{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2d9982e5-c037-49b2-aead-f4bb24e17dc9", "code": "139033637", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/139033637", "code_system": "PUBCHEM", "references": [ "3a455b1d-6360-4e5e-81ab-9017d9dc7a89" ] }, { "uuid": "74d7a317-a886-4333-9810-9dc1ed7785b7", "code": "2253964-52-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2253964-52-0", "code_system": "CAS", "references": [ "1e0b3e9e-75a9-4e6d-9e70-b6481184a9a7", "9c1f0ba9-6fe1-4cab-807f-b11d9678c9e6" ] }, { "uuid": "a2c1bd97-f3c0-464a-4dbb-3c27dde7e8d8", "code": "MCPO", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/MCPO", "code_system": "WIKIPEDIA", "references": [ "1e0b3e9e-75a9-4e6d-9e70-b6481184a9a7" ] }, { "uuid": "aae52df2-8f6f-472b-a0c1-2e2f5eae66a3", "code": "GK28JNK336", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a54f3809-b0d2-88c3-a61c-0fe3257ad020", "code": "DTXSID901350156", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901350156", "code_system": "EPA CompTox", "references": [ "1d2ea746-b8e1-36e6-c859-c4b6bc48d563" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0fe3d08f-b3f2-4eb8-8c75-b2fd52f295b4", "name": "Bis[2-(methoxycarbonyl)phenyl] oxalate", "stdName": "BIS(2-(METHOXYCARBONYL)PHENYL) OXALATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1e0b3e9e-75a9-4e6d-9e70-b6481184a9a7", "73b31d1a-7181-4dd4-b467-2b62e00bd3e1" ], "display_name": false }, { "uuid": "a9a1382a-b3e5-48b8-bd69-97251a6a75c4", "name": "MCPO", "stdName": "MCPO", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1e0b3e9e-75a9-4e6d-9e70-b6481184a9a7" ], "display_name": true } ], "references": [ { "uuid": "1e0b3e9e-75a9-4e6d-9e70-b6481184a9a7", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3a455b1d-6360-4e5e-81ab-9017d9dc7a89", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9c1f0ba9-6fe1-4cab-807f-b11d9678c9e6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "73b31d1a-7181-4dd4-b467-2b62e00bd3e1", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1d2ea746-b8e1-36e6-c859-c4b6bc48d563", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d30bfb74-0b16-45d1-97cc-42bfafc898fb", "id": "d30bfb74-0b16-45d1-97cc-42bfafc898fb", "molfile": "\n Marvin 06092207452D \n\n 26 27 0 0 0 0 999 V2000\n 2.1434 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7157 3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 15 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 3 6 2 0 0 0 0\n 5 21 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 7 16 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 11 22 1 0 0 0 0\n 12 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 18 20 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 2 0 0 0 0\n 24 26 2 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "COC(=O)c1ccccc1OC(=O)C(=O)Oc2ccccc2C(=O)OC", "formula": "C18H14O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0c19f610-c91c-476e-9ab4-c906e006a8c7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "358.2997", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "757383e0-8710-417f-9241-b98e52ba85da", "version": "8", "structure": { "id": "129caa95-a62e-4a95-b61a-77a966359e56", "molfile": "\n JSDraw206092207452D\n\n 26 27 0 0 0 0 0 V2000\n 22.5175 -7.3060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8685 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2195 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8685 -9.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5705 -8.0860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2195 -5.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8156 -5.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4646 -4.9660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1666 -4.9660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4646 -3.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2724 -9.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6234 -10.4260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9215 -10.4260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6234 -11.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1666 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8156 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1666 -9.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4646 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8156 -10.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4646 -9.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9215 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2724 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9215 -5.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6234 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2724 -4.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6234 -5.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 15 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 3 6 2 0 0 0 0\n 5 21 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 7 16 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 11 22 1 0 0 0 0\n 12 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 18 20 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 2 0 0 0 0\n 24 26 2 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "COC(=O)c1ccccc1OC(=O)C(=O)Oc2ccccc2C(=O)OC", "formula": "C18H14O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "358.2997", "optical_activity": "NONE", "references": [ "1e0b3e9e-75a9-4e6d-9e70-b6481184a9a7" ], "stereo_centers": 0 }, "unii": "GK28JNK336" } ] }