{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "dad17a63-f332-4859-8893-78bc6f3de919", "code": "N0000175749", "comments": "Established Pharmacologic Class [EPC]|Serotonin and Norepinephrine Reuptake Inhibitor [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175749", "code_system": "NDF-RT", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "50866e40-aeee-4f30-b592-0bc6cd5119ef", "code": "N06AX16", "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Other antidepressants|venlafaxine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N06AX16&showdescription=yes", "code_system": "WHO-ATC", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "82fa440a-77c7-4961-9c3c-8a6757cca02a", "code": "N0000000102", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Norepinephrine Transporter Interactions [MoA]|Norepinephrine Uptake Inhibitors [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000102", "code_system": "NDF-RT", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "872bd664-a2bd-467f-a3f8-a6b979455982", "code": "N0000000109", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Serotonin Transporter Interactions [MoA]|Serotonin Uptake Inhibitors [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000109", "code_system": "NDF-RT", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "83fbad39-a8aa-4a85-bd5b-81111c447661", "code": "QN06AX16", "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Other antidepressants|venlafaxine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AX16&showdescription=yes", "code_system": "WHO-VATC", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "382c3ea4-4b7a-489d-9958-4a7ee8a0360b", "code": "93413-69-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=93413-69-5", "code_system": "CAS", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4", "718f410a-eb6f-4378-be17-82543b3592c5" ] }, { "uuid": "689599ca-4a25-445e-aabe-365fcee8bbd2", "code": "C1278", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1278", "code_system": "NCI_THESAURUS", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "930ebd0d-6cc1-46a2-a7e9-ab25198b0ffd", "code": "C047426", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67047426", "code_system": "MESH", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "b74ad804-7861-4f30-b76d-702022085e4d", "code": "NBK548799", "comments": "LiverTox|CNS|Antidepressant|SSRI", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548799/", "code_system": "LIVERTOX", "references": [ "f4ab81fa-1909-8c95-b082-5e05ae1b3139" ] }, { "uuid": "77e5c71a-014c-443b-ab1f-3d7a4f50d524", "code": "VENLAFAXINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Venlafaxine", "code_system": "WIKIPEDIA", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "22ece14c-3cbc-4417-bb5d-0b5ab51b3eae", "code": "SUB00034MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "7bb7c046-dfb6-4279-a7c2-f1ef02a5c3d6", "code": "6358", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6358", "code_system": "INN", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "a4798023-81be-41ef-a760-e34054ccecdf", "code": "7321", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7321", "code_system": "IUPHAR", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "a8b0fb8e-8afe-4223-98a8-0baa33eebeaf", "code": "39786", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/39786/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "a873a187-50e9-40a4-a5bf-4d7655f40d70", "code": "m11410", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m11410?q=authorize", "code_system": "MERCK INDEX", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "b0280abf-b591-4a6a-b2cd-8338865d80b0", "code": "DB00285", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00285", "code_system": "DRUG BANK", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "3a7bab12-fb93-4241-8bce-bb1edc1b75c4", "code": "CHEMBL637", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL637", "code_system": "ChEMBL", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "eb4b48a5-f962-434b-950d-d5ddc930871e", "code": "5656", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5656", "code_system": "PUBCHEM", "references": [ "008fe5aa-a7f1-42ac-963f-66fd54741fa4" ] }, { "uuid": "d6eaa672-44e0-0891-254f-3c779ab75db4", "code": "DTXSID6023737", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6023737", "code_system": "EPA CompTox", "references": [ "0e5138e2-c571-3ed7-6209-c0724ffd5cee" ] }, { "uuid": "a4066e70-20df-c944-c4b2-beb580498759", "code": "6699", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6699", "code_system": "HSDB", "references": [ "3dcd6a62-1124-8835-881f-e55115bb1a0d" ] }, { "uuid": "20781b66-2460-765a-518f-0124bb66c7bd", "code": "C265", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antidepressant Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C265", "code_system": "NCI_THESAURUS", "references": [ "f4ab81fa-1909-8c95-b082-5e05ae1b3139" ] }, { "uuid": "44a78a4c-d6ba-4deb-8521-5ff98049e7ff", "code": "GRZ5RCB1QG", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "76b987c2-2d03-c73c-afb9-9cbd199adbdf", "code": "Venlafaxine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM329/", "code_system": "LACTMED", "references": [ "f4ab81fa-1909-8c95-b082-5e05ae1b3139" ] }, { "uuid": "5c72d3bc-399e-c046-ed31-9d959edccafe", "code": "2813", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2813", "code_system": "DRUG CENTRAL", "references": [ "f4ab81fa-1909-8c95-b082-5e05ae1b3139" ] }, { "uuid": "4636443c-7fe5-0c46-ee7c-0d8e91eff97b", "code": "9943", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9943", "code_system": "CHEBI", "references": [ "f4ab81fa-1909-8c95-b082-5e05ae1b3139" ] }, { "uuid": "68b1c3dd-f90e-23a3-d970-55a0da776f09", "code": "GRZ5RCB1QG", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=GRZ5RCB1QG", "code_system": "DAILYMED", "references": [ "870d01eb-7366-859e-6d47-005cb7b35070" ] }, { "uuid": "568190cc-6b6f-f026-9583-ba37197efd3d", "code": "100000092624", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "2673eaea-82aa-9cc9-5c50-e5233078c5c7" ] }, { "uuid": "3d938d56-0ee3-1dbf-8974-c7d329f605f0", "code": "758676", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758676", "code_system": "NSC", "references": [ "3e0a398b-e116-5114-eff0-6b0ce78fa337" ] } ], "substance_class": "chemical", "references": [ { "uuid": "07273f72-9bcd-4be7-ab8e-a362fb841a99", "citation": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=f2f03495-12b6-457a-901f-958b9c844bfd", "url": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=f2f03495-12b6-457a-901f-958b9c844bfd", "doc_type": "DRUG PRODUCT LABEL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f2179679-20f7-4d72-93e5-9f440b16aa04", "citation": "J CLIN PHARMACOL AUGUST 1, 1992 VOL. 32 NO. 8 716-724", "url": "http://jcp.sagepub.com/content/32/8/716.full.pdf+html", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f3f58177-da66-4997-9e78-0b0fb1dd3a75", "citation": "SRS import [GRZ5RCB1QG]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GRZ5RCB1QG", "doc_type": "SRS", "public_domain": true, "document_date": 1493390470000, "tags": [ "NOMEN" ] }, { "uuid": "0ca04f1c-66af-4651-803c-60711515f489", "citation": "USP Dictionary 2010; INN 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1f629dfd-dc72-41cf-b4b8-6abb7bcddae6", "citation": "VENLAFAXINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2e0af4db-d854-442a-b85a-c35d662138fd", "citation": "VENLAFAXINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5fc3cb9b-e337-47b5-8a0c-063fad2a8619", "citation": "VENLAFAXINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "82d23198-be95-4bea-8274-4c897c74bc73", "citation": "VENLAFAXINE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "03b525a8-7caa-4b4d-9b5b-a6230211b353", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "01669f1c-34ec-4e04-99ac-29bd7fba4163", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dc83832e-f0db-47db-826b-39628d00b249", "citation": "INN Proposed List 60", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL60.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f736aae5-8a9b-41fc-a43d-028483c62f9b", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a15c7489-ddc0-433e-8d9e-e97ff21a8cc0", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "df2f8239-aff9-4d99-91b7-032e94f58cb2", "citation": "D08670", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "de81d306-b613-44f8-aa38-fa27e3c7e9b3", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "444676a6-cfc2-4651-bb62-ae40b88afe76", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b5af29f6-fb91-4856-9de3-3a148b9f4f33", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "008fe5aa-a7f1-42ac-963f-66fd54741fa4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390470000, "tags": [ "NOMEN" ] }, { "uuid": "3dcd6a62-1124-8835-881f-e55115bb1a0d", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+93413-69-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0aed1690-52e3-d406-dab2-93681ade569f", "citation": "Pharmacol Rev 65:578–640, April 2013", "url": "http://dx.doi.org/10.1124/pr.111.005439", "doc_type": "JA", "public_domain": true }, { "uuid": "0e5138e2-c571-3ed7-6209-c0724ffd5cee", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=93413-69-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a06cccaa-7c16-2c26-15a8-c8e60775cd81", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+93413-69-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3eab0df5-81dc-0c39-7eec-5df1e397ce3e", "citation": "VENLAFAXINE", "doc_type": "MICROMEDEX", "public_domain": true }, { "uuid": "f4ab81fa-1909-8c95-b082-5e05ae1b3139", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "718f410a-eb6f-4378-be17-82543b3592c5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "2ae5975d-480b-4b0b-80a2-346364fafd8e", "citation": "Sabatucci, Joseph P., et al. \"Heterocyclic cycloalkanol ethylamines as norepinephrine reuptake inhibitors.\" Bioorganic & medicinal chemistry letters 20.9 (2010): 2809-2812.", "url": "https://www.sciencedirect.com/science/article/pii/S0960894X1000380X?via%3Dihub", "doc_type": "JA", "public_domain": true }, { "uuid": "3e0a398b-e116-5114-eff0-6b0ce78fa337", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "9014cbbf-192d-4f25-a3fa-ec035579c01c", "citation": "USP", "doc_type": "USPNF", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "870d01eb-7366-859e-6d47-005cb7b35070", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "711c65f4-46b4-8351-7732-75aadf96971c", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "2673eaea-82aa-9cc9-5c50-e5233078c5c7", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "20817e44-3fc0-4eef-9500-747be60995e4", "citation": "Kringen, Marianne K., et al. \"The influence of combined CYP2D6 and CYP2C19 genotypes on venlafaxine and O-desmethylvenlafaxine concentrations in a large patient cohort.\" Journal of clinical psychopharmacology 40.2 (2020): 137-144.", "url": "https://europepmc.org/article/NBK/nbk305561", "doc_type": "JA", "public_domain": true }, { "uuid": "9ff5136d-1a69-4441-9ab7-10db45d9f5a9", "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1", "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e098d133-3d71-49ff-8477-d5533a2dde54", "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1", "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0c72fb10-3a8c-4ede-99a2-c9a8b2584054", "id": "0c72fb10-3a8c-4ede-99a2-c9a8b2584054", "molfile": "\n CDK 07162419202D\n\n 20 21 0 0 0 0 0 0 0 0999 V2000\n 26.5977 -7.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2834 -8.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0769 -7.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4043 -6.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3741 -5.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2474 -8.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7244 -4.6370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1069 -7.5405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0409 -7.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7437 -8.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8704 -5.6971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5202 -6.8838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9351 -9.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5678 -9.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1978 -4.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5367 -3.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4872 -11.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8604 -11.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1335 -12.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1692 -7.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0 0 0 0\n 5 3 2 0 0 0 0\n 6 3 1 0 0 0 0\n 7 4 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 6 2 0 0 0 0\n 11 5 1 0 0 0 0\n 12 9 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 2 1 0 0 0 0\n 15 7 1 0 0 0 0\n 16 7 1 0 0 0 0\n 17 14 1 0 0 0 0\n 18 13 1 0 0 0 0\n 19 18 1 0 0 0 0\n 11 9 2 0 0 0 0\n 17 19 1 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 12 20 1 0 0 0 0\nM END", "smiles": "CN(C)CC(c1ccc(cc1)OC)C2(CCCCC2)O", "formula": "C17H27NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b5ba5b72-1cb4-4258-afe3-63bdc98a2d49" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "277.4024", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "92ab23e1-a435-47c7-b5a9-3312f26acfe7", "version": "44", "structure": { "id": "a6dd9b58-0dd9-423d-8c44-62effaecdc28", "molfile": "\n JSDraw207162419202D\n\n 20 21 0 0 0 0 0 V2000\n 26.5977 -7.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2834 -8.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0769 -7.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4043 -6.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3741 -5.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2474 -8.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7244 -4.6370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1069 -7.5405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0409 -7.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7437 -8.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8704 -5.6971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5202 -6.8838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9351 -9.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5678 -9.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1978 -4.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5367 -3.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4872 -11.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8604 -11.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1335 -12.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1692 -7.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0 0 0 0\n 5 3 2 0 0 0 0\n 6 3 1 0 0 0 0\n 7 4 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 6 2 0 0 0 0\n 11 5 1 0 0 0 0\n 12 9 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 2 1 0 0 0 0\n 15 7 1 0 0 0 0\n 16 7 1 0 0 0 0\n 17 14 1 0 0 0 0\n 18 13 1 0 0 0 0\n 19 18 1 0 0 0 0\n 11 9 2 0 0 0 0\n 17 19 1 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 12 20 1 0 0 0 0\nM END", "smiles": "CN(C)CC(c1ccc(cc1)OC)C2(CCCCC2)O", "formula": "C17H27NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "277.4024", "optical_activity": "( + / - )", "references": [ "f3f58177-da66-4997-9e78-0b0fb1dd3a75", "0ca04f1c-66af-4651-803c-60711515f489", "dc83832e-f0db-47db-826b-39628d00b249" ], "stereo_centers": 1 }, "unii": "GRZ5RCB1QG", "relationships": [ { "uuid": "db9cfeb1-a1ec-49ea-a58c-4ac1989cc2df", "amount": { "uuid": "f3b2337f-a250-437f-ac56-294395c5e8e7" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "e782ad1d-922c-45b2-8b11-14ae336586e0", "refuuid": "92ab23e1-a435-47c7-b5a9-3312f26acfe7", "name": "VENLAFAXINE", "unii": "GRZ5RCB1QG", "linking_id": "GRZ5RCB1QG", "ref_pname": "VENLAFAXINE", "substance_class": "reference" } }, { "uuid": "d176e1b4-be31-4f2e-953e-52c76641b8a0", "amount": { "uuid": "b3ceb8c9-5b72-43f6-9fc9-531d3189732e" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "e027c15c-ed79-460c-8464-6f6da3f56b98", "refuuid": "7d116bce-123f-4ba8-a95b-312b5f3f4fa0", "name": "VENLAFAXINE HYDROCHLORIDE", "unii": "7D7RX5A8MO", "linking_id": "7D7RX5A8MO", "ref_pname": "VENLAFAXINE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "0f564aec-1004-470c-9af8-9149e656d43b", "amount": { "uuid": "53872257-cf02-4621-b3d1-01d4c8e15200" }, "type": "METABOLITE ACTIVE->PARENT", "interaction_type": "MAJOR", "mediator_substance": { "uuid": "39618f5d-9e43-49ae-853b-7f9e58c8eb95", "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b", "name": "CYTOCHROME P450 2D6", "unii": "8E4LAA4357", "linking_id": "8E4LAA4357", "ref_pname": "CYTOCHROME P450 2D6", "substance_class": "reference" }, "references": [ "07273f72-9bcd-4be7-ab8e-a362fb841a99" ], "related_substance": { "uuid": "ef6bead6-5b79-463f-a205-61eba9c845cf", "refuuid": "eb2e8a38-528a-4b49-9dba-f7af328d3996", "name": "DESVENLAFAXINE", "unii": "NG99554ANW", "linking_id": "NG99554ANW", "ref_pname": "DESVENLAFAXINE", "substance_class": "reference" } }, { "uuid": "468ffb63-6672-4bc8-833f-05b70aa71da1", "amount": { "uuid": "8e7c0c09-6817-47e0-8e33-6162d52fb24f" }, "type": "METABOLITE INACTIVE->PARENT", "interaction_type": "MINOR", "references": [ "f2179679-20f7-4d72-93e5-9f440b16aa04" ], "related_substance": { "uuid": "367ec8b8-b927-4f6c-9d81-82f9d0f0f414", "refuuid": "ee332f0b-137f-40d7-becc-b68a3b2f5a41", "name": "N,O-DIDESMETHYLVENLAFAXINE", "unii": "DYW3W9739Y", "linking_id": "DYW3W9739Y", "ref_pname": "N,O-DIDESMETHYLVENLAFAXINE", "substance_class": "reference" } }, { "uuid": "dc9b5688-6c0c-49a9-954e-f0c16454d8f2", "amount": { "uuid": "ce9835f2-9bc8-42bc-86aa-b8787768fcff" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "b98d1f9e-a0b0-4f28-8092-0193931a1d43", "refuuid": "f2fd2992-d1f2-4ce5-802b-e525377cb27b", "name": "VENLAFAXINE, (R)-", "unii": "B33212715Z", "linking_id": "B33212715Z", "ref_pname": "VENLAFAXINE, (R)-", "substance_class": "reference" } }, { "uuid": "de351af7-3156-4a62-a655-eff5ba6fd765", "amount": { "uuid": "1a4b2535-28a8-4605-a170-8b0a3c0344da" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "00bae120-acf2-44e1-8420-50d480c6d5bb", "refuuid": "b3d6c9f7-1c4c-478c-ad78-6e826ac3190c", "name": "VENLAFAXINE, (S)-", "unii": "5FIM3PQD9S", "linking_id": "5FIM3PQD9S", "ref_pname": "VENLAFAXINE, (S)-", "substance_class": "reference" } }, { "uuid": "25a7ef9e-50f2-45f0-ac40-448e5f2a53fb", "amount": { "uuid": "21b7ccd2-71b8-4e96-8fe7-0adc332636b7", "average": 27, "units": "%" }, "type": "BINDER->LIGAND", "references": [ "0aed1690-52e3-d406-dab2-93681ade569f" ], "related_substance": { "uuid": "82cbfbe7-f25f-4cc8-9937-29f63ef1fd83", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "0b8b3b9b-b7fe-405e-95e3-ec2825b88e6e", "amount": { "uuid": "19da1a7b-c6e0-4468-be99-92aeb2eb611f" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "365ff763-d1b2-43c0-8e33-64898daca47f", "refuuid": "a33d3cbc-006d-4704-be5d-5fe722144126", "name": "VENLAFAXINE BESYLATE", "unii": "1R8EN4W1EG", "linking_id": "1R8EN4W1EG", "ref_pname": "VENLAFAXINE BESYLATE" } }, { "uuid": "59d167f4-9d3d-424a-b58f-278ab6d88b76", "amount": { "uuid": "753c2d8a-b969-4263-81fb-57a82bc6a13d" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "27a413a0-006c-4a59-b0c0-161c4a1c6b31", "refuuid": "4de97cc0-3eb3-404c-8104-69c8b0e9a942", "name": "VENLAFAXINE BESYLATE MONOHYDRATE", "unii": "18XP3YT5NH", "linking_id": "18XP3YT5NH", "ref_pname": "VENLAFAXINE BESYLATE MONOHYDRATE" } }, { "uuid": "6d50d051-d49b-460b-a36d-f1ef873a4f1d", "amount": { "uuid": "dae5ae1e-d302-4708-8804-771697ba231c", "average": 535, "units": "NANOMOLAR" }, "type": "TARGET->INHIBITOR", "related_substance": { "uuid": "be936cc7-e3b1-4878-8ee0-18dc4b0fe878", "refuuid": "0984671c-0dd0-410d-b763-0a7c9195929d", "name": "SODIUM-DEPENDENT NORADRENALINE TRANSPORTER", "unii": "HN86OLH1NW", "linking_id": "HN86OLH1NW", "ref_pname": "SODIUM-DEPENDENT NORADRENALINE TRANSPORTER", "substance_class": "reference" } }, { "uuid": "08445a6d-a737-471e-b37b-7163a9b73cda", "amount": { "uuid": "7452fe14-1ecf-4124-a4ba-89319d6a48a3", "average": 27, "units": "NANOMOLAR" }, "qualification": "IC50", "type": "TARGET->INHIBITOR", "references": [ "2ae5975d-480b-4b0b-80a2-346364fafd8e" ], "related_substance": { "uuid": "30ec9d75-098c-4912-959b-f249e80ce1ad", "refuuid": "06df8044-d6c0-4403-85ab-26c75e41e405", "name": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER", "unii": "CJZ26L1EGI", "linking_id": "CJZ26L1EGI", "ref_pname": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER", "substance_class": "reference" } }, { "uuid": "d4b765c1-f759-4861-9c66-32c43e3b1e1b", "amount": { "uuid": "b7b019f5-144a-4c01-b3c5-fe2bec08a0ed", "units": "PERCENT PEAK AREA", "high_limit": 0.15 }, "qualification": "USP", "type": "PARENT->IMPURITY", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "9014cbbf-192d-4f25-a3fa-ec035579c01c" ], "related_substance": { "uuid": "e692686f-8708-46bd-ac08-aae6ab7643d9", "refuuid": "eb2e8a38-528a-4b49-9dba-f7af328d3996", "name": "DESVENLAFAXINE", "unii": "NG99554ANW", "linking_id": "NG99554ANW", "ref_pname": "DESVENLAFAXINE", "substance_class": "reference" } }, { "uuid": "8069b622-db54-47eb-a069-5f4db4c39317", "amount": { "uuid": "9db9d44c-66af-4957-a4f3-e3a99eed2b11", "units": "PERCENT PEAK AREA", "high_limit": 0.15 }, "qualification": "USP", "type": "PARENT->IMPURITY", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "9014cbbf-192d-4f25-a3fa-ec035579c01c" ], "related_substance": { "uuid": "5c361e36-00d3-45a6-b066-c1fa038f363c", "refuuid": "f26e9b2a-bea7-4b96-9083-55313f166b20", "name": "DESVENLAFAXINE SUCCINATE", "unii": "ZB22ENF0XR", "linking_id": "ZB22ENF0XR", "ref_pname": "DESVENLAFAXINE SUCCINATE", "substance_class": "reference" } }, { "uuid": "24d05dc1-f16e-4c1c-8f3e-77ae7a280ff6", "amount": { "uuid": "e17315e5-a70b-4a4e-92c5-7220436c7446" }, "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "20817e44-3fc0-4eef-9500-747be60995e4" ], "related_substance": { "uuid": "a4c342f9-ceb1-422a-82e6-a67497822f7f", "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b", "name": "CYTOCHROME P450 2D6", "unii": "8E4LAA4357", "linking_id": "8E4LAA4357", "ref_pname": "CYTOCHROME P450 2D6", "substance_class": "reference" } }, { "uuid": "216477b2-e3f1-4fc6-b563-753d4d527d3e", "amount": { "uuid": "37067cb7-dadb-4089-b254-e4cd5e94c456" }, "type": "IMPURITY->PARENT", "references": [ "e098d133-3d71-49ff-8477-d5533a2dde54" ], "related_substance": { "uuid": "d69d4469-cd1a-4856-82f6-9c5b79995dad", "refuuid": "14ceb8f6-0e8c-4fd9-a331-19e0ff8342c3", "name": "N-nitroso-desmethyl-venlafaxine", "unii": "DC8MH5P7QR", "linking_id": "DC8MH5P7QR", "ref_pname": "N-nitroso-desmethyl-venlafaxine", "substance_class": "reference" } } ], "names": [ { "uuid": "c2ca25c6-4750-4d3d-ba7e-7b8a52144b8d", "name": "(±)-1-(.ALPHA.-((DIMETHYLAMINO)METHYL)-P-METHOXYBENZYL)CYCLOHEXANOL", "stdName": "(+/-)-1-(.ALPHA.-((DIMETHYLAMINO)METHYL)-P-METHOXYBENZYL)CYCLOHEXANOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "01669f1c-34ec-4e04-99ac-29bd7fba4163" ], "display_name": false }, { "uuid": "21e4c9ea-01ef-47bb-b7ea-f5c4de3daa97", "name": "CYCLOHEXANOL, 1-(2-(DIMETHYLAMINO)-1-(4-METHOXYPHENYL)ETHYL)-", "stdName": "CYCLOHEXANOL, 1-(2-(DIMETHYLAMINO)-1-(4-METHOXYPHENYL)ETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "01669f1c-34ec-4e04-99ac-29bd7fba4163" ], "display_name": false }, { "uuid": "723c78de-fb36-46ff-bc33-50223091ced4", "name": "EFECTIN", "stdName": "EFECTIN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "df2f8239-aff9-4d99-91b7-032e94f58cb2", "a15c7489-ddc0-433e-8d9e-e97ff21a8cc0" ], "display_name": false }, { "uuid": "dad7daf0-d800-4095-b6f7-3d63993a7b62", "name": "KANGHONG", "stdName": "KANGHONG", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b5af29f6-fb91-4856-9de3-3a148b9f4f33" ], "display_name": false }, { "uuid": "59a83b96-edef-a4ba-2eba-16ec8e086c58", "name": "NSC-758676", "stdName": "NSC-758676", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3e0a398b-e116-5114-eff0-6b0ce78fa337" ], "display_name": false }, { "uuid": "5df2d57b-b847-47f3-9334-6833515f66be", "name": "TREVILOR", "stdName": "TREVILOR", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b5af29f6-fb91-4856-9de3-3a148b9f4f33" ], "display_name": false }, { "uuid": "fb81f184-5011-44b3-829a-07ad4fbbfefe", "name": "VELAFAX", "stdName": "VELAFAX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b5af29f6-fb91-4856-9de3-3a148b9f4f33" ], "display_name": false }, { "uuid": "477a0a6c-61cd-4849-a31b-1df67d5b08c0", "name": "VENLAFAXINE", "stdName": "VENLAFAXINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "2e0af4db-d854-442a-b85a-c35d662138fd", "03b525a8-7caa-4b4d-9b5b-a6230211b353", "de81d306-b613-44f8-aa38-fa27e3c7e9b3", "82d23198-be95-4bea-8274-4c897c74bc73", "5fc3cb9b-e337-47b5-8a0c-063fad2a8619", "1f629dfd-dc72-41cf-b4b8-6abb7bcddae6", "444676a6-cfc2-4651-bb62-ae40b88afe76", "dc83832e-f0db-47db-826b-39628d00b249", "f736aae5-8a9b-41fc-a43d-028483c62f9b" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "267495b1-d519-450b-8a40-e1c8b2a3a117", "name_org": "INN" } ] }, { "uuid": "cc3a81f5-0f51-4a0d-b11e-be44c211d3dc", "name": "VENLAFAXINE [MI]", "stdName": "VENLAFAXINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f736aae5-8a9b-41fc-a43d-028483c62f9b" ], "display_name": false }, { "uuid": "4368d2b1-a0f5-409b-86d9-0a84144eb217", "name": "VENLAFAXINE [VANDF]", "stdName": "VENLAFAXINE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "444676a6-cfc2-4651-bb62-ae40b88afe76" ], "display_name": false }, { "uuid": "097d287b-aa0d-46f1-9081-d2c77322709b", "name": "VENLOR", "stdName": "VENLOR", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b5af29f6-fb91-4856-9de3-3a148b9f4f33" ], "display_name": false }, { "uuid": "7911e2db-7719-9711-f4db-ab841af85301", "name": "Venlafaxine [WHO-DD]", "stdName": "VENLAFAXINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "711c65f4-46b4-8351-7732-75aadf96971c" ], "display_name": false }, { "uuid": "437854cf-27ae-4eac-8455-a91a2452e20b", "name": "venlafaxine [INN]", "stdName": "VENLAFAXINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dc83832e-f0db-47db-826b-39628d00b249" ], "display_name": false } ], "properties": [ { "uuid": "dd7f4f3e-5ca8-4803-8629-1b7ffc9bef57", "name": "MAXIMUM TOLERATED DOSE", "value": { "uuid": "e48ce5ea-f603-4b32-aacc-e10433d2e4cf", "average": 225, "units": "mg/day", "non_numeric_value": "EXTENDED-RELEASE CAPSULE AND TABLET" }, "defining": false, "parameters": [ { "uuid": "ecb2c610-596f-4f21-b77e-7588bc265e29", "name": "IMMEDIATE-RELEASE TABLET: 375 MG/DAY", "references": [] } ], "property_type": "TOXICITY", "references": [ "3eab0df5-81dc-0c39-7eec-5df1e397ce3e" ] }, { "uuid": "c65503ee-d332-46f3-b27c-b86e120aef5e", "name": "ORAL BIOAVAILABILITY", "value": { "uuid": "fee7f504-fb0e-483b-a777-75d1e1a4b3a2", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "average": 12.6, "units": "%", "non_numeric_value": "REGULAR-RELEASE CAPSULE" }, "defining": false, "parameters": [ { "uuid": "e2e2c0a3-a806-4068-953f-173b67b0b752", "name": "EXTENDED-RELEASE CAPSULE", "value": { "uuid": "75ba3e64-6865-44c8-bdc1-5abb81a991f4", "average": 45, "units": "%", "references": [] }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "3eab0df5-81dc-0c39-7eec-5df1e397ce3e" ] }, { "uuid": "8adf4458-e6df-4a75-8df7-2e236f732440", "name": "Volume of Distribution", "value": { "uuid": "e07efa7f-1352-4486-8486-43a196039a2f", "average": 7.5, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "3eab0df5-81dc-0c39-7eec-5df1e397ce3e" ] }, { "uuid": "bdbe0115-a431-461b-80f5-8dd9fcc57ead", "name": "PROTEIN BINDING", "value": { "uuid": "b5cb218e-9e5c-4a21-8305-77b0fcb4e2bf", "high": 30, "low": 27, "units": "%" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "3eab0df5-81dc-0c39-7eec-5df1e397ce3e" ] }, { "uuid": "86bd2c70-d63a-4ff5-9d80-ffc5742d0618", "name": "Route of Elimination", "value": { "uuid": "40c51a08-25d3-4e35-978d-10cb1c5076f5", "type": "MOLE PERCENT OF AMOUNT EXCRETED", "average": 2, "units": "%", "non_numeric_value": "FECAL" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "3eab0df5-81dc-0c39-7eec-5df1e397ce3e" ] }, { "uuid": "7bb58f07-166a-46a1-ae89-d9febd6cc93b", "name": "Route of Elimination", "value": { "uuid": "7f7754e1-9e98-4ac3-b880-3d1f45177943", "type": "MOLE PERCENT OF AMOUNT EXCRETED", "average": 87, "units": "%", "non_numeric_value": "RENAL, AS METABOLITES" }, "defining": false, "parameters": [ { "uuid": "0efa1e17-4d1c-4a70-b33b-45e2ae75af39", "name": "EXCRETED UNCHANGED: 5%", "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "3eab0df5-81dc-0c39-7eec-5df1e397ce3e" ] }, { "uuid": "f379ff4c-fd48-43d4-b25d-cc765fcda30b", "name": "Biological Half-life", "value": { "uuid": "1f84af01-dcea-4ff4-8f0e-673de8a352da", "average": 5, "units": "hours" }, "defining": false, "parameters": [ { "uuid": "f01b6e3f-2e46-4be7-8061-58f9d1b6013e", "name": "DIALYSIS: PROLONGED BY ABOUT 180%", "references": [] }, { "uuid": "d841daac-c9ee-4a83-a189-bc73e71fad81", "name": "HEPATIC CIRRHOSIS: PROLONGED BY ABOUT 30%", "references": [] }, { "uuid": "05230852-d2b7-4a54-a5b5-be2fd3e22df8", "name": "RENAL IMPAIRMENT: PROLONGED BY ABOUT 50%", "references": [] }, { "uuid": "8fe37340-c7df-4fa4-b6cc-c766ca5604dd", "name": "O-DESMETHYLVENLAFAXINE: 11 HOURS", "references": [] }, { "uuid": "ec96cc05-8f44-4736-8162-7106b173e6cf", "name": "O-DESMETHYLVENLAFAXINE, DIALYSIS: PROLONGED BY ABOUT 142%", "references": [] }, { "uuid": "4868c97a-35c7-4673-90b8-a0ea597eced0", "name": "O-DESMETHYLVENLAFAXINE, HEPATIC CIRRHOSIS: PROLONGED BY ABOUT 60%", "references": [] }, { "uuid": "f1e7c266-4002-4be0-a650-94e973c4de69", "name": "O-DESMETHYLVENLAFAXINE, RENAL IMPAIRMENT: PROLONGED BY ABOUT 40%", "references": [] } ], "property_type": "PHARMACOKINETIC" } ], "modifications": { "uuid": "89b7efe9-8c0e-4b78-8624-6f11e9d8a5a0" } } ] }