{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9a81d1e0-1a4e-4fb4-a9a1-65f0726fc26c",
          "code": "877-24-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=877-24-7",
          "code_system": "CAS",
          "references": [
            "0f4146b7-9504-4168-8f96-6a6349f0029b",
            "2d224d20-2003-4086-84a2-27f59e2f79fd"
          ]
        },
        {
          "uuid": "a3e2535e-9169-4acf-8a98-c755afd6f124",
          "code": "212-889-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.718",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0f4146b7-9504-4168-8f96-6a6349f0029b"
          ]
        },
        {
          "uuid": "efda506d-e9cb-4df8-b279-39049c526e88",
          "code": "m9003",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9003?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0f4146b7-9504-4168-8f96-6a6349f0029b"
          ]
        },
        {
          "uuid": "8650fd4f-e732-4374-9f16-182927cdaa65",
          "code": "SUB20406",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0f4146b7-9504-4168-8f96-6a6349f0029b"
          ]
        },
        {
          "uuid": "faa98e24-a795-9165-a009-93481e0d1b54",
          "code": "DTXSID0042167",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0042167",
          "code_system": "EPA CompTox",
          "references": [
            "417511b1-dea9-4598-4b45-cd522bc9fe0a"
          ]
        },
        {
          "uuid": "4052c855-3602-44c8-b3e6-155f2f96cfab",
          "code": "GG9121M623",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "37eb41dc-3e63-9392-8281-5ce79224f41e",
          "code": "Potassium hydrogen phthalate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Potassium_hydrogen_phthalate",
          "code_system": "WIKIPEDIA",
          "references": [
            "8de12e07-ad27-6a5d-23a9-4bfbe2c233c6"
          ]
        },
        {
          "uuid": "a552b0f9-b62e-338e-3a29-5812a71e9e01",
          "code": "21225612",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21225612",
          "code_system": "PUBCHEM",
          "references": [
            "1f4889d5-ec66-4ad9-7053-b41774c88dce"
          ]
        },
        {
          "uuid": "9f9b9e17-9171-7f61-8b60-ddbbb2a431e7",
          "code": "100000085360",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "34a0d000-8f32-1692-edc7-a026c3930da3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "31fad2f8-9d8f-41f0-8240-e421d3365dbf",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a4041589-9a5e-4276-a31e-d6d174e309a9",
            "refuuid": "3ded9d27-53dd-4ad7-8687-32354f7876b3",
            "name": "Phthalic acid",
            "unii": "6O7F7IX66E",
            "linking_id": "6O7F7IX66E",
            "ref_pname": "Phthalic acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d92fe95e-da01-4b12-96a0-f79546659be9",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, POTASSIUM SALT (1:1)",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, POTASSIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7d66e30-3a6f-4490-9fa4-3cf13a95307d",
            "9e00fce1-0cbd-439b-a038-8f7c0c22a582"
          ],
          "display_name": false
        },
        {
          "uuid": "74313b05-f672-4725-862a-722c4bc44585",
          "name": "MONOPOTASSIUM PHTHALATE",
          "stdName": "MONOPOTASSIUM PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7d66e30-3a6f-4490-9fa4-3cf13a95307d",
            "76c0f38d-3259-4f9a-b66e-1d6b968b0303"
          ],
          "display_name": false
        },
        {
          "uuid": "6cfc3aba-d9d4-4b0f-8381-785f545ea643",
          "name": "POTASSIUM BIPHTHALATE",
          "stdName": "POTASSIUM BIPHTHALATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16bde324-6294-43fa-af61-4cc10fba04b6",
            "87f28cae-dc5d-473a-b29e-54acd893fd85",
            "a7d66e30-3a6f-4490-9fa4-3cf13a95307d",
            "278718dc-73b8-4286-b637-568acaeaa2c6",
            "0604a85c-2be6-41f3-b15c-ce716fab78bc",
            "62250387-7bf5-4a75-ad70-5f2555155056"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8efb6789-ae1f-4947-92b4-c4fa7ec48223",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4fd95082-f7c6-4e2e-b7ac-5de505eecb1f",
          "name": "POTASSIUM BIPHTHALATE [MI]",
          "stdName": "POTASSIUM BIPHTHALATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87f28cae-dc5d-473a-b29e-54acd893fd85",
            "a7d66e30-3a6f-4490-9fa4-3cf13a95307d"
          ],
          "display_name": false
        },
        {
          "uuid": "7dab5690-3825-4ef6-bac5-cc8adf33e7a9",
          "name": "POTASSIUM PHTHALATE MONOBASIC",
          "stdName": "POTASSIUM PHTHALATE MONOBASIC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16bde324-6294-43fa-af61-4cc10fba04b6",
            "a7d66e30-3a6f-4490-9fa4-3cf13a95307d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "16bde324-6294-43fa-af61-4cc10fba04b6",
          "citation": "http://www.scbt.com/datasheet-203363-potassium-phthalate-monobasic.html",
          "url": "http://www.scbt.com/datasheet-203363-potassium-phthalate-monobasic.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a7d66e30-3a6f-4490-9fa4-3cf13a95307d",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87f28cae-dc5d-473a-b29e-54acd893fd85",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e00fce1-0cbd-439b-a038-8f7c0c22a582",
          "citation": "http://www.lookchem.com/cas-877/877-24-7.html",
          "url": "http://www.lookchem.com/cas-877/877-24-7.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0604a85c-2be6-41f3-b15c-ce716fab78bc",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76c0f38d-3259-4f9a-b66e-1d6b968b0303",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f4146b7-9504-4168-8f96-6a6349f0029b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389698000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4efcc709-6364-4627-9025-62f9324fb755",
          "citation": "SRS import [GG9121M623]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GG9121M623",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389698000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62250387-7bf5-4a75-ad70-5f2555155056",
          "citation": "POTASSIUM BIPHTHALATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "278718dc-73b8-4286-b637-568acaeaa2c6",
          "citation": "POTASSIUM BIPHTHALATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "417511b1-dea9-4598-4b45-cd522bc9fe0a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=877-24-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8de12e07-ad27-6a5d-23a9-4bfbe2c233c6",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "1f4889d5-ec66-4ad9-7053-b41774c88dce",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "2d224d20-2003-4086-84a2-27f59e2f79fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "34a0d000-8f32-1692-edc7-a026c3930da3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "92fccacc-9550-4261-ab21-3c5505b83532",
          "id": "92fccacc-9550-4261-ab21-3c5505b83532",
          "molfile": "\n  Marvin  01132107372D          \n\n  1  0  0  0  0  0            999 V2000\n    0.0000   -1.3084    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b6190c38-cfe2-4156-b592-0906dc095bfd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a28e2667-f440-4f7d-8dca-d46a769087c8",
          "id": "a28e2667-f440-4f7d-8dca-d46a769087c8",
          "molfile": "\n  Marvin  01132108272D          \n\n 12 12  0  0  0  0            999 V2000\n    2.4221   -3.3125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4221   -2.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7160   -2.0638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1412   -2.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8499   -2.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5898   -2.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5898   -1.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8499   -0.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1412   -1.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4221   -0.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7160   -1.2487    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4221    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  CHG  1  11  -1\nM  END",
          "smiles": "c1ccc(c(c1)C(=O)O)C(=O)[O-]",
          "formula": "C8H5O4",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "24e1429a-1d0e-4a03-8998-c132c3785eb7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "165.1232",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bef28d71-dd22-4684-9595-17a6b7170a73",
      "version": "8",
      "structure": {
        "id": "2b351148-e837-4c58-875e-c1003c93e442",
        "molfile": "\n  Marvin  01132102202D          \n\n 13 12  0  0  0  0            999 V2000\n    3.1412   -1.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1412   -2.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4221   -0.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4221   -2.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7160   -1.2487    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4221    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4221   -3.3125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7160   -2.0638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8499   -0.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8499   -2.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5898   -2.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5898   -1.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.3084    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  4  2  0  0  0  0\n  8  4  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  9  2  0  0  0  0\n 11 10  2  0  0  0  0\nM  CHG  2   5  -1  13   1\nM  END",
        "smiles": "c1ccc(c(c1)C(=O)O)C(=O)[O-].[K+]",
        "formula": "C8H5O4.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "204.2215",
        "optical_activity": "NONE",
        "references": [
          "16bde324-6294-43fa-af61-4cc10fba04b6",
          "4efcc709-6364-4627-9025-62f9324fb755"
        ],
        "stereo_centers": 0
      },
      "unii": "GG9121M623"
    }
  ]
}