{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e6a09604-be61-4781-a7c5-1eadb810ebdc",
          "code": "86-75-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=86-75-9",
          "code_system": "CAS",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964",
            "dc7df70f-5efe-465f-b3ed-d92b067d1cec"
          ]
        },
        {
          "uuid": "193e11ab-948b-4cd7-817b-5e78e4bd1d79",
          "code": "SUB05763MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964"
          ]
        },
        {
          "uuid": "1e3d8848-0456-402a-b418-ab377098bf5c",
          "code": "2438",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2438",
          "code_system": "INN",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964"
          ]
        },
        {
          "uuid": "c4f0fe28-4cf2-42da-b652-77e672b8eaf8",
          "code": "C77027",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77027",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964"
          ]
        },
        {
          "uuid": "10856f4d-dfc6-4c46-b2ae-c80ed3e83e6d",
          "code": "314521",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/314521/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964"
          ]
        },
        {
          "uuid": "35cdefc8-53ae-4247-8583-a7e471d02b59",
          "code": "m72",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m72?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964"
          ]
        },
        {
          "uuid": "7e90a035-a307-4122-ae0a-42131d3620ff",
          "code": "CHEMBL1170610",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1170610",
          "code_system": "ChEMBL",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964"
          ]
        },
        {
          "uuid": "e0d31275-4981-4b89-b237-2301f94bf803",
          "code": "201-697-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.543",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964"
          ]
        },
        {
          "uuid": "a75d751d-a319-4f38-88a9-d95035d51823",
          "code": "6855",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6855",
          "code_system": "PUBCHEM",
          "references": [
            "0b042a89-ed3d-45b7-9f9e-4ed59627e964"
          ]
        },
        {
          "uuid": "10c2c442-3b3a-69c5-a0ea-3e3bb74cc277",
          "code": "DTXSID5046069",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5046069",
          "code_system": "EPA CompTox",
          "references": [
            "cda29fa8-03a7-616c-8cbe-11b1f285586a"
          ]
        },
        {
          "uuid": "654dcbd6-924b-e860-0eed-2ce838b5275a",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "58bab812-2c4e-f76e-7374-72df9ebf6e5a"
          ]
        },
        {
          "uuid": "0d855242-bc3e-498a-8314-34f377f7dd2f",
          "code": "GRE0P19C3Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "78a6cc74-94f0-eb58-3b7d-10394c9c6d47",
          "code": "100000086371",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8b1d7f8f-669a-920d-d892-7e312fd45129"
          ]
        },
        {
          "uuid": "cf03c299-f1f0-ab95-f155-9c63b40ce86b",
          "code": "3951",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3951",
          "code_system": "NSC",
          "references": [
            "3861f701-86be-5358-ae96-f8a64394e0a9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d1ec63c8-d1c2-4bcf-9c39-e54fd7793549",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5812030e-dc86-4c70-8d08-29a422f26529",
            "refuuid": "c429ae14-6717-4be5-95dd-951276d53f24",
            "name": "OXYQUINOLINE",
            "unii": "5UTX5635HP",
            "linking_id": "5UTX5635HP",
            "ref_pname": "OXYQUINOLINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f6064be8-a3c3-4601-a000-5e74071bf14f",
          "name": "8-HYDROXYQUINOLINE BENZOATE",
          "stdName": "8-HYDROXYQUINOLINE BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92329912-7a7e-4726-aaba-722da1f27a51"
          ],
          "display_name": false
        },
        {
          "uuid": "6fae1938-ed34-423d-8b2a-7e95535ad205",
          "name": "BENZOXIQUINE",
          "stdName": "BENZOXIQUINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6de73fbc-459c-48ff-9ca5-0598affe2f7c",
            "8cca8153-dcb9-44b1-a952-d2f1f04db7f9",
            "7d29eead-082f-4247-9c20-01e2f0dc4cba",
            "92329912-7a7e-4726-aaba-722da1f27a51",
            "59632092-e172-4b68-a02b-1cf46fb0d11d",
            "410cd41c-8bd6-4d44-b220-057b7fc86785",
            "faf17a34-d668-4f03-8982-4ff0d5a79fb5",
            "f72c556a-072e-42d3-9320-85a95de10237",
            "cbce4f30-4a6a-4202-89ea-d17f88a02263",
            "7b0b33d5-71c9-46f7-bc48-cbba70687a5f",
            "67951087-8daa-4a60-8bf6-14e63082ade9",
            "68a64256-c55b-4216-a3bb-b32639d028d2",
            "20054e01-c567-4bbf-9f16-884e53fdd3ad",
            "993b4e2e-b355-48fd-81e0-7d8909bbc3b6",
            "1eb96728-b494-4b63-a95a-97f6e2d595dd"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b69e6e13-2a9c-4ece-9dc4-219d00b1422f",
              "name_org": "INN"
            },
            {
              "uuid": "dec56421-02d4-4efe-a088-8ca2b474332b",
              "name_org": "USAN"
            },
            {
              "uuid": "ebcbe567-a9d0-4cf9-b268-f86a551d6758",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d7ce1ea2-8012-4a56-a03d-6cda50d97b14",
          "name": "BENZOXIQUINE [MART.]",
          "stdName": "BENZOXIQUINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59632092-e172-4b68-a02b-1cf46fb0d11d"
          ],
          "display_name": false
        },
        {
          "uuid": "71ad8edf-ecc4-4f32-bfc4-d9b82fae4553",
          "name": "BENZOXIQUINE [MI]",
          "stdName": "BENZOXIQUINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6de73fbc-459c-48ff-9ca5-0598affe2f7c"
          ],
          "display_name": false
        },
        {
          "uuid": "4ccb281d-a8a7-4aad-9fde-7b0bf15e8ac1",
          "name": "BENZOXIQUINE [USAN]",
          "stdName": "BENZOXIQUINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "faf17a34-d668-4f03-8982-4ff0d5a79fb5"
          ],
          "display_name": false
        },
        {
          "uuid": "3e36ede2-6cfc-4044-a4d5-d80821434e8e",
          "name": "BENZOXIQUINE [VANDF]",
          "stdName": "BENZOXIQUINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67951087-8daa-4a60-8bf6-14e63082ade9"
          ],
          "display_name": false
        },
        {
          "uuid": "8a0d013a-6467-7fae-3c58-1c8a37fc9624",
          "name": "Benzoxiquine [WHO-DD]",
          "stdName": "BENZOXIQUINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ecd7c7a-ef4d-3df3-04ae-9d753112dced"
          ],
          "display_name": false
        },
        {
          "uuid": "b1aaae5d-0cc7-4a83-a7ef-2dc19d5c2f44",
          "name": "NSC-3951",
          "stdName": "NSC-3951",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92329912-7a7e-4726-aaba-722da1f27a51"
          ],
          "display_name": false
        },
        {
          "uuid": "a1c30ad7-f688-49ea-9f92-b5456e3335ad",
          "name": "benzoxiquine [INN]",
          "stdName": "BENZOXIQUINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbce4f30-4a6a-4202-89ea-d17f88a02263"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "92329912-7a7e-4726-aaba-722da1f27a51",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cbce4f30-4a6a-4202-89ea-d17f88a02263",
          "citation": "INN Proposed List 18",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL18.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "faf17a34-d668-4f03-8982-4ff0d5a79fb5",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59632092-e172-4b68-a02b-1cf46fb0d11d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68a64256-c55b-4216-a3bb-b32639d028d2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cca8153-dcb9-44b1-a952-d2f1f04db7f9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67951087-8daa-4a60-8bf6-14e63082ade9",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6de73fbc-459c-48ff-9ca5-0598affe2f7c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b042a89-ed3d-45b7-9f9e-4ed59627e964",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ba98cc2-808e-4158-8d73-b5cf27a8cd0e",
          "citation": "SRS import [GRE0P19C3Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GRE0P19C3Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d80b2db5-c1c3-4202-ae99-b65bbf47387e",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "993b4e2e-b355-48fd-81e0-7d8909bbc3b6",
          "citation": "BENZOXIQUINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f72c556a-072e-42d3-9320-85a95de10237",
          "citation": "BENZOXIQUINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "20054e01-c567-4bbf-9f16-884e53fdd3ad",
          "citation": "BENZOXIQUINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b0b33d5-71c9-46f7-bc48-cbba70687a5f",
          "citation": "BENZOXIQUINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "410cd41c-8bd6-4d44-b220-057b7fc86785",
          "citation": "BENZOXIQUINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d29eead-082f-4247-9c20-01e2f0dc4cba",
          "citation": "BENZOXIQUINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1eb96728-b494-4b63-a95a-97f6e2d595dd",
          "citation": "BENZOXIQUINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cda29fa8-03a7-616c-8cbe-11b1f285586a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=86-75-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "58bab812-2c4e-f76e-7374-72df9ebf6e5a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dc7df70f-5efe-465f-b3ed-d92b067d1cec",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3861f701-86be-5358-ae96-f8a64394e0a9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3ecd7c7a-ef4d-3df3-04ae-9d753112dced",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8b1d7f8f-669a-920d-d892-7e312fd45129",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8b73e138-f6ae-4cf3-b2ae-b398079eb201",
          "id": "8b73e138-f6ae-4cf3-b2ae-b398079eb201",
          "molfile": "\n  Marvin  01132107152D          \n\n 19 21  0  0  0  0            999 V2000\n    0.0000   -2.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -2.8887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -2.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -1.6525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8499    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5715   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5715   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8499   -1.6525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -4.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -5.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n 14  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 13  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(=O)Oc2cccc3cccnc32",
          "formula": "C16H11NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "957c2b37-5232-41f2-b217-2c121b439ea2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "249.2646",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "269eb1ab-32a6-475c-888f-38c783c078d3",
      "version": "10",
      "structure": {
        "id": "a43a1932-a862-4b7b-be30-4811f4a193d8",
        "molfile": "\n  Marvin  01132108322D          \n\n 19 21  0  0  0  0            999 V2000\n    0.7164   -2.8887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -2.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -1.6525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8499   -1.6525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5715   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8499    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5715   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276   -4.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -5.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  3  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13  7  2  0  0  0  0\n 14  7  1  0  0  0  0\n 15  8  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 14  2  0  0  0  0\n 18 13  1  0  0  0  0\n 19 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 12  8  1  0  0  0  0\n 16 11  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(=O)Oc2cccc3cccnc32",
        "formula": "C16H11NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "249.2646",
        "optical_activity": "NONE",
        "references": [
          "d80b2db5-c1c3-4202-ae99-b65bbf47387e",
          "9ba98cc2-808e-4158-8d73-b5cf27a8cd0e",
          "cbce4f30-4a6a-4202-89ea-d17f88a02263"
        ],
        "stereo_centers": 0
      },
      "unii": "GRE0P19C3Z"
    }
  ]
}