{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bb068c8b-3393-4d2a-8f6d-089f4a6a56ac", "code": "2133023-03-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2133023-03-5", "code_system": "CAS", "references": [ "ef27ef84-3ffd-4294-8cfb-871f5d75730a" ] }, { "uuid": "26016af5-ace0-4138-ab5e-c3eb78ab5f97", "code": "GB8H55P3CU", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5ff468f8-0d52-fe14-9906-94c01b942e8f", "code": "169490849", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/169490849", "code_system": "PUBCHEM", "references": [ "128b571d-6195-59aa-2db1-78eb499fe68c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "09fbf9d8-d7fe-4083-9a8f-19d9967ddfd9", "name": "3-(Acetyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one", "stdName": "3-(ACETYLOXY)-5,7-DIHYDROXY-2-(3,4,5-TRIHYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ef27ef84-3ffd-4294-8cfb-871f5d75730a" ], "display_name": false }, { "uuid": "4742d172-e37b-4652-908a-b3c2e63ba8ea", "name": "3-acetoxy-myricetin", "stdName": "3-ACETOXY-MYRICETIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2604f341-f43f-4e1e-9401-bfe6609a695e" ], "display_name": false }, { "uuid": "b63cb313-279a-4434-9d07-b15cf99f8632", "name": "4H-1-Benzopyran-4-one, 3-(acetyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-", "stdName": "4H-1-BENZOPYRAN-4-ONE, 3-(ACETYLOXY)-5,7-DIHYDROXY-2-(3,4,5-TRIHYDROXYPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ef27ef84-3ffd-4294-8cfb-871f5d75730a" ], "display_name": false }, { "uuid": "f152f29b-7633-4ca3-9783-f23c28a48e41", "name": "Acetyl Myricetin", "stdName": "ACETYL MYRICETIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "2604f341-f43f-4e1e-9401-bfe6609a695e", "ef27ef84-3ffd-4294-8cfb-871f5d75730a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f15eb581-711d-4a28-8501-802c11ab708c", "name_org": "INCI" } ] } ], "references": [ { "uuid": "128b571d-6195-59aa-2db1-78eb499fe68c", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "ef27ef84-3ffd-4294-8cfb-871f5d75730a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2604f341-f43f-4e1e-9401-bfe6609a695e", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6545945f-4cb0-477c-893d-836a6c9af9b1", "id": "6545945f-4cb0-477c-893d-836a6c9af9b1", "molfile": "\n Marvin 09062314412D \n\n 26 28 0 0 0 0 999 V2000\n 5.7558 -2.8640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7558 -2.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0412 -1.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4702 -1.6265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1847 -2.0390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6123 -4.1015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0412 -6.5766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6137 -2.0390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6123 -5.7516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0426 -4.5141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4702 -4.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4702 -3.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1847 -4.5141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1847 -2.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8992 -4.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8992 -3.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6137 -4.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6137 -2.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3281 -4.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3281 -3.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7558 -4.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0412 -4.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7558 -5.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3268 -4.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0412 -5.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3268 -5.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 12 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 5 14 2 0 0 0 0\n 6 24 1 0 0 0 0\n 7 25 1 0 0 0 0\n 8 18 1 0 0 0 0\n 9 26 1 0 0 0 0\n 10 19 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 11 21 1 0 0 0 0\n 12 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 2 0 0 0 0\n 16 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 2 0 0 0 0\n 24 26 2 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "CC(=O)Oc1c(=O)c2c(cc(cc2oc1-c3cc(c(c(c3)O)O)O)O)O", "formula": "C17H12O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c996ee8d-90a8-475d-be13-7feaf9ed7da3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "360.2724", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "83d061f5-bd16-449e-b8ba-5aac998e1cfb", "version": "4", "structure": { "id": "e08e0805-9790-4cae-ac3b-cbd0ff5fee24", "molfile": "3-(Acetyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one\n JSDraw209062314412D\n\n 26 28 0 0 0 0 0 V2000\n 23.1415 -5.3559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1415 -3.7959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7904 -3.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4925 -3.0159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8435 -3.7959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0885 -7.6959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7904 -12.3761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5456 -3.7959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0885 -10.8161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2475 -8.4761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4925 -7.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4925 -6.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8435 -8.4761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8435 -5.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1945 -7.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1945 -6.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5456 -8.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5456 -5.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8965 -7.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8965 -6.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1415 -8.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7904 -7.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1415 -10.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -8.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7904 -10.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -10.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 12 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 5 14 2 0 0 0 0\n 6 24 1 0 0 0 0\n 7 25 1 0 0 0 0\n 8 18 1 0 0 0 0\n 9 26 1 0 0 0 0\n 10 19 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 11 21 1 0 0 0 0\n 12 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 2 0 0 0 0\n 16 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 2 0 0 0 0\n 24 26 2 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "CC(=O)Oc1c(=O)c2c(cc(cc2oc1-c3cc(c(c(c3)O)O)O)O)O", "formula": "C17H12O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "360.2724", "optical_activity": "NONE", "references": [ "ef27ef84-3ffd-4294-8cfb-871f5d75730a", "2604f341-f43f-4e1e-9401-bfe6609a695e" ], "stereo_centers": 0 }, "modifications": { "uuid": "e7bb55bd-50a7-4644-b6d9-c2f1775aee50" }, "unii": "GB8H55P3CU" } ] }