{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6624f70c-4213-43f4-a873-497f6789128b", "code": "3520-72-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3520-72-7", "code_system": "CAS", "references": [ "9e74a98a-39ee-464e-a246-e16ed7135aff", "7b29dfaf-843b-4834-8f36-793f8ce7d446" ] }, { "uuid": "1e74e343-7d9b-4aec-b4e3-e8634df42f3a", "code": "222-530-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.483", "code_system": "ECHA (EC/EINECS)", "references": [ "9e74a98a-39ee-464e-a246-e16ed7135aff" ] }, { "uuid": "c282c237-3391-46d1-6d2d-506332f02445", "code": "DTXSID6052031", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6052031", "code_system": "EPA CompTox", "references": [ "5078d299-f3de-32f8-1ad2-6e1a607bf9fa" ] }, { "uuid": "0c413a4a-89f0-464e-b5f3-b060ef489666", "code": "GDF7BXQ79T", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c7e6740d-ad76-ad5b-6d03-94c59dd69b54", "code": "Pigment Orange 13", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pigment_Orange_13", "code_system": "WIKIPEDIA", "references": [ "f2c06e0e-99d8-89a6-ed65-3aa94ee16d11" ] } ], "substance_class": "chemical", "names": [ { "uuid": "79bb105a-ca23-4583-9eb2-75c6ca7cf9f3", "name": "3H-PYRAZOL-3-ONE, 4,4'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'- DIYL)BIS(AZO))BIS(2,4-DIHYDRO-5-METHYL-2-PHENYL-", "stdName": "3H-PYRAZOL-3-ONE, 4,4'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'- DIYL)BIS(AZO))BIS(2,4-DIHYDRO-5-METHYL-2-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b8a148a7-218a-41fc-9905-6f0a6713a70e" ], "display_name": false }, { "uuid": "11086f8d-faf7-4f7d-953e-03e7b36a0463", "name": "3H-PYRAZOL-3-ONE, 4,4'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(2,4-DIHYDRO-5-METHYL-2-PHENYL-", "stdName": "3H-PYRAZOL-3-ONE, 4,4'-((3,3'-DICHLORO(1,1'-BIPHENYL)-4,4'-DIYL)BIS(2,1-DIAZENEDIYL))BIS(2,4-DIHYDRO-5-METHYL-2-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b47decf-859b-4eda-a875-9963942a2e93" ], "display_name": false }, { "uuid": "770a1236-9adc-4da7-b529-7603f28b95e7", "name": "BENZIDINE ORANGE", "stdName": "BENZIDINE ORANGE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7556e5d9-00e8-4f05-a435-0e03b0b0d3bc" ], "display_name": false }, { "uuid": "3a9fd57c-b235-49d1-aa11-ef2f05f3edae", "name": "C.I. 21110", "stdName": "C.I. 21110", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9b47decf-859b-4eda-a875-9963942a2e93" ], "display_name": false }, { "uuid": "04fd5e56-7200-409f-b88c-0e26eabd1611", "name": "C.I. PIGMENT ORANGE 13", "stdName": "C.I. PIGMENT ORANGE 13", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9b47decf-859b-4eda-a875-9963942a2e93" ], "display_name": false }, { "uuid": "f5cc7161-1743-4bbd-a58e-99e71fe00522", "name": "CI 21110", "stdName": "CI 21110", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b29dfaf-843b-4834-8f36-793f8ce7d446" ], "display_name": false }, { "uuid": "6d6c03e4-928e-4a2b-9574-daa980983544", "name": "PIGMENT ORANGE 13", "stdName": "PIGMENT ORANGE 13", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2bd34988-5fd3-4a30-8f80-7602314d6cbb" ], "display_name": true } ], "references": [ { "uuid": "7556e5d9-00e8-4f05-a435-0e03b0b0d3bc", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2bd34988-5fd3-4a30-8f80-7602314d6cbb", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9b47decf-859b-4eda-a875-9963942a2e93", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b8a148a7-218a-41fc-9905-6f0a6713a70e", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9e74a98a-39ee-464e-a246-e16ed7135aff", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392051000, "tags": [ "NOMEN" ] }, { "uuid": "246b1a00-0ef9-43ae-a57e-9472f3fe6bca", "citation": "SRS import [GDF7BXQ79T]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=GDF7BXQ79T", "doc_type": "SRS", "public_domain": true, "document_date": 1493392051000, "tags": [ "NOMEN" ] }, { "uuid": "5078d299-f3de-32f8-1ad2-6e1a607bf9fa", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3520-72-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f2c06e0e-99d8-89a6-ed65-3aa94ee16d11", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "7b29dfaf-843b-4834-8f36-793f8ce7d446", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "54213502-a6c4-4e6f-bc33-ae88b56e8209", "id": "54213502-a6c4-4e6f-bc33-ae88b56e8209", "molfile": "\n Marvin 01132104232D \n\n 44 49 0 0 0 0 999 V2000\n 7.6147 0.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2278 -0.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0348 -0.0661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4473 -0.7806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2678 -0.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7527 -0.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5732 -0.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9088 -1.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4238 -1.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6033 -1.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8953 -1.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0668 -2.2007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1416 -1.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4271 -1.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4271 -2.2957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7126 -2.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9982 -2.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2837 -2.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2837 -3.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9982 -3.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7126 -3.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4271 -3.9457 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5692 -3.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5692 -4.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8547 -5.1832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1403 -4.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4258 -5.1832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4258 -6.0082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7113 -6.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6251 -7.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2382 -7.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8182 -7.4127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4056 -6.6982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4148 -6.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8998 -7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7203 -7.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0558 -6.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5709 -5.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7504 -5.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9576 -6.0851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7861 -5.2782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1403 -3.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4258 -3.5332 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8547 -3.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 13 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 11 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 21 16 2 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 23 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 44 2 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 42 26 2 0 0 0 0\n 28 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 40 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 30 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 40 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 39 2 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 40 41 2 0 0 0 0\n 42 43 1 0 0 0 0\n 44 42 1 0 0 0 0\nM END", "smiles": "Cc1c(c(=O)n(-c2ccccc2)[nH]1)/N=N/c3ccc(cc3Cl)-c4ccc(c(c4)Cl)/N=N/c5c(C)[nH]n(-c6ccccc6)c5=O", "formula": "C32H24Cl2N8O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d22652a4-2088-430b-a38f-93526cb4e06b" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "623.4924", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ec6abb44-18b0-44d8-8e12-1e741702de9b", "version": "5", "structure": { "id": "4ee18091-7680-48e2-822c-d502a35bd197", "molfile": "\n Marvin 01132104072D \n\n 44 49 0 0 0 0 999 V2000\n 5.2837 -3.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9982 -3.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7126 -3.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7126 -2.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9982 -2.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2837 -2.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4271 -2.2957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4271 -1.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1416 -1.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8953 -1.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4473 -0.7806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0348 -0.0661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2278 -0.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6147 0.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2678 -0.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7527 -0.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5732 -0.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9088 -1.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4238 -1.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6033 -1.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0668 -2.2007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4271 -3.9457 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5692 -3.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8547 -3.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1403 -3.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1403 -4.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8547 -5.1832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5692 -4.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4258 -5.1832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4258 -6.0082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7113 -6.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9576 -6.0851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4056 -6.6982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8182 -7.4127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6251 -7.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2382 -7.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4148 -6.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8998 -7.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7203 -7.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0558 -6.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5709 -5.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7504 -5.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7861 -5.2782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4258 -3.5332 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 2 0 0 0 0\n 4 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 9 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 11 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 15 20 2 0 0 0 0\n 10 21 1 0 0 0 0\n 3 22 1 0 0 0 0\n 1 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 23 28 2 0 0 0 0\n 26 29 1 0 0 0 0\n 30 29 2 0 0 0 0\n 30 31 1 0 0 0 0\n 32 31 2 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 2 0 0 0 0\n 31 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 33 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 37 42 2 0 0 0 0\n 32 43 1 0 0 0 0\n 25 44 1 0 0 0 0\nM END", "smiles": "Cc1c(c(n(-c2ccccc2)n1)O)/N=N/c3ccc(cc3Cl)-c4ccc(c(c4)Cl)/N=N/c5c(C)nn(-c6ccccc6)c5O", "formula": "C32H24Cl2N8O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "623.4924", "optical_activity": "NONE", "references": [ "246b1a00-0ef9-43ae-a57e-9472f3fe6bca", "9b47decf-859b-4eda-a875-9963942a2e93" ], "stereo_centers": 0 }, "modifications": { "uuid": "d41d1ed0-bd21-46e4-97a5-a7244a674bd6" }, "unii": "GDF7BXQ79T" } ] }