid": "e0066070-a0d1-4ede-a3b2-8076c794623b",
          "name": "2-ETHYL-1-HEXYL FERULATE",
          "stdName": "2-ETHYL-1-HEXYL FERULATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dbfc7e7-ff52-4816-bd22-82755ae725ce",
            "b6dc0693-a273-41e7-8e9c-0f366c6a50ea"
          ],
          "display_name": false
        },
        {
          "uuid": "6766d2ca-817b-4905-a440-154906a43617",
          "name": "2-ETHYLHEXYL TRANS-FERULATE",
          "stdName": "2-ETHYLHEXYL TRANS-FERULATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1d04b7d-ca5a-40ff-b5a7-b9af1d2682e7",
            "1dbfc7e7-ff52-4816-bd22-82755ae725ce"
          ],
          "display_name": false
        },
        {
          "uuid": "2532f72d-b641-43a0-90ef-20433ec79049",
          "name": "2-PROPENOIC ACID, 3-(4-HYDROXY-3-METHOXYPHENYL)-, 2-ETHYLHEXYL ESTER, (2E)-",
          "stdName": "2-PROPENOIC ACID, 3-(4-HYDROXY-3-METHOXYPHENYL)-, 2-ETHYLHEXYL ESTER, (2E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1d04b7d-ca5a-40ff-b5a7-b9af1d2682e7",
            "1dbfc7e7-ff52-4816-bd22-82755ae725ce"
          ],
          "display_name": false
        },
        {
          "uuid": "b9031cd9-222f-4e6d-bc8c-e472f27da6e5",
          "name": "4-HYDROXY-3-METHOXYCINNAMIC ACID, 2-ETHYLHEXYL ESTER",
          "stdName": "4-HYDROXY-3-METHOXYCINNAMIC ACID, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dbfc7e7-ff52-4816-bd22-82755ae725ce",
            "b6dc0693-a273-41e7-8e9c-0f366c6a50ea"
          ],
          "display_name": false
        },
        {
          "uuid": "f56af27c-8a31-4963-86f7-a0987f3d5bd8",
          "name": "ETHYLHEXYL FERULATE",
          "stdName": "ETHYLHEXYL FERULATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dbfc7e7-ff52-4816-bd22-82755ae725ce",
            "4e85fa12-989e-4e56-b6c4-a8adf4a91988",
            "b6dc0693-a273-41e7-8e9c-0f366c6a50ea"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8fbb9fdd-dea2-4059-b151-8eeae43872b8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4cab0cae-102b-4700-a188-ef8764024291",
          "name": "ETHYLHEXYL FERULATE, (±)-",
          "stdName": "ETHYLHEXYL FERULATE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dbfc7e7-ff52-4816-bd22-82755ae725ce",
            "8318cc53-dd4d-4135-bb5b-c3a58f242d30"
          ],
          "display_name": false
        },
        {
          "uuid": "a2d9de2b-6581-418d-a2e0-3334dbdf36c6",
          "name": "FERULIC ACID, 2-ETHYLHEXYL ESTER",
          "stdName": "FERULIC ACID, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dbfc7e7-ff52-4816-bd22-82755ae725ce",
            "b6dc0693-a273-41e7-8e9c-0f366c6a50ea"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b6dc0693-a273-41e7-8e9c-0f366c6a50ea",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1dbfc7e7-ff52-4816-bd22-82755ae725ce",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8318cc53-dd4d-4135-bb5b-c3a58f242d30",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1d04b7d-ca5a-40ff-b5a7-b9af1d2682e7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9f9961e-881c-49e3-a89a-549476dce2ed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20ee31c7-c5ec-4b95-90a9-17acae970cc6",
          "citation": "SRS import [GV3ERH4H4P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GV3ERH4H4P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e85fa12-989e-4e56-b6c4-a8adf4a91988",
          "citation": "ETHYLHEXYL FERULATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5326da9a-35d0-4b57-84b3-fbd3ad2b6766",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d7b6ecba-0f00-4e75-a2e4-0bf82d8a55e1",
          "id": "d7b6ecba-0f00-4e75-a2e4-0bf82d8a55e1",
          "molfile": "\n  Marvin  01132111112D          \n\n 22 22  0  0  0  0            999 V2000\n    6.5807   -0.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5807   -1.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8662   -1.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8662   -2.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1518   -2.9666    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.4373   -2.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4373   -1.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1518   -3.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8662   -4.2041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8662   -5.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5807   -5.4416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1518   -5.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1518   -6.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4373   -6.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4373   -7.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7228   -7.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0084   -7.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2939   -7.9166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0084   -6.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2939   -6.2666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5794   -6.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7228   -6.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 22  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  2  0  0  0  0\n 19 20  1  0  0  0  0\n 22 19  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)/C=C/c1ccc(c(c1)OC)O",
          "formula": "C18H26O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ed94d638-96a0-4dac-9668-bb48d4252ab1"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "306.3973",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cd20e73d-c757-44bd-a792-cdace9112f38",
      "version": "3",
      "structure": {
        "id": "7f5508f7-f857-4723-bc8a-cfbef5f6dd2a",
        "molfile": "\n  Marvin  01132106372D          \n\n 22 22  0  0  0  0            999 V2000\n    5.1518   -3.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1518   -2.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8662   -2.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8662   -1.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5807   -1.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5807   -0.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4373   -2.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4373   -1.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5807   -5.4416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8662   -4.2041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8662   -5.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1518   -5.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1518   -6.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5794   -6.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2939   -6.2666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2939   -7.9166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4373   -7.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7228   -7.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0084   -7.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0084   -6.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7228   -6.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4373   -6.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 11  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 22 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 20 15  1  0  0  0  0\n 19 16  1  0  0  0  0\n 22 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 10  1  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)/C=C/c1ccc(c(c1)OC)O",
        "formula": "C18H26O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "306.3973",
        "optical_activity": "( + / - )",
        "references": [
          "f1d04b7d-ca5a-40ff-b5a7-b9af1d2682e7",
          "20ee31c7-c5ec-4b95-90a9-17acae970cc6"
        ],
        "stereo_centers": 1
      },
      "unii": "GV3ERH4H4P"
    }
  ]
}