{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "23f1954a-04f1-4506-9859-eeb277ca7827", "code": "1745-89-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1745-89-7", "code_system": "CAS", "references": [ "141de9a8-6dee-4723-9ff7-68da232c8719", "75fca052-3286-4244-bd7d-e9c9ac68f3ff" ] }, { "uuid": "83343d56-2261-4004-91cf-b8bf852c8c99", "code": "217-121-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.565", "code_system": "ECHA (EC/EINECS)", "references": [ "141de9a8-6dee-4723-9ff7-68da232c8719" ] }, { "uuid": "a497cd1b-cdef-43dd-9c71-4e29f2d5859e", "code": "74457", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/74457", "code_system": "PUBCHEM", "references": [ "141de9a8-6dee-4723-9ff7-68da232c8719" ] }, { "uuid": "fb1186bf-1bd4-457f-93d3-fd003fdd8584", "code": "GQ8ZL3YCS3", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8f9f3bf8-c0dd-812b-72fe-67d21d2bc7f8", "code": "DTXSID1061942", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1061942", "code_system": "EPA CompTox", "references": [ "7fa852a0-1808-aedd-0153-d7f8e2b103cf" ] } ], "substance_class": "chemical", "names": [ { "uuid": "f1599e54-6542-4d10-bd63-5e0b11dca2cf", "name": "2,2-Bis(3-allyl-4-hydroxyphenyl)propane", "stdName": "2,2-BIS(3-ALLYL-4-HYDROXYPHENYL)PROPANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "75fca052-3286-4244-bd7d-e9c9ac68f3ff" ], "display_name": false }, { "uuid": "53db1243-26ad-411f-af39-a7bbd953ea03", "name": "2,2′-Diallylbisphenol A", "stdName": "2,2'-DIALLYLBISPHENOL A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "75fca052-3286-4244-bd7d-e9c9ac68f3ff" ], "display_name": true }, { "uuid": "9a464347-916d-4089-8401-9e89c1e9b332", "name": "4,4′-(1-Methylethylidene)bis[2-(2-propen-1-yl)phenol]", "stdName": "4,4'-(1-METHYLETHYLIDENE)BIS(2-(2-PROPEN-1-YL)PHENOL)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "75fca052-3286-4244-bd7d-e9c9ac68f3ff" ], "display_name": false }, { "uuid": "4238cf45-d9cd-48f9-98fd-129fcb4cc868", "name": "Phenol, 4,4′-(1-methylethylidene)bis[2-(2-propen-1-yl)-", "stdName": "PHENOL, 4,4'-(1-METHYLETHYLIDENE)BIS(2-(2-PROPEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "75fca052-3286-4244-bd7d-e9c9ac68f3ff" ], "display_name": false }, { "uuid": "e79085ef-6e6b-4eaf-ab07-b05da11ddb8a", "name": "Phenol, 4,4′-(1-methylethylidene)bis[2-(2-propenyl)-", "stdName": "PHENOL, 4,4'-(1-METHYLETHYLIDENE)BIS(2-(2-PROPENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "311268de-bf32-4eb9-aee6-f3fe2d12bcb3", "57e2d4e1-08e5-424f-a199-ee8fc7d96561" ], "display_name": false }, { "uuid": "29575809-4c10-4a14-8e61-21e1fdb4ac9b", "name": "Phenol, 4,4′-isopropylidenebis[2-allyl-", "stdName": "PHENOL, 4,4'-ISOPROPYLIDENEBIS(2-ALLYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "75fca052-3286-4244-bd7d-e9c9ac68f3ff" ], "display_name": false } ], "references": [ { "uuid": "57e2d4e1-08e5-424f-a199-ee8fc7d96561", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "311268de-bf32-4eb9-aee6-f3fe2d12bcb3", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "141de9a8-6dee-4723-9ff7-68da232c8719", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393955000, "tags": [ "NOMEN" ] }, { "uuid": "7fa852a0-1808-aedd-0153-d7f8e2b103cf", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1745-89-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "75fca052-3286-4244-bd7d-e9c9ac68f3ff", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2d276346-ac63-45b1-a77d-cad9674e2247", "id": "2d276346-ac63-45b1-a77d-cad9674e2247", "molfile": "\n Marvin 01132102262D \n\n 23 24 0 0 0 0 999 V2000\n 0.3037 0.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7151 -0.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7162 0.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4257 -0.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1435 0.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1435 0.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8575 1.3088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4257 1.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4237 2.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7057 2.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7045 3.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7162 0.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1265 -1.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7122 -1.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1229 -2.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9479 -2.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3575 -3.3659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3622 -1.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1872 -1.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6047 -1.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4254 -1.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9515 -1.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 2 14 1 0 0 0 0\n 4 5 1 0 0 0 0\n 13 4 2 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 14 15 1 0 0 0 0\n 23 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 23 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\nM END", "smiles": "C=CCc1cc(ccc1O)C(C)(C)c2ccc(c(CC=C)c2)O", "formula": "C21H24O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ff251e5b-87a2-4ab9-b4b8-a3e68ee57189" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "308.4148", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9c99a6d6-05bb-4a2f-8938-0a1216f876e0", "version": "5", "structure": { "id": "4a2391d4-c5e2-48a3-b8f1-2612b0b08524", "molfile": "\n Marvin 01132103532D \n\n 23 24 0 0 0 0 999 V2000\n 3.8575 1.3088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1435 0.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4257 1.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7162 0.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7162 0.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4257 -0.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1435 0.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7151 -0.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1265 -1.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7122 -1.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1229 -2.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9479 -2.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3575 -3.3659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3622 -1.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1872 -1.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6047 -1.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4254 -1.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9515 -1.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3037 0.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4237 2.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7057 2.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7045 3.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 2 2 0 0 0 0\n 5 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 14 18 1 0 0 0 0\n 18 9 2 0 0 0 0\n 8 19 1 0 0 0 0\n 8 20 1 0 0 0 0\n 3 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\nM END", "smiles": "C=CCc1cc(ccc1O)C(C)(C)c2ccc(c(CC=C)c2)O", "formula": "C21H24O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "308.4148", "optical_activity": "NONE", "references": [ "57e2d4e1-08e5-424f-a199-ee8fc7d96561" ], "stereo_centers": 0 }, "unii": "GQ8ZL3YCS3" } ] }