{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "34434eac-060d-460c-98b8-1bd915931608",
          "code": "M03BB72",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Oxazol, thiazine, and triazine derivatives|chlormezanone, combinations with psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M03BB72&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "7cd80967-45e4-45fa-8028-96b7ee60b5f8",
          "code": "SUB06187MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "52ef8800-4cd7-48bf-be73-2eee2706c507",
          "code": "782",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=782",
          "code_system": "INN",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "3f8e4307-2202-492e-ae90-0fab7b37e9e0",
          "code": "7323",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7323",
          "code_system": "IUPHAR",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "dca01ccf-4139-4a9b-bf99-171df6381f5a",
          "code": "2373",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2373/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "67af3572-6455-4744-937d-4021dd488187",
          "code": "m3376",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3376?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "f60a556b-d053-41fe-a294-6e1a8da9b12a",
          "code": "DB01178",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01178",
          "code_system": "DRUG BANK",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "4276c7b6-3cbe-4238-a863-3806e4e7e962",
          "code": "CHEMBL1200714",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200714",
          "code_system": "ChEMBL",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "ac9bd82e-70c2-499b-80a7-242611373f08",
          "code": "201-307-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.190",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "eace51e4-0561-46a3-acb9-aab72c009583",
          "code": "2717",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2717",
          "code_system": "PUBCHEM",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "7734bc44-b398-45e0-808b-db81d60a4f98",
          "code": "M03BB02",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Oxazol, thiazine, and triazine derivatives|chlormezanone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M03BB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "5f64745b-924a-4112-834d-f353e555e48d",
          "code": "QM03BB72",
          "comments": "VATC|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Oxazol, thiazine, and triazine derivatives|chlormezanone, combinations with psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM03BB72&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "2c49d32b-f9ee-43cd-83eb-21fc1eb63a22",
          "code": "QM03BB02",
          "comments": "VATC|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Oxazol, thiazine, and triazine derivatives|chlormezanone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM03BB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "30e45b70-db32-4ad5-968b-7dc9482d8514",
          "code": "QM03BB52",
          "comments": "VATC|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Oxazol, thiazine, and triazine derivatives|chlormezanone, combinations excl. psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM03BB52&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "27c5241f-6f12-4143-a970-a7646fa4f88c",
          "code": "80-77-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80-77-3",
          "code_system": "CAS",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2",
            "88f1ad86-8a71-4daa-b7eb-30d44491931b"
          ]
        },
        {
          "uuid": "847082b9-dc82-4e4f-a693-b63ffac919d8",
          "code": "C65316",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65316",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "7b561a29-206c-44a0-a1d5-c486322647a2",
          "code": "D002720",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002720",
          "code_system": "MESH",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "16556aa7-93e1-4dd6-a87c-54129e650f12",
          "code": "CHLORMEZANONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chlormezanone",
          "code_system": "WIKIPEDIA",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "0425af24-66ec-49ce-90cf-45f1afd33ff3",
          "code": "M03BB52",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Oxazol, thiazine, and triazine derivatives|chlormezanone, combinations excl. psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M03BB52&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c419d485-ce77-4248-885b-ca2f4961e4b2"
          ]
        },
        {
          "uuid": "6948bc27-185e-da40-d2bf-885754619167",
          "code": "3300",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3300",
          "code_system": "HSDB",
          "references": [
            "0b4eb1cf-319c-66b8-6865-aeacd3e25e15"
          ]
        },
        {
          "uuid": "eaf25e85-200b-ac48-f9a5-a94a4c489ccd",
          "code": "DTXSID3022798",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3022798",
          "code_system": "EPA CompTox",
          "references": [
            "ec9f254c-5c3e-09ae-b7e6-d742facab4b6"
          ]
        },
        {
          "uuid": "82d36d21-990e-dbce-06b7-f1dda9879893",
          "code": "C28197",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28197",
          "code_system": "NCI_THESAURUS",
          "references": [
            "763813fd-7450-0668-7ae5-6ddd58444d4a"
          ]
        },
        {
          "uuid": "fcddd272-0b4f-4e7d-9634-79db1449bdd0",
          "code": "GP568V9G19",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4df15744-9717-8bab-0554-89dc281f3e08",
          "code": "603",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/603",
          "code_system": "DRUG CENTRAL",
          "references": [
            "763813fd-7450-0668-7ae5-6ddd58444d4a"
          ]
        },
        {
          "uuid": "0ee17956-6302-a523-8fca-888fd8d5a0c9",
          "code": "3619",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3619",
          "code_system": "CHEBI",
          "references": [
            "763813fd-7450-0668-7ae5-6ddd58444d4a"
          ]
        },
        {
          "uuid": "07acdd35-ba3c-4eec-1d8e-98b057d795ad",
          "code": "100000081564",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9cf9df19-2821-e40c-c2b7-2e4a9cf3289e"
          ]
        },
        {
          "uuid": "6a797a57-00ce-1fbd-49c2-b00b39dd92ac",
          "code": "169108",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=169108",
          "code_system": "NSC",
          "references": [
            "58401a06-c1c0-639a-4fb1-c62febdff23c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c6c4f55d-8479-4a1e-b329-5874f5324eaa",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "80af3b9e-eb97-41ac-bc6f-0b2fb73c844d",
            "refuuid": "36f1de9d-1405-4c1b-b06a-5b6cf4b688de",
            "name": "CHLORMEZANONE",
            "unii": "GP568V9G19",
            "linking_id": "GP568V9G19",
            "ref_pname": "CHLORMEZANONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9a5b25ff-a860-4bfd-b78e-7c8b19c0ae4a",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "6a41fb5d-4df2-4e38-8520-c803e1b7dbb0",
            "refuuid": "81a3759b-5e05-4e16-b5bd-4980cff04d6a",
            "name": "CHLORMEZANONE, (-)-",
            "unii": "C14WB33Y0S",
            "linking_id": "C14WB33Y0S",
            "ref_pname": "CHLORMEZANONE, (-)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7d8728c1-36f0-4648-9e16-90eeecdf4a7c",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f09b2e84-0a0a-4a19-a457-4a7b4ac7d19d",
            "refuuid": "91f9e745-3f72-4487-a77c-c4fd078bccdd",
            "name": "CHLORMEZANONE, (+)-",
            "unii": "4BU37OM8KL",
            "linking_id": "4BU37OM8KL",
            "ref_pname": "CHLORMEZANONE, (+)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7ac18f10-c34d-4cdf-ae53-75d72047f51f",
          "name": "CHLORMEZANONE",
          "stdName": "CHLORMEZANONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98e28019-83b1-4f13-9887-d6eca9034bd9",
            "afe5f53e-4202-430b-a52d-b862614775ac",
            "a80b3755-1d4c-4c6c-a875-03e72180ab28",
            "a6d109e2-9b27-405d-92ab-bfbdb30c2368",
            "ad48b8b4-265a-4707-8481-6426ec49da97",
            "41da677d-2625-4198-81a6-25af28d7af78",
            "0a98407a-06a4-480b-8322-aa126dd9463a",
            "78339cb7-1546-45ab-bcc6-b04b98a8fdb6",
            "974ffd0c-7178-4af5-a360-6910858f6bdb",
            "25fcf1ee-8558-458f-909d-eba945015613",
            "5142fa72-35ac-4a4f-861c-d0435ab33679",
            "a6589200-ef17-40b8-9d3a-10f4edc5a752",
            "651577be-7838-4461-9677-b535106ab144",
            "84a0e6da-d092-478f-a9e0-66c603f24d31",
            "92117947-e35e-4a86-9cdb-60e57104e3d9",
            "30da10e9-e3b4-4bed-a155-c59a388c5a7e",
            "aeff3432-62c7-4f9e-816f-fe6e3ba9c40e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "166e78ad-2bea-4314-8d8d-d2931228f117",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "2f6349c1-a05c-4fb5-bd48-48ecc26169ed",
          "name": "CHLORMEZANONE [HSDB]",
          "stdName": "CHLORMEZANONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30da10e9-e3b4-4bed-a155-c59a388c5a7e"
          ],
          "display_name": false
        },
        {
          "uuid": "90112c5d-5bdd-41a0-9405-0b3aa121e4b8",
          "name": "CHLORMEZANONE [JAN]",
          "stdName": "CHLORMEZANONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aeff3432-62c7-4f9e-816f-fe6e3ba9c40e"
          ],
          "display_name": false
        },
        {
          "uuid": "fb2513c1-bccb-4c79-bc14-e1081cf65a32",
          "name": "CHLORMEZANONE [MART.]",
          "stdName": "CHLORMEZANONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "651577be-7838-4461-9677-b535106ab144"
          ],
          "display_name": false
        },
        {
          "uuid": "a2608794-49fd-42e4-9cf4-92e7ca880fa0",
          "name": "CHLORMEZANONE [MI]",
          "stdName": "CHLORMEZANONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41da677d-2625-4198-81a6-25af28d7af78"
          ],
          "display_name": false
        },
        {
          "uuid": "d3c79102-9d73-432d-863f-86fe92bbe9e8",
          "name": "CHLORMEZANONE [ORANGE BOOK]",
          "stdName": "CHLORMEZANONE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6d109e2-9b27-405d-92ab-bfbdb30c2368"
          ],
          "display_name": false
        },
        {
          "uuid": "18f893ae-d6e0-47fa-a08e-993d48694472",
          "name": "CHLORMEZANONE [VANDF]",
          "stdName": "CHLORMEZANONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a98407a-06a4-480b-8322-aa126dd9463a"
          ],
          "display_name": false
        },
        {
          "uuid": "3e918666-a28a-f9f9-5008-8a3fefe802c7",
          "name": "Chlormezanone [WHO-DD]",
          "stdName": "CHLORMEZANONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5511494d-73ff-babb-3adc-c92cdc9f020f"
          ],
          "display_name": false
        },
        {
          "uuid": "66d41c7b-f65d-4e29-9044-9ea24b6377af",
          "name": "NSC-169108",
          "stdName": "NSC-169108",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c324af2-1c61-4164-8de5-be8b20c42699"
          ],
          "display_name": false
        },
        {
          "uuid": "83e6bb68-4af5-4c15-826f-9cba3cb49002",
          "name": "TRANCOPAL",
          "stdName": "TRANCOPAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6ec6953-3815-4a6a-bb93-eda583e3bdf9"
          ],
          "display_name": false
        },
        {
          "uuid": "6884d842-3c3e-46f5-b5e4-384c143301e8",
          "name": "chlormezanone [INN]",
          "stdName": "CHLORMEZANONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a80b3755-1d4c-4c6c-a875-03e72180ab28"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a6589200-ef17-40b8-9d3a-10f4edc5a752",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "55545c56-92f0-474b-a859-2ed7acea7982",
          "citation": "ACD9.0(USAN 2006)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6ec6953-3815-4a6a-bb93-eda583e3bdf9",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a80b3755-1d4c-4c6c-a875-03e72180ab28",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aeff3432-62c7-4f9e-816f-fe6e3ba9c40e",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6d109e2-9b27-405d-92ab-bfbdb30c2368",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "651577be-7838-4461-9677-b535106ab144",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41da677d-2625-4198-81a6-25af28d7af78",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30da10e9-e3b4-4bed-a155-c59a388c5a7e",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78339cb7-1546-45ab-bcc6-b04b98a8fdb6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a98407a-06a4-480b-8322-aa126dd9463a",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c324af2-1c61-4164-8de5-be8b20c42699",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c419d485-ce77-4248-885b-ca2f4961e4b2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390698000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "857d4b06-cbdf-45d5-85bd-d139cec2191c",
          "citation": "SRS import [GP568V9G19]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GP568V9G19",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390698000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92117947-e35e-4a86-9cdb-60e57104e3d9",
          "citation": "CHLORMEZANONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "afe5f53e-4202-430b-a52d-b862614775ac",
          "citation": "CHLORMEZANONE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "25fcf1ee-8558-458f-909d-eba945015613",
          "citation": "CHLORMEZANONE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad48b8b4-265a-4707-8481-6426ec49da97",
          "citation": "CHLORMEZANONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "974ffd0c-7178-4af5-a360-6910858f6bdb",
          "citation": "CHLORMEZANONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98e28019-83b1-4f13-9887-d6eca9034bd9",
          "citation": "CHLORMEZANONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5142fa72-35ac-4a4f-861c-d0435ab33679",
          "citation": "CHLORMEZANONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "84a0e6da-d092-478f-a9e0-66c603f24d31",
          "citation": "CHLORMEZANONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0b4eb1cf-319c-66b8-6865-aeacd3e25e15",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+80-77-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ec9f254c-5c3e-09ae-b7e6-d742facab4b6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80-77-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "763813fd-7450-0668-7ae5-6ddd58444d4a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "88f1ad86-8a71-4daa-b7eb-30d44491931b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "58401a06-c1c0-639a-4fb1-c62febdff23c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5511494d-73ff-babb-3adc-c92cdc9f020f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9cf9df19-2821-e40c-c2b7-2e4a9cf3289e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b082a086-870b-4d96-a6f2-89af24e7e240",
          "id": "b082a086-870b-4d96-a6f2-89af24e7e240",
          "molfile": "\n  Marvin  01132109092D          \n\n 17 18  0  0  0  0            999 V2000\n    2.4761   -3.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4839   -2.5874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2088   -2.1861    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.9161   -2.5978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6307   -2.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3406   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3484   -3.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0582   -3.8488    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.6255   -3.8358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9032   -3.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2010   -1.3597    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4863   -0.5773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0197   -1.5047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4942   -0.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7662   -1.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7636   -2.1680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0517   -2.5848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 16  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 11  1  0  0  0  0\n  5  4  1  0  0  0  0\n 10  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  2  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
          "smiles": "CN1C(=O)CCS(=O)(=O)C1c2ccc(cc2)Cl",
          "formula": "C11H12ClNO3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "571f4f06-dccb-4949-ad67-f6af283af802"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "273.7373",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "36f1de9d-1405-4c1b-b06a-5b6cf4b688de",
      "version": "12",
      "structure": {
        "id": "440e5352-d160-4b88-ad02-c9836b98d54f",
        "molfile": "\n  Marvin  01132103352D          \n\n 17 18  0  0  0  0            999 V2000\n    3.2008   -1.3596    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4837   -2.5872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2086   -2.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7635   -2.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7661   -1.3441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4940   -0.9350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4860   -0.5773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0194   -1.5046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9158   -2.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0516   -2.5846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9029   -3.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6304   -2.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4759   -3.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3480   -3.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3402   -2.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6252   -3.8355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0577   -3.8485    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8  1  2  0  0  0  0\n  3  9  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  9  2  0  0  0  0\n 12  9  1  0  0  0  0\n 13  2  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 12  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 14  1  0  0  0  0\n  2  4  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
        "smiles": "CN1C(=O)CCS(=O)(=O)C1c2ccc(cc2)Cl",
        "formula": "C11H12ClNO3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "273.7373",
        "optical_activity": "( + / - )",
        "references": [
          "a6589200-ef17-40b8-9d3a-10f4edc5a752",
          "857d4b06-cbdf-45d5-85bd-d139cec2191c",
          "a80b3755-1d4c-4c6c-a875-03e72180ab28"
        ],
        "stereo_centers": 1
      },
      "unii": "GP568V9G19"
    }
  ]
}