{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6c5b8536-d802-4ee0-82d9-ee39c58b514b",
          "code": "126094-21-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126094-21-1",
          "code_system": "CAS",
          "references": [
            "9af10cae-d8da-47f2-81ad-5afebf9d6ff6",
            "5e2bdb2b-17b8-47bf-8ca5-0a28ae42f5f1"
          ]
        },
        {
          "uuid": "148bff92-690c-42a4-ad62-dca7b2aba2e8",
          "code": "130850",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/130850",
          "code_system": "PUBCHEM",
          "references": [
            "9af10cae-d8da-47f2-81ad-5afebf9d6ff6"
          ]
        },
        {
          "uuid": "ea2ce44f-204b-b54f-3446-81166e8457b2",
          "code": "DTXSID90155078",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90155078",
          "code_system": "EPA CompTox",
          "references": [
            "65e825d8-1ed0-68d4-22a6-4275b1eb360b"
          ]
        },
        {
          "uuid": "99e5d611-26bc-a6d7-6920-2fa8f42380af",
          "code": "1862683",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1862683/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "b436c6d2-ed4c-4564-bb02-f33178b1a530",
          "code": "GON1S528TS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3eb46ed4-926e-70e3-7d15-d24f0151e86e",
          "code": "GON1S528TS",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=GON1S528TS",
          "code_system": "DAILYMED",
          "references": [
            "74aad845-3dfe-9359-bf0d-a0d04d6c489d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fe764884-3bf6-42cd-a6ca-96490e9b36eb",
          "name": "D-GLUCONAMIDE, N-(3-METHOXYPROPYL)-",
          "stdName": "D-GLUCONAMIDE, N-(3-METHOXYPROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6b9a26c-bbbe-457d-8c4e-5f864bd93754",
            "d99d0071-e001-42ce-9823-d0db09d5dbc5"
          ],
          "display_name": false
        },
        {
          "uuid": "b99b0dd3-f6b3-4c29-bef7-23733fab7d23",
          "name": "METHOXYPROPYLGLUCONAMIDE",
          "stdName": "METHOXYPROPYLGLUCONAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6b9a26c-bbbe-457d-8c4e-5f864bd93754",
            "3d5e1ed4-732d-4b30-bb45-a26a9f5e2303",
            "940907c5-eb66-4f12-9978-65d1d55886e7",
            "625c9ec8-3888-4727-b8d0-622767f8ab3d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "842c890b-88b0-4bca-9a80-41970f70e3cb",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "625c9ec8-3888-4727-b8d0-622767f8ab3d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3d5e1ed4-732d-4b30-bb45-a26a9f5e2303",
          "citation": "DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d99d0071-e001-42ce-9823-d0db09d5dbc5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6b9a26c-bbbe-457d-8c4e-5f864bd93754",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9af10cae-d8da-47f2-81ad-5afebf9d6ff6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1910f14a-3ce4-4ebd-b6d0-0010e944cc41",
          "citation": "SRS import [GON1S528TS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GON1S528TS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "940907c5-eb66-4f12-9978-65d1d55886e7",
          "citation": "METHOXYPROPYLGLUCONAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "65e825d8-1ed0-68d4-22a6-4275b1eb360b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126094-21-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5e2bdb2b-17b8-47bf-8ca5-0a28ae42f5f1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "74aad845-3dfe-9359-bf0d-a0d04d6c489d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e29e6563-55a0-4852-9853-ace57f291dae",
          "id": "e29e6563-55a0-4852-9853-ace57f291dae",
          "molfile": "\n  Marvin  01132111442D          \n\n 18 17  0  0  1  0            999 V2000\n   10.3554   -7.5118    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.3554   -8.3367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6410   -7.0993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9265   -7.5118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0699   -7.0993    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.0699   -6.2743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7844   -7.5118    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.7844   -8.3367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4988   -7.0993    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   12.4988   -6.2743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2133   -7.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2133   -8.3367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9277   -7.0993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6422   -7.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3566   -7.0993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0711   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7854   -7.0993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4999   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "COCCCNC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O",
          "formula": "C10H21NO7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bf1294bb-1c39-4df1-8a00-f00d13e02405"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "267.2767",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "57a5c580-ee39-4173-8017-3654392b34d1",
      "version": "6",
      "structure": {
        "id": "a58095fe-cd32-40b4-ad8f-ff150609bbd9",
        "molfile": "\n  Marvin  01132108362D          \n\n 18 17  0  0  1  0            999 V2000\n   11.7844   -7.5118    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.0699   -7.0993    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.3554   -7.5118    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.4988   -7.0993    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.7844   -8.3367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0699   -6.2743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3554   -8.3367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6410   -7.0993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9265   -7.5118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4988   -6.2743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2133   -7.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2133   -8.3367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9277   -7.0993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6422   -7.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3566   -7.0993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0711   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7854   -7.0993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4999   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  1  0  0  0\n  2  6  1  1  0  0  0\n  3  7  1  6  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  4 10  1  1  0  0  0\n  4 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "COCCCNC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O",
        "formula": "C10H21NO7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "267.2767",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d99d0071-e001-42ce-9823-d0db09d5dbc5",
          "1910f14a-3ce4-4ebd-b6d0-0010e944cc41"
        ],
        "stereo_centers": 4
      },
      "unii": "GON1S528TS"
    }
  ]
}