{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a6f71666-7f44-416a-b18d-a9a59deff241",
          "code": "GNC4MZ8B3Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1e479a07-c7c8-4eec-b871-0355f7b2b86b",
          "code": "70-40-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=70-40-6",
          "code_system": "CAS",
          "references": [
            "f17d6457-2f47-4678-aab9-ca4da9201a71",
            "6dbce84a-4408-484d-bd9f-8f6971e7b56f"
          ]
        },
        {
          "uuid": "43ff7b9c-31f7-4fa5-b611-58d506843f89",
          "code": "65559",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65559",
          "code_system": "PUBCHEM",
          "references": [
            "fda82875-b3ca-4716-9c02-38cbe8825b81"
          ]
        },
        {
          "uuid": "ec7780f6-aeca-72b2-379b-ae3ecdaccb1b",
          "code": "3,3'-Diiodothyronine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/3,3%27-Diiodothyronine",
          "code_system": "WIKIPEDIA",
          "references": [
            "f17d6457-2f47-4678-aab9-ca4da9201a71"
          ]
        },
        {
          "uuid": "c37b1276-f346-06ca-03dd-e2eb9e5bf0b8",
          "code": "DTXSID401018947",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401018947",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "4c3b3820-e58b-4e51-b70d-6e88a5ed653f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "53d24a4f-970d-4067-a152-81310763f994",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6dbce84a-4408-484d-bd9f-8f6971e7b56f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f17d6457-2f47-4678-aab9-ca4da9201a71",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fda82875-b3ca-4716-9c02-38cbe8825b81",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "59412098-45df-4928-bd53-492aad8bdd0e",
          "id": "59412098-45df-4928-bd53-492aad8bdd0e",
          "molfile": "\n  Marvin  01132104382D          \n\n 22 23  0  0  0  0            999 V2000\n    0.5846   -2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1299   -2.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1299   -3.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8444   -3.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5846   -3.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8444   -2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8444   -1.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1299   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1299   -0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5846    0.3750    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8444    0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8444    1.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1299    1.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5846    1.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2990    1.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2990    2.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0135    2.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5846    2.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5846    3.6750    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1299    2.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5588   -0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5588   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 22  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 21  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 20  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 22  2  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1CC(C(=O)O)N)I)Oc2ccc(c(c2)I)O",
          "formula": "C15H13I2NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a17a01c3-3d94-42ac-bcf1-fd25c3f18d66"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "525.0775",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "469f5eef-ba80-4467-8256-966222718039",
      "version": "10",
      "structure": {
        "id": "c545525d-df9c-4192-aaa6-6f7fa67870ef",
        "molfile": "\n  Marvin  01132110122D          \n\n 22 23  0  0  0  0            999 V2000\n   11.3025   -6.6001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5880   -7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5880   -7.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8735   -8.2501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3025   -8.2501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8735   -6.6001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8735   -5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5880   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5880   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3025   -4.1250    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8735   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8735   -3.3001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5880   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3025   -3.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0169   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0169   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7314   -1.6501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3025   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3025   -0.8250    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5880   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1591   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1591   -5.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 13 20  1  0  0  0  0\n 11 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n  7 22  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1CC(C(=O)O)N)I)Oc2ccc(c(c2)I)O",
        "formula": "C15H13I2NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "525.0775",
        "optical_activity": "( + / - )",
        "references": [
          "f17d6457-2f47-4678-aab9-ca4da9201a71",
          "6dbce84a-4408-484d-bd9f-8f6971e7b56f"
        ],
        "stereo_centers": 1
      },
      "unii": "GNC4MZ8B3Q",
      "relationships": [
        {
          "uuid": "d0797f67-1c6e-4421-b3f9-2f344bdf3c28",
          "amount": {
            "uuid": "8ab0a39a-9ff3-4998-802d-563fe064e1cf"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "35688464-5c6a-4dc0-b9fb-4c1c86bbed56",
            "refuuid": "645098b2-57ed-4144-af4f-f50c9e6dcf79",
            "name": "3,3'-DIIODOTHYRONINE, L-",
            "unii": "3L9U2Z4602",
            "linking_id": "3L9U2Z4602",
            "ref_pname": "3,3'-DIIODOTHYRONINE, L-",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "b88807ea-03ca-4386-b45d-83ae9d2582b8",
          "name": "(±)-O-(4-HYDROXY-3-IODOPHENYL)-3-IODOTYROSINE",
          "stdName": "(+/-)-O-(4-HYDROXY-3-IODOPHENYL)-3-IODOTYROSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53d24a4f-970d-4067-a152-81310763f994"
          ],
          "display_name": false
        },
        {
          "uuid": "b7845672-36d1-4c39-adc2-de0f90755d41",
          "name": "3,3'-DIIODOTHYRONINE, DL-",
          "stdName": "3,3'-DIIODOTHYRONINE, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f17d6457-2f47-4678-aab9-ca4da9201a71"
          ],
          "display_name": true
        },
        {
          "uuid": "9eaf0889-7ecd-490d-8461-0f162106b4c6",
          "name": "DL-ALANINE, 3-(4-(4-HYDROXY-3-IODOPHENOXY)-3-IODOPHENYL)-",
          "stdName": "DL-ALANINE, 3-(4-(4-HYDROXY-3-IODOPHENOXY)-3-IODOPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c3b3820-e58b-4e51-b70d-6e88a5ed653f"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "72b24e81-5381-4b6c-b2ce-2812a62a644b"
      }
    }
  ]
}