{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1f6743c5-8a7c-4109-aea6-9840209e6175", "code": "106246-33-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=106246-33-7", "code_system": "CAS", "references": [ "4a8008ef-7840-4ca5-afac-8114a1f07507", "22147e49-f635-4e16-bb32-141c82a33e57" ] }, { "uuid": "c0daf579-4a2c-4102-975a-86e4092c0c44", "code": "86261", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86261", "code_system": "PUBCHEM", "references": [ "4a8008ef-7840-4ca5-afac-8114a1f07507" ] }, { "uuid": "801b4808-4c43-9055-8c50-c94854f1b414", "code": "DTXSID0073031", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0073031", "code_system": "EPA CompTox", "references": [ "a534af78-8fd5-0100-b9b3-692f760240ad" ] }, { "uuid": "a4931a76-4570-49b0-92b6-284d860b8d5c", "code": "GN49RAR5P2", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "05f98413-39b1-4778-9b08-993ccc505dfb", "name": "4,4′-Methylenebis[3-chloro-2,6-diethylbenzenamine]", "stdName": "4,4'-METHYLENEBIS(3-CHLORO-2,6-DIETHYLBENZENAMINE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "22147e49-f635-4e16-bb32-141c82a33e57" ], "display_name": true }, { "uuid": "e1e069d6-17e8-46a7-8338-c4022bc12af3", "name": "Benzenamine, 4,4'-methylenebis(3-chloro-2,6-diethyl-", "stdName": "BENZENAMINE, 4,4'-METHYLENEBIS(3-CHLORO-2,6-DIETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7b2f5938-601d-4494-9402-3b818e88dc5e", "bf44437c-758a-48c6-8e18-cf398b7a1786" ], "display_name": false } ], "references": [ { "uuid": "bf44437c-758a-48c6-8e18-cf398b7a1786", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7b2f5938-601d-4494-9402-3b818e88dc5e", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4a8008ef-7840-4ca5-afac-8114a1f07507", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393330000, "tags": [ "NOMEN" ] }, { "uuid": "f5c80820-f027-48b5-9cf9-dbf0496ce519", "citation": "CHEMID RECORD 106246-33-7", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a534af78-8fd5-0100-b9b3-692f760240ad", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=106246-33-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "22147e49-f635-4e16-bb32-141c82a33e57", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "84aeee43-238e-4105-9a0a-0e179d1ab299", "id": "84aeee43-238e-4105-9a0a-0e179d1ab299", "molfile": "\n Marvin 01132106532D \n\n 25 26 0 0 0 0 999 V2000\n 3.7039 -4.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9872 -3.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9826 -2.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6916 -2.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6874 -1.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3994 -1.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1163 -1.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1201 -2.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8316 -2.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8332 -3.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5486 -4.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5474 -2.3593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2633 -2.7692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5436 -1.5343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2557 -1.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2512 -0.2927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8239 -1.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8181 -0.3001 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9700 -1.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9634 -0.3171 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2568 -1.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5384 -1.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8280 -1.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2652 -2.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5542 -2.8018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 24 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 19 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 17 2 0 0 0 0\n 9 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 12 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 2 0 0 0 0\n 14 15 1 0 0 0 0\n 17 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 19 2 0 0 0 0\n 21 22 1 0 0 0 0\n 24 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CCc1cc(Cc2cc(CC)c(c(CC)c2Cl)N)c(c(CC)c1N)Cl", "formula": "C21H28Cl2N2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ee985a4f-c5c1-4a6c-9ca1-b307a2203275" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "379.3671", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "d818971e-01bf-47b7-b87e-a77bfe83f995", "version": "5", "structure": { "id": "61bdb5eb-a287-4d49-bd64-4c3f29fbb398", "molfile": "\n Marvin 01132105042D \n\n 25 26 0 0 0 0 999 V2000\n 7.2633 -2.7692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5474 -2.3593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8316 -2.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1201 -2.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1163 -1.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8239 -1.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5436 -1.5343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2557 -1.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2512 -0.2927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8181 -0.3001 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3994 -1.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6874 -1.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6916 -2.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9826 -2.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2652 -2.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2568 -1.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9700 -1.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9634 -0.3171 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5384 -1.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8280 -1.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5542 -2.8018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9872 -3.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7039 -4.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8332 -3.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5486 -4.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 2 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 6 10 1 0 0 0 0\n 5 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 12 2 0 0 0 0\n 17 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 15 21 1 0 0 0 0\n 14 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 3 24 1 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CCc1cc(Cc2cc(CC)c(c(CC)c2Cl)N)c(c(CC)c1N)Cl", "formula": "C21H28Cl2N2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "379.3671", "optical_activity": "NONE", "references": [ "f5c80820-f027-48b5-9cf9-dbf0496ce519" ], "stereo_centers": 0 }, "unii": "GN49RAR5P2" } ] }