{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "96476343-ca2b-4f52-8897-6d92e3e4bb68",
          "code": "272451-65-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=272451-65-7",
          "code_system": "CAS",
          "references": [
            "01870895-9bf5-448f-b5a1-3abe9a10fc11",
            "2b1bcfb7-77e4-4748-be17-d844917f7394"
          ]
        },
        {
          "uuid": "c16278c9-489a-4b6d-9c21-e0ccb05aeae2",
          "code": "27602",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2387",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "01870895-9bf5-448f-b5a1-3abe9a10fc11"
          ]
        },
        {
          "uuid": "358f52c4-0849-4b26-aea2-68d3bed88c8d",
          "code": "m5420",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5420?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "01870895-9bf5-448f-b5a1-3abe9a10fc11"
          ]
        },
        {
          "uuid": "c168fab0-1e01-4508-8cd3-d4731bcd4eef",
          "code": "11193251",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11193251",
          "code_system": "PUBCHEM",
          "references": [
            "01870895-9bf5-448f-b5a1-3abe9a10fc11"
          ]
        },
        {
          "uuid": "3a99a51c-5366-d505-d175-59c27462d9cb",
          "code": "7883",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7883",
          "code_system": "HSDB",
          "references": [
            "841fb823-ac02-8464-6e0d-b421843ee1c0"
          ]
        },
        {
          "uuid": "ea7ebd5e-e44e-8b1e-c499-a5add72e8381",
          "code": "DTXSID4047672",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4047672",
          "code_system": "EPA CompTox",
          "references": [
            "75ca65b7-963b-6e17-db85-0e0af14c7aae"
          ]
        },
        {
          "uuid": "42e4b004-1c00-4c11-b2c8-f5418110ed19",
          "code": "GEV84ZI4K6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ff22d1e1-1e4d-4639-4462-ce5ae2a3a034",
          "code": "4986",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4986",
          "code_system": "CHEBI",
          "references": [
            "d8692094-e8ba-aeda-cf16-b550f5710b6d"
          ]
        },
        {
          "uuid": "e098e2c1-b735-9b52-249a-a75b7d56b803",
          "code": "38798",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38798",
          "code_system": "CHEBI",
          "references": [
            "d8692094-e8ba-aeda-cf16-b550f5710b6d"
          ]
        },
        {
          "uuid": "c31e34cf-50d6-da56-b795-e740610abb96",
          "code": "Flubendiamide",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Flubendiamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "a9174119-cf98-1c9f-8ed9-0513db0293a2"
          ]
        },
        {
          "uuid": "2cdf5d60-edc0-f1ef-14b3-a80e8a9226fe",
          "code": "flubendiamide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/flubendiamide.html",
          "code_system": "ALANWOOD",
          "references": [
            "d038f16a-6731-8385-3c1b-234d5ac6d772"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf866497-5746-494e-b571-b81a171751f8",
          "name": "1,2-BENZENEDICARBOXAMIDE, N2-(1,1-DIMETHYL-2-(METHYLSULFONYL)ETHYL)-3-IODO-N1-(2-METHYL-4-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)PHENYL)-",
          "stdName": "1,2-BENZENEDICARBOXAMIDE, N2-(1,1-DIMETHYL-2-(METHYLSULFONYL)ETHYL)-3-IODO-N1-(2-METHYL-4-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "cdb57e93-0692-4e68-8475-01abf8c701d6"
          ],
          "display_name": false
        },
        {
          "uuid": "cf258d59-6b91-45e5-b98c-596d8dee380a",
          "name": "3-IODO-N'-(2-MESYL-1,1-DIMETHYLETHYL)-N-(4-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)-O-TOLYL)PHTHALAMIDE",
          "stdName": "3-IODO-N'-(2-MESYL-1,1-DIMETHYLETHYL)-N-(4-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)-O-TOLYL)PHTHALAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a713bc6-5df3-4835-ad96-0ecd9c3c3744",
            "2ada3d19-605f-4dcc-a680-5a02d910503c"
          ],
          "display_name": false
        },
        {
          "uuid": "69dcf407-3ee6-44b1-be0a-a8749579281b",
          "name": "3-IODO-N1-(2-MESYL-1,1-DIMETHYLETHYL)-N-(4-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)-O-TOLYL)PHTHALAMIDE",
          "stdName": "3-IODO-N1-(2-MESYL-1,1-DIMETHYLETHYL)-N-(4-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)-O-TOLYL)PHTHALAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "ae8ed508-743a-418f-ab4c-e27f19172d65"
          ],
          "display_name": false
        },
        {
          "uuid": "e7669962-ce80-468f-aafa-76a487335188",
          "name": "BELT",
          "stdName": "BELT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "984d0786-ea26-4851-bcc4-f443e86a636a"
          ],
          "display_name": false
        },
        {
          "uuid": "381965ff-5378-4549-a516-59488f781170",
          "name": "FAME",
          "stdName": "FAME",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "984d0786-ea26-4851-bcc4-f443e86a636a"
          ],
          "display_name": false
        },
        {
          "uuid": "4ef5e161-54d3-40a7-b569-5f1a749bcf65",
          "name": "FENOS",
          "stdName": "FENOS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "984d0786-ea26-4851-bcc4-f443e86a636a"
          ],
          "display_name": false
        },
        {
          "uuid": "36e01573-06f5-45fb-b99a-871b4b12f47d",
          "name": "FLUBENDIAMIDE",
          "stdName": "FLUBENDIAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "0f76c987-01ff-4351-8795-97d5698a80c1",
            "ed45bc09-855e-4928-9d5b-143edb374f3b",
            "609432f1-e634-4535-937c-9ced522f2bc2",
            "4d3df97f-a447-45dc-b25b-883e42a52131",
            "08742ba8-804f-47b9-a159-c402f9ae3448"
          ],
          "display_name": true
        },
        {
          "uuid": "b5baa2af-7a0f-407d-b2c3-3ce8329b2375",
          "name": "FLUBENDIAMIDE [ISO]",
          "stdName": "FLUBENDIAMIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "08742ba8-804f-47b9-a159-c402f9ae3448"
          ],
          "display_name": false
        },
        {
          "uuid": "ca31fcb8-6bb6-4601-b6da-6acb4b80d462",
          "name": "FLUBENDIAMIDE [MI]",
          "stdName": "FLUBENDIAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "0f76c987-01ff-4351-8795-97d5698a80c1"
          ],
          "display_name": false
        },
        {
          "uuid": "65e1b481-8896-4321-8404-b05f6995584c",
          "name": "N(SUP 2)-(1,1-DIMETHYL-2-(METHYLSULFONYL)ETHYL)-3-IODO-N(SUP 1)-(2-METHYL-4-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)PHENYL)-1,2-BENZENEDICARBOXAMIDE",
          "stdName": "N(SUP 2)-(1,1-DIMETHYL-2-(METHYLSULFONYL)ETHYL)-3-IODO-N(SUP 1)-(2-METHYL-4-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)PHENYL)-1,2-BENZENEDICARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a713bc6-5df3-4835-ad96-0ecd9c3c3744",
            "731f0e97-1c8d-42b3-9b12-5990bac7c33f"
          ],
          "display_name": false
        },
        {
          "uuid": "94f7df28-2821-4d97-9761-27aa81aabc0d",
          "name": "NNI-0001",
          "stdName": "NNI-0001",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "ae8ed508-743a-418f-ab4c-e27f19172d65"
          ],
          "display_name": false
        },
        {
          "uuid": "90d548c1-52ea-43be-adc6-00ebaaedb4be",
          "name": "SYNAPSE",
          "stdName": "SYNAPSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
            "984d0786-ea26-4851-bcc4-f443e86a636a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "609432f1-e634-4535-937c-9ced522f2bc2",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6a713bc6-5df3-4835-ad96-0ecd9c3c3744",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ada3d19-605f-4dcc-a680-5a02d910503c",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "731f0e97-1c8d-42b3-9b12-5990bac7c33f",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f76c987-01ff-4351-8795-97d5698a80c1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b16ad4a6-21f5-45b2-a29a-76e3a22523df",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae8ed508-743a-418f-ab4c-e27f19172d65",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "984d0786-ea26-4851-bcc4-f443e86a636a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdb57e93-0692-4e68-8475-01abf8c701d6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08742ba8-804f-47b9-a159-c402f9ae3448",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01870895-9bf5-448f-b5a1-3abe9a10fc11",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36344b8a-d76c-4258-a744-c8c1a32b7781",
          "citation": "SRS import [GEV84ZI4K6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GEV84ZI4K6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd72b86b-a3e7-43e9-81a1-d6be6dc3d9a2",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed45bc09-855e-4928-9d5b-143edb374f3b",
          "citation": "FLUBENDIAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d3df97f-a447-45dc-b25b-883e42a52131",
          "citation": "FLUBENDIAMIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "841fb823-ac02-8464-6e0d-b421843ee1c0",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+272451-65-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "75ca65b7-963b-6e17-db85-0e0af14c7aae",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=272451-65-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a9174119-cf98-1c9f-8ed9-0513db0293a2",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "d038f16a-6731-8385-3c1b-234d5ac6d772",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "2b1bcfb7-77e4-4748-be17-d844917f7394",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d8692094-e8ba-aeda-cf16-b550f5710b6d",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "16d45c6f-38dc-443d-ab76-0b043d36a72d",
          "id": "16d45c6f-38dc-443d-ab76-0b043d36a72d",
          "molfile": "\n  Marvin  01132101232D          \n\n 38 39  0  0  0  0            999 V2000\n    4.9459   -4.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6612   -4.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6612   -3.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3718   -2.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0938   -3.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0938   -4.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3766   -4.5473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3810   -5.3683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3810   -6.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0934   -6.6087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6687   -6.6107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9610   -6.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2470   -6.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2470   -7.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9599   -7.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9599   -8.6698    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6687   -7.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3810   -7.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0934   -7.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3810   -8.6685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0959   -9.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0959   -9.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3564   -8.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8064   -8.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5214   -9.0805    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2363   -9.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2363   -8.6685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5214   -9.9043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3718   -2.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0856   -1.6534    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6554   -1.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6554   -0.8342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9419   -2.0724    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2368   -1.0729    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1698   -2.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9512   -2.2792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7512   -1.6939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6073   -2.8427    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4 29  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\n 25 28  2  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 29 35  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n 31 34  1  0  0  0  0\n 35 36  1  0  0  0  0\n 35 37  1  0  0  0  0\n 35 38  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(ccc1NC(=O)c2cccc(c2C(=O)NC(C)(C)CS(=O)(=O)C)I)C(C(F)(F)F)(C(F)(F)F)F",
          "formula": "C23H22F7IN2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eea387b3-83ef-41a9-b61b-3d7ab9c6849a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "682.392",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "64adcf95-1b8f-4de1-97ef-a3b21f3a0b8d",
      "version": "8",
      "structure": {
        "id": "2f553c4f-0475-4eff-bd43-7371a920b090",
        "molfile": "\n  Marvin  01132102322D          \n\n 38 39  0  0  0  0            999 V2000\n    8.5214   -9.0805    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2363   -9.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8064   -8.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0959   -9.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3810   -8.6685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3810   -7.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0934   -7.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6687   -7.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9599   -7.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2470   -7.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2470   -6.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9610   -6.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6687   -6.6107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3810   -6.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0934   -6.6087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3810   -5.3683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3766   -4.5473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6612   -4.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9459   -4.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6612   -3.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3718   -2.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3718   -2.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0856   -1.6534    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6554   -1.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6554   -0.8342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9419   -2.0724    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2368   -1.0729    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1698   -2.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9512   -2.2792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7512   -1.6939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6073   -2.8427    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0938   -3.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0938   -4.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9599   -8.6698    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0959   -9.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3564   -8.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2363   -8.6685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5214   -9.9043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 22 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 28 31  1  0  0  0  0\n 32 21  2  0  0  0  0\n 33 32  1  0  0  0  0\n 17 33  2  0  0  0  0\n  8 13  2  0  0  0  0\n  9 34  1  0  0  0  0\n  4 35  1  0  0  0  0\n  4 36  1  0  0  0  0\n  1 37  2  0  0  0  0\n  1 38  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(ccc1NC(=O)c2cccc(c2C(=O)NC(C)(C)CS(=O)(=O)C)I)C(C(F)(F)F)(C(F)(F)F)F",
        "formula": "C23H22F7IN2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "682.392",
        "optical_activity": "NONE",
        "references": [
          "36344b8a-d76c-4258-a744-c8c1a32b7781",
          "fd72b86b-a3e7-43e9-81a1-d6be6dc3d9a2"
        ],
        "stereo_centers": 0
      },
      "unii": "GEV84ZI4K6"
    }
  ]
}