{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "94339b63-4c7d-41b0-b1d6-d6d1e1c073e4", "code": "GSZ9YRQ9UY", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "6f743333-4a6c-45c9-b0ac-95cf7ce04aa6", "code": "10534-59-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=10534-59-5", "code_system": "CAS", "references": [ "c0d8b36b-aa67-4aca-a96a-76a55b70cb42", "862986a7-e192-41e7-ad78-465a25fa0a04" ] }, { "uuid": "3e400a2a-3efa-471e-9158-5ce3551e1a65", "code": "234-101-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.989", "code_system": "ECHA (EC/EINECS)", "references": [ "c0d8b36b-aa67-4aca-a96a-76a55b70cb42" ] }, { "uuid": "a84f8a2c-2469-4dc4-b6e7-34cf48358411", "code": "82707", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82707", "code_system": "PUBCHEM", "references": [ "c0d8b36b-aa67-4aca-a96a-76a55b70cb42" ] }, { "uuid": "4e813acc-4e35-508b-aaa0-8af8bc76ee2d", "code": "DTXSID8065111", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8065111", "code_system": "EPA CompTox", "references": [ "cf5da2a9-6ce7-1e06-5d56-939b4317abaa" ] } ], "substance_class": "chemical", "names": [ { "uuid": "42cfd295-f68f-4858-a959-e816c5841266", "name": "1-Butanaminium, N,N,N-tributyl-, acetate", "stdName": "1-BUTANAMINIUM, N,N,N-TRIBUTYL-, ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f98daf3e-4053-449b-ab2b-4d53cbeef13e", "8060f854-add6-4e0f-8929-9ea95a8e5846" ], "display_name": false }, { "uuid": "52b5cd87-a815-4dc5-9bc5-6089571217b5", "name": "Tetrabutylammonium acetate", "stdName": "TETRABUTYLAMMONIUM ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "862986a7-e192-41e7-ad78-465a25fa0a04" ], "display_name": true } ], "references": [ { "uuid": "f98daf3e-4053-449b-ab2b-4d53cbeef13e", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8060f854-add6-4e0f-8929-9ea95a8e5846", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c0d8b36b-aa67-4aca-a96a-76a55b70cb42", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393783000, "tags": [ "NOMEN" ] }, { "uuid": "cf5da2a9-6ce7-1e06-5d56-939b4317abaa", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10534-59-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "862986a7-e192-41e7-ad78-465a25fa0a04", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a7ca4b32-cd83-4274-808c-2a978a0882cf", "id": "a7ca4b32-cd83-4274-808c-2a978a0882cf", "molfile": "\n CDK 02182517002D\n\n 4 3 0 0 0 0 0 0 0 0999 V2000\n 23.2960 -7.0339 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 24.6470 -7.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9980 -7.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6470 -9.3739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\nM CHG 1 1 -1\nM END", "smiles": "CC(=O)[O-]", "formula": "C2H3O2", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "73017247-cb4b-4ba3-80fb-87095eae3c16" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "59.0441", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "699d4365-09e1-45e3-a7b1-06370fd72283", "id": "699d4365-09e1-45e3-a7b1-06370fd72283", "molfile": "\n CDK 02182517002D\n\n 17 16 0 0 0 0 0 0 0 0999 V2000\n 14.0400 -7.6059 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 12.6890 -8.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3910 -6.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2600 -6.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8200 -8.9569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7420 -7.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0930 -6.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4440 -7.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0400 -4.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2600 -3.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0400 -2.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0400 -10.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8200 -11.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0400 -13.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3380 -7.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9870 -8.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6360 -7.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 5 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 2 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "CCCC[N+](CCCC)(CCCC)CCCC", "formula": "C16H36N", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6f631882-89d9-432c-abeb-975394b813a9" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "242.4643", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "bc00afb6-8b63-4384-9c61-02c88799176d", "version": "5", "structure": { "id": "a0cc9420-3026-4ac2-b414-6014dc1d4cfe", "molfile": "\n JSDraw202182517002D\n\n 21 19 0 0 0 0 0 V2000\n 14.0400 -7.6059 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 12.6890 -8.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3910 -6.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2600 -6.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8200 -8.9569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7420 -7.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0930 -6.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4440 -7.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0400 -4.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2600 -3.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0400 -2.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0400 -10.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8200 -11.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0400 -13.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3380 -7.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9870 -8.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6360 -7.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2960 -7.0339 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 24.6470 -7.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9980 -7.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6470 -9.3739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 5 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 2 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 2 0 0 0 0\nM CHG 2 1 1 18 -1\nM END", "smiles": "CCCC[N+](CCCC)(CCCC)CCCC.CC(=O)[O-]", "formula": "C16H36N.C2H3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "301.5084", "optical_activity": "NONE", "references": [ "f98daf3e-4053-449b-ab2b-4d53cbeef13e" ], "stereo_centers": 0 }, "unii": "GSZ9YRQ9UY" } ] }